Compare commits
2 Commits
android-15
...
android-15
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
7297cc1ad5 | ||
|
|
7827ea76a3 |
@@ -3,4 +3,4 @@
|
||||
|
||||
[codespell]
|
||||
skip = ./.git,./build,./dist,./Doxyfile,./externals,./LICENSES,./src/android/app/src/main/res
|
||||
ignore-words-list = aci,allright,ba,canonicalizations,deques,fpr,froms,hda,inout,lod,masia,nam,nax,nce,nd,optin,pullrequests,pullrequest,te,transfered,unstall,uscaled,vas,zink
|
||||
ignore-words-list = aci,allright,ba,canonicalizations,deques,froms,hda,inout,lod,masia,nam,nax,nce,nd,optin,pullrequests,pullrequest,te,transfered,unstall,uscaled,vas,zink
|
||||
|
||||
@@ -1,5 +1,6 @@
|
||||
| Pull Request | Commit | Title | Author | Merged? |
|
||||
|----|----|----|----|----|
|
||||
| [12271](https://github.com/yuzu-emu/yuzu//pull/12271) | [`9de99839b`](https://github.com/yuzu-emu/yuzu//pull/12271/files) | nce: fix pre-text patch for single modules | [liamwhite](https://github.com/liamwhite/) | Yes |
|
||||
|
||||
|
||||
End of merge log. You can find the original README.md below the break.
|
||||
|
||||
19
dist/72-yuzu-input.rules
vendored
19
dist/72-yuzu-input.rules
vendored
@@ -1,19 +0,0 @@
|
||||
# SPDX-FileCopyrightText: 2023 yuzu Emulator Project
|
||||
# SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
# Allow systemd-logind to manage user access to hidraw with this file
|
||||
# On most systems, this file should be installed to /etc/udev/rules.d/72-yuzu-input.rules
|
||||
# Consult your distro if this is not the case
|
||||
|
||||
# Switch Pro Controller (USB/Bluetooth)
|
||||
KERNEL=="hidraw*", ATTRS{idVendor}=="057e", ATTRS{idProduct}=="2009", MODE="0660", TAG+="uaccess"
|
||||
KERNEL=="hidraw*", KERNELS=="*057e:2009*", MODE="0660", TAG+="uaccess"
|
||||
|
||||
# Joy-Con L (Bluetooth)
|
||||
KERNEL=="hidraw*", KERNELS=="*057e:2006*", MODE="0660", TAG+="uaccess"
|
||||
|
||||
# Joy-Con R (Bluetooth)
|
||||
KERNEL=="hidraw*", KERNELS=="*057e:2007*", MODE="0660", TAG+="uaccess"
|
||||
|
||||
# Joy-Con Charging Grip (USB)
|
||||
KERNEL=="hidraw*", ATTRS{idVendor}=="057e", ATTRS{idProduct}=="200e", MODE="0660", TAG+="uaccess"
|
||||
@@ -14,10 +14,8 @@ import org.yuzu.yuzu_emu.R
|
||||
import org.yuzu.yuzu_emu.databinding.DialogAddFolderBinding
|
||||
import org.yuzu.yuzu_emu.model.GameDir
|
||||
import org.yuzu.yuzu_emu.model.GamesViewModel
|
||||
import org.yuzu.yuzu_emu.model.HomeViewModel
|
||||
|
||||
class AddGameFolderDialogFragment : DialogFragment() {
|
||||
private val homeViewModel: HomeViewModel by activityViewModels()
|
||||
private val gamesViewModel: GamesViewModel by activityViewModels()
|
||||
|
||||
override fun onCreateDialog(savedInstanceState: Bundle?): Dialog {
|
||||
@@ -32,7 +30,6 @@ class AddGameFolderDialogFragment : DialogFragment() {
|
||||
.setTitle(R.string.add_game_folder)
|
||||
.setPositiveButton(android.R.string.ok) { _: DialogInterface, _: Int ->
|
||||
val newGameDir = GameDir(folderUriString!!, binding.deepScanSwitch.isChecked)
|
||||
homeViewModel.setGamesDirSelected(true)
|
||||
gamesViewModel.addFolder(newGameDir)
|
||||
}
|
||||
.setNegativeButton(android.R.string.cancel, null)
|
||||
|
||||
@@ -4,7 +4,6 @@
|
||||
package org.yuzu.yuzu_emu.fragments
|
||||
|
||||
import android.Manifest
|
||||
import android.annotation.SuppressLint
|
||||
import android.content.Intent
|
||||
import android.os.Build
|
||||
import android.os.Bundle
|
||||
@@ -76,8 +75,6 @@ class SetupFragment : Fragment() {
|
||||
return binding.root
|
||||
}
|
||||
|
||||
// This is using the correct scope, lint is just acting up
|
||||
@SuppressLint("UnsafeRepeatOnLifecycleDetector")
|
||||
override fun onViewCreated(view: View, savedInstanceState: Bundle?) {
|
||||
mainActivity = requireActivity() as MainActivity
|
||||
|
||||
@@ -209,24 +206,12 @@ class SetupFragment : Fragment() {
|
||||
)
|
||||
}
|
||||
|
||||
viewLifecycleOwner.lifecycleScope.apply {
|
||||
launch {
|
||||
repeatOnLifecycle(Lifecycle.State.CREATED) {
|
||||
homeViewModel.shouldPageForward.collect {
|
||||
if (it) {
|
||||
pageForward()
|
||||
homeViewModel.setShouldPageForward(false)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
launch {
|
||||
repeatOnLifecycle(Lifecycle.State.CREATED) {
|
||||
homeViewModel.gamesDirSelected.collect {
|
||||
if (it) {
|
||||
gamesDirCallback.onStepCompleted()
|
||||
homeViewModel.setGamesDirSelected(false)
|
||||
}
|
||||
viewLifecycleOwner.lifecycleScope.launch {
|
||||
repeatOnLifecycle(Lifecycle.State.CREATED) {
|
||||
homeViewModel.shouldPageForward.collect {
|
||||
if (it) {
|
||||
pageForward()
|
||||
homeViewModel.setShouldPageForward(false)
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -354,6 +339,7 @@ class SetupFragment : Fragment() {
|
||||
registerForActivityResult(ActivityResultContracts.OpenDocumentTree()) { result ->
|
||||
if (result != null) {
|
||||
mainActivity.processGamesDir(result)
|
||||
gamesDirCallback.onStepCompleted()
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -133,7 +133,7 @@ class GamesViewModel : ViewModel() {
|
||||
viewModelScope.launch {
|
||||
withContext(Dispatchers.IO) {
|
||||
NativeConfig.addGameDir(gameDir)
|
||||
getGameDirs(true)
|
||||
getGameDirs()
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -6,7 +6,6 @@ package org.yuzu.yuzu_emu.model
|
||||
import androidx.lifecycle.ViewModel
|
||||
import kotlinx.coroutines.flow.MutableStateFlow
|
||||
import kotlinx.coroutines.flow.StateFlow
|
||||
import kotlinx.coroutines.flow.asStateFlow
|
||||
|
||||
class HomeViewModel : ViewModel() {
|
||||
val navigationVisible: StateFlow<Pair<Boolean, Boolean>> get() = _navigationVisible
|
||||
@@ -18,9 +17,6 @@ class HomeViewModel : ViewModel() {
|
||||
val shouldPageForward: StateFlow<Boolean> get() = _shouldPageForward
|
||||
private val _shouldPageForward = MutableStateFlow(false)
|
||||
|
||||
private val _gamesDirSelected = MutableStateFlow(false)
|
||||
val gamesDirSelected get() = _gamesDirSelected.asStateFlow()
|
||||
|
||||
var navigatedToSetup = false
|
||||
|
||||
fun setNavigationVisibility(visible: Boolean, animated: Boolean) {
|
||||
@@ -40,8 +36,4 @@ class HomeViewModel : ViewModel() {
|
||||
fun setShouldPageForward(pageForward: Boolean) {
|
||||
_shouldPageForward.value = pageForward
|
||||
}
|
||||
|
||||
fun setGamesDirSelected(selected: Boolean) {
|
||||
_gamesDirSelected.value = selected
|
||||
}
|
||||
}
|
||||
|
||||
@@ -160,16 +160,12 @@ static bool is_nce_enabled = false;
|
||||
|
||||
void SetNceEnabled(bool is_39bit) {
|
||||
const bool is_nce_selected = values.cpu_backend.GetValue() == CpuBackend::Nce;
|
||||
if (is_nce_selected && !IsFastmemEnabled()) {
|
||||
LOG_WARNING(Common, "Fastmem is required to natively execute code in a performant manner, "
|
||||
"falling back to Dynarmic");
|
||||
}
|
||||
if (is_nce_selected && !is_39bit) {
|
||||
is_nce_enabled = IsFastmemEnabled() && is_nce_selected && is_39bit;
|
||||
if (is_nce_selected && !is_nce_enabled) {
|
||||
LOG_WARNING(
|
||||
Common,
|
||||
"Program does not utilize 39-bit address space, unable to natively execute code");
|
||||
}
|
||||
is_nce_enabled = IsFastmemEnabled() && is_nce_selected && is_39bit;
|
||||
}
|
||||
|
||||
bool IsNceEnabled() {
|
||||
|
||||
@@ -180,20 +180,14 @@ struct Values {
|
||||
&use_speed_limit};
|
||||
|
||||
// Cpu
|
||||
SwitchableSetting<CpuBackend, true> cpu_backend{linkage,
|
||||
SwitchableSetting<CpuBackend, true> cpu_backend{
|
||||
linkage, CpuBackend::Dynarmic, CpuBackend::Dynarmic,
|
||||
#ifdef HAS_NCE
|
||||
CpuBackend::Nce,
|
||||
CpuBackend::Nce,
|
||||
#else
|
||||
CpuBackend::Dynarmic,
|
||||
#endif
|
||||
CpuBackend::Dynarmic,
|
||||
#ifdef HAS_NCE
|
||||
CpuBackend::Nce,
|
||||
#else
|
||||
CpuBackend::Dynarmic,
|
||||
#endif
|
||||
"cpu_backend",
|
||||
Category::Cpu};
|
||||
"cpu_backend", Category::Cpu};
|
||||
SwitchableSetting<CpuAccuracy, true> cpu_accuracy{linkage, CpuAccuracy::Auto,
|
||||
CpuAccuracy::Auto, CpuAccuracy::Paranoid,
|
||||
"cpu_accuracy", Category::Cpu};
|
||||
|
||||
@@ -4,8 +4,6 @@
|
||||
add_library(core STATIC
|
||||
arm/arm_interface.h
|
||||
arm/arm_interface.cpp
|
||||
arm/debug.cpp
|
||||
arm/debug.h
|
||||
arm/exclusive_monitor.cpp
|
||||
arm/exclusive_monitor.h
|
||||
arm/symbols.cpp
|
||||
@@ -251,16 +249,10 @@ add_library(core STATIC
|
||||
hle/kernel/k_hardware_timer.h
|
||||
hle/kernel/k_interrupt_manager.cpp
|
||||
hle/kernel/k_interrupt_manager.h
|
||||
hle/kernel/k_light_client_session.cpp
|
||||
hle/kernel/k_light_client_session.h
|
||||
hle/kernel/k_light_condition_variable.cpp
|
||||
hle/kernel/k_light_condition_variable.h
|
||||
hle/kernel/k_light_lock.cpp
|
||||
hle/kernel/k_light_lock.h
|
||||
hle/kernel/k_light_server_session.cpp
|
||||
hle/kernel/k_light_server_session.h
|
||||
hle/kernel/k_light_session.cpp
|
||||
hle/kernel/k_light_session.h
|
||||
hle/kernel/k_memory_block.h
|
||||
hle/kernel/k_memory_block_manager.cpp
|
||||
hle/kernel/k_memory_block_manager.h
|
||||
@@ -549,8 +541,6 @@ add_library(core STATIC
|
||||
hle/service/hid/xcd.cpp
|
||||
hle/service/hid/xcd.h
|
||||
hle/service/hid/errors.h
|
||||
hle/service/hid/controllers/applet_resource.cpp
|
||||
hle/service/hid/controllers/applet_resource.h
|
||||
hle/service/hid/controllers/console_six_axis.cpp
|
||||
hle/service/hid/controllers/console_six_axis.h
|
||||
hle/service/hid/controllers/controller_base.cpp
|
||||
@@ -772,12 +762,6 @@ add_library(core STATIC
|
||||
hle/service/kernel_helpers.h
|
||||
hle/service/mutex.cpp
|
||||
hle/service/mutex.h
|
||||
hle/service/ro/ro_nro_utils.cpp
|
||||
hle/service/ro/ro_nro_utils.h
|
||||
hle/service/ro/ro_results.h
|
||||
hle/service/ro/ro_types.h
|
||||
hle/service/ro/ro.cpp
|
||||
hle/service/ro/ro.h
|
||||
hle/service/server_manager.cpp
|
||||
hle/service/server_manager.h
|
||||
hle/service/service.cpp
|
||||
|
||||
@@ -1,32 +1,231 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2018 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include <map>
|
||||
#include <optional>
|
||||
|
||||
#include "common/bit_field.h"
|
||||
#include "common/common_types.h"
|
||||
#include "common/demangle.h"
|
||||
#include "common/logging/log.h"
|
||||
#include "core/arm/arm_interface.h"
|
||||
#include "core/arm/debug.h"
|
||||
#include "core/arm/symbols.h"
|
||||
#include "core/core.h"
|
||||
#include "core/debugger/debugger.h"
|
||||
#include "core/hle/kernel/k_process.h"
|
||||
#include "core/hle/kernel/k_thread.h"
|
||||
#include "core/hle/kernel/svc.h"
|
||||
#include "core/loader/loader.h"
|
||||
#include "core/memory.h"
|
||||
|
||||
namespace Core {
|
||||
|
||||
void ArmInterface::LogBacktrace(const Kernel::KProcess* process) const {
|
||||
Kernel::Svc::ThreadContext ctx;
|
||||
this->GetContext(ctx);
|
||||
constexpr u64 SEGMENT_BASE = 0x7100000000ull;
|
||||
|
||||
LOG_ERROR(Core_ARM, "Backtrace, sp={:016X}, pc={:016X}", ctx.sp, ctx.pc);
|
||||
std::vector<ARM_Interface::BacktraceEntry> ARM_Interface::GetBacktraceFromContext(
|
||||
Core::System& system, const ARM_Interface::ThreadContext32& ctx) {
|
||||
std::vector<BacktraceEntry> out;
|
||||
auto& memory = system.ApplicationMemory();
|
||||
|
||||
const auto& reg = ctx.cpu_registers;
|
||||
u32 pc = reg[15], lr = reg[14], fp = reg[11];
|
||||
out.push_back({"", 0, pc, 0, ""});
|
||||
|
||||
// fp (= r11) points to the last frame record.
|
||||
// Frame records are two words long:
|
||||
// fp+0 : pointer to previous frame record
|
||||
// fp+4 : value of lr for frame
|
||||
for (size_t i = 0; i < 256; i++) {
|
||||
out.push_back({"", 0, lr, 0, ""});
|
||||
if (!fp || (fp % 4 != 0) || !memory.IsValidVirtualAddressRange(fp, 8)) {
|
||||
break;
|
||||
}
|
||||
lr = memory.Read32(fp + 4);
|
||||
fp = memory.Read32(fp);
|
||||
}
|
||||
|
||||
SymbolicateBacktrace(system, out);
|
||||
|
||||
return out;
|
||||
}
|
||||
|
||||
std::vector<ARM_Interface::BacktraceEntry> ARM_Interface::GetBacktraceFromContext(
|
||||
Core::System& system, const ARM_Interface::ThreadContext64& ctx) {
|
||||
std::vector<BacktraceEntry> out;
|
||||
auto& memory = system.ApplicationMemory();
|
||||
|
||||
const auto& reg = ctx.cpu_registers;
|
||||
u64 pc = ctx.pc, lr = reg[30], fp = reg[29];
|
||||
|
||||
out.push_back({"", 0, pc, 0, ""});
|
||||
|
||||
// fp (= x29) points to the previous frame record.
|
||||
// Frame records are two words long:
|
||||
// fp+0 : pointer to previous frame record
|
||||
// fp+8 : value of lr for frame
|
||||
for (size_t i = 0; i < 256; i++) {
|
||||
out.push_back({"", 0, lr, 0, ""});
|
||||
if (!fp || (fp % 4 != 0) || !memory.IsValidVirtualAddressRange(fp, 16)) {
|
||||
break;
|
||||
}
|
||||
lr = memory.Read64(fp + 8);
|
||||
fp = memory.Read64(fp);
|
||||
}
|
||||
|
||||
SymbolicateBacktrace(system, out);
|
||||
|
||||
return out;
|
||||
}
|
||||
|
||||
void ARM_Interface::SymbolicateBacktrace(Core::System& system, std::vector<BacktraceEntry>& out) {
|
||||
std::map<VAddr, std::string> modules;
|
||||
auto& loader{system.GetAppLoader()};
|
||||
if (loader.ReadNSOModules(modules) != Loader::ResultStatus::Success) {
|
||||
return;
|
||||
}
|
||||
|
||||
std::map<std::string, Symbols::Symbols> symbols;
|
||||
for (const auto& module : modules) {
|
||||
symbols.insert_or_assign(module.second,
|
||||
Symbols::GetSymbols(module.first, system.ApplicationMemory(),
|
||||
system.ApplicationProcess()->Is64Bit()));
|
||||
}
|
||||
|
||||
for (auto& entry : out) {
|
||||
VAddr base = 0;
|
||||
for (auto iter = modules.rbegin(); iter != modules.rend(); ++iter) {
|
||||
const auto& module{*iter};
|
||||
if (entry.original_address >= module.first) {
|
||||
entry.module = module.second;
|
||||
base = module.first;
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
entry.offset = entry.original_address - base;
|
||||
entry.address = SEGMENT_BASE + entry.offset;
|
||||
|
||||
if (entry.module.empty()) {
|
||||
entry.module = "unknown";
|
||||
}
|
||||
|
||||
const auto symbol_set = symbols.find(entry.module);
|
||||
if (symbol_set != symbols.end()) {
|
||||
const auto symbol = Symbols::GetSymbolName(symbol_set->second, entry.offset);
|
||||
if (symbol) {
|
||||
entry.name = Common::DemangleSymbol(*symbol);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
std::vector<ARM_Interface::BacktraceEntry> ARM_Interface::GetBacktrace() const {
|
||||
if (GetArchitecture() == Architecture::Aarch64) {
|
||||
ThreadContext64 ctx;
|
||||
SaveContext(ctx);
|
||||
return GetBacktraceFromContext(system, ctx);
|
||||
} else {
|
||||
ThreadContext32 ctx;
|
||||
SaveContext(ctx);
|
||||
return GetBacktraceFromContext(system, ctx);
|
||||
}
|
||||
}
|
||||
|
||||
void ARM_Interface::LogBacktrace() const {
|
||||
const VAddr sp = GetSP();
|
||||
const VAddr pc = GetPC();
|
||||
LOG_ERROR(Core_ARM, "Backtrace, sp={:016X}, pc={:016X}", sp, pc);
|
||||
LOG_ERROR(Core_ARM, "{:20}{:20}{:20}{:20}{}", "Module Name", "Address", "Original Address",
|
||||
"Offset", "Symbol");
|
||||
LOG_ERROR(Core_ARM, "");
|
||||
const auto backtrace = GetBacktraceFromContext(process, ctx);
|
||||
const auto backtrace = GetBacktrace();
|
||||
for (const auto& entry : backtrace) {
|
||||
LOG_ERROR(Core_ARM, "{:20}{:016X} {:016X} {:016X} {}", entry.module, entry.address,
|
||||
entry.original_address, entry.offset, entry.name);
|
||||
}
|
||||
}
|
||||
|
||||
const Kernel::DebugWatchpoint* ArmInterface::MatchingWatchpoint(
|
||||
void ARM_Interface::Run() {
|
||||
using Kernel::StepState;
|
||||
using Kernel::SuspendType;
|
||||
|
||||
while (true) {
|
||||
Kernel::KThread* current_thread{Kernel::GetCurrentThreadPointer(system.Kernel())};
|
||||
HaltReason hr{};
|
||||
|
||||
// If the thread is scheduled for termination, exit the thread.
|
||||
if (current_thread->HasDpc()) {
|
||||
if (current_thread->IsTerminationRequested()) {
|
||||
current_thread->Exit();
|
||||
UNREACHABLE();
|
||||
}
|
||||
}
|
||||
|
||||
// Notify the debugger and go to sleep if a step was performed
|
||||
// and this thread has been scheduled again.
|
||||
if (current_thread->GetStepState() == StepState::StepPerformed) {
|
||||
system.GetDebugger().NotifyThreadStopped(current_thread);
|
||||
current_thread->RequestSuspend(SuspendType::Debug);
|
||||
break;
|
||||
}
|
||||
|
||||
// Otherwise, run the thread.
|
||||
system.EnterCPUProfile();
|
||||
if (current_thread->GetStepState() == StepState::StepPending) {
|
||||
hr = StepJit();
|
||||
|
||||
if (True(hr & HaltReason::StepThread)) {
|
||||
current_thread->SetStepState(StepState::StepPerformed);
|
||||
}
|
||||
} else {
|
||||
hr = RunJit();
|
||||
}
|
||||
system.ExitCPUProfile();
|
||||
|
||||
// Notify the debugger and go to sleep if a breakpoint was hit,
|
||||
// or if the thread is unable to continue for any reason.
|
||||
if (True(hr & HaltReason::InstructionBreakpoint) || True(hr & HaltReason::PrefetchAbort)) {
|
||||
if (!True(hr & HaltReason::PrefetchAbort)) {
|
||||
RewindBreakpointInstruction();
|
||||
}
|
||||
if (system.DebuggerEnabled()) {
|
||||
system.GetDebugger().NotifyThreadStopped(current_thread);
|
||||
} else {
|
||||
LogBacktrace();
|
||||
}
|
||||
current_thread->RequestSuspend(SuspendType::Debug);
|
||||
break;
|
||||
}
|
||||
|
||||
// Notify the debugger and go to sleep if a watchpoint was hit.
|
||||
if (True(hr & HaltReason::DataAbort)) {
|
||||
if (system.DebuggerEnabled()) {
|
||||
system.GetDebugger().NotifyThreadWatchpoint(current_thread, *HaltedWatchpoint());
|
||||
} else {
|
||||
LogBacktrace();
|
||||
}
|
||||
current_thread->RequestSuspend(SuspendType::Debug);
|
||||
break;
|
||||
}
|
||||
|
||||
// Handle syscalls and scheduling (this may change the current thread/core)
|
||||
if (True(hr & HaltReason::SupervisorCall)) {
|
||||
Kernel::Svc::Call(system, GetSvcNumber());
|
||||
break;
|
||||
}
|
||||
if (True(hr & HaltReason::BreakLoop) || !uses_wall_clock) {
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
void ARM_Interface::LoadWatchpointArray(const WatchpointArray* wp) {
|
||||
watchpoints = wp;
|
||||
}
|
||||
|
||||
const Kernel::DebugWatchpoint* ARM_Interface::MatchingWatchpoint(
|
||||
u64 addr, u64 size, Kernel::DebugWatchpointType access_type) const {
|
||||
if (!m_watchpoints) {
|
||||
if (!watchpoints) {
|
||||
return nullptr;
|
||||
}
|
||||
|
||||
@@ -34,7 +233,7 @@ const Kernel::DebugWatchpoint* ArmInterface::MatchingWatchpoint(
|
||||
const u64 end_address{addr + size};
|
||||
|
||||
for (size_t i = 0; i < Core::Hardware::NUM_WATCHPOINTS; i++) {
|
||||
const auto& watch{(*m_watchpoints)[i]};
|
||||
const auto& watch{(*watchpoints)[i]};
|
||||
|
||||
if (end_address <= GetInteger(watch.start_address)) {
|
||||
continue;
|
||||
|
||||
@@ -12,20 +12,20 @@
|
||||
#include "common/common_types.h"
|
||||
#include "core/hardware_properties.h"
|
||||
|
||||
#include "core/hle/kernel/svc_types.h"
|
||||
|
||||
namespace Common {
|
||||
struct PageTable;
|
||||
}
|
||||
|
||||
namespace Kernel {
|
||||
enum class VMAPermission : u8;
|
||||
enum class DebugWatchpointType : u8;
|
||||
struct DebugWatchpoint;
|
||||
class KThread;
|
||||
class KProcess;
|
||||
} // namespace Kernel
|
||||
|
||||
namespace Core {
|
||||
class System;
|
||||
class CPUInterruptHandler;
|
||||
|
||||
using WatchpointArray = std::array<Kernel::DebugWatchpoint, Core::Hardware::NUM_WATCHPOINTS>;
|
||||
|
||||
// NOTE: these values match the HaltReason enum in Dynarmic
|
||||
@@ -40,74 +40,197 @@ enum class HaltReason : u64 {
|
||||
DECLARE_ENUM_FLAG_OPERATORS(HaltReason);
|
||||
|
||||
enum class Architecture {
|
||||
AArch64,
|
||||
AArch32,
|
||||
Aarch32,
|
||||
Aarch64,
|
||||
};
|
||||
|
||||
/// Generic ARMv8 CPU interface
|
||||
class ArmInterface {
|
||||
class ARM_Interface {
|
||||
public:
|
||||
YUZU_NON_COPYABLE(ArmInterface);
|
||||
YUZU_NON_MOVEABLE(ArmInterface);
|
||||
YUZU_NON_COPYABLE(ARM_Interface);
|
||||
YUZU_NON_MOVEABLE(ARM_Interface);
|
||||
|
||||
explicit ArmInterface(bool uses_wall_clock) : m_uses_wall_clock{uses_wall_clock} {}
|
||||
virtual ~ArmInterface() = default;
|
||||
explicit ARM_Interface(System& system_, bool uses_wall_clock_)
|
||||
: system{system_}, uses_wall_clock{uses_wall_clock_} {}
|
||||
virtual ~ARM_Interface() = default;
|
||||
|
||||
// Perform any backend-specific initialization.
|
||||
struct ThreadContext32 {
|
||||
std::array<u32, 16> cpu_registers{};
|
||||
std::array<u32, 64> extension_registers{};
|
||||
u32 cpsr{};
|
||||
u32 fpscr{};
|
||||
u32 fpexc{};
|
||||
u32 tpidr{};
|
||||
};
|
||||
// Internally within the kernel, it expects the AArch32 version of the
|
||||
// thread context to be 344 bytes in size.
|
||||
static_assert(sizeof(ThreadContext32) == 0x150);
|
||||
|
||||
struct ThreadContext64 {
|
||||
std::array<u64, 31> cpu_registers{};
|
||||
u64 sp{};
|
||||
u64 pc{};
|
||||
u32 pstate{};
|
||||
std::array<u8, 4> padding{};
|
||||
std::array<u128, 32> vector_registers{};
|
||||
u32 fpcr{};
|
||||
u32 fpsr{};
|
||||
u64 tpidr{};
|
||||
};
|
||||
// Internally within the kernel, it expects the AArch64 version of the
|
||||
// thread context to be 800 bytes in size.
|
||||
static_assert(sizeof(ThreadContext64) == 0x320);
|
||||
|
||||
/// Perform any backend-specific initialization.
|
||||
virtual void Initialize() {}
|
||||
|
||||
// Runs the CPU until an event happens.
|
||||
virtual HaltReason RunThread(Kernel::KThread* thread) = 0;
|
||||
/// Runs the CPU until an event happens
|
||||
void Run();
|
||||
|
||||
// Runs the CPU for one instruction or until an event happens.
|
||||
virtual HaltReason StepThread(Kernel::KThread* thread) = 0;
|
||||
|
||||
// Admits a backend-specific mechanism to lock the thread context.
|
||||
virtual void LockThread(Kernel::KThread* thread) {}
|
||||
virtual void UnlockThread(Kernel::KThread* thread) {}
|
||||
|
||||
// Clear the entire instruction cache for this CPU.
|
||||
/// Clear all instruction cache
|
||||
virtual void ClearInstructionCache() = 0;
|
||||
|
||||
// Clear a range of the instruction cache for this CPU.
|
||||
/**
|
||||
* Clear instruction cache range
|
||||
* @param addr Start address of the cache range to clear
|
||||
* @param size Size of the cache range to clear, starting at addr
|
||||
*/
|
||||
virtual void InvalidateCacheRange(u64 addr, std::size_t size) = 0;
|
||||
|
||||
// Get the current architecture.
|
||||
// This returns AArch64 when PSTATE.nRW == 0 and AArch32 when PSTATE.nRW == 1.
|
||||
/**
|
||||
* Notifies CPU emulation that the current page table has changed.
|
||||
* @param new_page_table The new page table.
|
||||
* @param new_address_space_size_in_bits The new usable size of the address space in bits.
|
||||
* This can be either 32, 36, or 39 on official software.
|
||||
*/
|
||||
virtual void PageTableChanged(Common::PageTable& new_page_table,
|
||||
std::size_t new_address_space_size_in_bits) = 0;
|
||||
|
||||
/**
|
||||
* Set the Program Counter to an address
|
||||
* @param addr Address to set PC to
|
||||
*/
|
||||
virtual void SetPC(u64 addr) = 0;
|
||||
|
||||
/*
|
||||
* Get the current Program Counter
|
||||
* @return Returns current PC
|
||||
*/
|
||||
virtual u64 GetPC() const = 0;
|
||||
|
||||
/**
|
||||
* Get the current Stack Pointer
|
||||
* @return Returns current SP
|
||||
*/
|
||||
virtual u64 GetSP() const = 0;
|
||||
|
||||
/**
|
||||
* Get an ARM register
|
||||
* @param index Register index
|
||||
* @return Returns the value in the register
|
||||
*/
|
||||
virtual u64 GetReg(int index) const = 0;
|
||||
|
||||
/**
|
||||
* Set an ARM register
|
||||
* @param index Register index
|
||||
* @param value Value to set register to
|
||||
*/
|
||||
virtual void SetReg(int index, u64 value) = 0;
|
||||
|
||||
/**
|
||||
* Gets the value of a specified vector register.
|
||||
*
|
||||
* @param index The index of the vector register.
|
||||
* @return the value within the vector register.
|
||||
*/
|
||||
virtual u128 GetVectorReg(int index) const = 0;
|
||||
|
||||
/**
|
||||
* Sets a given value into a vector register.
|
||||
*
|
||||
* @param index The index of the vector register.
|
||||
* @param value The new value to place in the register.
|
||||
*/
|
||||
virtual void SetVectorReg(int index, u128 value) = 0;
|
||||
|
||||
/**
|
||||
* Get the current PSTATE register
|
||||
* @return Returns the value of the PSTATE register
|
||||
*/
|
||||
virtual u32 GetPSTATE() const = 0;
|
||||
|
||||
/**
|
||||
* Set the current PSTATE register
|
||||
* @param pstate Value to set PSTATE to
|
||||
*/
|
||||
virtual void SetPSTATE(u32 pstate) = 0;
|
||||
|
||||
virtual u64 GetTlsAddress() const = 0;
|
||||
|
||||
virtual void SetTlsAddress(u64 address) = 0;
|
||||
|
||||
/**
|
||||
* Gets the value within the TPIDR_EL0 (read/write software thread ID) register.
|
||||
*
|
||||
* @return the value within the register.
|
||||
*/
|
||||
virtual u64 GetTPIDR_EL0() const = 0;
|
||||
|
||||
/**
|
||||
* Sets a new value within the TPIDR_EL0 (read/write software thread ID) register.
|
||||
*
|
||||
* @param value The new value to place in the register.
|
||||
*/
|
||||
virtual void SetTPIDR_EL0(u64 value) = 0;
|
||||
|
||||
virtual Architecture GetArchitecture() const = 0;
|
||||
virtual void SaveContext(ThreadContext32& ctx) const = 0;
|
||||
virtual void SaveContext(ThreadContext64& ctx) const = 0;
|
||||
virtual void LoadContext(const ThreadContext32& ctx) = 0;
|
||||
virtual void LoadContext(const ThreadContext64& ctx) = 0;
|
||||
void LoadWatchpointArray(const WatchpointArray* wp);
|
||||
|
||||
// Context accessors.
|
||||
// These should not be called if the CPU is running.
|
||||
virtual void GetContext(Kernel::Svc::ThreadContext& ctx) const = 0;
|
||||
virtual void SetContext(const Kernel::Svc::ThreadContext& ctx) = 0;
|
||||
virtual void SetTpidrroEl0(u64 value) = 0;
|
||||
/// Clears the exclusive monitor's state.
|
||||
virtual void ClearExclusiveState() = 0;
|
||||
|
||||
virtual void GetSvcArguments(std::span<uint64_t, 8> args) const = 0;
|
||||
virtual void SetSvcArguments(std::span<const uint64_t, 8> args) = 0;
|
||||
virtual u32 GetSvcNumber() const = 0;
|
||||
/// Signal an interrupt and ask the core to halt as soon as possible.
|
||||
virtual void SignalInterrupt() = 0;
|
||||
|
||||
void SetWatchpointArray(const WatchpointArray* watchpoints) {
|
||||
m_watchpoints = watchpoints;
|
||||
}
|
||||
/// Clear a previous interrupt.
|
||||
virtual void ClearInterrupt() = 0;
|
||||
|
||||
// Signal an interrupt for execution to halt as soon as possible.
|
||||
// It is safe to call this if the CPU is not running.
|
||||
virtual void SignalInterrupt(Kernel::KThread* thread) = 0;
|
||||
struct BacktraceEntry {
|
||||
std::string module;
|
||||
u64 address;
|
||||
u64 original_address;
|
||||
u64 offset;
|
||||
std::string name;
|
||||
};
|
||||
|
||||
// Stack trace generation.
|
||||
void LogBacktrace(const Kernel::KProcess* process) const;
|
||||
static std::vector<BacktraceEntry> GetBacktraceFromContext(System& system,
|
||||
const ThreadContext32& ctx);
|
||||
static std::vector<BacktraceEntry> GetBacktraceFromContext(System& system,
|
||||
const ThreadContext64& ctx);
|
||||
|
||||
// Debug functionality.
|
||||
virtual const Kernel::DebugWatchpoint* HaltedWatchpoint() const = 0;
|
||||
virtual void RewindBreakpointInstruction() = 0;
|
||||
std::vector<BacktraceEntry> GetBacktrace() const;
|
||||
void LogBacktrace() const;
|
||||
|
||||
protected:
|
||||
/// System context that this ARM interface is running under.
|
||||
System& system;
|
||||
const WatchpointArray* watchpoints;
|
||||
bool uses_wall_clock;
|
||||
|
||||
static void SymbolicateBacktrace(Core::System& system, std::vector<BacktraceEntry>& out);
|
||||
const Kernel::DebugWatchpoint* MatchingWatchpoint(
|
||||
u64 addr, u64 size, Kernel::DebugWatchpointType access_type) const;
|
||||
|
||||
protected:
|
||||
const WatchpointArray* m_watchpoints{};
|
||||
bool m_uses_wall_clock{};
|
||||
virtual HaltReason RunJit() = 0;
|
||||
virtual HaltReason StepJit() = 0;
|
||||
virtual u32 GetSvcNumber() const = 0;
|
||||
virtual const Kernel::DebugWatchpoint* HaltedWatchpoint() const = 0;
|
||||
virtual void RewindBreakpointInstruction() = 0;
|
||||
};
|
||||
|
||||
} // namespace Core
|
||||
|
||||
@@ -1,354 +0,0 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2023 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include "common/demangle.h"
|
||||
#include "core/arm/debug.h"
|
||||
#include "core/arm/symbols.h"
|
||||
#include "core/hle/kernel/k_process.h"
|
||||
#include "core/hle/kernel/k_thread.h"
|
||||
#include "core/memory.h"
|
||||
|
||||
namespace Core {
|
||||
|
||||
namespace {
|
||||
|
||||
std::optional<std::string> GetNameFromThreadType64(Core::Memory::Memory& memory,
|
||||
const Kernel::KThread& thread) {
|
||||
// Read thread type from TLS
|
||||
const VAddr tls_thread_type{memory.Read64(thread.GetTlsAddress() + 0x1f8)};
|
||||
const VAddr argument_thread_type{thread.GetArgument()};
|
||||
|
||||
if (argument_thread_type && tls_thread_type != argument_thread_type) {
|
||||
// Probably not created by nnsdk, no name available.
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
if (!tls_thread_type) {
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
const u16 version{memory.Read16(tls_thread_type + 0x46)};
|
||||
VAddr name_pointer{};
|
||||
if (version == 1) {
|
||||
name_pointer = memory.Read64(tls_thread_type + 0x1a0);
|
||||
} else {
|
||||
name_pointer = memory.Read64(tls_thread_type + 0x1a8);
|
||||
}
|
||||
|
||||
if (!name_pointer) {
|
||||
// No name provided.
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
return memory.ReadCString(name_pointer, 256);
|
||||
}
|
||||
|
||||
std::optional<std::string> GetNameFromThreadType32(Core::Memory::Memory& memory,
|
||||
const Kernel::KThread& thread) {
|
||||
// Read thread type from TLS
|
||||
const VAddr tls_thread_type{memory.Read32(thread.GetTlsAddress() + 0x1fc)};
|
||||
const VAddr argument_thread_type{thread.GetArgument()};
|
||||
|
||||
if (argument_thread_type && tls_thread_type != argument_thread_type) {
|
||||
// Probably not created by nnsdk, no name available.
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
if (!tls_thread_type) {
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
const u16 version{memory.Read16(tls_thread_type + 0x26)};
|
||||
VAddr name_pointer{};
|
||||
if (version == 1) {
|
||||
name_pointer = memory.Read32(tls_thread_type + 0xe4);
|
||||
} else {
|
||||
name_pointer = memory.Read32(tls_thread_type + 0xe8);
|
||||
}
|
||||
|
||||
if (!name_pointer) {
|
||||
// No name provided.
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
return memory.ReadCString(name_pointer, 256);
|
||||
}
|
||||
|
||||
constexpr std::array<u64, 2> SegmentBases{
|
||||
0x60000000ULL,
|
||||
0x7100000000ULL,
|
||||
};
|
||||
|
||||
void SymbolicateBacktrace(const Kernel::KProcess* process, std::vector<BacktraceEntry>& out) {
|
||||
auto modules = FindModules(process);
|
||||
|
||||
const bool is_64 = process->Is64Bit();
|
||||
|
||||
std::map<std::string, Symbols::Symbols> symbols;
|
||||
for (const auto& module : modules) {
|
||||
symbols.insert_or_assign(module.second,
|
||||
Symbols::GetSymbols(module.first, process->GetMemory(), is_64));
|
||||
}
|
||||
|
||||
for (auto& entry : out) {
|
||||
VAddr base = 0;
|
||||
for (auto iter = modules.rbegin(); iter != modules.rend(); ++iter) {
|
||||
const auto& module{*iter};
|
||||
if (entry.original_address >= module.first) {
|
||||
entry.module = module.second;
|
||||
base = module.first;
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
entry.offset = entry.original_address - base;
|
||||
entry.address = SegmentBases[is_64] + entry.offset;
|
||||
|
||||
if (entry.module.empty()) {
|
||||
entry.module = "unknown";
|
||||
}
|
||||
|
||||
const auto symbol_set = symbols.find(entry.module);
|
||||
if (symbol_set != symbols.end()) {
|
||||
const auto symbol = Symbols::GetSymbolName(symbol_set->second, entry.offset);
|
||||
if (symbol) {
|
||||
entry.name = Common::DemangleSymbol(*symbol);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
std::vector<BacktraceEntry> GetAArch64Backtrace(const Kernel::KProcess* process,
|
||||
const Kernel::Svc::ThreadContext& ctx) {
|
||||
std::vector<BacktraceEntry> out;
|
||||
auto& memory = process->GetMemory();
|
||||
auto pc = ctx.pc, lr = ctx.lr, fp = ctx.fp;
|
||||
|
||||
out.push_back({"", 0, pc, 0, ""});
|
||||
|
||||
// fp (= x29) points to the previous frame record.
|
||||
// Frame records are two words long:
|
||||
// fp+0 : pointer to previous frame record
|
||||
// fp+8 : value of lr for frame
|
||||
for (size_t i = 0; i < 256; i++) {
|
||||
out.push_back({"", 0, lr, 0, ""});
|
||||
if (!fp || (fp % 4 != 0) || !memory.IsValidVirtualAddressRange(fp, 16)) {
|
||||
break;
|
||||
}
|
||||
lr = memory.Read64(fp + 8);
|
||||
fp = memory.Read64(fp);
|
||||
}
|
||||
|
||||
SymbolicateBacktrace(process, out);
|
||||
|
||||
return out;
|
||||
}
|
||||
|
||||
std::vector<BacktraceEntry> GetAArch32Backtrace(const Kernel::KProcess* process,
|
||||
const Kernel::Svc::ThreadContext& ctx) {
|
||||
std::vector<BacktraceEntry> out;
|
||||
auto& memory = process->GetMemory();
|
||||
auto pc = ctx.pc, lr = ctx.lr, fp = ctx.fp;
|
||||
|
||||
out.push_back({"", 0, pc, 0, ""});
|
||||
|
||||
// fp (= r11) points to the last frame record.
|
||||
// Frame records are two words long:
|
||||
// fp+0 : pointer to previous frame record
|
||||
// fp+4 : value of lr for frame
|
||||
for (size_t i = 0; i < 256; i++) {
|
||||
out.push_back({"", 0, lr, 0, ""});
|
||||
if (!fp || (fp % 4 != 0) || !memory.IsValidVirtualAddressRange(fp, 8)) {
|
||||
break;
|
||||
}
|
||||
lr = memory.Read32(fp + 4);
|
||||
fp = memory.Read32(fp);
|
||||
}
|
||||
|
||||
SymbolicateBacktrace(process, out);
|
||||
|
||||
return out;
|
||||
}
|
||||
|
||||
} // namespace
|
||||
|
||||
std::optional<std::string> GetThreadName(const Kernel::KThread* thread) {
|
||||
const auto* process = thread->GetOwnerProcess();
|
||||
if (process->Is64Bit()) {
|
||||
return GetNameFromThreadType64(process->GetMemory(), *thread);
|
||||
} else {
|
||||
return GetNameFromThreadType32(process->GetMemory(), *thread);
|
||||
}
|
||||
}
|
||||
|
||||
std::string_view GetThreadWaitReason(const Kernel::KThread* thread) {
|
||||
switch (thread->GetWaitReasonForDebugging()) {
|
||||
case Kernel::ThreadWaitReasonForDebugging::Sleep:
|
||||
return "Sleep";
|
||||
case Kernel::ThreadWaitReasonForDebugging::IPC:
|
||||
return "IPC";
|
||||
case Kernel::ThreadWaitReasonForDebugging::Synchronization:
|
||||
return "Synchronization";
|
||||
case Kernel::ThreadWaitReasonForDebugging::ConditionVar:
|
||||
return "ConditionVar";
|
||||
case Kernel::ThreadWaitReasonForDebugging::Arbitration:
|
||||
return "Arbitration";
|
||||
case Kernel::ThreadWaitReasonForDebugging::Suspended:
|
||||
return "Suspended";
|
||||
default:
|
||||
return "Unknown";
|
||||
}
|
||||
}
|
||||
|
||||
std::string GetThreadState(const Kernel::KThread* thread) {
|
||||
switch (thread->GetState()) {
|
||||
case Kernel::ThreadState::Initialized:
|
||||
return "Initialized";
|
||||
case Kernel::ThreadState::Waiting:
|
||||
return fmt::format("Waiting ({})", GetThreadWaitReason(thread));
|
||||
case Kernel::ThreadState::Runnable:
|
||||
return "Runnable";
|
||||
case Kernel::ThreadState::Terminated:
|
||||
return "Terminated";
|
||||
default:
|
||||
return "Unknown";
|
||||
}
|
||||
}
|
||||
|
||||
Kernel::KProcessAddress GetModuleEnd(const Kernel::KProcess* process,
|
||||
Kernel::KProcessAddress base) {
|
||||
Kernel::KMemoryInfo mem_info;
|
||||
Kernel::Svc::MemoryInfo svc_mem_info;
|
||||
Kernel::Svc::PageInfo page_info;
|
||||
VAddr cur_addr{GetInteger(base)};
|
||||
auto& page_table = process->GetPageTable();
|
||||
|
||||
// Expect: r-x Code (.text)
|
||||
R_ASSERT(page_table.QueryInfo(std::addressof(mem_info), std::addressof(page_info), cur_addr));
|
||||
svc_mem_info = mem_info.GetSvcMemoryInfo();
|
||||
cur_addr = svc_mem_info.base_address + svc_mem_info.size;
|
||||
if (svc_mem_info.state != Kernel::Svc::MemoryState::Code ||
|
||||
svc_mem_info.permission != Kernel::Svc::MemoryPermission::ReadExecute) {
|
||||
return cur_addr - 1;
|
||||
}
|
||||
|
||||
// Expect: r-- Code (.rodata)
|
||||
R_ASSERT(page_table.QueryInfo(std::addressof(mem_info), std::addressof(page_info), cur_addr));
|
||||
svc_mem_info = mem_info.GetSvcMemoryInfo();
|
||||
cur_addr = svc_mem_info.base_address + svc_mem_info.size;
|
||||
if (svc_mem_info.state != Kernel::Svc::MemoryState::Code ||
|
||||
svc_mem_info.permission != Kernel::Svc::MemoryPermission::Read) {
|
||||
return cur_addr - 1;
|
||||
}
|
||||
|
||||
// Expect: rw- CodeData (.data)
|
||||
R_ASSERT(page_table.QueryInfo(std::addressof(mem_info), std::addressof(page_info), cur_addr));
|
||||
svc_mem_info = mem_info.GetSvcMemoryInfo();
|
||||
cur_addr = svc_mem_info.base_address + svc_mem_info.size;
|
||||
return cur_addr - 1;
|
||||
}
|
||||
|
||||
Loader::AppLoader::Modules FindModules(const Kernel::KProcess* process) {
|
||||
Loader::AppLoader::Modules modules;
|
||||
|
||||
auto& page_table = process->GetPageTable();
|
||||
auto& memory = process->GetMemory();
|
||||
VAddr cur_addr = 0;
|
||||
|
||||
// Look for executable sections in Code or AliasCode regions.
|
||||
while (true) {
|
||||
Kernel::KMemoryInfo mem_info{};
|
||||
Kernel::Svc::PageInfo page_info{};
|
||||
R_ASSERT(
|
||||
page_table.QueryInfo(std::addressof(mem_info), std::addressof(page_info), cur_addr));
|
||||
auto svc_mem_info = mem_info.GetSvcMemoryInfo();
|
||||
|
||||
if (svc_mem_info.permission == Kernel::Svc::MemoryPermission::ReadExecute &&
|
||||
(svc_mem_info.state == Kernel::Svc::MemoryState::Code ||
|
||||
svc_mem_info.state == Kernel::Svc::MemoryState::AliasCode)) {
|
||||
// Try to read the module name from its path.
|
||||
constexpr s32 PathLengthMax = 0x200;
|
||||
struct {
|
||||
u32 zero;
|
||||
s32 path_length;
|
||||
std::array<char, PathLengthMax> path;
|
||||
} module_path;
|
||||
|
||||
if (memory.ReadBlock(svc_mem_info.base_address + svc_mem_info.size, &module_path,
|
||||
sizeof(module_path))) {
|
||||
if (module_path.zero == 0 && module_path.path_length > 0) {
|
||||
// Truncate module name.
|
||||
module_path.path[PathLengthMax - 1] = '\0';
|
||||
|
||||
// Ignore leading directories.
|
||||
char* path_pointer = module_path.path.data();
|
||||
char* path_end =
|
||||
path_pointer + std::min(PathLengthMax, module_path.path_length);
|
||||
|
||||
for (s32 i = 0; i < std::min(PathLengthMax, module_path.path_length) &&
|
||||
module_path.path[i] != '\0';
|
||||
i++) {
|
||||
if (module_path.path[i] == '/' || module_path.path[i] == '\\') {
|
||||
path_pointer = module_path.path.data() + i + 1;
|
||||
}
|
||||
}
|
||||
|
||||
// Insert output.
|
||||
modules.emplace(svc_mem_info.base_address,
|
||||
std::string_view(path_pointer, path_end));
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Check if we're done.
|
||||
const uintptr_t next_address = svc_mem_info.base_address + svc_mem_info.size;
|
||||
if (next_address <= cur_addr) {
|
||||
break;
|
||||
}
|
||||
|
||||
cur_addr = next_address;
|
||||
}
|
||||
|
||||
return modules;
|
||||
}
|
||||
|
||||
Kernel::KProcessAddress FindMainModuleEntrypoint(const Kernel::KProcess* process) {
|
||||
// Do we have any loaded executable sections?
|
||||
auto modules = FindModules(process);
|
||||
|
||||
if (modules.size() >= 2) {
|
||||
// If we have two or more, the first one is rtld and the second is main.
|
||||
return std::next(modules.begin())->first;
|
||||
} else if (!modules.empty()) {
|
||||
// If we only have one, this is the main module.
|
||||
return modules.begin()->first;
|
||||
}
|
||||
|
||||
// As a last resort, use the start of the code region.
|
||||
return GetInteger(process->GetPageTable().GetCodeRegionStart());
|
||||
}
|
||||
|
||||
void InvalidateInstructionCacheRange(const Kernel::KProcess* process, u64 address, u64 size) {
|
||||
for (size_t i = 0; i < Core::Hardware::NUM_CPU_CORES; i++) {
|
||||
auto* interface = process->GetArmInterface(i);
|
||||
if (interface) {
|
||||
interface->InvalidateCacheRange(address, size);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
std::vector<BacktraceEntry> GetBacktraceFromContext(const Kernel::KProcess* process,
|
||||
const Kernel::Svc::ThreadContext& ctx) {
|
||||
if (process->Is64Bit()) {
|
||||
return GetAArch64Backtrace(process, ctx);
|
||||
} else {
|
||||
return GetAArch32Backtrace(process, ctx);
|
||||
}
|
||||
}
|
||||
|
||||
std::vector<BacktraceEntry> GetBacktrace(const Kernel::KThread* thread) {
|
||||
Kernel::Svc::ThreadContext ctx = thread->GetContext();
|
||||
return GetBacktraceFromContext(thread->GetOwnerProcess(), ctx);
|
||||
}
|
||||
|
||||
} // namespace Core
|
||||
@@ -1,35 +0,0 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2023 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#pragma once
|
||||
|
||||
#include <optional>
|
||||
|
||||
#include "core/hle/kernel/k_thread.h"
|
||||
#include "core/loader/loader.h"
|
||||
|
||||
namespace Core {
|
||||
|
||||
std::optional<std::string> GetThreadName(const Kernel::KThread* thread);
|
||||
std::string_view GetThreadWaitReason(const Kernel::KThread* thread);
|
||||
std::string GetThreadState(const Kernel::KThread* thread);
|
||||
|
||||
Loader::AppLoader::Modules FindModules(const Kernel::KProcess* process);
|
||||
Kernel::KProcessAddress GetModuleEnd(const Kernel::KProcess* process, Kernel::KProcessAddress base);
|
||||
Kernel::KProcessAddress FindMainModuleEntrypoint(const Kernel::KProcess* process);
|
||||
|
||||
void InvalidateInstructionCacheRange(const Kernel::KProcess* process, u64 address, u64 size);
|
||||
|
||||
struct BacktraceEntry {
|
||||
std::string module;
|
||||
u64 address;
|
||||
u64 original_address;
|
||||
u64 offset;
|
||||
std::string name;
|
||||
};
|
||||
|
||||
std::vector<BacktraceEntry> GetBacktraceFromContext(const Kernel::KProcess* process,
|
||||
const Kernel::Svc::ThreadContext& ctx);
|
||||
std::vector<BacktraceEntry> GetBacktrace(const Kernel::KThread* thread);
|
||||
|
||||
} // namespace Core
|
||||
@@ -1,13 +1,25 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2020 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include <cinttypes>
|
||||
#include <memory>
|
||||
#include <dynarmic/interface/A32/a32.h>
|
||||
#include <dynarmic/interface/A32/config.h>
|
||||
#include "common/assert.h"
|
||||
#include "common/literals.h"
|
||||
#include "common/logging/log.h"
|
||||
#include "common/page_table.h"
|
||||
#include "common/settings.h"
|
||||
#include "core/arm/dynarmic/arm_dynarmic.h"
|
||||
#include "core/arm/dynarmic/arm_dynarmic_32.h"
|
||||
#include "core/arm/dynarmic/dynarmic_cp15.h"
|
||||
#include "core/arm/dynarmic/dynarmic_exclusive_monitor.h"
|
||||
#include "core/core.h"
|
||||
#include "core/core_timing.h"
|
||||
#include "core/debugger/debugger.h"
|
||||
#include "core/hle/kernel/k_process.h"
|
||||
#include "core/hle/kernel/svc.h"
|
||||
#include "core/memory.h"
|
||||
|
||||
namespace Core {
|
||||
|
||||
@@ -15,78 +27,78 @@ using namespace Common::Literals;
|
||||
|
||||
class DynarmicCallbacks32 : public Dynarmic::A32::UserCallbacks {
|
||||
public:
|
||||
explicit DynarmicCallbacks32(ArmDynarmic32& parent, const Kernel::KProcess* process)
|
||||
: m_parent{parent}, m_memory(process->GetMemory()),
|
||||
m_process(process), m_debugger_enabled{parent.m_system.DebuggerEnabled()},
|
||||
m_check_memory_access{m_debugger_enabled ||
|
||||
!Settings::values.cpuopt_ignore_memory_aborts.GetValue()} {}
|
||||
explicit DynarmicCallbacks32(ARM_Dynarmic_32& parent_)
|
||||
: parent{parent_}, memory(parent.system.ApplicationMemory()),
|
||||
debugger_enabled{parent.system.DebuggerEnabled()},
|
||||
check_memory_access{debugger_enabled ||
|
||||
!Settings::values.cpuopt_ignore_memory_aborts.GetValue()} {}
|
||||
|
||||
u8 MemoryRead8(u32 vaddr) override {
|
||||
CheckMemoryAccess(vaddr, 1, Kernel::DebugWatchpointType::Read);
|
||||
return m_memory.Read8(vaddr);
|
||||
return memory.Read8(vaddr);
|
||||
}
|
||||
u16 MemoryRead16(u32 vaddr) override {
|
||||
CheckMemoryAccess(vaddr, 2, Kernel::DebugWatchpointType::Read);
|
||||
return m_memory.Read16(vaddr);
|
||||
return memory.Read16(vaddr);
|
||||
}
|
||||
u32 MemoryRead32(u32 vaddr) override {
|
||||
CheckMemoryAccess(vaddr, 4, Kernel::DebugWatchpointType::Read);
|
||||
return m_memory.Read32(vaddr);
|
||||
return memory.Read32(vaddr);
|
||||
}
|
||||
u64 MemoryRead64(u32 vaddr) override {
|
||||
CheckMemoryAccess(vaddr, 8, Kernel::DebugWatchpointType::Read);
|
||||
return m_memory.Read64(vaddr);
|
||||
return memory.Read64(vaddr);
|
||||
}
|
||||
std::optional<u32> MemoryReadCode(u32 vaddr) override {
|
||||
if (!m_memory.IsValidVirtualAddressRange(vaddr, sizeof(u32))) {
|
||||
if (!memory.IsValidVirtualAddressRange(vaddr, sizeof(u32))) {
|
||||
return std::nullopt;
|
||||
}
|
||||
return m_memory.Read32(vaddr);
|
||||
return memory.Read32(vaddr);
|
||||
}
|
||||
|
||||
void MemoryWrite8(u32 vaddr, u8 value) override {
|
||||
if (CheckMemoryAccess(vaddr, 1, Kernel::DebugWatchpointType::Write)) {
|
||||
m_memory.Write8(vaddr, value);
|
||||
memory.Write8(vaddr, value);
|
||||
}
|
||||
}
|
||||
void MemoryWrite16(u32 vaddr, u16 value) override {
|
||||
if (CheckMemoryAccess(vaddr, 2, Kernel::DebugWatchpointType::Write)) {
|
||||
m_memory.Write16(vaddr, value);
|
||||
memory.Write16(vaddr, value);
|
||||
}
|
||||
}
|
||||
void MemoryWrite32(u32 vaddr, u32 value) override {
|
||||
if (CheckMemoryAccess(vaddr, 4, Kernel::DebugWatchpointType::Write)) {
|
||||
m_memory.Write32(vaddr, value);
|
||||
memory.Write32(vaddr, value);
|
||||
}
|
||||
}
|
||||
void MemoryWrite64(u32 vaddr, u64 value) override {
|
||||
if (CheckMemoryAccess(vaddr, 8, Kernel::DebugWatchpointType::Write)) {
|
||||
m_memory.Write64(vaddr, value);
|
||||
memory.Write64(vaddr, value);
|
||||
}
|
||||
}
|
||||
|
||||
bool MemoryWriteExclusive8(u32 vaddr, u8 value, u8 expected) override {
|
||||
return CheckMemoryAccess(vaddr, 1, Kernel::DebugWatchpointType::Write) &&
|
||||
m_memory.WriteExclusive8(vaddr, value, expected);
|
||||
memory.WriteExclusive8(vaddr, value, expected);
|
||||
}
|
||||
bool MemoryWriteExclusive16(u32 vaddr, u16 value, u16 expected) override {
|
||||
return CheckMemoryAccess(vaddr, 2, Kernel::DebugWatchpointType::Write) &&
|
||||
m_memory.WriteExclusive16(vaddr, value, expected);
|
||||
memory.WriteExclusive16(vaddr, value, expected);
|
||||
}
|
||||
bool MemoryWriteExclusive32(u32 vaddr, u32 value, u32 expected) override {
|
||||
return CheckMemoryAccess(vaddr, 4, Kernel::DebugWatchpointType::Write) &&
|
||||
m_memory.WriteExclusive32(vaddr, value, expected);
|
||||
memory.WriteExclusive32(vaddr, value, expected);
|
||||
}
|
||||
bool MemoryWriteExclusive64(u32 vaddr, u64 value, u64 expected) override {
|
||||
return CheckMemoryAccess(vaddr, 8, Kernel::DebugWatchpointType::Write) &&
|
||||
m_memory.WriteExclusive64(vaddr, value, expected);
|
||||
memory.WriteExclusive64(vaddr, value, expected);
|
||||
}
|
||||
|
||||
void InterpreterFallback(u32 pc, std::size_t num_instructions) override {
|
||||
m_parent.LogBacktrace(m_process);
|
||||
parent.LogBacktrace();
|
||||
LOG_ERROR(Core_ARM,
|
||||
"Unimplemented instruction @ 0x{:X} for {} instructions (instr = {:08X})", pc,
|
||||
num_instructions, m_memory.Read32(pc));
|
||||
num_instructions, memory.Read32(pc));
|
||||
}
|
||||
|
||||
void ExceptionRaised(u32 pc, Dynarmic::A32::Exception exception) override {
|
||||
@@ -96,64 +108,73 @@ public:
|
||||
ReturnException(pc, PrefetchAbort);
|
||||
return;
|
||||
default:
|
||||
if (m_debugger_enabled) {
|
||||
if (debugger_enabled) {
|
||||
ReturnException(pc, InstructionBreakpoint);
|
||||
return;
|
||||
}
|
||||
|
||||
m_parent.LogBacktrace(m_process);
|
||||
parent.LogBacktrace();
|
||||
LOG_CRITICAL(Core_ARM,
|
||||
"ExceptionRaised(exception = {}, pc = {:08X}, code = {:08X}, thumb = {})",
|
||||
exception, pc, m_memory.Read32(pc), m_parent.IsInThumbMode());
|
||||
exception, pc, memory.Read32(pc), parent.IsInThumbMode());
|
||||
}
|
||||
}
|
||||
|
||||
void CallSVC(u32 swi) override {
|
||||
m_parent.m_svc_swi = swi;
|
||||
m_parent.m_jit->HaltExecution(SupervisorCall);
|
||||
parent.svc_swi = swi;
|
||||
parent.jit.load()->HaltExecution(SupervisorCall);
|
||||
}
|
||||
|
||||
void AddTicks(u64 ticks) override {
|
||||
ASSERT_MSG(!m_parent.m_uses_wall_clock, "Dynarmic ticking disabled");
|
||||
if (parent.uses_wall_clock) {
|
||||
return;
|
||||
}
|
||||
|
||||
// Divide the number of ticks by the amount of CPU cores. TODO(Subv): This yields only a
|
||||
// rough approximation of the amount of executed ticks in the system, it may be thrown off
|
||||
// if not all cores are doing a similar amount of work. Instead of doing this, we should
|
||||
// device a way so that timing is consistent across all cores without increasing the ticks 4
|
||||
// times.
|
||||
u64 amortized_ticks = ticks / Core::Hardware::NUM_CPU_CORES;
|
||||
u64 amortized_ticks =
|
||||
(ticks - num_interpreted_instructions) / Core::Hardware::NUM_CPU_CORES;
|
||||
// Always execute at least one tick.
|
||||
amortized_ticks = std::max<u64>(amortized_ticks, 1);
|
||||
|
||||
m_parent.m_system.CoreTiming().AddTicks(amortized_ticks);
|
||||
parent.system.CoreTiming().AddTicks(amortized_ticks);
|
||||
num_interpreted_instructions = 0;
|
||||
}
|
||||
|
||||
u64 GetTicksRemaining() override {
|
||||
ASSERT_MSG(!m_parent.m_uses_wall_clock, "Dynarmic ticking disabled");
|
||||
if (parent.uses_wall_clock) {
|
||||
if (!IsInterrupted()) {
|
||||
return minimum_run_cycles;
|
||||
}
|
||||
return 0U;
|
||||
}
|
||||
|
||||
return std::max<s64>(m_parent.m_system.CoreTiming().GetDowncount(), 0);
|
||||
return std::max<s64>(parent.system.CoreTiming().GetDowncount(), 0);
|
||||
}
|
||||
|
||||
bool CheckMemoryAccess(u64 addr, u64 size, Kernel::DebugWatchpointType type) {
|
||||
if (!m_check_memory_access) {
|
||||
if (!check_memory_access) {
|
||||
return true;
|
||||
}
|
||||
|
||||
if (!m_memory.IsValidVirtualAddressRange(addr, size)) {
|
||||
if (!memory.IsValidVirtualAddressRange(addr, size)) {
|
||||
LOG_CRITICAL(Core_ARM, "Stopping execution due to unmapped memory access at {:#x}",
|
||||
addr);
|
||||
m_parent.m_jit->HaltExecution(PrefetchAbort);
|
||||
parent.jit.load()->HaltExecution(PrefetchAbort);
|
||||
return false;
|
||||
}
|
||||
|
||||
if (!m_debugger_enabled) {
|
||||
if (!debugger_enabled) {
|
||||
return true;
|
||||
}
|
||||
|
||||
const auto match{m_parent.MatchingWatchpoint(addr, size, type)};
|
||||
const auto match{parent.MatchingWatchpoint(addr, size, type)};
|
||||
if (match) {
|
||||
m_parent.m_halted_watchpoint = match;
|
||||
m_parent.m_jit->HaltExecution(DataAbort);
|
||||
parent.halted_watchpoint = match;
|
||||
parent.jit.load()->HaltExecution(DataAbort);
|
||||
return false;
|
||||
}
|
||||
|
||||
@@ -161,31 +182,32 @@ public:
|
||||
}
|
||||
|
||||
void ReturnException(u32 pc, Dynarmic::HaltReason hr) {
|
||||
m_parent.GetContext(m_parent.m_breakpoint_context);
|
||||
m_parent.m_breakpoint_context.pc = pc;
|
||||
m_parent.m_breakpoint_context.r[15] = pc;
|
||||
m_parent.m_jit->HaltExecution(hr);
|
||||
parent.SaveContext(parent.breakpoint_context);
|
||||
parent.breakpoint_context.cpu_registers[15] = pc;
|
||||
parent.jit.load()->HaltExecution(hr);
|
||||
}
|
||||
|
||||
ArmDynarmic32& m_parent;
|
||||
Core::Memory::Memory& m_memory;
|
||||
const Kernel::KProcess* m_process{};
|
||||
const bool m_debugger_enabled{};
|
||||
const bool m_check_memory_access{};
|
||||
static constexpr u64 MinimumRunCycles = 10000U;
|
||||
bool IsInterrupted() {
|
||||
return parent.system.Kernel().PhysicalCore(parent.core_index).IsInterrupted();
|
||||
}
|
||||
|
||||
ARM_Dynarmic_32& parent;
|
||||
Core::Memory::Memory& memory;
|
||||
std::size_t num_interpreted_instructions{};
|
||||
const bool debugger_enabled{};
|
||||
const bool check_memory_access{};
|
||||
static constexpr u64 minimum_run_cycles = 10000U;
|
||||
};
|
||||
|
||||
std::shared_ptr<Dynarmic::A32::Jit> ArmDynarmic32::MakeJit(Common::PageTable* page_table) const {
|
||||
std::shared_ptr<Dynarmic::A32::Jit> ARM_Dynarmic_32::MakeJit(Common::PageTable* page_table) const {
|
||||
Dynarmic::A32::UserConfig config;
|
||||
config.callbacks = m_cb.get();
|
||||
config.coprocessors[15] = m_cp15;
|
||||
config.callbacks = cb.get();
|
||||
config.coprocessors[15] = cp15;
|
||||
config.define_unpredictable_behaviour = true;
|
||||
|
||||
static constexpr std::size_t YUZU_PAGEBITS = 12;
|
||||
static constexpr std::size_t NUM_PAGE_TABLE_ENTRIES = 1 << (32 - YUZU_PAGEBITS);
|
||||
if (page_table) {
|
||||
constexpr size_t PageBits = 12;
|
||||
constexpr size_t NumPageTableEntries = 1 << (32 - PageBits);
|
||||
|
||||
config.page_table = reinterpret_cast<std::array<std::uint8_t*, NumPageTableEntries>*>(
|
||||
config.page_table = reinterpret_cast<std::array<std::uint8_t*, NUM_PAGE_TABLE_ENTRIES>*>(
|
||||
page_table->pointers.data());
|
||||
config.absolute_offset_page_table = true;
|
||||
config.page_table_pointer_mask_bits = Common::PageTable::ATTRIBUTE_BITS;
|
||||
@@ -199,12 +221,12 @@ std::shared_ptr<Dynarmic::A32::Jit> ArmDynarmic32::MakeJit(Common::PageTable* pa
|
||||
}
|
||||
|
||||
// Multi-process state
|
||||
config.processor_id = m_core_index;
|
||||
config.global_monitor = &m_exclusive_monitor.monitor;
|
||||
config.processor_id = core_index;
|
||||
config.global_monitor = &exclusive_monitor.monitor;
|
||||
|
||||
// Timing
|
||||
config.wall_clock_cntpct = m_uses_wall_clock;
|
||||
config.enable_cycle_counting = !m_uses_wall_clock;
|
||||
config.wall_clock_cntpct = uses_wall_clock;
|
||||
config.enable_cycle_counting = true;
|
||||
|
||||
// Code cache size
|
||||
#ifdef ARCHITECTURE_arm64
|
||||
@@ -214,7 +236,7 @@ std::shared_ptr<Dynarmic::A32::Jit> ArmDynarmic32::MakeJit(Common::PageTable* pa
|
||||
#endif
|
||||
|
||||
// Allow memory fault handling to work
|
||||
if (m_system.DebuggerEnabled()) {
|
||||
if (system.DebuggerEnabled()) {
|
||||
config.check_halt_on_memory_access = true;
|
||||
}
|
||||
|
||||
@@ -303,140 +325,137 @@ std::shared_ptr<Dynarmic::A32::Jit> ArmDynarmic32::MakeJit(Common::PageTable* pa
|
||||
return std::make_unique<Dynarmic::A32::Jit>(config);
|
||||
}
|
||||
|
||||
static std::pair<u32, u32> FpscrToFpsrFpcr(u32 fpscr) {
|
||||
// FPSCR bits [31:27] are mapped to FPSR[31:27].
|
||||
// FPSCR bit [7] is mapped to FPSR[7].
|
||||
// FPSCR bits [4:0] are mapped to FPSR[4:0].
|
||||
const u32 nzcv = fpscr & 0xf8000000;
|
||||
const u32 idc = fpscr & 0x80;
|
||||
const u32 fiq = fpscr & 0x1f;
|
||||
const u32 fpsr = nzcv | idc | fiq;
|
||||
|
||||
// FPSCR bits [26:15] are mapped to FPCR[26:15].
|
||||
// FPSCR bits [12:8] are mapped to FPCR[12:8].
|
||||
const u32 round = fpscr & 0x7ff8000;
|
||||
const u32 trap = fpscr & 0x1f00;
|
||||
const u32 fpcr = round | trap;
|
||||
|
||||
return {fpsr, fpcr};
|
||||
HaltReason ARM_Dynarmic_32::RunJit() {
|
||||
return TranslateHaltReason(jit.load()->Run());
|
||||
}
|
||||
|
||||
static u32 FpsrFpcrToFpscr(u64 fpsr, u64 fpcr) {
|
||||
auto [s, c] = FpscrToFpsrFpcr(static_cast<u32>(fpsr | fpcr));
|
||||
return s | c;
|
||||
HaltReason ARM_Dynarmic_32::StepJit() {
|
||||
return TranslateHaltReason(jit.load()->Step());
|
||||
}
|
||||
|
||||
bool ArmDynarmic32::IsInThumbMode() const {
|
||||
return (m_jit->Cpsr() & 0x20) != 0;
|
||||
u32 ARM_Dynarmic_32::GetSvcNumber() const {
|
||||
return svc_swi;
|
||||
}
|
||||
|
||||
HaltReason ArmDynarmic32::RunThread(Kernel::KThread* thread) {
|
||||
m_jit->ClearExclusiveState();
|
||||
return TranslateHaltReason(m_jit->Run());
|
||||
const Kernel::DebugWatchpoint* ARM_Dynarmic_32::HaltedWatchpoint() const {
|
||||
return halted_watchpoint;
|
||||
}
|
||||
|
||||
HaltReason ArmDynarmic32::StepThread(Kernel::KThread* thread) {
|
||||
m_jit->ClearExclusiveState();
|
||||
return TranslateHaltReason(m_jit->Step());
|
||||
void ARM_Dynarmic_32::RewindBreakpointInstruction() {
|
||||
LoadContext(breakpoint_context);
|
||||
}
|
||||
|
||||
u32 ArmDynarmic32::GetSvcNumber() const {
|
||||
return m_svc_swi;
|
||||
ARM_Dynarmic_32::ARM_Dynarmic_32(System& system_, bool uses_wall_clock_,
|
||||
DynarmicExclusiveMonitor& exclusive_monitor_,
|
||||
std::size_t core_index_)
|
||||
: ARM_Interface{system_, uses_wall_clock_}, cb(std::make_unique<DynarmicCallbacks32>(*this)),
|
||||
cp15(std::make_shared<DynarmicCP15>(*this)), core_index{core_index_},
|
||||
exclusive_monitor{exclusive_monitor_}, null_jit{MakeJit(nullptr)}, jit{null_jit.get()} {}
|
||||
|
||||
ARM_Dynarmic_32::~ARM_Dynarmic_32() = default;
|
||||
|
||||
void ARM_Dynarmic_32::SetPC(u64 pc) {
|
||||
jit.load()->Regs()[15] = static_cast<u32>(pc);
|
||||
}
|
||||
|
||||
void ArmDynarmic32::GetSvcArguments(std::span<uint64_t, 8> args) const {
|
||||
Dynarmic::A32::Jit& j = *m_jit;
|
||||
auto& gpr = j.Regs();
|
||||
u64 ARM_Dynarmic_32::GetPC() const {
|
||||
return jit.load()->Regs()[15];
|
||||
}
|
||||
|
||||
for (size_t i = 0; i < 8; i++) {
|
||||
args[i] = gpr[i];
|
||||
u64 ARM_Dynarmic_32::GetSP() const {
|
||||
return jit.load()->Regs()[13];
|
||||
}
|
||||
|
||||
u64 ARM_Dynarmic_32::GetReg(int index) const {
|
||||
return jit.load()->Regs()[index];
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::SetReg(int index, u64 value) {
|
||||
jit.load()->Regs()[index] = static_cast<u32>(value);
|
||||
}
|
||||
|
||||
u128 ARM_Dynarmic_32::GetVectorReg(int index) const {
|
||||
return {};
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::SetVectorReg(int index, u128 value) {}
|
||||
|
||||
u32 ARM_Dynarmic_32::GetPSTATE() const {
|
||||
return jit.load()->Cpsr();
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::SetPSTATE(u32 cpsr) {
|
||||
jit.load()->SetCpsr(cpsr);
|
||||
}
|
||||
|
||||
u64 ARM_Dynarmic_32::GetTlsAddress() const {
|
||||
return cp15->uro;
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::SetTlsAddress(u64 address) {
|
||||
cp15->uro = static_cast<u32>(address);
|
||||
}
|
||||
|
||||
u64 ARM_Dynarmic_32::GetTPIDR_EL0() const {
|
||||
return cp15->uprw;
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::SetTPIDR_EL0(u64 value) {
|
||||
cp15->uprw = static_cast<u32>(value);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::SaveContext(ThreadContext32& ctx) const {
|
||||
Dynarmic::A32::Jit* j = jit.load();
|
||||
ctx.cpu_registers = j->Regs();
|
||||
ctx.extension_registers = j->ExtRegs();
|
||||
ctx.cpsr = j->Cpsr();
|
||||
ctx.fpscr = j->Fpscr();
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::LoadContext(const ThreadContext32& ctx) {
|
||||
Dynarmic::A32::Jit* j = jit.load();
|
||||
j->Regs() = ctx.cpu_registers;
|
||||
j->ExtRegs() = ctx.extension_registers;
|
||||
j->SetCpsr(ctx.cpsr);
|
||||
j->SetFpscr(ctx.fpscr);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::SignalInterrupt() {
|
||||
jit.load()->HaltExecution(BreakLoop);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::ClearInterrupt() {
|
||||
jit.load()->ClearHalt(BreakLoop);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::ClearInstructionCache() {
|
||||
jit.load()->ClearCache();
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::InvalidateCacheRange(u64 addr, std::size_t size) {
|
||||
jit.load()->InvalidateCacheRange(static_cast<u32>(addr), size);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::ClearExclusiveState() {
|
||||
jit.load()->ClearExclusiveState();
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::PageTableChanged(Common::PageTable& page_table,
|
||||
std::size_t new_address_space_size_in_bits) {
|
||||
ThreadContext32 ctx{};
|
||||
SaveContext(ctx);
|
||||
|
||||
auto key = std::make_pair(&page_table, new_address_space_size_in_bits);
|
||||
auto iter = jit_cache.find(key);
|
||||
if (iter != jit_cache.end()) {
|
||||
jit.store(iter->second.get());
|
||||
LoadContext(ctx);
|
||||
return;
|
||||
}
|
||||
}
|
||||
|
||||
void ArmDynarmic32::SetSvcArguments(std::span<const uint64_t, 8> args) {
|
||||
Dynarmic::A32::Jit& j = *m_jit;
|
||||
auto& gpr = j.Regs();
|
||||
|
||||
for (size_t i = 0; i < 8; i++) {
|
||||
gpr[i] = static_cast<u32>(args[i]);
|
||||
}
|
||||
}
|
||||
|
||||
const Kernel::DebugWatchpoint* ArmDynarmic32::HaltedWatchpoint() const {
|
||||
return m_halted_watchpoint;
|
||||
}
|
||||
|
||||
void ArmDynarmic32::RewindBreakpointInstruction() {
|
||||
this->SetContext(m_breakpoint_context);
|
||||
}
|
||||
|
||||
ArmDynarmic32::ArmDynarmic32(System& system, bool uses_wall_clock, const Kernel::KProcess* process,
|
||||
DynarmicExclusiveMonitor& exclusive_monitor, std::size_t core_index)
|
||||
: ArmInterface{uses_wall_clock}, m_system{system}, m_exclusive_monitor{exclusive_monitor},
|
||||
m_cb(std::make_unique<DynarmicCallbacks32>(*this, process)),
|
||||
m_cp15(std::make_shared<DynarmicCP15>(*this)), m_core_index{core_index} {
|
||||
auto& page_table_impl = process->GetPageTable().GetBasePageTable().GetImpl();
|
||||
m_jit = MakeJit(&page_table_impl);
|
||||
}
|
||||
|
||||
ArmDynarmic32::~ArmDynarmic32() = default;
|
||||
|
||||
void ArmDynarmic32::SetTpidrroEl0(u64 value) {
|
||||
m_cp15->uro = static_cast<u32>(value);
|
||||
}
|
||||
|
||||
void ArmDynarmic32::GetContext(Kernel::Svc::ThreadContext& ctx) const {
|
||||
Dynarmic::A32::Jit& j = *m_jit;
|
||||
auto& gpr = j.Regs();
|
||||
auto& fpr = j.ExtRegs();
|
||||
|
||||
for (size_t i = 0; i < 16; i++) {
|
||||
ctx.r[i] = gpr[i];
|
||||
}
|
||||
|
||||
ctx.fp = gpr[11];
|
||||
ctx.sp = gpr[13];
|
||||
ctx.lr = gpr[14];
|
||||
ctx.pc = gpr[15];
|
||||
ctx.pstate = j.Cpsr();
|
||||
|
||||
static_assert(sizeof(fpr) <= sizeof(ctx.v));
|
||||
std::memcpy(ctx.v.data(), &fpr, sizeof(fpr));
|
||||
|
||||
auto [fpsr, fpcr] = FpscrToFpsrFpcr(j.Fpscr());
|
||||
ctx.fpcr = fpcr;
|
||||
ctx.fpsr = fpsr;
|
||||
ctx.tpidr = m_cp15->uprw;
|
||||
}
|
||||
|
||||
void ArmDynarmic32::SetContext(const Kernel::Svc::ThreadContext& ctx) {
|
||||
Dynarmic::A32::Jit& j = *m_jit;
|
||||
auto& gpr = j.Regs();
|
||||
auto& fpr = j.ExtRegs();
|
||||
|
||||
for (size_t i = 0; i < 16; i++) {
|
||||
gpr[i] = static_cast<u32>(ctx.r[i]);
|
||||
}
|
||||
|
||||
j.SetCpsr(ctx.pstate);
|
||||
|
||||
static_assert(sizeof(fpr) <= sizeof(ctx.v));
|
||||
std::memcpy(&fpr, ctx.v.data(), sizeof(fpr));
|
||||
|
||||
j.SetFpscr(FpsrFpcrToFpscr(ctx.fpsr, ctx.fpcr));
|
||||
m_cp15->uprw = static_cast<u32>(ctx.tpidr);
|
||||
}
|
||||
|
||||
void ArmDynarmic32::SignalInterrupt(Kernel::KThread* thread) {
|
||||
m_jit->HaltExecution(BreakLoop);
|
||||
}
|
||||
|
||||
void ArmDynarmic32::ClearInstructionCache() {
|
||||
m_jit->ClearCache();
|
||||
}
|
||||
|
||||
void ArmDynarmic32::InvalidateCacheRange(u64 addr, std::size_t size) {
|
||||
m_jit->InvalidateCacheRange(static_cast<u32>(addr), size);
|
||||
std::shared_ptr new_jit = MakeJit(&page_table);
|
||||
jit.store(new_jit.get());
|
||||
LoadContext(ctx);
|
||||
jit_cache.emplace(key, std::move(new_jit));
|
||||
}
|
||||
|
||||
} // namespace Core
|
||||
|
||||
@@ -3,8 +3,14 @@
|
||||
|
||||
#pragma once
|
||||
|
||||
#include <dynarmic/interface/A32/a32.h>
|
||||
#include <atomic>
|
||||
#include <memory>
|
||||
#include <unordered_map>
|
||||
|
||||
#include <dynarmic/interface/A32/a32.h>
|
||||
#include <dynarmic/interface/A64/a64.h>
|
||||
#include "common/common_types.h"
|
||||
#include "common/hash.h"
|
||||
#include "core/arm/arm_interface.h"
|
||||
#include "core/arm/dynarmic/dynarmic_exclusive_monitor.h"
|
||||
|
||||
@@ -14,63 +20,89 @@ class Memory;
|
||||
|
||||
namespace Core {
|
||||
|
||||
class CPUInterruptHandler;
|
||||
class DynarmicCallbacks32;
|
||||
class DynarmicCP15;
|
||||
class DynarmicExclusiveMonitor;
|
||||
class System;
|
||||
|
||||
class ArmDynarmic32 final : public ArmInterface {
|
||||
class ARM_Dynarmic_32 final : public ARM_Interface {
|
||||
public:
|
||||
ArmDynarmic32(System& system, bool uses_wall_clock, const Kernel::KProcess* process,
|
||||
DynarmicExclusiveMonitor& exclusive_monitor, std::size_t core_index);
|
||||
~ArmDynarmic32() override;
|
||||
ARM_Dynarmic_32(System& system_, bool uses_wall_clock_,
|
||||
DynarmicExclusiveMonitor& exclusive_monitor_, std::size_t core_index_);
|
||||
~ARM_Dynarmic_32() override;
|
||||
|
||||
Architecture GetArchitecture() const override {
|
||||
return Architecture::AArch32;
|
||||
void SetPC(u64 pc) override;
|
||||
u64 GetPC() const override;
|
||||
u64 GetSP() const override;
|
||||
u64 GetReg(int index) const override;
|
||||
void SetReg(int index, u64 value) override;
|
||||
u128 GetVectorReg(int index) const override;
|
||||
void SetVectorReg(int index, u128 value) override;
|
||||
u32 GetPSTATE() const override;
|
||||
void SetPSTATE(u32 pstate) override;
|
||||
u64 GetTlsAddress() const override;
|
||||
void SetTlsAddress(u64 address) override;
|
||||
void SetTPIDR_EL0(u64 value) override;
|
||||
u64 GetTPIDR_EL0() const override;
|
||||
|
||||
bool IsInThumbMode() const {
|
||||
return (GetPSTATE() & 0x20) != 0;
|
||||
}
|
||||
|
||||
bool IsInThumbMode() const;
|
||||
Architecture GetArchitecture() const override {
|
||||
return Architecture::Aarch32;
|
||||
}
|
||||
void SaveContext(ThreadContext32& ctx) const override;
|
||||
void SaveContext(ThreadContext64& ctx) const override {}
|
||||
void LoadContext(const ThreadContext32& ctx) override;
|
||||
void LoadContext(const ThreadContext64& ctx) override {}
|
||||
|
||||
HaltReason RunThread(Kernel::KThread* thread) override;
|
||||
HaltReason StepThread(Kernel::KThread* thread) override;
|
||||
void SignalInterrupt() override;
|
||||
void ClearInterrupt() override;
|
||||
void ClearExclusiveState() override;
|
||||
|
||||
void GetContext(Kernel::Svc::ThreadContext& ctx) const override;
|
||||
void SetContext(const Kernel::Svc::ThreadContext& ctx) override;
|
||||
void SetTpidrroEl0(u64 value) override;
|
||||
|
||||
void GetSvcArguments(std::span<uint64_t, 8> args) const override;
|
||||
void SetSvcArguments(std::span<const uint64_t, 8> args) override;
|
||||
u32 GetSvcNumber() const override;
|
||||
|
||||
void SignalInterrupt(Kernel::KThread* thread) override;
|
||||
void ClearInstructionCache() override;
|
||||
void InvalidateCacheRange(u64 addr, std::size_t size) override;
|
||||
void PageTableChanged(Common::PageTable& new_page_table,
|
||||
std::size_t new_address_space_size_in_bits) override;
|
||||
|
||||
protected:
|
||||
HaltReason RunJit() override;
|
||||
HaltReason StepJit() override;
|
||||
u32 GetSvcNumber() const override;
|
||||
const Kernel::DebugWatchpoint* HaltedWatchpoint() const override;
|
||||
void RewindBreakpointInstruction() override;
|
||||
|
||||
private:
|
||||
System& m_system;
|
||||
DynarmicExclusiveMonitor& m_exclusive_monitor;
|
||||
std::shared_ptr<Dynarmic::A32::Jit> MakeJit(Common::PageTable* page_table) const;
|
||||
|
||||
static std::vector<BacktraceEntry> GetBacktrace(Core::System& system, u64 fp, u64 lr, u64 pc);
|
||||
|
||||
using JitCacheKey = std::pair<Common::PageTable*, std::size_t>;
|
||||
using JitCacheType =
|
||||
std::unordered_map<JitCacheKey, std::shared_ptr<Dynarmic::A32::Jit>, Common::PairHash>;
|
||||
|
||||
private:
|
||||
friend class DynarmicCallbacks32;
|
||||
friend class DynarmicCP15;
|
||||
|
||||
std::shared_ptr<Dynarmic::A32::Jit> MakeJit(Common::PageTable* page_table) const;
|
||||
std::unique_ptr<DynarmicCallbacks32> cb;
|
||||
JitCacheType jit_cache;
|
||||
std::shared_ptr<DynarmicCP15> cp15;
|
||||
std::size_t core_index;
|
||||
DynarmicExclusiveMonitor& exclusive_monitor;
|
||||
|
||||
std::unique_ptr<DynarmicCallbacks32> m_cb{};
|
||||
std::shared_ptr<DynarmicCP15> m_cp15{};
|
||||
std::size_t m_core_index{};
|
||||
std::shared_ptr<Dynarmic::A32::Jit> null_jit;
|
||||
|
||||
std::shared_ptr<Dynarmic::A32::Jit> m_jit{};
|
||||
// A raw pointer here is fine; we never delete Jit instances.
|
||||
std::atomic<Dynarmic::A32::Jit*> jit;
|
||||
|
||||
// SVC callback
|
||||
u32 m_svc_swi{};
|
||||
u32 svc_swi{};
|
||||
|
||||
// Watchpoint info
|
||||
const Kernel::DebugWatchpoint* m_halted_watchpoint{};
|
||||
Kernel::Svc::ThreadContext m_breakpoint_context{};
|
||||
const Kernel::DebugWatchpoint* halted_watchpoint;
|
||||
ThreadContext32 breakpoint_context;
|
||||
};
|
||||
|
||||
} // namespace Core
|
||||
|
||||
@@ -1,12 +1,25 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2018 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include <cinttypes>
|
||||
#include <memory>
|
||||
#include <dynarmic/interface/A64/a64.h>
|
||||
#include <dynarmic/interface/A64/config.h>
|
||||
#include "common/assert.h"
|
||||
#include "common/literals.h"
|
||||
#include "common/logging/log.h"
|
||||
#include "common/page_table.h"
|
||||
#include "common/settings.h"
|
||||
#include "core/arm/dynarmic/arm_dynarmic.h"
|
||||
#include "core/arm/dynarmic/arm_dynarmic_64.h"
|
||||
#include "core/arm/dynarmic/dynarmic_exclusive_monitor.h"
|
||||
#include "core/core.h"
|
||||
#include "core/core_timing.h"
|
||||
#include "core/debugger/debugger.h"
|
||||
#include "core/hardware_properties.h"
|
||||
#include "core/hle/kernel/k_process.h"
|
||||
#include "core/hle/kernel/svc.h"
|
||||
#include "core/memory.h"
|
||||
|
||||
namespace Core {
|
||||
|
||||
@@ -15,92 +28,92 @@ using namespace Common::Literals;
|
||||
|
||||
class DynarmicCallbacks64 : public Dynarmic::A64::UserCallbacks {
|
||||
public:
|
||||
explicit DynarmicCallbacks64(ArmDynarmic64& parent, const Kernel::KProcess* process)
|
||||
: m_parent{parent}, m_memory(process->GetMemory()),
|
||||
m_process(process), m_debugger_enabled{parent.m_system.DebuggerEnabled()},
|
||||
m_check_memory_access{m_debugger_enabled ||
|
||||
!Settings::values.cpuopt_ignore_memory_aborts.GetValue()} {}
|
||||
explicit DynarmicCallbacks64(ARM_Dynarmic_64& parent_)
|
||||
: parent{parent_}, memory(parent.system.ApplicationMemory()),
|
||||
debugger_enabled{parent.system.DebuggerEnabled()},
|
||||
check_memory_access{debugger_enabled ||
|
||||
!Settings::values.cpuopt_ignore_memory_aborts.GetValue()} {}
|
||||
|
||||
u8 MemoryRead8(u64 vaddr) override {
|
||||
CheckMemoryAccess(vaddr, 1, Kernel::DebugWatchpointType::Read);
|
||||
return m_memory.Read8(vaddr);
|
||||
return memory.Read8(vaddr);
|
||||
}
|
||||
u16 MemoryRead16(u64 vaddr) override {
|
||||
CheckMemoryAccess(vaddr, 2, Kernel::DebugWatchpointType::Read);
|
||||
return m_memory.Read16(vaddr);
|
||||
return memory.Read16(vaddr);
|
||||
}
|
||||
u32 MemoryRead32(u64 vaddr) override {
|
||||
CheckMemoryAccess(vaddr, 4, Kernel::DebugWatchpointType::Read);
|
||||
return m_memory.Read32(vaddr);
|
||||
return memory.Read32(vaddr);
|
||||
}
|
||||
u64 MemoryRead64(u64 vaddr) override {
|
||||
CheckMemoryAccess(vaddr, 8, Kernel::DebugWatchpointType::Read);
|
||||
return m_memory.Read64(vaddr);
|
||||
return memory.Read64(vaddr);
|
||||
}
|
||||
Vector MemoryRead128(u64 vaddr) override {
|
||||
CheckMemoryAccess(vaddr, 16, Kernel::DebugWatchpointType::Read);
|
||||
return {m_memory.Read64(vaddr), m_memory.Read64(vaddr + 8)};
|
||||
return {memory.Read64(vaddr), memory.Read64(vaddr + 8)};
|
||||
}
|
||||
std::optional<u32> MemoryReadCode(u64 vaddr) override {
|
||||
if (!m_memory.IsValidVirtualAddressRange(vaddr, sizeof(u32))) {
|
||||
if (!memory.IsValidVirtualAddressRange(vaddr, sizeof(u32))) {
|
||||
return std::nullopt;
|
||||
}
|
||||
return m_memory.Read32(vaddr);
|
||||
return memory.Read32(vaddr);
|
||||
}
|
||||
|
||||
void MemoryWrite8(u64 vaddr, u8 value) override {
|
||||
if (CheckMemoryAccess(vaddr, 1, Kernel::DebugWatchpointType::Write)) {
|
||||
m_memory.Write8(vaddr, value);
|
||||
memory.Write8(vaddr, value);
|
||||
}
|
||||
}
|
||||
void MemoryWrite16(u64 vaddr, u16 value) override {
|
||||
if (CheckMemoryAccess(vaddr, 2, Kernel::DebugWatchpointType::Write)) {
|
||||
m_memory.Write16(vaddr, value);
|
||||
memory.Write16(vaddr, value);
|
||||
}
|
||||
}
|
||||
void MemoryWrite32(u64 vaddr, u32 value) override {
|
||||
if (CheckMemoryAccess(vaddr, 4, Kernel::DebugWatchpointType::Write)) {
|
||||
m_memory.Write32(vaddr, value);
|
||||
memory.Write32(vaddr, value);
|
||||
}
|
||||
}
|
||||
void MemoryWrite64(u64 vaddr, u64 value) override {
|
||||
if (CheckMemoryAccess(vaddr, 8, Kernel::DebugWatchpointType::Write)) {
|
||||
m_memory.Write64(vaddr, value);
|
||||
memory.Write64(vaddr, value);
|
||||
}
|
||||
}
|
||||
void MemoryWrite128(u64 vaddr, Vector value) override {
|
||||
if (CheckMemoryAccess(vaddr, 16, Kernel::DebugWatchpointType::Write)) {
|
||||
m_memory.Write64(vaddr, value[0]);
|
||||
m_memory.Write64(vaddr + 8, value[1]);
|
||||
memory.Write64(vaddr, value[0]);
|
||||
memory.Write64(vaddr + 8, value[1]);
|
||||
}
|
||||
}
|
||||
|
||||
bool MemoryWriteExclusive8(u64 vaddr, std::uint8_t value, std::uint8_t expected) override {
|
||||
return CheckMemoryAccess(vaddr, 1, Kernel::DebugWatchpointType::Write) &&
|
||||
m_memory.WriteExclusive8(vaddr, value, expected);
|
||||
memory.WriteExclusive8(vaddr, value, expected);
|
||||
}
|
||||
bool MemoryWriteExclusive16(u64 vaddr, std::uint16_t value, std::uint16_t expected) override {
|
||||
return CheckMemoryAccess(vaddr, 2, Kernel::DebugWatchpointType::Write) &&
|
||||
m_memory.WriteExclusive16(vaddr, value, expected);
|
||||
memory.WriteExclusive16(vaddr, value, expected);
|
||||
}
|
||||
bool MemoryWriteExclusive32(u64 vaddr, std::uint32_t value, std::uint32_t expected) override {
|
||||
return CheckMemoryAccess(vaddr, 4, Kernel::DebugWatchpointType::Write) &&
|
||||
m_memory.WriteExclusive32(vaddr, value, expected);
|
||||
memory.WriteExclusive32(vaddr, value, expected);
|
||||
}
|
||||
bool MemoryWriteExclusive64(u64 vaddr, std::uint64_t value, std::uint64_t expected) override {
|
||||
return CheckMemoryAccess(vaddr, 8, Kernel::DebugWatchpointType::Write) &&
|
||||
m_memory.WriteExclusive64(vaddr, value, expected);
|
||||
memory.WriteExclusive64(vaddr, value, expected);
|
||||
}
|
||||
bool MemoryWriteExclusive128(u64 vaddr, Vector value, Vector expected) override {
|
||||
return CheckMemoryAccess(vaddr, 16, Kernel::DebugWatchpointType::Write) &&
|
||||
m_memory.WriteExclusive128(vaddr, value, expected);
|
||||
memory.WriteExclusive128(vaddr, value, expected);
|
||||
}
|
||||
|
||||
void InterpreterFallback(u64 pc, std::size_t num_instructions) override {
|
||||
m_parent.LogBacktrace(m_process);
|
||||
parent.LogBacktrace();
|
||||
LOG_ERROR(Core_ARM,
|
||||
"Unimplemented instruction @ 0x{:X} for {} instructions (instr = {:08X})", pc,
|
||||
num_instructions, m_memory.Read32(pc));
|
||||
num_instructions, memory.Read32(pc));
|
||||
ReturnException(pc, PrefetchAbort);
|
||||
}
|
||||
|
||||
@@ -111,11 +124,11 @@ public:
|
||||
static constexpr u64 ICACHE_LINE_SIZE = 64;
|
||||
|
||||
const u64 cache_line_start = value & ~(ICACHE_LINE_SIZE - 1);
|
||||
m_parent.InvalidateCacheRange(cache_line_start, ICACHE_LINE_SIZE);
|
||||
parent.system.InvalidateCpuInstructionCacheRange(cache_line_start, ICACHE_LINE_SIZE);
|
||||
break;
|
||||
}
|
||||
case Dynarmic::A64::InstructionCacheOperation::InvalidateAllToPoU:
|
||||
m_parent.ClearInstructionCache();
|
||||
parent.system.InvalidateCpuInstructionCaches();
|
||||
break;
|
||||
case Dynarmic::A64::InstructionCacheOperation::InvalidateAllToPoUInnerSharable:
|
||||
default:
|
||||
@@ -123,7 +136,7 @@ public:
|
||||
break;
|
||||
}
|
||||
|
||||
m_parent.m_jit->HaltExecution(Dynarmic::HaltReason::CacheInvalidation);
|
||||
parent.jit.load()->HaltExecution(Dynarmic::HaltReason::CacheInvalidation);
|
||||
}
|
||||
|
||||
void ExceptionRaised(u64 pc, Dynarmic::A64::Exception exception) override {
|
||||
@@ -139,24 +152,26 @@ public:
|
||||
ReturnException(pc, PrefetchAbort);
|
||||
return;
|
||||
default:
|
||||
if (m_debugger_enabled) {
|
||||
if (debugger_enabled) {
|
||||
ReturnException(pc, InstructionBreakpoint);
|
||||
return;
|
||||
}
|
||||
|
||||
m_parent.LogBacktrace(m_process);
|
||||
parent.LogBacktrace();
|
||||
LOG_CRITICAL(Core_ARM, "ExceptionRaised(exception = {}, pc = {:08X}, code = {:08X})",
|
||||
static_cast<std::size_t>(exception), pc, m_memory.Read32(pc));
|
||||
static_cast<std::size_t>(exception), pc, memory.Read32(pc));
|
||||
}
|
||||
}
|
||||
|
||||
void CallSVC(u32 svc) override {
|
||||
m_parent.m_svc = svc;
|
||||
m_parent.m_jit->HaltExecution(SupervisorCall);
|
||||
void CallSVC(u32 swi) override {
|
||||
parent.svc_swi = swi;
|
||||
parent.jit.load()->HaltExecution(SupervisorCall);
|
||||
}
|
||||
|
||||
void AddTicks(u64 ticks) override {
|
||||
ASSERT_MSG(!m_parent.m_uses_wall_clock, "Dynarmic ticking disabled");
|
||||
if (parent.uses_wall_clock) {
|
||||
return;
|
||||
}
|
||||
|
||||
// Divide the number of ticks by the amount of CPU cores. TODO(Subv): This yields only a
|
||||
// rough approximation of the amount of executed ticks in the system, it may be thrown off
|
||||
@@ -167,39 +182,44 @@ public:
|
||||
// Always execute at least one tick.
|
||||
amortized_ticks = std::max<u64>(amortized_ticks, 1);
|
||||
|
||||
m_parent.m_system.CoreTiming().AddTicks(amortized_ticks);
|
||||
parent.system.CoreTiming().AddTicks(amortized_ticks);
|
||||
}
|
||||
|
||||
u64 GetTicksRemaining() override {
|
||||
ASSERT_MSG(!m_parent.m_uses_wall_clock, "Dynarmic ticking disabled");
|
||||
if (parent.uses_wall_clock) {
|
||||
if (!IsInterrupted()) {
|
||||
return minimum_run_cycles;
|
||||
}
|
||||
return 0U;
|
||||
}
|
||||
|
||||
return std::max<s64>(m_parent.m_system.CoreTiming().GetDowncount(), 0);
|
||||
return std::max<s64>(parent.system.CoreTiming().GetDowncount(), 0);
|
||||
}
|
||||
|
||||
u64 GetCNTPCT() override {
|
||||
return m_parent.m_system.CoreTiming().GetClockTicks();
|
||||
return parent.system.CoreTiming().GetClockTicks();
|
||||
}
|
||||
|
||||
bool CheckMemoryAccess(u64 addr, u64 size, Kernel::DebugWatchpointType type) {
|
||||
if (!m_check_memory_access) {
|
||||
if (!check_memory_access) {
|
||||
return true;
|
||||
}
|
||||
|
||||
if (!m_memory.IsValidVirtualAddressRange(addr, size)) {
|
||||
if (!memory.IsValidVirtualAddressRange(addr, size)) {
|
||||
LOG_CRITICAL(Core_ARM, "Stopping execution due to unmapped memory access at {:#x}",
|
||||
addr);
|
||||
m_parent.m_jit->HaltExecution(PrefetchAbort);
|
||||
parent.jit.load()->HaltExecution(PrefetchAbort);
|
||||
return false;
|
||||
}
|
||||
|
||||
if (!m_debugger_enabled) {
|
||||
if (!debugger_enabled) {
|
||||
return true;
|
||||
}
|
||||
|
||||
const auto match{m_parent.MatchingWatchpoint(addr, size, type)};
|
||||
const auto match{parent.MatchingWatchpoint(addr, size, type)};
|
||||
if (match) {
|
||||
m_parent.m_halted_watchpoint = match;
|
||||
m_parent.m_jit->HaltExecution(DataAbort);
|
||||
parent.halted_watchpoint = match;
|
||||
parent.jit.load()->HaltExecution(DataAbort);
|
||||
return false;
|
||||
}
|
||||
|
||||
@@ -207,27 +227,30 @@ public:
|
||||
}
|
||||
|
||||
void ReturnException(u64 pc, Dynarmic::HaltReason hr) {
|
||||
m_parent.GetContext(m_parent.m_breakpoint_context);
|
||||
m_parent.m_breakpoint_context.pc = pc;
|
||||
m_parent.m_jit->HaltExecution(hr);
|
||||
parent.SaveContext(parent.breakpoint_context);
|
||||
parent.breakpoint_context.pc = pc;
|
||||
parent.jit.load()->HaltExecution(hr);
|
||||
}
|
||||
|
||||
ArmDynarmic64& m_parent;
|
||||
Core::Memory::Memory& m_memory;
|
||||
u64 m_tpidrro_el0{};
|
||||
u64 m_tpidr_el0{};
|
||||
const Kernel::KProcess* m_process{};
|
||||
const bool m_debugger_enabled{};
|
||||
const bool m_check_memory_access{};
|
||||
static constexpr u64 MinimumRunCycles = 10000U;
|
||||
bool IsInterrupted() {
|
||||
return parent.system.Kernel().PhysicalCore(parent.core_index).IsInterrupted();
|
||||
}
|
||||
|
||||
ARM_Dynarmic_64& parent;
|
||||
Core::Memory::Memory& memory;
|
||||
u64 tpidrro_el0 = 0;
|
||||
u64 tpidr_el0 = 0;
|
||||
const bool debugger_enabled{};
|
||||
const bool check_memory_access{};
|
||||
static constexpr u64 minimum_run_cycles = 10000U;
|
||||
};
|
||||
|
||||
std::shared_ptr<Dynarmic::A64::Jit> ArmDynarmic64::MakeJit(Common::PageTable* page_table,
|
||||
std::size_t address_space_bits) const {
|
||||
std::shared_ptr<Dynarmic::A64::Jit> ARM_Dynarmic_64::MakeJit(Common::PageTable* page_table,
|
||||
std::size_t address_space_bits) const {
|
||||
Dynarmic::A64::UserConfig config;
|
||||
|
||||
// Callbacks
|
||||
config.callbacks = m_cb.get();
|
||||
config.callbacks = cb.get();
|
||||
|
||||
// Memory
|
||||
if (page_table) {
|
||||
@@ -248,12 +271,12 @@ std::shared_ptr<Dynarmic::A64::Jit> ArmDynarmic64::MakeJit(Common::PageTable* pa
|
||||
}
|
||||
|
||||
// Multi-process state
|
||||
config.processor_id = m_core_index;
|
||||
config.global_monitor = &m_exclusive_monitor.monitor;
|
||||
config.processor_id = core_index;
|
||||
config.global_monitor = &exclusive_monitor.monitor;
|
||||
|
||||
// System registers
|
||||
config.tpidrro_el0 = &m_cb->m_tpidrro_el0;
|
||||
config.tpidr_el0 = &m_cb->m_tpidr_el0;
|
||||
config.tpidrro_el0 = &cb->tpidrro_el0;
|
||||
config.tpidr_el0 = &cb->tpidr_el0;
|
||||
config.dczid_el0 = 4;
|
||||
config.ctr_el0 = 0x8444c004;
|
||||
config.cntfrq_el0 = Hardware::CNTFREQ;
|
||||
@@ -262,8 +285,8 @@ std::shared_ptr<Dynarmic::A64::Jit> ArmDynarmic64::MakeJit(Common::PageTable* pa
|
||||
config.define_unpredictable_behaviour = true;
|
||||
|
||||
// Timing
|
||||
config.wall_clock_cntpct = m_uses_wall_clock;
|
||||
config.enable_cycle_counting = !m_uses_wall_clock;
|
||||
config.wall_clock_cntpct = uses_wall_clock;
|
||||
config.enable_cycle_counting = true;
|
||||
|
||||
// Code cache size
|
||||
#ifdef ARCHITECTURE_arm64
|
||||
@@ -273,7 +296,7 @@ std::shared_ptr<Dynarmic::A64::Jit> ArmDynarmic64::MakeJit(Common::PageTable* pa
|
||||
#endif
|
||||
|
||||
// Allow memory fault handling to work
|
||||
if (m_system.DebuggerEnabled()) {
|
||||
if (system.DebuggerEnabled()) {
|
||||
config.check_halt_on_memory_access = true;
|
||||
}
|
||||
|
||||
@@ -361,112 +384,147 @@ std::shared_ptr<Dynarmic::A64::Jit> ArmDynarmic64::MakeJit(Common::PageTable* pa
|
||||
return std::make_shared<Dynarmic::A64::Jit>(config);
|
||||
}
|
||||
|
||||
HaltReason ArmDynarmic64::RunThread(Kernel::KThread* thread) {
|
||||
m_jit->ClearExclusiveState();
|
||||
return TranslateHaltReason(m_jit->Run());
|
||||
HaltReason ARM_Dynarmic_64::RunJit() {
|
||||
return TranslateHaltReason(jit.load()->Run());
|
||||
}
|
||||
|
||||
HaltReason ArmDynarmic64::StepThread(Kernel::KThread* thread) {
|
||||
m_jit->ClearExclusiveState();
|
||||
return TranslateHaltReason(m_jit->Step());
|
||||
HaltReason ARM_Dynarmic_64::StepJit() {
|
||||
return TranslateHaltReason(jit.load()->Step());
|
||||
}
|
||||
|
||||
u32 ArmDynarmic64::GetSvcNumber() const {
|
||||
return m_svc;
|
||||
u32 ARM_Dynarmic_64::GetSvcNumber() const {
|
||||
return svc_swi;
|
||||
}
|
||||
|
||||
void ArmDynarmic64::GetSvcArguments(std::span<uint64_t, 8> args) const {
|
||||
Dynarmic::A64::Jit& j = *m_jit;
|
||||
const Kernel::DebugWatchpoint* ARM_Dynarmic_64::HaltedWatchpoint() const {
|
||||
return halted_watchpoint;
|
||||
}
|
||||
|
||||
for (size_t i = 0; i < 8; i++) {
|
||||
args[i] = j.GetRegister(i);
|
||||
void ARM_Dynarmic_64::RewindBreakpointInstruction() {
|
||||
LoadContext(breakpoint_context);
|
||||
}
|
||||
|
||||
ARM_Dynarmic_64::ARM_Dynarmic_64(System& system_, bool uses_wall_clock_,
|
||||
DynarmicExclusiveMonitor& exclusive_monitor_,
|
||||
std::size_t core_index_)
|
||||
: ARM_Interface{system_, uses_wall_clock_},
|
||||
cb(std::make_unique<DynarmicCallbacks64>(*this)), core_index{core_index_},
|
||||
exclusive_monitor{exclusive_monitor_}, null_jit{MakeJit(nullptr, 48)}, jit{null_jit.get()} {}
|
||||
|
||||
ARM_Dynarmic_64::~ARM_Dynarmic_64() = default;
|
||||
|
||||
void ARM_Dynarmic_64::SetPC(u64 pc) {
|
||||
jit.load()->SetPC(pc);
|
||||
}
|
||||
|
||||
u64 ARM_Dynarmic_64::GetPC() const {
|
||||
return jit.load()->GetPC();
|
||||
}
|
||||
|
||||
u64 ARM_Dynarmic_64::GetSP() const {
|
||||
return jit.load()->GetSP();
|
||||
}
|
||||
|
||||
u64 ARM_Dynarmic_64::GetReg(int index) const {
|
||||
return jit.load()->GetRegister(index);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::SetReg(int index, u64 value) {
|
||||
jit.load()->SetRegister(index, value);
|
||||
}
|
||||
|
||||
u128 ARM_Dynarmic_64::GetVectorReg(int index) const {
|
||||
return jit.load()->GetVector(index);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::SetVectorReg(int index, u128 value) {
|
||||
jit.load()->SetVector(index, value);
|
||||
}
|
||||
|
||||
u32 ARM_Dynarmic_64::GetPSTATE() const {
|
||||
return jit.load()->GetPstate();
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::SetPSTATE(u32 pstate) {
|
||||
jit.load()->SetPstate(pstate);
|
||||
}
|
||||
|
||||
u64 ARM_Dynarmic_64::GetTlsAddress() const {
|
||||
return cb->tpidrro_el0;
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::SetTlsAddress(u64 address) {
|
||||
cb->tpidrro_el0 = address;
|
||||
}
|
||||
|
||||
u64 ARM_Dynarmic_64::GetTPIDR_EL0() const {
|
||||
return cb->tpidr_el0;
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::SetTPIDR_EL0(u64 value) {
|
||||
cb->tpidr_el0 = value;
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::SaveContext(ThreadContext64& ctx) const {
|
||||
Dynarmic::A64::Jit* j = jit.load();
|
||||
ctx.cpu_registers = j->GetRegisters();
|
||||
ctx.sp = j->GetSP();
|
||||
ctx.pc = j->GetPC();
|
||||
ctx.pstate = j->GetPstate();
|
||||
ctx.vector_registers = j->GetVectors();
|
||||
ctx.fpcr = j->GetFpcr();
|
||||
ctx.fpsr = j->GetFpsr();
|
||||
ctx.tpidr = cb->tpidr_el0;
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::LoadContext(const ThreadContext64& ctx) {
|
||||
Dynarmic::A64::Jit* j = jit.load();
|
||||
j->SetRegisters(ctx.cpu_registers);
|
||||
j->SetSP(ctx.sp);
|
||||
j->SetPC(ctx.pc);
|
||||
j->SetPstate(ctx.pstate);
|
||||
j->SetVectors(ctx.vector_registers);
|
||||
j->SetFpcr(ctx.fpcr);
|
||||
j->SetFpsr(ctx.fpsr);
|
||||
SetTPIDR_EL0(ctx.tpidr);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::SignalInterrupt() {
|
||||
jit.load()->HaltExecution(BreakLoop);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::ClearInterrupt() {
|
||||
jit.load()->ClearHalt(BreakLoop);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::ClearInstructionCache() {
|
||||
jit.load()->ClearCache();
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::InvalidateCacheRange(u64 addr, std::size_t size) {
|
||||
jit.load()->InvalidateCacheRange(addr, size);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::ClearExclusiveState() {
|
||||
jit.load()->ClearExclusiveState();
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::PageTableChanged(Common::PageTable& page_table,
|
||||
std::size_t new_address_space_size_in_bits) {
|
||||
ThreadContext64 ctx{};
|
||||
SaveContext(ctx);
|
||||
|
||||
auto key = std::make_pair(&page_table, new_address_space_size_in_bits);
|
||||
auto iter = jit_cache.find(key);
|
||||
if (iter != jit_cache.end()) {
|
||||
jit.store(iter->second.get());
|
||||
LoadContext(ctx);
|
||||
return;
|
||||
}
|
||||
}
|
||||
|
||||
void ArmDynarmic64::SetSvcArguments(std::span<const uint64_t, 8> args) {
|
||||
Dynarmic::A64::Jit& j = *m_jit;
|
||||
|
||||
for (size_t i = 0; i < 8; i++) {
|
||||
j.SetRegister(i, args[i]);
|
||||
}
|
||||
}
|
||||
|
||||
const Kernel::DebugWatchpoint* ArmDynarmic64::HaltedWatchpoint() const {
|
||||
return m_halted_watchpoint;
|
||||
}
|
||||
|
||||
void ArmDynarmic64::RewindBreakpointInstruction() {
|
||||
this->SetContext(m_breakpoint_context);
|
||||
}
|
||||
|
||||
ArmDynarmic64::ArmDynarmic64(System& system, bool uses_wall_clock, const Kernel::KProcess* process,
|
||||
DynarmicExclusiveMonitor& exclusive_monitor, std::size_t core_index)
|
||||
: ArmInterface{uses_wall_clock}, m_system{system}, m_exclusive_monitor{exclusive_monitor},
|
||||
m_cb(std::make_unique<DynarmicCallbacks64>(*this, process)), m_core_index{core_index} {
|
||||
auto& page_table = process->GetPageTable().GetBasePageTable();
|
||||
auto& page_table_impl = page_table.GetImpl();
|
||||
m_jit = MakeJit(&page_table_impl, page_table.GetAddressSpaceWidth());
|
||||
}
|
||||
|
||||
ArmDynarmic64::~ArmDynarmic64() = default;
|
||||
|
||||
void ArmDynarmic64::SetTpidrroEl0(u64 value) {
|
||||
m_cb->m_tpidrro_el0 = value;
|
||||
}
|
||||
|
||||
void ArmDynarmic64::GetContext(Kernel::Svc::ThreadContext& ctx) const {
|
||||
Dynarmic::A64::Jit& j = *m_jit;
|
||||
auto gpr = j.GetRegisters();
|
||||
auto fpr = j.GetVectors();
|
||||
|
||||
// TODO: this is inconvenient
|
||||
for (size_t i = 0; i < 29; i++) {
|
||||
ctx.r[i] = gpr[i];
|
||||
}
|
||||
ctx.fp = gpr[29];
|
||||
ctx.lr = gpr[30];
|
||||
|
||||
ctx.sp = j.GetSP();
|
||||
ctx.pc = j.GetPC();
|
||||
ctx.pstate = j.GetPstate();
|
||||
ctx.v = fpr;
|
||||
ctx.fpcr = j.GetFpcr();
|
||||
ctx.fpsr = j.GetFpsr();
|
||||
ctx.tpidr = m_cb->m_tpidr_el0;
|
||||
}
|
||||
|
||||
void ArmDynarmic64::SetContext(const Kernel::Svc::ThreadContext& ctx) {
|
||||
Dynarmic::A64::Jit& j = *m_jit;
|
||||
|
||||
// TODO: this is inconvenient
|
||||
std::array<u64, 31> gpr;
|
||||
|
||||
for (size_t i = 0; i < 29; i++) {
|
||||
gpr[i] = ctx.r[i];
|
||||
}
|
||||
gpr[29] = ctx.fp;
|
||||
gpr[30] = ctx.lr;
|
||||
|
||||
j.SetRegisters(gpr);
|
||||
j.SetSP(ctx.sp);
|
||||
j.SetPC(ctx.pc);
|
||||
j.SetPstate(ctx.pstate);
|
||||
j.SetVectors(ctx.v);
|
||||
j.SetFpcr(ctx.fpcr);
|
||||
j.SetFpsr(ctx.fpsr);
|
||||
m_cb->m_tpidr_el0 = ctx.tpidr;
|
||||
}
|
||||
|
||||
void ArmDynarmic64::SignalInterrupt(Kernel::KThread* thread) {
|
||||
m_jit->HaltExecution(BreakLoop);
|
||||
}
|
||||
|
||||
void ArmDynarmic64::ClearInstructionCache() {
|
||||
m_jit->ClearCache();
|
||||
}
|
||||
|
||||
void ArmDynarmic64::InvalidateCacheRange(u64 addr, std::size_t size) {
|
||||
m_jit->InvalidateCacheRange(addr, size);
|
||||
std::shared_ptr new_jit = MakeJit(&page_table, new_address_space_size_in_bits);
|
||||
jit.store(new_jit.get());
|
||||
LoadContext(ctx);
|
||||
jit_cache.emplace(key, std::move(new_jit));
|
||||
}
|
||||
|
||||
} // namespace Core
|
||||
|
||||
@@ -23,55 +23,76 @@ class DynarmicCallbacks64;
|
||||
class DynarmicExclusiveMonitor;
|
||||
class System;
|
||||
|
||||
class ArmDynarmic64 final : public ArmInterface {
|
||||
class ARM_Dynarmic_64 final : public ARM_Interface {
|
||||
public:
|
||||
ArmDynarmic64(System& system, bool uses_wall_clock, const Kernel::KProcess* process,
|
||||
DynarmicExclusiveMonitor& exclusive_monitor, std::size_t core_index);
|
||||
~ArmDynarmic64() override;
|
||||
ARM_Dynarmic_64(System& system_, bool uses_wall_clock_,
|
||||
DynarmicExclusiveMonitor& exclusive_monitor_, std::size_t core_index_);
|
||||
~ARM_Dynarmic_64() override;
|
||||
|
||||
void SetPC(u64 pc) override;
|
||||
u64 GetPC() const override;
|
||||
u64 GetSP() const override;
|
||||
u64 GetReg(int index) const override;
|
||||
void SetReg(int index, u64 value) override;
|
||||
u128 GetVectorReg(int index) const override;
|
||||
void SetVectorReg(int index, u128 value) override;
|
||||
u32 GetPSTATE() const override;
|
||||
void SetPSTATE(u32 pstate) override;
|
||||
u64 GetTlsAddress() const override;
|
||||
void SetTlsAddress(u64 address) override;
|
||||
void SetTPIDR_EL0(u64 value) override;
|
||||
u64 GetTPIDR_EL0() const override;
|
||||
|
||||
Architecture GetArchitecture() const override {
|
||||
return Architecture::AArch64;
|
||||
return Architecture::Aarch64;
|
||||
}
|
||||
void SaveContext(ThreadContext32& ctx) const override {}
|
||||
void SaveContext(ThreadContext64& ctx) const override;
|
||||
void LoadContext(const ThreadContext32& ctx) override {}
|
||||
void LoadContext(const ThreadContext64& ctx) override;
|
||||
|
||||
HaltReason RunThread(Kernel::KThread* thread) override;
|
||||
HaltReason StepThread(Kernel::KThread* thread) override;
|
||||
void SignalInterrupt() override;
|
||||
void ClearInterrupt() override;
|
||||
void ClearExclusiveState() override;
|
||||
|
||||
void GetContext(Kernel::Svc::ThreadContext& ctx) const override;
|
||||
void SetContext(const Kernel::Svc::ThreadContext& ctx) override;
|
||||
void SetTpidrroEl0(u64 value) override;
|
||||
|
||||
void GetSvcArguments(std::span<uint64_t, 8> args) const override;
|
||||
void SetSvcArguments(std::span<const uint64_t, 8> args) override;
|
||||
u32 GetSvcNumber() const override;
|
||||
|
||||
void SignalInterrupt(Kernel::KThread* thread) override;
|
||||
void ClearInstructionCache() override;
|
||||
void InvalidateCacheRange(u64 addr, std::size_t size) override;
|
||||
void PageTableChanged(Common::PageTable& new_page_table,
|
||||
std::size_t new_address_space_size_in_bits) override;
|
||||
|
||||
protected:
|
||||
HaltReason RunJit() override;
|
||||
HaltReason StepJit() override;
|
||||
u32 GetSvcNumber() const override;
|
||||
const Kernel::DebugWatchpoint* HaltedWatchpoint() const override;
|
||||
void RewindBreakpointInstruction() override;
|
||||
|
||||
private:
|
||||
System& m_system;
|
||||
DynarmicExclusiveMonitor& m_exclusive_monitor;
|
||||
|
||||
private:
|
||||
friend class DynarmicCallbacks64;
|
||||
|
||||
std::shared_ptr<Dynarmic::A64::Jit> MakeJit(Common::PageTable* page_table,
|
||||
std::size_t address_space_bits) const;
|
||||
std::unique_ptr<DynarmicCallbacks64> m_cb{};
|
||||
std::size_t m_core_index{};
|
||||
|
||||
std::shared_ptr<Dynarmic::A64::Jit> m_jit{};
|
||||
using JitCacheKey = std::pair<Common::PageTable*, std::size_t>;
|
||||
using JitCacheType =
|
||||
std::unordered_map<JitCacheKey, std::shared_ptr<Dynarmic::A64::Jit>, Common::PairHash>;
|
||||
|
||||
friend class DynarmicCallbacks64;
|
||||
std::unique_ptr<DynarmicCallbacks64> cb;
|
||||
JitCacheType jit_cache;
|
||||
|
||||
std::size_t core_index;
|
||||
DynarmicExclusiveMonitor& exclusive_monitor;
|
||||
|
||||
std::shared_ptr<Dynarmic::A64::Jit> null_jit;
|
||||
|
||||
// A raw pointer here is fine; we never delete Jit instances.
|
||||
std::atomic<Dynarmic::A64::Jit*> jit;
|
||||
|
||||
// SVC callback
|
||||
u32 m_svc{};
|
||||
u32 svc_swi{};
|
||||
|
||||
// Watchpoint info
|
||||
const Kernel::DebugWatchpoint* m_halted_watchpoint{};
|
||||
Kernel::Svc::ThreadContext m_breakpoint_context{};
|
||||
// Breakpoint info
|
||||
const Kernel::DebugWatchpoint* halted_watchpoint;
|
||||
ThreadContext64 breakpoint_context;
|
||||
};
|
||||
|
||||
} // namespace Core
|
||||
|
||||
@@ -124,8 +124,8 @@ CallbackOrAccessTwoWords DynarmicCP15::CompileGetTwoWords(bool two, unsigned opc
|
||||
if (!two && opc == 0 && CRm == CoprocReg::C14) {
|
||||
// CNTPCT
|
||||
const auto callback = [](void* arg, u32, u32) -> u64 {
|
||||
const auto& parent_arg = *static_cast<ArmDynarmic32*>(arg);
|
||||
return parent_arg.m_system.CoreTiming().GetClockTicks();
|
||||
const auto& parent_arg = *static_cast<ARM_Dynarmic_32*>(arg);
|
||||
return parent_arg.system.CoreTiming().GetClockTicks();
|
||||
};
|
||||
return Callback{callback, &parent};
|
||||
}
|
||||
|
||||
@@ -10,13 +10,13 @@
|
||||
|
||||
namespace Core {
|
||||
|
||||
class ArmDynarmic32;
|
||||
class ARM_Dynarmic_32;
|
||||
|
||||
class DynarmicCP15 final : public Dynarmic::A32::Coprocessor {
|
||||
public:
|
||||
using CoprocReg = Dynarmic::A32::CoprocReg;
|
||||
|
||||
explicit DynarmicCP15(ArmDynarmic32& parent_) : parent{parent_} {}
|
||||
explicit DynarmicCP15(ARM_Dynarmic_32& parent_) : parent{parent_} {}
|
||||
|
||||
std::optional<Callback> CompileInternalOperation(bool two, unsigned opc1, CoprocReg CRd,
|
||||
CoprocReg CRn, CoprocReg CRm,
|
||||
@@ -32,11 +32,11 @@ public:
|
||||
std::optional<Callback> CompileStoreWords(bool two, bool long_transfer, CoprocReg CRd,
|
||||
std::optional<u8> option) override;
|
||||
|
||||
ArmDynarmic32& parent;
|
||||
ARM_Dynarmic_32& parent;
|
||||
u32 uprw = 0;
|
||||
u32 uro = 0;
|
||||
|
||||
friend class ArmDynarmic32;
|
||||
friend class ARM_Dynarmic_32;
|
||||
};
|
||||
|
||||
} // namespace Core
|
||||
|
||||
@@ -14,8 +14,8 @@ class Memory;
|
||||
|
||||
namespace Core {
|
||||
|
||||
class ArmDynarmic32;
|
||||
class ArmDynarmic64;
|
||||
class ARM_Dynarmic_32;
|
||||
class ARM_Dynarmic_64;
|
||||
|
||||
class DynarmicExclusiveMonitor final : public ExclusiveMonitor {
|
||||
public:
|
||||
@@ -36,8 +36,8 @@ public:
|
||||
bool ExclusiveWrite128(std::size_t core_index, VAddr vaddr, u128 value) override;
|
||||
|
||||
private:
|
||||
friend class ArmDynarmic32;
|
||||
friend class ArmDynarmic64;
|
||||
friend class ARM_Dynarmic_32;
|
||||
friend class ARM_Dynarmic_64;
|
||||
Dynarmic::ExclusiveMonitor monitor;
|
||||
Core::Memory::Memory& memory;
|
||||
};
|
||||
|
||||
@@ -6,7 +6,6 @@
|
||||
|
||||
#include "common/signal_chain.h"
|
||||
#include "core/arm/nce/arm_nce.h"
|
||||
#include "core/arm/nce/guest_context.h"
|
||||
#include "core/arm/nce/patcher.h"
|
||||
#include "core/core.h"
|
||||
#include "core/memory.h"
|
||||
@@ -39,7 +38,7 @@ fpsimd_context* GetFloatingPointState(mcontext_t& host_ctx) {
|
||||
|
||||
} // namespace
|
||||
|
||||
void* ArmNce::RestoreGuestContext(void* raw_context) {
|
||||
void* ARM_NCE::RestoreGuestContext(void* raw_context) {
|
||||
// Retrieve the host context.
|
||||
auto& host_ctx = static_cast<ucontext_t*>(raw_context)->uc_mcontext;
|
||||
|
||||
@@ -72,7 +71,7 @@ void* ArmNce::RestoreGuestContext(void* raw_context) {
|
||||
return tpidr;
|
||||
}
|
||||
|
||||
void ArmNce::SaveGuestContext(GuestContext* guest_ctx, void* raw_context) {
|
||||
void ARM_NCE::SaveGuestContext(GuestContext* guest_ctx, void* raw_context) {
|
||||
// Retrieve the host context.
|
||||
auto& host_ctx = static_cast<ucontext_t*>(raw_context)->uc_mcontext;
|
||||
|
||||
@@ -104,7 +103,7 @@ void ArmNce::SaveGuestContext(GuestContext* guest_ctx, void* raw_context) {
|
||||
host_ctx.regs[0] = guest_ctx->esr_el1.exchange(0);
|
||||
}
|
||||
|
||||
bool ArmNce::HandleGuestFault(GuestContext* guest_ctx, void* raw_info, void* raw_context) {
|
||||
bool ARM_NCE::HandleGuestFault(GuestContext* guest_ctx, void* raw_info, void* raw_context) {
|
||||
auto& host_ctx = static_cast<ucontext_t*>(raw_context)->uc_mcontext;
|
||||
auto* info = static_cast<siginfo_t*>(raw_info);
|
||||
|
||||
@@ -135,7 +134,7 @@ bool ArmNce::HandleGuestFault(GuestContext* guest_ctx, void* raw_info, void* raw
|
||||
// - If we lose the race, then SignalInterrupt will send us a signal we are masking,
|
||||
// and it will do nothing when it is unmasked, as we have already left guest code.
|
||||
// - If we win the race, then SignalInterrupt will wait for us to unlock first.
|
||||
auto& thread_params = guest_ctx->parent->m_running_thread->GetNativeExecutionParameters();
|
||||
auto& thread_params = guest_ctx->parent->running_thread->GetNativeExecutionParameters();
|
||||
thread_params.lock.store(SpinLockLocked);
|
||||
|
||||
// Return to host.
|
||||
@@ -143,93 +142,97 @@ bool ArmNce::HandleGuestFault(GuestContext* guest_ctx, void* raw_info, void* raw
|
||||
return false;
|
||||
}
|
||||
|
||||
void ArmNce::HandleHostFault(int sig, void* raw_info, void* raw_context) {
|
||||
void ARM_NCE::HandleHostFault(int sig, void* raw_info, void* raw_context) {
|
||||
return g_orig_action.sa_sigaction(sig, static_cast<siginfo_t*>(raw_info), raw_context);
|
||||
}
|
||||
|
||||
void ArmNce::LockThread(Kernel::KThread* thread) {
|
||||
HaltReason ARM_NCE::RunJit() {
|
||||
// Get the thread parameters.
|
||||
// TODO: pass the current thread down from ::Run
|
||||
auto* thread = Kernel::GetCurrentThreadPointer(system.Kernel());
|
||||
auto* thread_params = &thread->GetNativeExecutionParameters();
|
||||
LockThreadParameters(thread_params);
|
||||
}
|
||||
|
||||
void ArmNce::UnlockThread(Kernel::KThread* thread) {
|
||||
auto* thread_params = &thread->GetNativeExecutionParameters();
|
||||
UnlockThreadParameters(thread_params);
|
||||
}
|
||||
{
|
||||
// Lock our core context.
|
||||
std::scoped_lock lk{lock};
|
||||
|
||||
HaltReason ArmNce::RunThread(Kernel::KThread* thread) {
|
||||
// Check if we're already interrupted.
|
||||
// If we are, we can just return immediately.
|
||||
HaltReason hr = static_cast<HaltReason>(m_guest_ctx.esr_el1.exchange(0));
|
||||
if (True(hr)) {
|
||||
return hr;
|
||||
// We should not be running.
|
||||
ASSERT(running_thread == nullptr);
|
||||
|
||||
// Check if we need to run. If we have already been halted, we are done.
|
||||
u64 halt = guest_ctx.esr_el1.exchange(0);
|
||||
if (halt != 0) {
|
||||
return static_cast<HaltReason>(halt);
|
||||
}
|
||||
|
||||
// Mark that we are running.
|
||||
running_thread = thread;
|
||||
|
||||
// Acquire the lock on the thread parameters.
|
||||
// This allows us to force synchronization with SignalInterrupt.
|
||||
LockThreadParameters(thread_params);
|
||||
}
|
||||
|
||||
// Get the thread context.
|
||||
auto* thread_params = &thread->GetNativeExecutionParameters();
|
||||
auto* process = thread->GetOwnerProcess();
|
||||
|
||||
// Assign current members.
|
||||
m_running_thread = thread;
|
||||
m_guest_ctx.parent = this;
|
||||
thread_params->native_context = &m_guest_ctx;
|
||||
thread_params->tpidr_el0 = m_guest_ctx.tpidr_el0;
|
||||
thread_params->tpidrro_el0 = m_guest_ctx.tpidrro_el0;
|
||||
guest_ctx.parent = this;
|
||||
thread_params->native_context = &guest_ctx;
|
||||
thread_params->tpidr_el0 = guest_ctx.tpidr_el0;
|
||||
thread_params->tpidrro_el0 = guest_ctx.tpidrro_el0;
|
||||
thread_params->is_running = true;
|
||||
|
||||
HaltReason halt{};
|
||||
|
||||
// TODO: finding and creating the post handler needs to be locked
|
||||
// to deal with dynamic loading of NROs.
|
||||
const auto& post_handlers = process->GetPostHandlers();
|
||||
if (auto it = post_handlers.find(m_guest_ctx.pc); it != post_handlers.end()) {
|
||||
hr = ReturnToRunCodeByTrampoline(thread_params, &m_guest_ctx, it->second);
|
||||
const auto& post_handlers = system.ApplicationProcess()->GetPostHandlers();
|
||||
if (auto it = post_handlers.find(guest_ctx.pc); it != post_handlers.end()) {
|
||||
halt = ReturnToRunCodeByTrampoline(thread_params, &guest_ctx, it->second);
|
||||
} else {
|
||||
hr = ReturnToRunCodeByExceptionLevelChange(m_thread_id, thread_params);
|
||||
halt = ReturnToRunCodeByExceptionLevelChange(thread_id, thread_params);
|
||||
}
|
||||
|
||||
// Unload members.
|
||||
// The thread does not change, so we can persist the old reference.
|
||||
m_running_thread = nullptr;
|
||||
m_guest_ctx.tpidr_el0 = thread_params->tpidr_el0;
|
||||
guest_ctx.tpidr_el0 = thread_params->tpidr_el0;
|
||||
thread_params->native_context = nullptr;
|
||||
thread_params->is_running = false;
|
||||
|
||||
// Unlock the thread parameters.
|
||||
UnlockThreadParameters(thread_params);
|
||||
|
||||
{
|
||||
// Lock the core context.
|
||||
std::scoped_lock lk{lock};
|
||||
|
||||
// On exit, we no longer have an active thread.
|
||||
running_thread = nullptr;
|
||||
}
|
||||
|
||||
// Return the halt reason.
|
||||
return hr;
|
||||
return halt;
|
||||
}
|
||||
|
||||
HaltReason ArmNce::StepThread(Kernel::KThread* thread) {
|
||||
HaltReason ARM_NCE::StepJit() {
|
||||
return HaltReason::StepThread;
|
||||
}
|
||||
|
||||
u32 ArmNce::GetSvcNumber() const {
|
||||
return m_guest_ctx.svc;
|
||||
u32 ARM_NCE::GetSvcNumber() const {
|
||||
return guest_ctx.svc_swi;
|
||||
}
|
||||
|
||||
void ArmNce::GetSvcArguments(std::span<uint64_t, 8> args) const {
|
||||
for (size_t i = 0; i < 8; i++) {
|
||||
args[i] = m_guest_ctx.cpu_registers[i];
|
||||
}
|
||||
ARM_NCE::ARM_NCE(System& system_, bool uses_wall_clock_, std::size_t core_index_)
|
||||
: ARM_Interface{system_, uses_wall_clock_}, core_index{core_index_} {
|
||||
guest_ctx.system = &system_;
|
||||
}
|
||||
|
||||
void ArmNce::SetSvcArguments(std::span<const uint64_t, 8> args) {
|
||||
for (size_t i = 0; i < 8; i++) {
|
||||
m_guest_ctx.cpu_registers[i] = args[i];
|
||||
}
|
||||
}
|
||||
ARM_NCE::~ARM_NCE() = default;
|
||||
|
||||
ArmNce::ArmNce(System& system, bool uses_wall_clock, std::size_t core_index)
|
||||
: ArmInterface{uses_wall_clock}, m_system{system}, m_core_index{core_index} {
|
||||
m_guest_ctx.system = &m_system;
|
||||
}
|
||||
|
||||
ArmNce::~ArmNce() = default;
|
||||
|
||||
void ArmNce::Initialize() {
|
||||
m_thread_id = gettid();
|
||||
void ARM_NCE::Initialize() {
|
||||
thread_id = gettid();
|
||||
|
||||
// Setup our signals
|
||||
static std::once_flag signals;
|
||||
std::call_once(signals, [] {
|
||||
static std::once_flag flag;
|
||||
std::call_once(flag, [] {
|
||||
using HandlerType = decltype(sigaction::sa_sigaction);
|
||||
|
||||
sigset_t signal_mask;
|
||||
@@ -241,7 +244,7 @@ void ArmNce::Initialize() {
|
||||
struct sigaction return_to_run_code_action {};
|
||||
return_to_run_code_action.sa_flags = SA_SIGINFO | SA_ONSTACK;
|
||||
return_to_run_code_action.sa_sigaction = reinterpret_cast<HandlerType>(
|
||||
&ArmNce::ReturnToRunCodeByExceptionLevelChangeSignalHandler);
|
||||
&ARM_NCE::ReturnToRunCodeByExceptionLevelChangeSignalHandler);
|
||||
return_to_run_code_action.sa_mask = signal_mask;
|
||||
Common::SigAction(ReturnToRunCodeByExceptionLevelChangeSignal, &return_to_run_code_action,
|
||||
nullptr);
|
||||
@@ -249,13 +252,14 @@ void ArmNce::Initialize() {
|
||||
struct sigaction break_from_run_code_action {};
|
||||
break_from_run_code_action.sa_flags = SA_SIGINFO | SA_ONSTACK;
|
||||
break_from_run_code_action.sa_sigaction =
|
||||
reinterpret_cast<HandlerType>(&ArmNce::BreakFromRunCodeSignalHandler);
|
||||
reinterpret_cast<HandlerType>(&ARM_NCE::BreakFromRunCodeSignalHandler);
|
||||
break_from_run_code_action.sa_mask = signal_mask;
|
||||
Common::SigAction(BreakFromRunCodeSignal, &break_from_run_code_action, nullptr);
|
||||
|
||||
struct sigaction fault_action {};
|
||||
fault_action.sa_flags = SA_SIGINFO | SA_ONSTACK | SA_RESTART;
|
||||
fault_action.sa_sigaction = reinterpret_cast<HandlerType>(&ArmNce::GuestFaultSignalHandler);
|
||||
fault_action.sa_sigaction =
|
||||
reinterpret_cast<HandlerType>(&ARM_NCE::GuestFaultSignalHandler);
|
||||
fault_action.sa_mask = signal_mask;
|
||||
Common::SigAction(GuestFaultSignal, &fault_action, &g_orig_action);
|
||||
|
||||
@@ -268,59 +272,111 @@ void ArmNce::Initialize() {
|
||||
});
|
||||
}
|
||||
|
||||
void ArmNce::SetTpidrroEl0(u64 value) {
|
||||
m_guest_ctx.tpidrro_el0 = value;
|
||||
void ARM_NCE::SetPC(u64 pc) {
|
||||
guest_ctx.pc = pc;
|
||||
}
|
||||
|
||||
void ArmNce::GetContext(Kernel::Svc::ThreadContext& ctx) const {
|
||||
for (size_t i = 0; i < 29; i++) {
|
||||
ctx.r[i] = m_guest_ctx.cpu_registers[i];
|
||||
}
|
||||
ctx.fp = m_guest_ctx.cpu_registers[29];
|
||||
ctx.lr = m_guest_ctx.cpu_registers[30];
|
||||
ctx.sp = m_guest_ctx.sp;
|
||||
ctx.pc = m_guest_ctx.pc;
|
||||
ctx.pstate = m_guest_ctx.pstate;
|
||||
ctx.v = m_guest_ctx.vector_registers;
|
||||
ctx.fpcr = m_guest_ctx.fpcr;
|
||||
ctx.fpsr = m_guest_ctx.fpsr;
|
||||
ctx.tpidr = m_guest_ctx.tpidr_el0;
|
||||
u64 ARM_NCE::GetPC() const {
|
||||
return guest_ctx.pc;
|
||||
}
|
||||
|
||||
void ArmNce::SetContext(const Kernel::Svc::ThreadContext& ctx) {
|
||||
for (size_t i = 0; i < 29; i++) {
|
||||
m_guest_ctx.cpu_registers[i] = ctx.r[i];
|
||||
}
|
||||
m_guest_ctx.cpu_registers[29] = ctx.fp;
|
||||
m_guest_ctx.cpu_registers[30] = ctx.lr;
|
||||
m_guest_ctx.sp = ctx.sp;
|
||||
m_guest_ctx.pc = ctx.pc;
|
||||
m_guest_ctx.pstate = ctx.pstate;
|
||||
m_guest_ctx.vector_registers = ctx.v;
|
||||
m_guest_ctx.fpcr = ctx.fpcr;
|
||||
m_guest_ctx.fpsr = ctx.fpsr;
|
||||
m_guest_ctx.tpidr_el0 = ctx.tpidr;
|
||||
u64 ARM_NCE::GetSP() const {
|
||||
return guest_ctx.sp;
|
||||
}
|
||||
|
||||
void ArmNce::SignalInterrupt(Kernel::KThread* thread) {
|
||||
u64 ARM_NCE::GetReg(int index) const {
|
||||
return guest_ctx.cpu_registers[index];
|
||||
}
|
||||
|
||||
void ARM_NCE::SetReg(int index, u64 value) {
|
||||
guest_ctx.cpu_registers[index] = value;
|
||||
}
|
||||
|
||||
u128 ARM_NCE::GetVectorReg(int index) const {
|
||||
return guest_ctx.vector_registers[index];
|
||||
}
|
||||
|
||||
void ARM_NCE::SetVectorReg(int index, u128 value) {
|
||||
guest_ctx.vector_registers[index] = value;
|
||||
}
|
||||
|
||||
u32 ARM_NCE::GetPSTATE() const {
|
||||
return guest_ctx.pstate;
|
||||
}
|
||||
|
||||
void ARM_NCE::SetPSTATE(u32 pstate) {
|
||||
guest_ctx.pstate = pstate;
|
||||
}
|
||||
|
||||
u64 ARM_NCE::GetTlsAddress() const {
|
||||
return guest_ctx.tpidrro_el0;
|
||||
}
|
||||
|
||||
void ARM_NCE::SetTlsAddress(u64 address) {
|
||||
guest_ctx.tpidrro_el0 = address;
|
||||
}
|
||||
|
||||
u64 ARM_NCE::GetTPIDR_EL0() const {
|
||||
return guest_ctx.tpidr_el0;
|
||||
}
|
||||
|
||||
void ARM_NCE::SetTPIDR_EL0(u64 value) {
|
||||
guest_ctx.tpidr_el0 = value;
|
||||
}
|
||||
|
||||
void ARM_NCE::SaveContext(ThreadContext64& ctx) const {
|
||||
ctx.cpu_registers = guest_ctx.cpu_registers;
|
||||
ctx.sp = guest_ctx.sp;
|
||||
ctx.pc = guest_ctx.pc;
|
||||
ctx.pstate = guest_ctx.pstate;
|
||||
ctx.vector_registers = guest_ctx.vector_registers;
|
||||
ctx.fpcr = guest_ctx.fpcr;
|
||||
ctx.fpsr = guest_ctx.fpsr;
|
||||
ctx.tpidr = guest_ctx.tpidr_el0;
|
||||
}
|
||||
|
||||
void ARM_NCE::LoadContext(const ThreadContext64& ctx) {
|
||||
guest_ctx.cpu_registers = ctx.cpu_registers;
|
||||
guest_ctx.sp = ctx.sp;
|
||||
guest_ctx.pc = ctx.pc;
|
||||
guest_ctx.pstate = ctx.pstate;
|
||||
guest_ctx.vector_registers = ctx.vector_registers;
|
||||
guest_ctx.fpcr = ctx.fpcr;
|
||||
guest_ctx.fpsr = ctx.fpsr;
|
||||
guest_ctx.tpidr_el0 = ctx.tpidr;
|
||||
}
|
||||
|
||||
void ARM_NCE::SignalInterrupt() {
|
||||
// Lock core context.
|
||||
std::scoped_lock lk{lock};
|
||||
|
||||
// Add break loop condition.
|
||||
m_guest_ctx.esr_el1.fetch_or(static_cast<u64>(HaltReason::BreakLoop));
|
||||
guest_ctx.esr_el1.fetch_or(static_cast<u64>(HaltReason::BreakLoop));
|
||||
|
||||
// If there is no thread running, we are done.
|
||||
if (running_thread == nullptr) {
|
||||
return;
|
||||
}
|
||||
|
||||
// Lock the thread context.
|
||||
auto* params = &thread->GetNativeExecutionParameters();
|
||||
auto* params = &running_thread->GetNativeExecutionParameters();
|
||||
LockThreadParameters(params);
|
||||
|
||||
if (params->is_running) {
|
||||
// We should signal to the running thread.
|
||||
// The running thread will unlock the thread context.
|
||||
syscall(SYS_tkill, m_thread_id, BreakFromRunCodeSignal);
|
||||
syscall(SYS_tkill, thread_id, BreakFromRunCodeSignal);
|
||||
} else {
|
||||
// If the thread is no longer running, we have nothing to do.
|
||||
UnlockThreadParameters(params);
|
||||
}
|
||||
}
|
||||
|
||||
void ArmNce::ClearInstructionCache() {
|
||||
void ARM_NCE::ClearInterrupt() {
|
||||
guest_ctx.esr_el1 = {};
|
||||
}
|
||||
|
||||
void ARM_NCE::ClearInstructionCache() {
|
||||
// TODO: This is not possible to implement correctly on Linux because
|
||||
// we do not have any access to ic iallu.
|
||||
|
||||
@@ -328,8 +384,17 @@ void ArmNce::ClearInstructionCache() {
|
||||
std::atomic_thread_fence(std::memory_order_seq_cst);
|
||||
}
|
||||
|
||||
void ArmNce::InvalidateCacheRange(u64 addr, std::size_t size) {
|
||||
void ARM_NCE::InvalidateCacheRange(u64 addr, std::size_t size) {
|
||||
this->ClearInstructionCache();
|
||||
}
|
||||
|
||||
void ARM_NCE::ClearExclusiveState() {
|
||||
// No-op.
|
||||
}
|
||||
|
||||
void ARM_NCE::PageTableChanged(Common::PageTable& page_table,
|
||||
std::size_t new_address_space_size_in_bits) {
|
||||
// No-op. Page table is never used.
|
||||
}
|
||||
|
||||
} // namespace Core
|
||||
|
||||
@@ -3,7 +3,11 @@
|
||||
|
||||
#pragma once
|
||||
|
||||
#include <mutex>
|
||||
#include <atomic>
|
||||
#include <memory>
|
||||
#include <span>
|
||||
#include <unordered_map>
|
||||
#include <vector>
|
||||
|
||||
#include "core/arm/arm_interface.h"
|
||||
#include "core/arm/nce/guest_context.h"
|
||||
@@ -16,36 +20,51 @@ namespace Core {
|
||||
|
||||
class System;
|
||||
|
||||
class ArmNce final : public ArmInterface {
|
||||
class ARM_NCE final : public ARM_Interface {
|
||||
public:
|
||||
ArmNce(System& system, bool uses_wall_clock, std::size_t core_index);
|
||||
~ArmNce() override;
|
||||
ARM_NCE(System& system_, bool uses_wall_clock_, std::size_t core_index_);
|
||||
|
||||
~ARM_NCE() override;
|
||||
|
||||
void Initialize() override;
|
||||
void SetPC(u64 pc) override;
|
||||
u64 GetPC() const override;
|
||||
u64 GetSP() const override;
|
||||
u64 GetReg(int index) const override;
|
||||
void SetReg(int index, u64 value) override;
|
||||
u128 GetVectorReg(int index) const override;
|
||||
void SetVectorReg(int index, u128 value) override;
|
||||
|
||||
u32 GetPSTATE() const override;
|
||||
void SetPSTATE(u32 pstate) override;
|
||||
u64 GetTlsAddress() const override;
|
||||
void SetTlsAddress(u64 address) override;
|
||||
void SetTPIDR_EL0(u64 value) override;
|
||||
u64 GetTPIDR_EL0() const override;
|
||||
|
||||
Architecture GetArchitecture() const override {
|
||||
return Architecture::AArch64;
|
||||
return Architecture::Aarch64;
|
||||
}
|
||||
|
||||
HaltReason RunThread(Kernel::KThread* thread) override;
|
||||
HaltReason StepThread(Kernel::KThread* thread) override;
|
||||
void SaveContext(ThreadContext32& ctx) const override {}
|
||||
void SaveContext(ThreadContext64& ctx) const override;
|
||||
void LoadContext(const ThreadContext32& ctx) override {}
|
||||
void LoadContext(const ThreadContext64& ctx) override;
|
||||
|
||||
void GetContext(Kernel::Svc::ThreadContext& ctx) const override;
|
||||
void SetContext(const Kernel::Svc::ThreadContext& ctx) override;
|
||||
void SetTpidrroEl0(u64 value) override;
|
||||
|
||||
void GetSvcArguments(std::span<uint64_t, 8> args) const override;
|
||||
void SetSvcArguments(std::span<const uint64_t, 8> args) override;
|
||||
u32 GetSvcNumber() const override;
|
||||
|
||||
void SignalInterrupt(Kernel::KThread* thread) override;
|
||||
void SignalInterrupt() override;
|
||||
void ClearInterrupt() override;
|
||||
void ClearExclusiveState() override;
|
||||
void ClearInstructionCache() override;
|
||||
void InvalidateCacheRange(u64 addr, std::size_t size) override;
|
||||
|
||||
void LockThread(Kernel::KThread* thread) override;
|
||||
void UnlockThread(Kernel::KThread* thread) override;
|
||||
void PageTableChanged(Common::PageTable& new_page_table,
|
||||
std::size_t new_address_space_size_in_bits) override;
|
||||
|
||||
protected:
|
||||
HaltReason RunJit() override;
|
||||
HaltReason StepJit() override;
|
||||
|
||||
u32 GetSvcNumber() const override;
|
||||
|
||||
const Kernel::DebugWatchpoint* HaltedWatchpoint() const override {
|
||||
return nullptr;
|
||||
}
|
||||
@@ -74,15 +93,16 @@ private:
|
||||
static void HandleHostFault(int sig, void* info, void* raw_context);
|
||||
|
||||
public:
|
||||
Core::System& m_system;
|
||||
|
||||
// Members set on initialization.
|
||||
std::size_t m_core_index{};
|
||||
pid_t m_thread_id{-1};
|
||||
std::size_t core_index{};
|
||||
pid_t thread_id{-1};
|
||||
|
||||
// Core context.
|
||||
GuestContext m_guest_ctx{};
|
||||
Kernel::KThread* m_running_thread{};
|
||||
GuestContext guest_ctx;
|
||||
|
||||
// Thread and invalidation info.
|
||||
std::mutex lock;
|
||||
Kernel::KThread* running_thread{};
|
||||
};
|
||||
|
||||
} // namespace Core
|
||||
|
||||
@@ -8,11 +8,11 @@
|
||||
movk reg, #(((val) >> 0x10) & 0xFFFF), lsl #16
|
||||
|
||||
|
||||
/* static HaltReason Core::ArmNce::ReturnToRunCodeByTrampoline(void* tpidr, Core::GuestContext* ctx, u64 trampoline_addr) */
|
||||
.section .text._ZN4Core6ArmNce27ReturnToRunCodeByTrampolineEPvPNS_12GuestContextEm, "ax", %progbits
|
||||
.global _ZN4Core6ArmNce27ReturnToRunCodeByTrampolineEPvPNS_12GuestContextEm
|
||||
.type _ZN4Core6ArmNce27ReturnToRunCodeByTrampolineEPvPNS_12GuestContextEm, %function
|
||||
_ZN4Core6ArmNce27ReturnToRunCodeByTrampolineEPvPNS_12GuestContextEm:
|
||||
/* static HaltReason Core::ARM_NCE::ReturnToRunCodeByTrampoline(void* tpidr, Core::GuestContext* ctx, u64 trampoline_addr) */
|
||||
.section .text._ZN4Core7ARM_NCE27ReturnToRunCodeByTrampolineEPvPNS_12GuestContextEm, "ax", %progbits
|
||||
.global _ZN4Core7ARM_NCE27ReturnToRunCodeByTrampolineEPvPNS_12GuestContextEm
|
||||
.type _ZN4Core7ARM_NCE27ReturnToRunCodeByTrampolineEPvPNS_12GuestContextEm, %function
|
||||
_ZN4Core7ARM_NCE27ReturnToRunCodeByTrampolineEPvPNS_12GuestContextEm:
|
||||
/* Back up host sp to x3. */
|
||||
/* Back up host tpidr_el0 to x4. */
|
||||
mov x3, sp
|
||||
@@ -49,11 +49,11 @@ _ZN4Core6ArmNce27ReturnToRunCodeByTrampolineEPvPNS_12GuestContextEm:
|
||||
br x2
|
||||
|
||||
|
||||
/* static HaltReason Core::ArmNce::ReturnToRunCodeByExceptionLevelChange(int tid, void* tpidr) */
|
||||
.section .text._ZN4Core6ArmNce37ReturnToRunCodeByExceptionLevelChangeEiPv, "ax", %progbits
|
||||
.global _ZN4Core6ArmNce37ReturnToRunCodeByExceptionLevelChangeEiPv
|
||||
.type _ZN4Core6ArmNce37ReturnToRunCodeByExceptionLevelChangeEiPv, %function
|
||||
_ZN4Core6ArmNce37ReturnToRunCodeByExceptionLevelChangeEiPv:
|
||||
/* static HaltReason Core::ARM_NCE::ReturnToRunCodeByExceptionLevelChange(int tid, void* tpidr) */
|
||||
.section .text._ZN4Core7ARM_NCE37ReturnToRunCodeByExceptionLevelChangeEiPv, "ax", %progbits
|
||||
.global _ZN4Core7ARM_NCE37ReturnToRunCodeByExceptionLevelChangeEiPv
|
||||
.type _ZN4Core7ARM_NCE37ReturnToRunCodeByExceptionLevelChangeEiPv, %function
|
||||
_ZN4Core7ARM_NCE37ReturnToRunCodeByExceptionLevelChangeEiPv:
|
||||
/* This jumps to the signal handler, which will restore the entire context. */
|
||||
/* On entry, x0 = thread id, which is already in the right place. */
|
||||
|
||||
@@ -71,17 +71,17 @@ _ZN4Core6ArmNce37ReturnToRunCodeByExceptionLevelChangeEiPv:
|
||||
brk #1000
|
||||
|
||||
|
||||
/* static void Core::ArmNce::ReturnToRunCodeByExceptionLevelChangeSignalHandler(int sig, void* info, void* raw_context) */
|
||||
.section .text._ZN4Core6ArmNce50ReturnToRunCodeByExceptionLevelChangeSignalHandlerEiPvS1_, "ax", %progbits
|
||||
.global _ZN4Core6ArmNce50ReturnToRunCodeByExceptionLevelChangeSignalHandlerEiPvS1_
|
||||
.type _ZN4Core6ArmNce50ReturnToRunCodeByExceptionLevelChangeSignalHandlerEiPvS1_, %function
|
||||
_ZN4Core6ArmNce50ReturnToRunCodeByExceptionLevelChangeSignalHandlerEiPvS1_:
|
||||
/* static void Core::ARM_NCE::ReturnToRunCodeByExceptionLevelChangeSignalHandler(int sig, void* info, void* raw_context) */
|
||||
.section .text._ZN4Core7ARM_NCE50ReturnToRunCodeByExceptionLevelChangeSignalHandlerEiPvS1_, "ax", %progbits
|
||||
.global _ZN4Core7ARM_NCE50ReturnToRunCodeByExceptionLevelChangeSignalHandlerEiPvS1_
|
||||
.type _ZN4Core7ARM_NCE50ReturnToRunCodeByExceptionLevelChangeSignalHandlerEiPvS1_, %function
|
||||
_ZN4Core7ARM_NCE50ReturnToRunCodeByExceptionLevelChangeSignalHandlerEiPvS1_:
|
||||
stp x29, x30, [sp, #-0x10]!
|
||||
mov x29, sp
|
||||
|
||||
/* Call the context restorer with the raw context. */
|
||||
mov x0, x2
|
||||
bl _ZN4Core6ArmNce19RestoreGuestContextEPv
|
||||
bl _ZN4Core7ARM_NCE19RestoreGuestContextEPv
|
||||
|
||||
/* Save the old value of tpidr_el0. */
|
||||
mrs x8, tpidr_el0
|
||||
@@ -92,18 +92,18 @@ _ZN4Core6ArmNce50ReturnToRunCodeByExceptionLevelChangeSignalHandlerEiPvS1_:
|
||||
msr tpidr_el0, x0
|
||||
|
||||
/* Unlock the context. */
|
||||
bl _ZN4Core6ArmNce22UnlockThreadParametersEPv
|
||||
bl _ZN4Core7ARM_NCE22UnlockThreadParametersEPv
|
||||
|
||||
/* Returning from here will enter the guest. */
|
||||
ldp x29, x30, [sp], #0x10
|
||||
ret
|
||||
|
||||
|
||||
/* static void Core::ArmNce::BreakFromRunCodeSignalHandler(int sig, void* info, void* raw_context) */
|
||||
.section .text._ZN4Core6ArmNce29BreakFromRunCodeSignalHandlerEiPvS1_, "ax", %progbits
|
||||
.global _ZN4Core6ArmNce29BreakFromRunCodeSignalHandlerEiPvS1_
|
||||
.type _ZN4Core6ArmNce29BreakFromRunCodeSignalHandlerEiPvS1_, %function
|
||||
_ZN4Core6ArmNce29BreakFromRunCodeSignalHandlerEiPvS1_:
|
||||
/* static void Core::ARM_NCE::BreakFromRunCodeSignalHandler(int sig, void* info, void* raw_context) */
|
||||
.section .text._ZN4Core7ARM_NCE29BreakFromRunCodeSignalHandlerEiPvS1_, "ax", %progbits
|
||||
.global _ZN4Core7ARM_NCE29BreakFromRunCodeSignalHandlerEiPvS1_
|
||||
.type _ZN4Core7ARM_NCE29BreakFromRunCodeSignalHandlerEiPvS1_, %function
|
||||
_ZN4Core7ARM_NCE29BreakFromRunCodeSignalHandlerEiPvS1_:
|
||||
/* Check to see if we have the correct TLS magic. */
|
||||
mrs x8, tpidr_el0
|
||||
ldr w9, [x8, #(TpidrEl0TlsMagic)]
|
||||
@@ -121,7 +121,7 @@ _ZN4Core6ArmNce29BreakFromRunCodeSignalHandlerEiPvS1_:
|
||||
|
||||
/* Tail call the restorer. */
|
||||
mov x1, x2
|
||||
b _ZN4Core6ArmNce16SaveGuestContextEPNS_12GuestContextEPv
|
||||
b _ZN4Core7ARM_NCE16SaveGuestContextEPNS_12GuestContextEPv
|
||||
|
||||
/* Returning from here will enter host code. */
|
||||
|
||||
@@ -130,11 +130,11 @@ _ZN4Core6ArmNce29BreakFromRunCodeSignalHandlerEiPvS1_:
|
||||
ret
|
||||
|
||||
|
||||
/* static void Core::ArmNce::GuestFaultSignalHandler(int sig, void* info, void* raw_context) */
|
||||
.section .text._ZN4Core6ArmNce23GuestFaultSignalHandlerEiPvS1_, "ax", %progbits
|
||||
.global _ZN4Core6ArmNce23GuestFaultSignalHandlerEiPvS1_
|
||||
.type _ZN4Core6ArmNce23GuestFaultSignalHandlerEiPvS1_, %function
|
||||
_ZN4Core6ArmNce23GuestFaultSignalHandlerEiPvS1_:
|
||||
/* static void Core::ARM_NCE::GuestFaultSignalHandler(int sig, void* info, void* raw_context) */
|
||||
.section .text._ZN4Core7ARM_NCE23GuestFaultSignalHandlerEiPvS1_, "ax", %progbits
|
||||
.global _ZN4Core7ARM_NCE23GuestFaultSignalHandlerEiPvS1_
|
||||
.type _ZN4Core7ARM_NCE23GuestFaultSignalHandlerEiPvS1_, %function
|
||||
_ZN4Core7ARM_NCE23GuestFaultSignalHandlerEiPvS1_:
|
||||
/* Check to see if we have the correct TLS magic. */
|
||||
mrs x8, tpidr_el0
|
||||
ldr w9, [x8, #(TpidrEl0TlsMagic)]
|
||||
@@ -146,7 +146,7 @@ _ZN4Core6ArmNce23GuestFaultSignalHandlerEiPvS1_:
|
||||
|
||||
/* Incorrect TLS magic, so this is a host fault. */
|
||||
/* Tail call the handler. */
|
||||
b _ZN4Core6ArmNce15HandleHostFaultEiPvS1_
|
||||
b _ZN4Core7ARM_NCE15HandleHostFaultEiPvS1_
|
||||
|
||||
1:
|
||||
/* Correct TLS magic, so this is a guest fault. */
|
||||
@@ -163,7 +163,7 @@ _ZN4Core6ArmNce23GuestFaultSignalHandlerEiPvS1_:
|
||||
msr tpidr_el0, x3
|
||||
|
||||
/* Call the handler. */
|
||||
bl _ZN4Core6ArmNce16HandleGuestFaultEPNS_12GuestContextEPvS3_
|
||||
bl _ZN4Core7ARM_NCE16HandleGuestFaultEPNS_12GuestContextEPvS3_
|
||||
|
||||
/* If the handler returned false, we want to preserve the host tpidr_el0. */
|
||||
cbz x0, 2f
|
||||
@@ -177,11 +177,11 @@ _ZN4Core6ArmNce23GuestFaultSignalHandlerEiPvS1_:
|
||||
ret
|
||||
|
||||
|
||||
/* static void Core::ArmNce::LockThreadParameters(void* tpidr) */
|
||||
.section .text._ZN4Core6ArmNce20LockThreadParametersEPv, "ax", %progbits
|
||||
.global _ZN4Core6ArmNce20LockThreadParametersEPv
|
||||
.type _ZN4Core6ArmNce20LockThreadParametersEPv, %function
|
||||
_ZN4Core6ArmNce20LockThreadParametersEPv:
|
||||
/* static void Core::ARM_NCE::LockThreadParameters(void* tpidr) */
|
||||
.section .text._ZN4Core7ARM_NCE20LockThreadParametersEPv, "ax", %progbits
|
||||
.global _ZN4Core7ARM_NCE20LockThreadParametersEPv
|
||||
.type _ZN4Core7ARM_NCE20LockThreadParametersEPv, %function
|
||||
_ZN4Core7ARM_NCE20LockThreadParametersEPv:
|
||||
/* Offset to lock member. */
|
||||
add x0, x0, #(TpidrEl0Lock)
|
||||
|
||||
@@ -205,11 +205,11 @@ _ZN4Core6ArmNce20LockThreadParametersEPv:
|
||||
ret
|
||||
|
||||
|
||||
/* static void Core::ArmNce::UnlockThreadParameters(void* tpidr) */
|
||||
.section .text._ZN4Core6ArmNce22UnlockThreadParametersEPv, "ax", %progbits
|
||||
.global _ZN4Core6ArmNce22UnlockThreadParametersEPv
|
||||
.type _ZN4Core6ArmNce22UnlockThreadParametersEPv, %function
|
||||
_ZN4Core6ArmNce22UnlockThreadParametersEPv:
|
||||
/* static void Core::ARM_NCE::UnlockThreadParameters(void* tpidr) */
|
||||
.section .text._ZN4Core7ARM_NCE22UnlockThreadParametersEPv, "ax", %progbits
|
||||
.global _ZN4Core7ARM_NCE22UnlockThreadParametersEPv
|
||||
.type _ZN4Core7ARM_NCE22UnlockThreadParametersEPv, %function
|
||||
_ZN4Core7ARM_NCE22UnlockThreadParametersEPv:
|
||||
/* Offset to lock member. */
|
||||
add x0, x0, #(TpidrEl0Lock)
|
||||
|
||||
|
||||
@@ -3,8 +3,6 @@
|
||||
|
||||
#pragma once
|
||||
|
||||
#include <atomic>
|
||||
|
||||
#include "common/common_funcs.h"
|
||||
#include "common/common_types.h"
|
||||
#include "core/arm/arm_interface.h"
|
||||
@@ -12,7 +10,7 @@
|
||||
|
||||
namespace Core {
|
||||
|
||||
class ArmNce;
|
||||
class ARM_NCE;
|
||||
class System;
|
||||
|
||||
struct HostContext {
|
||||
@@ -35,9 +33,9 @@ struct GuestContext {
|
||||
u64 tpidr_el0{};
|
||||
std::atomic<u64> esr_el1{};
|
||||
u32 nzcv{};
|
||||
u32 svc{};
|
||||
u32 svc_swi{};
|
||||
System* system{};
|
||||
ArmNce* parent{};
|
||||
ARM_NCE* parent{};
|
||||
};
|
||||
|
||||
// Verify assembly offsets.
|
||||
|
||||
@@ -280,7 +280,7 @@ void Patcher::WriteSvcTrampoline(ModuleDestLabel module_dest, u32 svc_id) {
|
||||
|
||||
// Store SVC number to execute when we return
|
||||
c.MOV(X2, svc_id);
|
||||
c.STR(W2, X1, offsetof(GuestContext, svc));
|
||||
c.STR(W2, X1, offsetof(GuestContext, svc_swi));
|
||||
|
||||
// We are calling a SVC. Clear esr_el1 and return it.
|
||||
static_assert(std::is_same_v<std::underlying_type_t<HaltReason>, u64>);
|
||||
|
||||
@@ -323,6 +323,7 @@ struct System::Impl {
|
||||
static_cast<u32>(SystemResultStatus::ErrorLoader) + static_cast<u32>(load_result));
|
||||
}
|
||||
AddGlueRegistrationForProcess(*app_loader, *main_process);
|
||||
kernel.InitializeCores();
|
||||
|
||||
// Initialize cheat engine
|
||||
if (cheat_engine) {
|
||||
@@ -599,6 +600,14 @@ bool System::IsPaused() const {
|
||||
return impl->IsPaused();
|
||||
}
|
||||
|
||||
void System::InvalidateCpuInstructionCaches() {
|
||||
impl->kernel.InvalidateAllInstructionCaches();
|
||||
}
|
||||
|
||||
void System::InvalidateCpuInstructionCacheRange(u64 addr, std::size_t size) {
|
||||
impl->kernel.InvalidateCpuInstructionCacheRange(addr, size);
|
||||
}
|
||||
|
||||
void System::ShutdownMainProcess() {
|
||||
impl->ShutdownMainProcess();
|
||||
}
|
||||
@@ -687,6 +696,14 @@ const TelemetrySession& System::TelemetrySession() const {
|
||||
return *impl->telemetry_session;
|
||||
}
|
||||
|
||||
ARM_Interface& System::CurrentArmInterface() {
|
||||
return impl->kernel.CurrentPhysicalCore().ArmInterface();
|
||||
}
|
||||
|
||||
const ARM_Interface& System::CurrentArmInterface() const {
|
||||
return impl->kernel.CurrentPhysicalCore().ArmInterface();
|
||||
}
|
||||
|
||||
Kernel::PhysicalCore& System::CurrentPhysicalCore() {
|
||||
return impl->kernel.CurrentPhysicalCore();
|
||||
}
|
||||
@@ -721,6 +738,14 @@ const Kernel::KProcess* System::ApplicationProcess() const {
|
||||
return impl->kernel.ApplicationProcess();
|
||||
}
|
||||
|
||||
ARM_Interface& System::ArmInterface(std::size_t core_index) {
|
||||
return impl->kernel.PhysicalCore(core_index).ArmInterface();
|
||||
}
|
||||
|
||||
const ARM_Interface& System::ArmInterface(std::size_t core_index) const {
|
||||
return impl->kernel.PhysicalCore(core_index).ArmInterface();
|
||||
}
|
||||
|
||||
ExclusiveMonitor& System::Monitor() {
|
||||
return impl->kernel.GetExclusiveMonitor();
|
||||
}
|
||||
|
||||
@@ -108,6 +108,7 @@ class RenderdocAPI;
|
||||
|
||||
namespace Core {
|
||||
|
||||
class ARM_Interface;
|
||||
class CpuManager;
|
||||
class Debugger;
|
||||
class DeviceMemory;
|
||||
@@ -170,6 +171,15 @@ public:
|
||||
/// Check if the core is currently paused.
|
||||
[[nodiscard]] bool IsPaused() const;
|
||||
|
||||
/**
|
||||
* Invalidate the CPU instruction caches
|
||||
* This function should only be used by GDB Stub to support breakpoints, memory updates and
|
||||
* step/continue commands.
|
||||
*/
|
||||
void InvalidateCpuInstructionCaches();
|
||||
|
||||
void InvalidateCpuInstructionCacheRange(u64 addr, std::size_t size);
|
||||
|
||||
/// Shutdown the main emulated process.
|
||||
void ShutdownMainProcess();
|
||||
|
||||
@@ -234,12 +244,24 @@ public:
|
||||
/// Gets and resets core performance statistics
|
||||
[[nodiscard]] PerfStatsResults GetAndResetPerfStats();
|
||||
|
||||
/// Gets an ARM interface to the CPU core that is currently running
|
||||
[[nodiscard]] ARM_Interface& CurrentArmInterface();
|
||||
|
||||
/// Gets an ARM interface to the CPU core that is currently running
|
||||
[[nodiscard]] const ARM_Interface& CurrentArmInterface() const;
|
||||
|
||||
/// Gets the physical core for the CPU core that is currently running
|
||||
[[nodiscard]] Kernel::PhysicalCore& CurrentPhysicalCore();
|
||||
|
||||
/// Gets the physical core for the CPU core that is currently running
|
||||
[[nodiscard]] const Kernel::PhysicalCore& CurrentPhysicalCore() const;
|
||||
|
||||
/// Gets a reference to an ARM interface for the CPU core with the specified index
|
||||
[[nodiscard]] ARM_Interface& ArmInterface(std::size_t core_index);
|
||||
|
||||
/// Gets a const reference to an ARM interface from the CPU core with the specified index
|
||||
[[nodiscard]] const ARM_Interface& ArmInterface(std::size_t core_index) const;
|
||||
|
||||
/// Gets a reference to the underlying CPU manager.
|
||||
[[nodiscard]] CpuManager& GetCpuManager();
|
||||
|
||||
|
||||
@@ -73,13 +73,12 @@ void CpuManager::HandleInterrupt() {
|
||||
void CpuManager::MultiCoreRunGuestThread() {
|
||||
// Similar to UserModeThreadStarter in HOS
|
||||
auto& kernel = system.Kernel();
|
||||
auto* thread = Kernel::GetCurrentThreadPointer(kernel);
|
||||
kernel.CurrentScheduler()->OnThreadStart();
|
||||
|
||||
while (true) {
|
||||
auto* physical_core = &kernel.CurrentPhysicalCore();
|
||||
while (!physical_core->IsInterrupted()) {
|
||||
physical_core->RunThread(thread);
|
||||
physical_core->Run();
|
||||
physical_core = &kernel.CurrentPhysicalCore();
|
||||
}
|
||||
|
||||
@@ -111,13 +110,12 @@ void CpuManager::MultiCoreRunIdleThread() {
|
||||
|
||||
void CpuManager::SingleCoreRunGuestThread() {
|
||||
auto& kernel = system.Kernel();
|
||||
auto* thread = Kernel::GetCurrentThreadPointer(kernel);
|
||||
kernel.CurrentScheduler()->OnThreadStart();
|
||||
|
||||
while (true) {
|
||||
auto* physical_core = &kernel.CurrentPhysicalCore();
|
||||
if (!physical_core->IsInterrupted()) {
|
||||
physical_core->RunThread(thread);
|
||||
physical_core->Run();
|
||||
physical_core = &kernel.CurrentPhysicalCore();
|
||||
}
|
||||
|
||||
@@ -213,6 +211,8 @@ void CpuManager::RunThread(std::stop_token token, std::size_t core) {
|
||||
system.GPU().ObtainContext();
|
||||
}
|
||||
|
||||
system.ArmInterface(core).Initialize();
|
||||
|
||||
auto& kernel = system.Kernel();
|
||||
auto& scheduler = *kernel.CurrentScheduler();
|
||||
auto* thread = scheduler.GetSchedulerCurrentThread();
|
||||
|
||||
@@ -16,7 +16,6 @@
|
||||
#include "common/settings.h"
|
||||
#include "common/string_util.h"
|
||||
#include "core/arm/arm_interface.h"
|
||||
#include "core/arm/debug.h"
|
||||
#include "core/core.h"
|
||||
#include "core/debugger/gdbstub.h"
|
||||
#include "core/debugger/gdbstub_arch.h"
|
||||
@@ -311,7 +310,7 @@ void GDBStub::ExecuteCommand(std::string_view packet, std::vector<DebuggerAction
|
||||
const auto mem{Common::HexStringToVector(mem_substr, false)};
|
||||
|
||||
if (system.ApplicationMemory().WriteBlock(addr, mem.data(), size)) {
|
||||
Core::InvalidateInstructionCacheRange(system.ApplicationProcess(), addr, size);
|
||||
system.InvalidateCpuInstructionCacheRange(addr, size);
|
||||
SendReply(GDB_STUB_REPLY_OK);
|
||||
} else {
|
||||
SendReply(GDB_STUB_REPLY_ERR);
|
||||
@@ -364,7 +363,7 @@ void GDBStub::HandleBreakpointInsert(std::string_view command) {
|
||||
case BreakpointType::Software:
|
||||
replaced_instructions[addr] = system.ApplicationMemory().Read32(addr);
|
||||
system.ApplicationMemory().Write32(addr, arch->BreakpointInstruction());
|
||||
Core::InvalidateInstructionCacheRange(system.ApplicationProcess(), addr, sizeof(u32));
|
||||
system.InvalidateCpuInstructionCacheRange(addr, sizeof(u32));
|
||||
success = true;
|
||||
break;
|
||||
case BreakpointType::WriteWatch:
|
||||
@@ -412,7 +411,7 @@ void GDBStub::HandleBreakpointRemove(std::string_view command) {
|
||||
const auto orig_insn{replaced_instructions.find(addr)};
|
||||
if (orig_insn != replaced_instructions.end()) {
|
||||
system.ApplicationMemory().Write32(addr, orig_insn->second);
|
||||
Core::InvalidateInstructionCacheRange(system.ApplicationProcess(), addr, sizeof(u32));
|
||||
system.InvalidateCpuInstructionCacheRange(addr, sizeof(u32));
|
||||
replaced_instructions.erase(addr);
|
||||
success = true;
|
||||
}
|
||||
@@ -443,6 +442,114 @@ void GDBStub::HandleBreakpointRemove(std::string_view command) {
|
||||
}
|
||||
}
|
||||
|
||||
// Structure offsets are from Atmosphere
|
||||
// See osdbg_thread_local_region.os.horizon.hpp and osdbg_thread_type.os.horizon.hpp
|
||||
|
||||
static std::optional<std::string> GetNameFromThreadType32(Core::Memory::Memory& memory,
|
||||
const Kernel::KThread& thread) {
|
||||
// Read thread type from TLS
|
||||
const VAddr tls_thread_type{memory.Read32(thread.GetTlsAddress() + 0x1fc)};
|
||||
const VAddr argument_thread_type{thread.GetArgument()};
|
||||
|
||||
if (argument_thread_type && tls_thread_type != argument_thread_type) {
|
||||
// Probably not created by nnsdk, no name available.
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
if (!tls_thread_type) {
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
const u16 version{memory.Read16(tls_thread_type + 0x26)};
|
||||
VAddr name_pointer{};
|
||||
if (version == 1) {
|
||||
name_pointer = memory.Read32(tls_thread_type + 0xe4);
|
||||
} else {
|
||||
name_pointer = memory.Read32(tls_thread_type + 0xe8);
|
||||
}
|
||||
|
||||
if (!name_pointer) {
|
||||
// No name provided.
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
return memory.ReadCString(name_pointer, 256);
|
||||
}
|
||||
|
||||
static std::optional<std::string> GetNameFromThreadType64(Core::Memory::Memory& memory,
|
||||
const Kernel::KThread& thread) {
|
||||
// Read thread type from TLS
|
||||
const VAddr tls_thread_type{memory.Read64(thread.GetTlsAddress() + 0x1f8)};
|
||||
const VAddr argument_thread_type{thread.GetArgument()};
|
||||
|
||||
if (argument_thread_type && tls_thread_type != argument_thread_type) {
|
||||
// Probably not created by nnsdk, no name available.
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
if (!tls_thread_type) {
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
const u16 version{memory.Read16(tls_thread_type + 0x46)};
|
||||
VAddr name_pointer{};
|
||||
if (version == 1) {
|
||||
name_pointer = memory.Read64(tls_thread_type + 0x1a0);
|
||||
} else {
|
||||
name_pointer = memory.Read64(tls_thread_type + 0x1a8);
|
||||
}
|
||||
|
||||
if (!name_pointer) {
|
||||
// No name provided.
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
return memory.ReadCString(name_pointer, 256);
|
||||
}
|
||||
|
||||
static std::optional<std::string> GetThreadName(Core::System& system,
|
||||
const Kernel::KThread& thread) {
|
||||
if (system.ApplicationProcess()->Is64Bit()) {
|
||||
return GetNameFromThreadType64(system.ApplicationMemory(), thread);
|
||||
} else {
|
||||
return GetNameFromThreadType32(system.ApplicationMemory(), thread);
|
||||
}
|
||||
}
|
||||
|
||||
static std::string_view GetThreadWaitReason(const Kernel::KThread& thread) {
|
||||
switch (thread.GetWaitReasonForDebugging()) {
|
||||
case Kernel::ThreadWaitReasonForDebugging::Sleep:
|
||||
return "Sleep";
|
||||
case Kernel::ThreadWaitReasonForDebugging::IPC:
|
||||
return "IPC";
|
||||
case Kernel::ThreadWaitReasonForDebugging::Synchronization:
|
||||
return "Synchronization";
|
||||
case Kernel::ThreadWaitReasonForDebugging::ConditionVar:
|
||||
return "ConditionVar";
|
||||
case Kernel::ThreadWaitReasonForDebugging::Arbitration:
|
||||
return "Arbitration";
|
||||
case Kernel::ThreadWaitReasonForDebugging::Suspended:
|
||||
return "Suspended";
|
||||
default:
|
||||
return "Unknown";
|
||||
}
|
||||
}
|
||||
|
||||
static std::string GetThreadState(const Kernel::KThread& thread) {
|
||||
switch (thread.GetState()) {
|
||||
case Kernel::ThreadState::Initialized:
|
||||
return "Initialized";
|
||||
case Kernel::ThreadState::Waiting:
|
||||
return fmt::format("Waiting ({})", GetThreadWaitReason(thread));
|
||||
case Kernel::ThreadState::Runnable:
|
||||
return "Runnable";
|
||||
case Kernel::ThreadState::Terminated:
|
||||
return "Terminated";
|
||||
default:
|
||||
return "Unknown";
|
||||
}
|
||||
}
|
||||
|
||||
static std::string PaginateBuffer(std::string_view buffer, std::string_view request) {
|
||||
const auto amount{request.substr(request.find(',') + 1)};
|
||||
const auto offset_val{static_cast<u64>(strtoll(request.data(), nullptr, 16))};
|
||||
@@ -455,6 +562,120 @@ static std::string PaginateBuffer(std::string_view buffer, std::string_view requ
|
||||
}
|
||||
}
|
||||
|
||||
static VAddr GetModuleEnd(Kernel::KProcessPageTable& page_table, VAddr base) {
|
||||
Kernel::KMemoryInfo mem_info;
|
||||
Kernel::Svc::MemoryInfo svc_mem_info;
|
||||
Kernel::Svc::PageInfo page_info;
|
||||
VAddr cur_addr{base};
|
||||
|
||||
// Expect: r-x Code (.text)
|
||||
R_ASSERT(page_table.QueryInfo(std::addressof(mem_info), std::addressof(page_info), cur_addr));
|
||||
svc_mem_info = mem_info.GetSvcMemoryInfo();
|
||||
cur_addr = svc_mem_info.base_address + svc_mem_info.size;
|
||||
if (svc_mem_info.state != Kernel::Svc::MemoryState::Code ||
|
||||
svc_mem_info.permission != Kernel::Svc::MemoryPermission::ReadExecute) {
|
||||
return cur_addr - 1;
|
||||
}
|
||||
|
||||
// Expect: r-- Code (.rodata)
|
||||
R_ASSERT(page_table.QueryInfo(std::addressof(mem_info), std::addressof(page_info), cur_addr));
|
||||
svc_mem_info = mem_info.GetSvcMemoryInfo();
|
||||
cur_addr = svc_mem_info.base_address + svc_mem_info.size;
|
||||
if (svc_mem_info.state != Kernel::Svc::MemoryState::Code ||
|
||||
svc_mem_info.permission != Kernel::Svc::MemoryPermission::Read) {
|
||||
return cur_addr - 1;
|
||||
}
|
||||
|
||||
// Expect: rw- CodeData (.data)
|
||||
R_ASSERT(page_table.QueryInfo(std::addressof(mem_info), std::addressof(page_info), cur_addr));
|
||||
svc_mem_info = mem_info.GetSvcMemoryInfo();
|
||||
cur_addr = svc_mem_info.base_address + svc_mem_info.size;
|
||||
return cur_addr - 1;
|
||||
}
|
||||
|
||||
static Loader::AppLoader::Modules FindModules(Core::System& system) {
|
||||
Loader::AppLoader::Modules modules;
|
||||
|
||||
auto& page_table = system.ApplicationProcess()->GetPageTable();
|
||||
auto& memory = system.ApplicationMemory();
|
||||
VAddr cur_addr = 0;
|
||||
|
||||
// Look for executable sections in Code or AliasCode regions.
|
||||
while (true) {
|
||||
Kernel::KMemoryInfo mem_info{};
|
||||
Kernel::Svc::PageInfo page_info{};
|
||||
R_ASSERT(
|
||||
page_table.QueryInfo(std::addressof(mem_info), std::addressof(page_info), cur_addr));
|
||||
auto svc_mem_info = mem_info.GetSvcMemoryInfo();
|
||||
|
||||
if (svc_mem_info.permission == Kernel::Svc::MemoryPermission::ReadExecute &&
|
||||
(svc_mem_info.state == Kernel::Svc::MemoryState::Code ||
|
||||
svc_mem_info.state == Kernel::Svc::MemoryState::AliasCode)) {
|
||||
// Try to read the module name from its path.
|
||||
constexpr s32 PathLengthMax = 0x200;
|
||||
struct {
|
||||
u32 zero;
|
||||
s32 path_length;
|
||||
std::array<char, PathLengthMax> path;
|
||||
} module_path;
|
||||
|
||||
if (memory.ReadBlock(svc_mem_info.base_address + svc_mem_info.size, &module_path,
|
||||
sizeof(module_path))) {
|
||||
if (module_path.zero == 0 && module_path.path_length > 0) {
|
||||
// Truncate module name.
|
||||
module_path.path[PathLengthMax - 1] = '\0';
|
||||
|
||||
// Ignore leading directories.
|
||||
char* path_pointer = module_path.path.data();
|
||||
|
||||
for (s32 i = 0; i < std::min(PathLengthMax, module_path.path_length) &&
|
||||
module_path.path[i] != '\0';
|
||||
i++) {
|
||||
if (module_path.path[i] == '/' || module_path.path[i] == '\\') {
|
||||
path_pointer = module_path.path.data() + i + 1;
|
||||
}
|
||||
}
|
||||
|
||||
// Insert output.
|
||||
modules.emplace(svc_mem_info.base_address, path_pointer);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Check if we're done.
|
||||
const uintptr_t next_address = svc_mem_info.base_address + svc_mem_info.size;
|
||||
if (next_address <= cur_addr) {
|
||||
break;
|
||||
}
|
||||
|
||||
cur_addr = next_address;
|
||||
}
|
||||
|
||||
return modules;
|
||||
}
|
||||
|
||||
static VAddr FindMainModuleEntrypoint(Core::System& system) {
|
||||
Loader::AppLoader::Modules modules;
|
||||
system.GetAppLoader().ReadNSOModules(modules);
|
||||
|
||||
// Do we have a module named main?
|
||||
const auto main = std::find_if(modules.begin(), modules.end(),
|
||||
[](const auto& key) { return key.second == "main"; });
|
||||
|
||||
if (main != modules.end()) {
|
||||
return main->first;
|
||||
}
|
||||
|
||||
// Do we have any loaded executable sections?
|
||||
modules = FindModules(system);
|
||||
if (!modules.empty()) {
|
||||
return modules.begin()->first;
|
||||
}
|
||||
|
||||
// As a last resort, use the start of the code region.
|
||||
return GetInteger(system.ApplicationProcess()->GetPageTable().GetCodeRegionStart());
|
||||
}
|
||||
|
||||
void GDBStub::HandleQuery(std::string_view command) {
|
||||
if (command.starts_with("TStatus")) {
|
||||
// no tracepoint support
|
||||
@@ -466,10 +687,10 @@ void GDBStub::HandleQuery(std::string_view command) {
|
||||
const auto target_xml{arch->GetTargetXML()};
|
||||
SendReply(PaginateBuffer(target_xml, command.substr(30)));
|
||||
} else if (command.starts_with("Offsets")) {
|
||||
const auto main_offset = Core::FindMainModuleEntrypoint(system.ApplicationProcess());
|
||||
SendReply(fmt::format("TextSeg={:x}", GetInteger(main_offset)));
|
||||
const auto main_offset = FindMainModuleEntrypoint(system);
|
||||
SendReply(fmt::format("TextSeg={:x}", main_offset));
|
||||
} else if (command.starts_with("Xfer:libraries:read::")) {
|
||||
auto modules = Core::FindModules(system.ApplicationProcess());
|
||||
auto modules = FindModules(system);
|
||||
|
||||
std::string buffer;
|
||||
buffer += R"(<?xml version="1.0"?>)";
|
||||
@@ -499,14 +720,14 @@ void GDBStub::HandleQuery(std::string_view command) {
|
||||
|
||||
const auto& threads = system.ApplicationProcess()->GetThreadList();
|
||||
for (const auto& thread : threads) {
|
||||
auto thread_name{Core::GetThreadName(&thread)};
|
||||
auto thread_name{GetThreadName(system, thread)};
|
||||
if (!thread_name) {
|
||||
thread_name = fmt::format("Thread {:d}", thread.GetThreadId());
|
||||
}
|
||||
|
||||
buffer += fmt::format(R"(<thread id="{:x}" core="{:d}" name="{}">{}</thread>)",
|
||||
thread.GetThreadId(), thread.GetActiveCore(),
|
||||
EscapeXML(*thread_name), GetThreadState(&thread));
|
||||
EscapeXML(*thread_name), GetThreadState(thread));
|
||||
}
|
||||
|
||||
buffer += "</threads>";
|
||||
@@ -635,7 +856,7 @@ void GDBStub::HandleRcmd(const std::vector<u8>& command) {
|
||||
reply = "Fastmem is not enabled.\n";
|
||||
}
|
||||
} else if (command_str == "get info") {
|
||||
auto modules = Core::FindModules(process);
|
||||
auto modules = FindModules(system);
|
||||
|
||||
reply = fmt::format("Process: {:#x} ({})\n"
|
||||
"Program Id: {:#018x}\n",
|
||||
@@ -659,7 +880,7 @@ void GDBStub::HandleRcmd(const std::vector<u8>& command) {
|
||||
|
||||
for (const auto& [vaddr, name] : modules) {
|
||||
reply += fmt::format(" {:#012x} - {:#012x} {}\n", vaddr,
|
||||
GetInteger(Core::GetModuleEnd(process, vaddr)), name);
|
||||
GetModuleEnd(page_table, vaddr), name);
|
||||
}
|
||||
} else if (command_str == "get mappings") {
|
||||
reply = "Mappings:\n";
|
||||
|
||||
@@ -24,6 +24,21 @@ static std::string ValueToHex(const T value) {
|
||||
return Common::HexToString(mem);
|
||||
}
|
||||
|
||||
template <typename T>
|
||||
static T GetSIMDRegister(const std::array<u32, 64>& simd_regs, size_t offset) {
|
||||
static_assert(std::is_trivially_copyable_v<T>);
|
||||
T value{};
|
||||
std::memcpy(&value, reinterpret_cast<const u8*>(simd_regs.data()) + sizeof(T) * offset,
|
||||
sizeof(T));
|
||||
return value;
|
||||
}
|
||||
|
||||
template <typename T>
|
||||
static void PutSIMDRegister(std::array<u32, 64>& simd_regs, size_t offset, const T value) {
|
||||
static_assert(std::is_trivially_copyable_v<T>);
|
||||
std::memcpy(reinterpret_cast<u8*>(simd_regs.data()) + sizeof(T) * offset, &value, sizeof(T));
|
||||
}
|
||||
|
||||
// For sample XML files see the GDB source /gdb/features
|
||||
// This XML defines what the registers are for this specific ARM device
|
||||
std::string_view GDBStubA64::GetTargetXML() const {
|
||||
@@ -169,16 +184,12 @@ std::string GDBStubA64::RegRead(const Kernel::KThread* thread, size_t id) const
|
||||
return "";
|
||||
}
|
||||
|
||||
const auto& context{thread->GetContext()};
|
||||
const auto& gprs{context.r};
|
||||
const auto& fprs{context.v};
|
||||
const auto& context{thread->GetContext64()};
|
||||
const auto& gprs{context.cpu_registers};
|
||||
const auto& fprs{context.vector_registers};
|
||||
|
||||
if (id < FP_REGISTER) {
|
||||
if (id < SP_REGISTER) {
|
||||
return ValueToHex(gprs[id]);
|
||||
} else if (id == FP_REGISTER) {
|
||||
return ValueToHex(context.fp);
|
||||
} else if (id == LR_REGISTER) {
|
||||
return ValueToHex(context.lr);
|
||||
} else if (id == SP_REGISTER) {
|
||||
return ValueToHex(context.sp);
|
||||
} else if (id == PC_REGISTER) {
|
||||
@@ -201,14 +212,10 @@ void GDBStubA64::RegWrite(Kernel::KThread* thread, size_t id, std::string_view v
|
||||
return;
|
||||
}
|
||||
|
||||
auto& context{thread->GetContext()};
|
||||
auto& context{thread->GetContext64()};
|
||||
|
||||
if (id < FP_REGISTER) {
|
||||
context.r[id] = HexToValue<u64>(value);
|
||||
} else if (id == FP_REGISTER) {
|
||||
context.fp = HexToValue<u64>(value);
|
||||
} else if (id == LR_REGISTER) {
|
||||
context.lr = HexToValue<u64>(value);
|
||||
if (id < SP_REGISTER) {
|
||||
context.cpu_registers[id] = HexToValue<u64>(value);
|
||||
} else if (id == SP_REGISTER) {
|
||||
context.sp = HexToValue<u64>(value);
|
||||
} else if (id == PC_REGISTER) {
|
||||
@@ -216,7 +223,7 @@ void GDBStubA64::RegWrite(Kernel::KThread* thread, size_t id, std::string_view v
|
||||
} else if (id == PSTATE_REGISTER) {
|
||||
context.pstate = HexToValue<u32>(value);
|
||||
} else if (id >= Q0_REGISTER && id < FPSR_REGISTER) {
|
||||
context.v[id - Q0_REGISTER] = HexToValue<u128>(value);
|
||||
context.vector_registers[id - Q0_REGISTER] = HexToValue<u128>(value);
|
||||
} else if (id == FPSR_REGISTER) {
|
||||
context.fpsr = HexToValue<u32>(value);
|
||||
} else if (id == FPCR_REGISTER) {
|
||||
@@ -374,20 +381,22 @@ std::string GDBStubA32::RegRead(const Kernel::KThread* thread, size_t id) const
|
||||
return "";
|
||||
}
|
||||
|
||||
const auto& context{thread->GetContext()};
|
||||
const auto& gprs{context.r};
|
||||
const auto& fprs{context.v};
|
||||
const auto& context{thread->GetContext32()};
|
||||
const auto& gprs{context.cpu_registers};
|
||||
const auto& fprs{context.extension_registers};
|
||||
|
||||
if (id <= PC_REGISTER) {
|
||||
return ValueToHex(static_cast<u32>(gprs[id]));
|
||||
return ValueToHex(gprs[id]);
|
||||
} else if (id == CPSR_REGISTER) {
|
||||
return ValueToHex(context.pstate);
|
||||
return ValueToHex(context.cpsr);
|
||||
} else if (id >= D0_REGISTER && id < Q0_REGISTER) {
|
||||
return ValueToHex(fprs[id - D0_REGISTER][0]);
|
||||
const u64 dN{GetSIMDRegister<u64>(fprs, id - D0_REGISTER)};
|
||||
return ValueToHex(dN);
|
||||
} else if (id >= Q0_REGISTER && id < FPSCR_REGISTER) {
|
||||
return ValueToHex(fprs[id - Q0_REGISTER]);
|
||||
const u128 qN{GetSIMDRegister<u128>(fprs, id - Q0_REGISTER)};
|
||||
return ValueToHex(qN);
|
||||
} else if (id == FPSCR_REGISTER) {
|
||||
return ValueToHex(context.fpcr | context.fpsr);
|
||||
return ValueToHex(context.fpscr);
|
||||
} else {
|
||||
return "";
|
||||
}
|
||||
@@ -398,20 +407,19 @@ void GDBStubA32::RegWrite(Kernel::KThread* thread, size_t id, std::string_view v
|
||||
return;
|
||||
}
|
||||
|
||||
auto& context{thread->GetContext()};
|
||||
auto& fprs{context.v};
|
||||
auto& context{thread->GetContext32()};
|
||||
auto& fprs{context.extension_registers};
|
||||
|
||||
if (id <= PC_REGISTER) {
|
||||
context.r[id] = HexToValue<u32>(value);
|
||||
context.cpu_registers[id] = HexToValue<u32>(value);
|
||||
} else if (id == CPSR_REGISTER) {
|
||||
context.pstate = HexToValue<u32>(value);
|
||||
context.cpsr = HexToValue<u32>(value);
|
||||
} else if (id >= D0_REGISTER && id < Q0_REGISTER) {
|
||||
fprs[id - D0_REGISTER] = {HexToValue<u64>(value), 0};
|
||||
PutSIMDRegister(fprs, id - D0_REGISTER, HexToValue<u64>(value));
|
||||
} else if (id >= Q0_REGISTER && id < FPSCR_REGISTER) {
|
||||
fprs[id - Q0_REGISTER] = HexToValue<u128>(value);
|
||||
PutSIMDRegister(fprs, id - Q0_REGISTER, HexToValue<u128>(value));
|
||||
} else if (id == FPSCR_REGISTER) {
|
||||
context.fpcr = HexToValue<u32>(value);
|
||||
context.fpsr = HexToValue<u32>(value);
|
||||
context.fpscr = HexToValue<u32>(value);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -36,7 +36,6 @@ public:
|
||||
u32 BreakpointInstruction() const override;
|
||||
|
||||
private:
|
||||
static constexpr u32 FP_REGISTER = 29;
|
||||
static constexpr u32 LR_REGISTER = 30;
|
||||
static constexpr u32 SP_REGISTER = 31;
|
||||
static constexpr u32 PC_REGISTER = 32;
|
||||
|
||||
@@ -2,7 +2,6 @@
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include <cstring>
|
||||
#include <span>
|
||||
#include <string_view>
|
||||
#include "common/alignment.h"
|
||||
#include "common/assert.h"
|
||||
@@ -135,7 +134,7 @@ void RomFSBuildContext::VisitDirectory(VirtualDir romfs_dir, VirtualDir ext_dir,
|
||||
|
||||
child->size = child->source->GetSize();
|
||||
|
||||
AddFile(parent, std::move(child));
|
||||
AddFile(parent, child);
|
||||
}
|
||||
|
||||
for (auto& child_romfs_dir : romfs_dir->GetSubdirectories()) {
|
||||
@@ -164,24 +163,36 @@ void RomFSBuildContext::VisitDirectory(VirtualDir romfs_dir, VirtualDir ext_dir,
|
||||
|
||||
bool RomFSBuildContext::AddDirectory(std::shared_ptr<RomFSBuildDirectoryContext> parent_dir_ctx,
|
||||
std::shared_ptr<RomFSBuildDirectoryContext> dir_ctx) {
|
||||
// Check whether it's already in the known directories.
|
||||
const auto [it, is_new] = directories.emplace(dir_ctx->path, nullptr);
|
||||
if (!is_new) {
|
||||
return false;
|
||||
}
|
||||
|
||||
// Add a new directory.
|
||||
num_dirs++;
|
||||
dir_table_size +=
|
||||
sizeof(RomFSDirectoryEntry) + Common::AlignUp(dir_ctx->path_len - dir_ctx->cur_path_ofs, 4);
|
||||
dir_ctx->parent = std::move(parent_dir_ctx);
|
||||
directories.emplace_back(std::move(dir_ctx));
|
||||
dir_ctx->parent = parent_dir_ctx;
|
||||
it->second = dir_ctx;
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
bool RomFSBuildContext::AddFile(std::shared_ptr<RomFSBuildDirectoryContext> parent_dir_ctx,
|
||||
std::shared_ptr<RomFSBuildFileContext> file_ctx) {
|
||||
// Check whether it's already in the known files.
|
||||
const auto [it, is_new] = files.emplace(file_ctx->path, nullptr);
|
||||
if (!is_new) {
|
||||
return false;
|
||||
}
|
||||
|
||||
// Add a new file.
|
||||
num_files++;
|
||||
file_table_size +=
|
||||
sizeof(RomFSFileEntry) + Common::AlignUp(file_ctx->path_len - file_ctx->cur_path_ofs, 4);
|
||||
file_ctx->parent = std::move(parent_dir_ctx);
|
||||
files.emplace_back(std::move(file_ctx));
|
||||
file_ctx->parent = parent_dir_ctx;
|
||||
it->second = file_ctx;
|
||||
|
||||
return true;
|
||||
}
|
||||
@@ -190,7 +201,7 @@ RomFSBuildContext::RomFSBuildContext(VirtualDir base_, VirtualDir ext_)
|
||||
: base(std::move(base_)), ext(std::move(ext_)) {
|
||||
root = std::make_shared<RomFSBuildDirectoryContext>();
|
||||
root->path = "\0";
|
||||
directories.emplace_back(root);
|
||||
directories.emplace(root->path, root);
|
||||
num_dirs = 1;
|
||||
dir_table_size = 0x18;
|
||||
|
||||
@@ -199,43 +210,28 @@ RomFSBuildContext::RomFSBuildContext(VirtualDir base_, VirtualDir ext_)
|
||||
|
||||
RomFSBuildContext::~RomFSBuildContext() = default;
|
||||
|
||||
std::vector<std::pair<u64, VirtualFile>> RomFSBuildContext::Build() {
|
||||
std::multimap<u64, VirtualFile> RomFSBuildContext::Build() {
|
||||
const u64 dir_hash_table_entry_count = romfs_get_hash_table_count(num_dirs);
|
||||
const u64 file_hash_table_entry_count = romfs_get_hash_table_count(num_files);
|
||||
dir_hash_table_size = 4 * dir_hash_table_entry_count;
|
||||
file_hash_table_size = 4 * file_hash_table_entry_count;
|
||||
|
||||
// Assign metadata pointers.
|
||||
// Assign metadata pointers
|
||||
RomFSHeader header{};
|
||||
|
||||
std::vector<u8> metadata(file_hash_table_size + file_table_size + dir_hash_table_size +
|
||||
dir_table_size);
|
||||
u32* const dir_hash_table_pointer = reinterpret_cast<u32*>(metadata.data());
|
||||
u8* const dir_table_pointer = metadata.data() + dir_hash_table_size;
|
||||
u32* const file_hash_table_pointer =
|
||||
reinterpret_cast<u32*>(metadata.data() + dir_hash_table_size + dir_table_size);
|
||||
u8* const file_table_pointer =
|
||||
metadata.data() + dir_hash_table_size + dir_table_size + file_hash_table_size;
|
||||
std::vector<u32> dir_hash_table(dir_hash_table_entry_count, ROMFS_ENTRY_EMPTY);
|
||||
std::vector<u32> file_hash_table(file_hash_table_entry_count, ROMFS_ENTRY_EMPTY);
|
||||
|
||||
std::span<u32> dir_hash_table(dir_hash_table_pointer, dir_hash_table_entry_count);
|
||||
std::span<u32> file_hash_table(file_hash_table_pointer, file_hash_table_entry_count);
|
||||
std::span<u8> dir_table(dir_table_pointer, dir_table_size);
|
||||
std::span<u8> file_table(file_table_pointer, file_table_size);
|
||||
std::vector<u8> dir_table(dir_table_size);
|
||||
std::vector<u8> file_table(file_table_size);
|
||||
|
||||
// Initialize hash tables.
|
||||
std::memset(dir_hash_table.data(), 0xFF, dir_hash_table.size_bytes());
|
||||
std::memset(file_hash_table.data(), 0xFF, file_hash_table.size_bytes());
|
||||
|
||||
// Sort tables by name.
|
||||
std::sort(files.begin(), files.end(),
|
||||
[](const auto& a, const auto& b) { return a->path < b->path; });
|
||||
std::sort(directories.begin(), directories.end(),
|
||||
[](const auto& a, const auto& b) { return a->path < b->path; });
|
||||
std::shared_ptr<RomFSBuildFileContext> cur_file;
|
||||
|
||||
// Determine file offsets.
|
||||
u32 entry_offset = 0;
|
||||
std::shared_ptr<RomFSBuildFileContext> prev_file = nullptr;
|
||||
for (const auto& cur_file : files) {
|
||||
for (const auto& it : files) {
|
||||
cur_file = it.second;
|
||||
file_partition_size = Common::AlignUp(file_partition_size, 16);
|
||||
cur_file->offset = file_partition_size;
|
||||
file_partition_size += cur_file->size;
|
||||
@@ -247,48 +243,34 @@ std::vector<std::pair<u64, VirtualFile>> RomFSBuildContext::Build() {
|
||||
}
|
||||
// Assign deferred parent/sibling ownership.
|
||||
for (auto it = files.rbegin(); it != files.rend(); ++it) {
|
||||
auto& cur_file = *it;
|
||||
cur_file = it->second;
|
||||
cur_file->sibling = cur_file->parent->file;
|
||||
cur_file->parent->file = cur_file;
|
||||
}
|
||||
|
||||
std::shared_ptr<RomFSBuildDirectoryContext> cur_dir;
|
||||
|
||||
// Determine directory offsets.
|
||||
entry_offset = 0;
|
||||
for (const auto& cur_dir : directories) {
|
||||
for (const auto& it : directories) {
|
||||
cur_dir = it.second;
|
||||
cur_dir->entry_offset = entry_offset;
|
||||
entry_offset +=
|
||||
static_cast<u32>(sizeof(RomFSDirectoryEntry) +
|
||||
Common::AlignUp(cur_dir->path_len - cur_dir->cur_path_ofs, 4));
|
||||
}
|
||||
// Assign deferred parent/sibling ownership.
|
||||
for (auto it = directories.rbegin(); (*it) != root; ++it) {
|
||||
auto& cur_dir = *it;
|
||||
for (auto it = directories.rbegin(); it->second != root; ++it) {
|
||||
cur_dir = it->second;
|
||||
cur_dir->sibling = cur_dir->parent->child;
|
||||
cur_dir->parent->child = cur_dir;
|
||||
}
|
||||
|
||||
// Create output map.
|
||||
std::vector<std::pair<u64, VirtualFile>> out;
|
||||
out.reserve(num_files + 2);
|
||||
|
||||
// Set header fields.
|
||||
header.header_size = sizeof(RomFSHeader);
|
||||
header.file_hash_table_size = file_hash_table_size;
|
||||
header.file_table_size = file_table_size;
|
||||
header.dir_hash_table_size = dir_hash_table_size;
|
||||
header.dir_table_size = dir_table_size;
|
||||
header.file_partition_ofs = ROMFS_FILEPARTITION_OFS;
|
||||
header.dir_hash_table_ofs = Common::AlignUp(header.file_partition_ofs + file_partition_size, 4);
|
||||
header.dir_table_ofs = header.dir_hash_table_ofs + header.dir_hash_table_size;
|
||||
header.file_hash_table_ofs = header.dir_table_ofs + header.dir_table_size;
|
||||
header.file_table_ofs = header.file_hash_table_ofs + header.file_hash_table_size;
|
||||
|
||||
std::vector<u8> header_data(sizeof(RomFSHeader));
|
||||
std::memcpy(header_data.data(), &header, header_data.size());
|
||||
out.emplace_back(0, std::make_shared<VectorVfsFile>(std::move(header_data)));
|
||||
std::multimap<u64, VirtualFile> out;
|
||||
|
||||
// Populate file tables.
|
||||
for (const auto& cur_file : files) {
|
||||
for (const auto& it : files) {
|
||||
cur_file = it.second;
|
||||
RomFSFileEntry cur_entry{};
|
||||
|
||||
cur_entry.parent = cur_file->parent->entry_offset;
|
||||
@@ -305,7 +287,7 @@ std::vector<std::pair<u64, VirtualFile>> RomFSBuildContext::Build() {
|
||||
|
||||
cur_entry.name_size = name_size;
|
||||
|
||||
out.emplace_back(cur_file->offset + ROMFS_FILEPARTITION_OFS, std::move(cur_file->source));
|
||||
out.emplace(cur_file->offset + ROMFS_FILEPARTITION_OFS, std::move(cur_file->source));
|
||||
std::memcpy(file_table.data() + cur_file->entry_offset, &cur_entry, sizeof(RomFSFileEntry));
|
||||
std::memset(file_table.data() + cur_file->entry_offset + sizeof(RomFSFileEntry), 0,
|
||||
Common::AlignUp(cur_entry.name_size, 4));
|
||||
@@ -314,7 +296,8 @@ std::vector<std::pair<u64, VirtualFile>> RomFSBuildContext::Build() {
|
||||
}
|
||||
|
||||
// Populate dir tables.
|
||||
for (const auto& cur_dir : directories) {
|
||||
for (const auto& it : directories) {
|
||||
cur_dir = it.second;
|
||||
RomFSDirectoryEntry cur_entry{};
|
||||
|
||||
cur_entry.parent = cur_dir == root ? 0 : cur_dir->parent->entry_offset;
|
||||
@@ -340,13 +323,34 @@ std::vector<std::pair<u64, VirtualFile>> RomFSBuildContext::Build() {
|
||||
cur_dir->path.data() + cur_dir->cur_path_ofs, name_size);
|
||||
}
|
||||
|
||||
// Write metadata.
|
||||
out.emplace_back(header.dir_hash_table_ofs,
|
||||
std::make_shared<VectorVfsFile>(std::move(metadata)));
|
||||
// Set header fields.
|
||||
header.header_size = sizeof(RomFSHeader);
|
||||
header.file_hash_table_size = file_hash_table_size;
|
||||
header.file_table_size = file_table_size;
|
||||
header.dir_hash_table_size = dir_hash_table_size;
|
||||
header.dir_table_size = dir_table_size;
|
||||
header.file_partition_ofs = ROMFS_FILEPARTITION_OFS;
|
||||
header.dir_hash_table_ofs = Common::AlignUp(header.file_partition_ofs + file_partition_size, 4);
|
||||
header.dir_table_ofs = header.dir_hash_table_ofs + header.dir_hash_table_size;
|
||||
header.file_hash_table_ofs = header.dir_table_ofs + header.dir_table_size;
|
||||
header.file_table_ofs = header.file_hash_table_ofs + header.file_hash_table_size;
|
||||
|
||||
// Sort the output.
|
||||
std::sort(out.begin(), out.end(),
|
||||
[](const auto& a, const auto& b) { return a.first < b.first; });
|
||||
std::vector<u8> header_data(sizeof(RomFSHeader));
|
||||
std::memcpy(header_data.data(), &header, header_data.size());
|
||||
out.emplace(0, std::make_shared<VectorVfsFile>(std::move(header_data)));
|
||||
|
||||
std::vector<u8> metadata(file_hash_table_size + file_table_size + dir_hash_table_size +
|
||||
dir_table_size);
|
||||
std::size_t index = 0;
|
||||
std::memcpy(metadata.data(), dir_hash_table.data(), dir_hash_table.size() * sizeof(u32));
|
||||
index += dir_hash_table.size() * sizeof(u32);
|
||||
std::memcpy(metadata.data() + index, dir_table.data(), dir_table.size());
|
||||
index += dir_table.size();
|
||||
std::memcpy(metadata.data() + index, file_hash_table.data(),
|
||||
file_hash_table.size() * sizeof(u32));
|
||||
index += file_hash_table.size() * sizeof(u32);
|
||||
std::memcpy(metadata.data() + index, file_table.data(), file_table.size());
|
||||
out.emplace(header.dir_hash_table_ofs, std::make_shared<VectorVfsFile>(std::move(metadata)));
|
||||
|
||||
return out;
|
||||
}
|
||||
|
||||
@@ -22,14 +22,14 @@ public:
|
||||
~RomFSBuildContext();
|
||||
|
||||
// This finalizes the context.
|
||||
std::vector<std::pair<u64, VirtualFile>> Build();
|
||||
std::multimap<u64, VirtualFile> Build();
|
||||
|
||||
private:
|
||||
VirtualDir base;
|
||||
VirtualDir ext;
|
||||
std::shared_ptr<RomFSBuildDirectoryContext> root;
|
||||
std::vector<std::shared_ptr<RomFSBuildDirectoryContext>> directories;
|
||||
std::vector<std::shared_ptr<RomFSBuildFileContext>> files;
|
||||
std::map<std::string, std::shared_ptr<RomFSBuildDirectoryContext>, std::less<>> directories;
|
||||
std::map<std::string, std::shared_ptr<RomFSBuildFileContext>, std::less<>> files;
|
||||
u64 num_dirs = 0;
|
||||
u64 num_files = 0;
|
||||
u64 dir_table_size = 0;
|
||||
|
||||
@@ -55,68 +55,44 @@ struct FileEntry {
|
||||
};
|
||||
static_assert(sizeof(FileEntry) == 0x20, "FileEntry has incorrect size.");
|
||||
|
||||
struct RomFSTraversalContext {
|
||||
RomFSHeader header;
|
||||
VirtualFile file;
|
||||
std::vector<u8> directory_meta;
|
||||
std::vector<u8> file_meta;
|
||||
};
|
||||
|
||||
template <typename EntryType, auto Member>
|
||||
std::pair<EntryType, std::string> GetEntry(const RomFSTraversalContext& ctx, size_t offset) {
|
||||
const size_t entry_end = offset + sizeof(EntryType);
|
||||
const std::vector<u8>& vec = ctx.*Member;
|
||||
const size_t size = vec.size();
|
||||
const u8* data = vec.data();
|
||||
EntryType entry{};
|
||||
|
||||
if (entry_end > size) {
|
||||
template <typename Entry>
|
||||
std::pair<Entry, std::string> GetEntry(const VirtualFile& file, std::size_t offset) {
|
||||
Entry entry{};
|
||||
if (file->ReadObject(&entry, offset) != sizeof(Entry))
|
||||
return {};
|
||||
}
|
||||
std::memcpy(&entry, data + offset, sizeof(EntryType));
|
||||
|
||||
const size_t name_length = std::min(entry_end + entry.name_length, size) - entry_end;
|
||||
std::string name(reinterpret_cast<const char*>(data + entry_end), name_length);
|
||||
|
||||
return {entry, std::move(name)};
|
||||
std::string string(entry.name_length, '\0');
|
||||
if (file->ReadArray(&string[0], string.size(), offset + sizeof(Entry)) != string.size())
|
||||
return {};
|
||||
return {entry, string};
|
||||
}
|
||||
|
||||
std::pair<DirectoryEntry, std::string> GetDirectoryEntry(const RomFSTraversalContext& ctx,
|
||||
size_t directory_offset) {
|
||||
return GetEntry<DirectoryEntry, &RomFSTraversalContext::directory_meta>(ctx, directory_offset);
|
||||
}
|
||||
|
||||
std::pair<FileEntry, std::string> GetFileEntry(const RomFSTraversalContext& ctx,
|
||||
size_t file_offset) {
|
||||
return GetEntry<FileEntry, &RomFSTraversalContext::file_meta>(ctx, file_offset);
|
||||
}
|
||||
|
||||
void ProcessFile(const RomFSTraversalContext& ctx, u32 this_file_offset,
|
||||
std::shared_ptr<VectorVfsDirectory>& parent) {
|
||||
void ProcessFile(const VirtualFile& file, std::size_t file_offset, std::size_t data_offset,
|
||||
u32 this_file_offset, std::shared_ptr<VectorVfsDirectory>& parent) {
|
||||
while (this_file_offset != ROMFS_ENTRY_EMPTY) {
|
||||
auto entry = GetFileEntry(ctx, this_file_offset);
|
||||
auto entry = GetEntry<FileEntry>(file, file_offset + this_file_offset);
|
||||
|
||||
parent->AddFile(std::make_shared<OffsetVfsFile>(ctx.file, entry.first.size,
|
||||
entry.first.offset + ctx.header.data_offset,
|
||||
std::move(entry.second)));
|
||||
parent->AddFile(std::make_shared<OffsetVfsFile>(
|
||||
file, entry.first.size, entry.first.offset + data_offset, entry.second));
|
||||
|
||||
this_file_offset = entry.first.sibling;
|
||||
}
|
||||
}
|
||||
|
||||
void ProcessDirectory(const RomFSTraversalContext& ctx, u32 this_dir_offset,
|
||||
void ProcessDirectory(const VirtualFile& file, std::size_t dir_offset, std::size_t file_offset,
|
||||
std::size_t data_offset, u32 this_dir_offset,
|
||||
std::shared_ptr<VectorVfsDirectory>& parent) {
|
||||
while (this_dir_offset != ROMFS_ENTRY_EMPTY) {
|
||||
auto entry = GetDirectoryEntry(ctx, this_dir_offset);
|
||||
auto entry = GetEntry<DirectoryEntry>(file, dir_offset + this_dir_offset);
|
||||
auto current = std::make_shared<VectorVfsDirectory>(
|
||||
std::vector<VirtualFile>{}, std::vector<VirtualDir>{}, entry.second);
|
||||
|
||||
if (entry.first.child_file != ROMFS_ENTRY_EMPTY) {
|
||||
ProcessFile(ctx, entry.first.child_file, current);
|
||||
ProcessFile(file, file_offset, data_offset, entry.first.child_file, current);
|
||||
}
|
||||
|
||||
if (entry.first.child_dir != ROMFS_ENTRY_EMPTY) {
|
||||
ProcessDirectory(ctx, entry.first.child_dir, current);
|
||||
ProcessDirectory(file, dir_offset, file_offset, data_offset, entry.first.child_dir,
|
||||
current);
|
||||
}
|
||||
|
||||
parent->AddDirectory(current);
|
||||
@@ -131,25 +107,22 @@ VirtualDir ExtractRomFS(VirtualFile file) {
|
||||
return root_container;
|
||||
}
|
||||
|
||||
RomFSTraversalContext ctx{};
|
||||
|
||||
if (file->ReadObject(&ctx.header) != sizeof(RomFSHeader)) {
|
||||
return nullptr;
|
||||
RomFSHeader header{};
|
||||
if (file->ReadObject(&header) != sizeof(RomFSHeader)) {
|
||||
return root_container;
|
||||
}
|
||||
|
||||
if (ctx.header.header_size != sizeof(RomFSHeader)) {
|
||||
return nullptr;
|
||||
if (header.header_size != sizeof(RomFSHeader)) {
|
||||
return root_container;
|
||||
}
|
||||
|
||||
ctx.file = file;
|
||||
ctx.directory_meta =
|
||||
file->ReadBytes(ctx.header.directory_meta.size, ctx.header.directory_meta.offset);
|
||||
ctx.file_meta = file->ReadBytes(ctx.header.file_meta.size, ctx.header.file_meta.offset);
|
||||
const u64 file_offset = header.file_meta.offset;
|
||||
const u64 dir_offset = header.directory_meta.offset;
|
||||
|
||||
ProcessDirectory(ctx, 0, root_container);
|
||||
ProcessDirectory(file, dir_offset, file_offset, header.data_offset, 0, root_container);
|
||||
|
||||
if (auto root = root_container->GetSubdirectory(""); root) {
|
||||
return root;
|
||||
return std::make_shared<CachedVfsDirectory>(std::move(root));
|
||||
}
|
||||
|
||||
ASSERT(false);
|
||||
|
||||
@@ -12,6 +12,8 @@
|
||||
|
||||
namespace FileSys {
|
||||
|
||||
constexpr char SAVE_DATA_SIZE_FILENAME[] = ".yuzu_save_size";
|
||||
|
||||
namespace {
|
||||
|
||||
void PrintSaveDataAttributeWarnings(SaveDataAttribute meta) {
|
||||
@@ -195,7 +197,7 @@ SaveDataSize SaveDataFactory::ReadSaveDataSize(SaveDataType type, u64 title_id,
|
||||
GetFullPath(system, dir, SaveDataSpaceId::NandUser, type, title_id, user_id, 0);
|
||||
const auto relative_dir = GetOrCreateDirectoryRelative(dir, path);
|
||||
|
||||
const auto size_file = relative_dir->GetFile(GetSaveDataSizeFileName());
|
||||
const auto size_file = relative_dir->GetFile(SAVE_DATA_SIZE_FILENAME);
|
||||
if (size_file == nullptr || size_file->GetSize() < sizeof(SaveDataSize)) {
|
||||
return {0, 0};
|
||||
}
|
||||
@@ -214,7 +216,7 @@ void SaveDataFactory::WriteSaveDataSize(SaveDataType type, u64 title_id, u128 us
|
||||
GetFullPath(system, dir, SaveDataSpaceId::NandUser, type, title_id, user_id, 0);
|
||||
const auto relative_dir = GetOrCreateDirectoryRelative(dir, path);
|
||||
|
||||
const auto size_file = relative_dir->CreateFile(GetSaveDataSizeFileName());
|
||||
const auto size_file = relative_dir->CreateFile(SAVE_DATA_SIZE_FILENAME);
|
||||
if (size_file == nullptr) {
|
||||
return;
|
||||
}
|
||||
|
||||
@@ -83,10 +83,6 @@ struct SaveDataSize {
|
||||
u64 journal;
|
||||
};
|
||||
|
||||
constexpr const char* GetSaveDataSizeFileName() {
|
||||
return ".yuzu_save_size";
|
||||
}
|
||||
|
||||
/// File system interface to the SaveData archive
|
||||
class SaveDataFactory {
|
||||
public:
|
||||
|
||||
@@ -59,8 +59,8 @@ VirtualFile ConcatenatedVfsFile::MakeConcatenatedFile(std::string&& name,
|
||||
return VirtualFile(new ConcatenatedVfsFile(std::move(name), std::move(concatenation_map)));
|
||||
}
|
||||
|
||||
VirtualFile ConcatenatedVfsFile::MakeConcatenatedFile(
|
||||
u8 filler_byte, std::string&& name, std::vector<std::pair<u64, VirtualFile>>&& files) {
|
||||
VirtualFile ConcatenatedVfsFile::MakeConcatenatedFile(u8 filler_byte, std::string&& name,
|
||||
std::multimap<u64, VirtualFile>&& files) {
|
||||
// Fold trivial cases.
|
||||
if (files.empty()) {
|
||||
return nullptr;
|
||||
|
||||
@@ -37,7 +37,7 @@ public:
|
||||
/// Convenience function that turns a map of offsets to files into a concatenated file, filling
|
||||
/// gaps with a given filler byte.
|
||||
static VirtualFile MakeConcatenatedFile(u8 filler_byte, std::string&& name,
|
||||
std::vector<std::pair<u64, VirtualFile>>&& files);
|
||||
std::multimap<u64, VirtualFile>&& files);
|
||||
|
||||
std::string GetName() const override;
|
||||
std::size_t GetSize() const override;
|
||||
|
||||
@@ -3,7 +3,6 @@
|
||||
|
||||
#include <algorithm>
|
||||
#include <set>
|
||||
#include <unordered_set>
|
||||
#include <utility>
|
||||
#include "core/file_sys/vfs_layered.h"
|
||||
|
||||
@@ -60,12 +59,13 @@ std::string LayeredVfsDirectory::GetFullPath() const {
|
||||
|
||||
std::vector<VirtualFile> LayeredVfsDirectory::GetFiles() const {
|
||||
std::vector<VirtualFile> out;
|
||||
std::unordered_set<std::string> out_names;
|
||||
std::set<std::string, std::less<>> out_names;
|
||||
|
||||
for (const auto& layer : dirs) {
|
||||
for (auto& file : layer->GetFiles()) {
|
||||
const auto [it, is_new] = out_names.emplace(file->GetName());
|
||||
if (is_new) {
|
||||
auto file_name = file->GetName();
|
||||
if (!out_names.contains(file_name)) {
|
||||
out_names.emplace(std::move(file_name));
|
||||
out.emplace_back(std::move(file));
|
||||
}
|
||||
}
|
||||
@@ -75,19 +75,18 @@ std::vector<VirtualFile> LayeredVfsDirectory::GetFiles() const {
|
||||
}
|
||||
|
||||
std::vector<VirtualDir> LayeredVfsDirectory::GetSubdirectories() const {
|
||||
std::vector<VirtualDir> out;
|
||||
std::unordered_set<std::string> out_names;
|
||||
|
||||
std::vector<std::string> names;
|
||||
for (const auto& layer : dirs) {
|
||||
for (const auto& sd : layer->GetSubdirectories()) {
|
||||
out_names.emplace(sd->GetName());
|
||||
if (std::find(names.begin(), names.end(), sd->GetName()) == names.end())
|
||||
names.push_back(sd->GetName());
|
||||
}
|
||||
}
|
||||
|
||||
out.reserve(out_names.size());
|
||||
for (const auto& subdir : out_names) {
|
||||
std::vector<VirtualDir> out;
|
||||
out.reserve(names.size());
|
||||
for (const auto& subdir : names)
|
||||
out.emplace_back(GetSubdirectory(subdir));
|
||||
}
|
||||
|
||||
return out;
|
||||
}
|
||||
|
||||
@@ -3,7 +3,6 @@
|
||||
|
||||
#include "common/scope_exit.h"
|
||||
#include "core/hle/kernel/k_client_port.h"
|
||||
#include "core/hle/kernel/k_light_session.h"
|
||||
#include "core/hle/kernel/k_port.h"
|
||||
#include "core/hle/kernel/k_scheduler.h"
|
||||
#include "core/hle/kernel/k_scoped_resource_reservation.h"
|
||||
@@ -64,7 +63,6 @@ Result KClientPort::CreateSession(KClientSession** out) {
|
||||
R_UNLESS(session_reservation.Succeeded(), ResultLimitReached);
|
||||
|
||||
// Allocate a session normally.
|
||||
// TODO: Dynamic resource limits
|
||||
session = KSession::Create(m_kernel);
|
||||
|
||||
// Check that we successfully created a session.
|
||||
@@ -121,71 +119,4 @@ Result KClientPort::CreateSession(KClientSession** out) {
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
||||
Result KClientPort::CreateLightSession(KLightClientSession** out) {
|
||||
// Declare the session we're going to allocate.
|
||||
KLightSession* session{};
|
||||
|
||||
// Reserve a new session from the resource limit.
|
||||
KScopedResourceReservation session_reservation(GetCurrentProcessPointer(m_kernel),
|
||||
Svc::LimitableResource::SessionCountMax);
|
||||
R_UNLESS(session_reservation.Succeeded(), ResultLimitReached);
|
||||
|
||||
// Allocate a session normally.
|
||||
// TODO: Dynamic resource limits
|
||||
session = KLightSession::Create(m_kernel);
|
||||
|
||||
// Check that we successfully created a session.
|
||||
R_UNLESS(session != nullptr, ResultOutOfResource);
|
||||
|
||||
// Update the session counts.
|
||||
{
|
||||
ON_RESULT_FAILURE {
|
||||
session->Close();
|
||||
};
|
||||
|
||||
// Atomically increment the number of sessions.
|
||||
s32 new_sessions;
|
||||
{
|
||||
const auto max = m_max_sessions;
|
||||
auto cur_sessions = m_num_sessions.load(std::memory_order_acquire);
|
||||
do {
|
||||
R_UNLESS(cur_sessions < max, ResultOutOfSessions);
|
||||
new_sessions = cur_sessions + 1;
|
||||
} while (!m_num_sessions.compare_exchange_weak(cur_sessions, new_sessions,
|
||||
std::memory_order_relaxed));
|
||||
}
|
||||
|
||||
// Atomically update the peak session tracking.
|
||||
{
|
||||
auto peak = m_peak_sessions.load(std::memory_order_acquire);
|
||||
do {
|
||||
if (peak >= new_sessions) {
|
||||
break;
|
||||
}
|
||||
} while (!m_peak_sessions.compare_exchange_weak(peak, new_sessions,
|
||||
std::memory_order_relaxed));
|
||||
}
|
||||
}
|
||||
|
||||
// Initialize the session.
|
||||
session->Initialize(this, m_parent->GetName());
|
||||
|
||||
// Commit the session reservation.
|
||||
session_reservation.Commit();
|
||||
|
||||
// Register the session.
|
||||
KLightSession::Register(m_kernel, session);
|
||||
ON_RESULT_FAILURE {
|
||||
session->GetClientSession().Close();
|
||||
session->GetServerSession().Close();
|
||||
};
|
||||
|
||||
// Enqueue the session with our parent.
|
||||
R_TRY(m_parent->EnqueueSession(std::addressof(session->GetServerSession())));
|
||||
|
||||
// We succeeded, so set the output.
|
||||
*out = std::addressof(session->GetClientSession());
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
||||
} // namespace Kernel
|
||||
|
||||
@@ -11,7 +11,6 @@
|
||||
|
||||
namespace Kernel {
|
||||
|
||||
class KLightClientSession;
|
||||
class KClientSession;
|
||||
class KernelCore;
|
||||
class KPort;
|
||||
@@ -52,7 +51,6 @@ public:
|
||||
bool IsSignaled() const override;
|
||||
|
||||
Result CreateSession(KClientSession** out);
|
||||
Result CreateLightSession(KLightClientSession** out);
|
||||
|
||||
private:
|
||||
std::atomic<s32> m_num_sessions{};
|
||||
|
||||
@@ -10,7 +10,9 @@
|
||||
|
||||
namespace Kernel {
|
||||
|
||||
KClientSession::KClientSession(KernelCore& kernel) : KAutoObject{kernel} {}
|
||||
static constexpr u32 MessageBufferSize = 0x100;
|
||||
|
||||
KClientSession::KClientSession(KernelCore& kernel) : KAutoObjectWithSlabHeapAndContainer{kernel} {}
|
||||
KClientSession::~KClientSession() = default;
|
||||
|
||||
void KClientSession::Destroy() {
|
||||
@@ -20,30 +22,18 @@ void KClientSession::Destroy() {
|
||||
|
||||
void KClientSession::OnServerClosed() {}
|
||||
|
||||
Result KClientSession::SendSyncRequest(uintptr_t address, size_t size) {
|
||||
Result KClientSession::SendSyncRequest() {
|
||||
// Create a session request.
|
||||
KSessionRequest* request = KSessionRequest::Create(m_kernel);
|
||||
R_UNLESS(request != nullptr, ResultOutOfResource);
|
||||
SCOPE_EXIT({ request->Close(); });
|
||||
|
||||
// Initialize the request.
|
||||
request->Initialize(nullptr, address, size);
|
||||
request->Initialize(nullptr, GetInteger(GetCurrentThread(m_kernel).GetTlsAddress()),
|
||||
MessageBufferSize);
|
||||
|
||||
// Send the request.
|
||||
R_RETURN(m_parent->OnRequest(request));
|
||||
}
|
||||
|
||||
Result KClientSession::SendAsyncRequest(KEvent* event, uintptr_t address, size_t size) {
|
||||
// Create a session request.
|
||||
KSessionRequest* request = KSessionRequest::Create(m_kernel);
|
||||
R_UNLESS(request != nullptr, ResultOutOfResource);
|
||||
SCOPE_EXIT({ request->Close(); });
|
||||
|
||||
// Initialize the request.
|
||||
request->Initialize(event, address, size);
|
||||
|
||||
// Send the request.
|
||||
R_RETURN(m_parent->OnRequest(request));
|
||||
R_RETURN(m_parent->GetServerSession().OnRequest(request));
|
||||
}
|
||||
|
||||
} // namespace Kernel
|
||||
|
||||
@@ -9,12 +9,24 @@
|
||||
#include "core/hle/kernel/slab_helpers.h"
|
||||
#include "core/hle/result.h"
|
||||
|
||||
union Result;
|
||||
|
||||
namespace Core::Memory {
|
||||
class Memory;
|
||||
}
|
||||
|
||||
namespace Core::Timing {
|
||||
class CoreTiming;
|
||||
}
|
||||
|
||||
namespace Kernel {
|
||||
|
||||
class KernelCore;
|
||||
class KSession;
|
||||
class KThread;
|
||||
|
||||
class KClientSession final : public KAutoObject {
|
||||
class KClientSession final
|
||||
: public KAutoObjectWithSlabHeapAndContainer<KClientSession, KAutoObjectWithList> {
|
||||
KERNEL_AUTOOBJECT_TRAITS(KClientSession, KAutoObject);
|
||||
|
||||
public:
|
||||
@@ -27,13 +39,13 @@ public:
|
||||
}
|
||||
|
||||
void Destroy() override;
|
||||
static void PostDestroy(uintptr_t arg) {}
|
||||
|
||||
KSession* GetParent() const {
|
||||
return m_parent;
|
||||
}
|
||||
|
||||
Result SendSyncRequest(uintptr_t address, size_t size);
|
||||
Result SendAsyncRequest(KEvent* event, uintptr_t address, size_t size);
|
||||
Result SendSyncRequest();
|
||||
|
||||
void OnServerClosed();
|
||||
|
||||
|
||||
@@ -1,31 +0,0 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2023 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include "core/hle/kernel/k_light_client_session.h"
|
||||
#include "core/hle/kernel/k_light_session.h"
|
||||
#include "core/hle/kernel/k_thread.h"
|
||||
|
||||
namespace Kernel {
|
||||
|
||||
KLightClientSession::KLightClientSession(KernelCore& kernel) : KAutoObject(kernel) {}
|
||||
|
||||
KLightClientSession::~KLightClientSession() = default;
|
||||
|
||||
void KLightClientSession::Destroy() {
|
||||
m_parent->OnClientClosed();
|
||||
}
|
||||
|
||||
void KLightClientSession::OnServerClosed() {}
|
||||
|
||||
Result KLightClientSession::SendSyncRequest(u32* data) {
|
||||
// Get the request thread.
|
||||
KThread* cur_thread = GetCurrentThreadPointer(m_kernel);
|
||||
|
||||
// Set the light data.
|
||||
cur_thread->SetLightSessionData(data);
|
||||
|
||||
// Send the request.
|
||||
R_RETURN(m_parent->OnRequest(cur_thread));
|
||||
}
|
||||
|
||||
} // namespace Kernel
|
||||
@@ -1,39 +0,0 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2023 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#pragma once
|
||||
|
||||
#include "core/hle/kernel/k_auto_object.h"
|
||||
#include "core/hle/result.h"
|
||||
|
||||
namespace Kernel {
|
||||
|
||||
class KLightSession;
|
||||
|
||||
class KLightClientSession final : public KAutoObject {
|
||||
KERNEL_AUTOOBJECT_TRAITS(KLightClientSession, KAutoObject);
|
||||
|
||||
public:
|
||||
explicit KLightClientSession(KernelCore& kernel);
|
||||
~KLightClientSession();
|
||||
|
||||
void Initialize(KLightSession* parent) {
|
||||
// Set member variables.
|
||||
m_parent = parent;
|
||||
}
|
||||
|
||||
virtual void Destroy() override;
|
||||
|
||||
const KLightSession* GetParent() const {
|
||||
return m_parent;
|
||||
}
|
||||
|
||||
Result SendSyncRequest(u32* data);
|
||||
|
||||
void OnServerClosed();
|
||||
|
||||
private:
|
||||
KLightSession* m_parent;
|
||||
};
|
||||
|
||||
} // namespace Kernel
|
||||
@@ -1,247 +0,0 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2023 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include "core/hle/kernel/k_light_server_session.h"
|
||||
#include "core/hle/kernel/k_light_session.h"
|
||||
#include "core/hle/kernel/k_thread.h"
|
||||
#include "core/hle/kernel/k_thread_queue.h"
|
||||
#include "core/hle/kernel/svc_results.h"
|
||||
|
||||
namespace Kernel {
|
||||
|
||||
namespace {
|
||||
|
||||
constexpr u64 InvalidThreadId = std::numeric_limits<u64>::max();
|
||||
|
||||
class ThreadQueueImplForKLightServerSessionRequest final : public KThreadQueue {
|
||||
private:
|
||||
KThread::WaiterList* m_wait_list;
|
||||
|
||||
public:
|
||||
ThreadQueueImplForKLightServerSessionRequest(KernelCore& kernel, KThread::WaiterList* wl)
|
||||
: KThreadQueue(kernel), m_wait_list(wl) {}
|
||||
|
||||
virtual void EndWait(KThread* waiting_thread, Result wait_result) override {
|
||||
// Remove the thread from our wait list.
|
||||
m_wait_list->erase(m_wait_list->iterator_to(*waiting_thread));
|
||||
|
||||
// Invoke the base end wait handler.
|
||||
KThreadQueue::EndWait(waiting_thread, wait_result);
|
||||
}
|
||||
|
||||
virtual void CancelWait(KThread* waiting_thread, Result wait_result,
|
||||
bool cancel_timer_task) override {
|
||||
// Remove the thread from our wait list.
|
||||
m_wait_list->erase(m_wait_list->iterator_to(*waiting_thread));
|
||||
|
||||
// Invoke the base cancel wait handler.
|
||||
KThreadQueue::CancelWait(waiting_thread, wait_result, cancel_timer_task);
|
||||
}
|
||||
};
|
||||
|
||||
class ThreadQueueImplForKLightServerSessionReceive final : public KThreadQueue {
|
||||
private:
|
||||
KThread** m_server_thread;
|
||||
|
||||
public:
|
||||
ThreadQueueImplForKLightServerSessionReceive(KernelCore& kernel, KThread** st)
|
||||
: KThreadQueue(kernel), m_server_thread(st) {}
|
||||
|
||||
virtual void EndWait(KThread* waiting_thread, Result wait_result) override {
|
||||
// Clear the server thread.
|
||||
*m_server_thread = nullptr;
|
||||
|
||||
// Set the waiting thread as not cancelable.
|
||||
waiting_thread->ClearCancellable();
|
||||
|
||||
// Invoke the base end wait handler.
|
||||
KThreadQueue::EndWait(waiting_thread, wait_result);
|
||||
}
|
||||
|
||||
virtual void CancelWait(KThread* waiting_thread, Result wait_result,
|
||||
bool cancel_timer_task) override {
|
||||
// Clear the server thread.
|
||||
*m_server_thread = nullptr;
|
||||
|
||||
// Set the waiting thread as not cancelable.
|
||||
waiting_thread->ClearCancellable();
|
||||
|
||||
// Invoke the base cancel wait handler.
|
||||
KThreadQueue::CancelWait(waiting_thread, wait_result, cancel_timer_task);
|
||||
}
|
||||
};
|
||||
|
||||
} // namespace
|
||||
|
||||
KLightServerSession::KLightServerSession(KernelCore& kernel) : KAutoObject(kernel) {}
|
||||
KLightServerSession::~KLightServerSession() = default;
|
||||
|
||||
void KLightServerSession::Destroy() {
|
||||
this->CleanupRequests();
|
||||
|
||||
m_parent->OnServerClosed();
|
||||
}
|
||||
|
||||
void KLightServerSession::OnClientClosed() {
|
||||
this->CleanupRequests();
|
||||
}
|
||||
|
||||
Result KLightServerSession::OnRequest(KThread* request_thread) {
|
||||
ThreadQueueImplForKLightServerSessionRequest wait_queue(m_kernel,
|
||||
std::addressof(m_request_list));
|
||||
|
||||
// Send the request.
|
||||
{
|
||||
// Lock the scheduler.
|
||||
KScopedSchedulerLock sl(m_kernel);
|
||||
|
||||
// Check that the server isn't closed.
|
||||
R_UNLESS(!m_parent->IsServerClosed(), ResultSessionClosed);
|
||||
|
||||
// Check that the request thread isn't terminating.
|
||||
R_UNLESS(!request_thread->IsTerminationRequested(), ResultTerminationRequested);
|
||||
|
||||
// Add the request thread to our list.
|
||||
m_request_list.push_back(*request_thread);
|
||||
|
||||
// Begin waiting on the request.
|
||||
request_thread->SetWaitReasonForDebugging(ThreadWaitReasonForDebugging::IPC);
|
||||
request_thread->BeginWait(std::addressof(wait_queue));
|
||||
|
||||
// If we have a server thread, end its wait.
|
||||
if (m_server_thread != nullptr) {
|
||||
m_server_thread->EndWait(ResultSuccess);
|
||||
}
|
||||
}
|
||||
|
||||
// NOTE: Nintendo returns GetCurrentThread().GetWaitResult() here.
|
||||
// This is technically incorrect, although it doesn't cause problems in practice
|
||||
// because this is only ever called with request_thread = GetCurrentThreadPointer().
|
||||
R_RETURN(request_thread->GetWaitResult());
|
||||
}
|
||||
|
||||
Result KLightServerSession::ReplyAndReceive(u32* data) {
|
||||
// Set the server context.
|
||||
GetCurrentThread(m_kernel).SetLightSessionData(data);
|
||||
|
||||
// Reply, if we need to.
|
||||
if (data[0] & KLightSession::ReplyFlag) {
|
||||
KScopedSchedulerLock sl(m_kernel);
|
||||
|
||||
// Check that we're open.
|
||||
R_UNLESS(!m_parent->IsClientClosed(), ResultSessionClosed);
|
||||
R_UNLESS(!m_parent->IsServerClosed(), ResultSessionClosed);
|
||||
|
||||
// Check that we have a request to reply to.
|
||||
R_UNLESS(m_current_request != nullptr, ResultInvalidState);
|
||||
|
||||
// Check that the server thread id is correct.
|
||||
R_UNLESS(m_server_thread_id == GetCurrentThread(m_kernel).GetId(), ResultInvalidState);
|
||||
|
||||
// If we can reply, do so.
|
||||
if (!m_current_request->IsTerminationRequested()) {
|
||||
std::memcpy(m_current_request->GetLightSessionData(),
|
||||
GetCurrentThread(m_kernel).GetLightSessionData(), KLightSession::DataSize);
|
||||
m_current_request->EndWait(ResultSuccess);
|
||||
}
|
||||
|
||||
// Close our current request.
|
||||
m_current_request->Close();
|
||||
|
||||
// Clear our current request.
|
||||
m_current_request = nullptr;
|
||||
m_server_thread_id = InvalidThreadId;
|
||||
}
|
||||
|
||||
// Create the wait queue for our receive.
|
||||
ThreadQueueImplForKLightServerSessionReceive wait_queue(m_kernel,
|
||||
std::addressof(m_server_thread));
|
||||
|
||||
// Receive.
|
||||
while (true) {
|
||||
// Try to receive a request.
|
||||
{
|
||||
KScopedSchedulerLock sl(m_kernel);
|
||||
|
||||
// Check that we aren't already receiving.
|
||||
R_UNLESS(m_server_thread == nullptr, ResultInvalidState);
|
||||
R_UNLESS(m_server_thread_id == InvalidThreadId, ResultInvalidState);
|
||||
|
||||
// Check that we're open.
|
||||
R_UNLESS(!m_parent->IsClientClosed(), ResultSessionClosed);
|
||||
R_UNLESS(!m_parent->IsServerClosed(), ResultSessionClosed);
|
||||
|
||||
// Check that we're not terminating.
|
||||
R_UNLESS(!GetCurrentThread(m_kernel).IsTerminationRequested(),
|
||||
ResultTerminationRequested);
|
||||
|
||||
// If we have a request available, use it.
|
||||
if (auto head = m_request_list.begin(); head != m_request_list.end()) {
|
||||
// Set our current request.
|
||||
m_current_request = std::addressof(*head);
|
||||
m_current_request->Open();
|
||||
|
||||
// Set our server thread id.
|
||||
m_server_thread_id = GetCurrentThread(m_kernel).GetId();
|
||||
|
||||
// Copy the client request data.
|
||||
std::memcpy(GetCurrentThread(m_kernel).GetLightSessionData(),
|
||||
m_current_request->GetLightSessionData(), KLightSession::DataSize);
|
||||
|
||||
// We successfully received.
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
||||
// We need to wait for a request to come in.
|
||||
|
||||
// Check if we were cancelled.
|
||||
if (GetCurrentThread(m_kernel).IsWaitCancelled()) {
|
||||
GetCurrentThread(m_kernel).ClearWaitCancelled();
|
||||
R_THROW(ResultCancelled);
|
||||
}
|
||||
|
||||
// Mark ourselves as cancellable.
|
||||
GetCurrentThread(m_kernel).SetCancellable();
|
||||
|
||||
// Wait for a request to come in.
|
||||
m_server_thread = GetCurrentThreadPointer(m_kernel);
|
||||
GetCurrentThread(m_kernel).SetWaitReasonForDebugging(ThreadWaitReasonForDebugging::IPC);
|
||||
GetCurrentThread(m_kernel).BeginWait(std::addressof(wait_queue));
|
||||
}
|
||||
|
||||
// We waited to receive a request; if our wait failed, return the failing result.
|
||||
R_TRY(GetCurrentThread(m_kernel).GetWaitResult());
|
||||
}
|
||||
}
|
||||
|
||||
void KLightServerSession::CleanupRequests() {
|
||||
// Cleanup all pending requests.
|
||||
{
|
||||
KScopedSchedulerLock sl(m_kernel);
|
||||
|
||||
// Handle the current request.
|
||||
if (m_current_request != nullptr) {
|
||||
// Reply to the current request.
|
||||
if (!m_current_request->IsTerminationRequested()) {
|
||||
m_current_request->EndWait(ResultSessionClosed);
|
||||
}
|
||||
|
||||
// Clear our current request.
|
||||
m_current_request->Close();
|
||||
m_current_request = nullptr;
|
||||
m_server_thread_id = InvalidThreadId;
|
||||
}
|
||||
|
||||
// Reply to all other requests.
|
||||
for (auto& thread : m_request_list) {
|
||||
thread.EndWait(ResultSessionClosed);
|
||||
}
|
||||
|
||||
// Wait up our server thread, if we have one.
|
||||
if (m_server_thread != nullptr) {
|
||||
m_server_thread->EndWait(ResultSessionClosed);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
} // namespace Kernel
|
||||
@@ -1,49 +0,0 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2023 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#pragma once
|
||||
|
||||
#include "core/hle/kernel/k_auto_object.h"
|
||||
#include "core/hle/kernel/k_thread.h"
|
||||
#include "core/hle/result.h"
|
||||
|
||||
namespace Kernel {
|
||||
|
||||
class KLightSession;
|
||||
|
||||
class KLightServerSession final : public KAutoObject,
|
||||
public Common::IntrusiveListBaseNode<KLightServerSession> {
|
||||
KERNEL_AUTOOBJECT_TRAITS(KLightServerSession, KAutoObject);
|
||||
|
||||
private:
|
||||
KLightSession* m_parent{};
|
||||
KThread::WaiterList m_request_list{};
|
||||
KThread* m_current_request{};
|
||||
u64 m_server_thread_id{std::numeric_limits<u64>::max()};
|
||||
KThread* m_server_thread{};
|
||||
|
||||
public:
|
||||
explicit KLightServerSession(KernelCore& kernel);
|
||||
~KLightServerSession();
|
||||
|
||||
void Initialize(KLightSession* parent) {
|
||||
// Set member variables. */
|
||||
m_parent = parent;
|
||||
}
|
||||
|
||||
virtual void Destroy() override;
|
||||
|
||||
constexpr const KLightSession* GetParent() const {
|
||||
return m_parent;
|
||||
}
|
||||
|
||||
Result OnRequest(KThread* request_thread);
|
||||
Result ReplyAndReceive(u32* data);
|
||||
|
||||
void OnClientClosed();
|
||||
|
||||
private:
|
||||
void CleanupRequests();
|
||||
};
|
||||
|
||||
} // namespace Kernel
|
||||
@@ -1,81 +0,0 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2023 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include "core/hle/kernel/k_client_port.h"
|
||||
#include "core/hle/kernel/k_light_client_session.h"
|
||||
#include "core/hle/kernel/k_light_server_session.h"
|
||||
#include "core/hle/kernel/k_light_session.h"
|
||||
#include "core/hle/kernel/k_process.h"
|
||||
|
||||
namespace Kernel {
|
||||
|
||||
KLightSession::KLightSession(KernelCore& kernel)
|
||||
: KAutoObjectWithSlabHeapAndContainer(kernel), m_server(kernel), m_client(kernel) {}
|
||||
KLightSession::~KLightSession() = default;
|
||||
|
||||
void KLightSession::Initialize(KClientPort* client_port, uintptr_t name) {
|
||||
// Increment reference count.
|
||||
// Because reference count is one on creation, this will result
|
||||
// in a reference count of two. Thus, when both server and client are closed
|
||||
// this object will be destroyed.
|
||||
this->Open();
|
||||
|
||||
// Create our sub sessions.
|
||||
KAutoObject::Create(std::addressof(m_server));
|
||||
KAutoObject::Create(std::addressof(m_client));
|
||||
|
||||
// Initialize our sub sessions.
|
||||
m_server.Initialize(this);
|
||||
m_client.Initialize(this);
|
||||
|
||||
// Set state and name.
|
||||
m_state = State::Normal;
|
||||
m_name = name;
|
||||
|
||||
// Set our owner process.
|
||||
m_process = GetCurrentProcessPointer(m_kernel);
|
||||
m_process->Open();
|
||||
|
||||
// Set our port.
|
||||
m_port = client_port;
|
||||
if (m_port != nullptr) {
|
||||
m_port->Open();
|
||||
}
|
||||
|
||||
// Mark initialized.
|
||||
m_initialized = true;
|
||||
}
|
||||
|
||||
void KLightSession::Finalize() {
|
||||
if (m_port != nullptr) {
|
||||
m_port->OnSessionFinalized();
|
||||
m_port->Close();
|
||||
}
|
||||
}
|
||||
|
||||
void KLightSession::OnServerClosed() {
|
||||
if (m_state == State::Normal) {
|
||||
m_state = State::ServerClosed;
|
||||
m_client.OnServerClosed();
|
||||
}
|
||||
|
||||
this->Close();
|
||||
}
|
||||
|
||||
void KLightSession::OnClientClosed() {
|
||||
if (m_state == State::Normal) {
|
||||
m_state = State::ClientClosed;
|
||||
m_server.OnClientClosed();
|
||||
}
|
||||
|
||||
this->Close();
|
||||
}
|
||||
|
||||
void KLightSession::PostDestroy(uintptr_t arg) {
|
||||
// Release the session count resource the owner process holds.
|
||||
KProcess* owner = reinterpret_cast<KProcess*>(arg);
|
||||
owner->ReleaseResource(Svc::LimitableResource::SessionCountMax, 1);
|
||||
owner->Close();
|
||||
}
|
||||
|
||||
} // namespace Kernel
|
||||
@@ -1,86 +0,0 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2023 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#pragma once
|
||||
|
||||
#include "core/hle/kernel/k_light_client_session.h"
|
||||
#include "core/hle/kernel/k_light_server_session.h"
|
||||
#include "core/hle/kernel/slab_helpers.h"
|
||||
#include "core/hle/result.h"
|
||||
|
||||
namespace Kernel {
|
||||
|
||||
class KClientPort;
|
||||
class KProcess;
|
||||
|
||||
// TODO: SupportDynamicExpansion for SlabHeap
|
||||
class KLightSession final
|
||||
: public KAutoObjectWithSlabHeapAndContainer<KLightSession, KAutoObjectWithList> {
|
||||
KERNEL_AUTOOBJECT_TRAITS(KLightSession, KAutoObject);
|
||||
|
||||
private:
|
||||
enum class State : u8 {
|
||||
Invalid = 0,
|
||||
Normal = 1,
|
||||
ClientClosed = 2,
|
||||
ServerClosed = 3,
|
||||
};
|
||||
|
||||
public:
|
||||
static constexpr size_t DataSize = sizeof(u32) * 7;
|
||||
static constexpr u32 ReplyFlag = (1U << 31);
|
||||
|
||||
private:
|
||||
KLightServerSession m_server;
|
||||
KLightClientSession m_client;
|
||||
State m_state{State::Invalid};
|
||||
KClientPort* m_port{};
|
||||
uintptr_t m_name{};
|
||||
KProcess* m_process{};
|
||||
bool m_initialized{};
|
||||
|
||||
public:
|
||||
explicit KLightSession(KernelCore& kernel);
|
||||
~KLightSession();
|
||||
|
||||
void Initialize(KClientPort* client_port, uintptr_t name);
|
||||
void Finalize() override;
|
||||
|
||||
bool IsInitialized() const override {
|
||||
return m_initialized;
|
||||
}
|
||||
uintptr_t GetPostDestroyArgument() const override {
|
||||
return reinterpret_cast<uintptr_t>(m_process);
|
||||
}
|
||||
|
||||
static void PostDestroy(uintptr_t arg);
|
||||
|
||||
void OnServerClosed();
|
||||
void OnClientClosed();
|
||||
|
||||
bool IsServerClosed() const {
|
||||
return m_state != State::Normal;
|
||||
}
|
||||
bool IsClientClosed() const {
|
||||
return m_state != State::Normal;
|
||||
}
|
||||
|
||||
Result OnRequest(KThread* request_thread) {
|
||||
R_RETURN(m_server.OnRequest(request_thread));
|
||||
}
|
||||
|
||||
KLightClientSession& GetClientSession() {
|
||||
return m_client;
|
||||
}
|
||||
KLightServerSession& GetServerSession() {
|
||||
return m_server;
|
||||
}
|
||||
const KLightClientSession& GetClientSession() const {
|
||||
return m_client;
|
||||
}
|
||||
const KLightServerSession& GetServerSession() const {
|
||||
return m_server;
|
||||
}
|
||||
};
|
||||
|
||||
} // namespace Kernel
|
||||
@@ -69,16 +69,8 @@ public:
|
||||
};
|
||||
|
||||
template <typename AddressType>
|
||||
void InvalidateInstructionCache(KernelCore& kernel, AddressType addr, u64 size) {
|
||||
// TODO: lock the process list
|
||||
for (auto& process : kernel.GetProcessList()) {
|
||||
for (size_t i = 0; i < Core::Hardware::NUM_CPU_CORES; i++) {
|
||||
auto* interface = process->GetArmInterface(i);
|
||||
if (interface) {
|
||||
interface->InvalidateCacheRange(GetInteger(addr), size);
|
||||
}
|
||||
}
|
||||
}
|
||||
void InvalidateInstructionCache(Core::System& system, AddressType addr, u64 size) {
|
||||
system.InvalidateCpuInstructionCacheRange(GetInteger(addr), size);
|
||||
}
|
||||
|
||||
template <typename AddressType>
|
||||
@@ -1269,7 +1261,7 @@ Result KPageTableBase::UnmapCodeMemory(KProcessAddress dst_address, KProcessAddr
|
||||
bool reprotected_pages = false;
|
||||
SCOPE_EXIT({
|
||||
if (reprotected_pages && any_code_pages) {
|
||||
InvalidateInstructionCache(m_kernel, dst_address, size);
|
||||
InvalidateInstructionCache(m_system, dst_address, size);
|
||||
}
|
||||
});
|
||||
|
||||
@@ -2005,7 +1997,7 @@ Result KPageTableBase::SetProcessMemoryPermission(KProcessAddress addr, size_t s
|
||||
for (const auto& block : pg) {
|
||||
StoreDataCache(GetHeapVirtualPointer(m_kernel, block.GetAddress()), block.GetSize());
|
||||
}
|
||||
InvalidateInstructionCache(m_kernel, addr, size);
|
||||
InvalidateInstructionCache(m_system, addr, size);
|
||||
}
|
||||
|
||||
R_SUCCEED();
|
||||
@@ -3247,7 +3239,7 @@ Result KPageTableBase::WriteDebugMemory(KProcessAddress dst_address, KProcessAdd
|
||||
R_TRY(PerformCopy());
|
||||
|
||||
// Invalidate the instruction cache, as this svc allows modifying executable pages.
|
||||
InvalidateInstructionCache(m_kernel, dst_address, size);
|
||||
InvalidateInstructionCache(m_system, dst_address, size);
|
||||
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
||||
@@ -58,13 +58,4 @@ Result KPort::EnqueueSession(KServerSession* session) {
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
||||
Result KPort::EnqueueSession(KLightServerSession* session) {
|
||||
KScopedSchedulerLock sl{m_kernel};
|
||||
|
||||
R_UNLESS(m_state == State::Normal, ResultPortClosed);
|
||||
|
||||
m_server.EnqueueSession(session);
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
||||
} // namespace Kernel
|
||||
|
||||
@@ -13,7 +13,6 @@
|
||||
|
||||
namespace Kernel {
|
||||
|
||||
class KLightServerSession;
|
||||
class KServerSession;
|
||||
|
||||
class KPort final : public KAutoObjectWithSlabHeapAndContainer<KPort, KAutoObjectWithList> {
|
||||
@@ -39,7 +38,6 @@ public:
|
||||
bool IsServerClosed() const;
|
||||
|
||||
Result EnqueueSession(KServerSession* session);
|
||||
Result EnqueueSession(KLightServerSession* session);
|
||||
|
||||
KClientPort& GetClientPort() {
|
||||
return m_client;
|
||||
|
||||
@@ -13,12 +13,6 @@
|
||||
#include "core/hle/kernel/k_thread_queue.h"
|
||||
#include "core/hle/kernel/k_worker_task_manager.h"
|
||||
|
||||
#include "core/arm/dynarmic/arm_dynarmic_32.h"
|
||||
#include "core/arm/dynarmic/arm_dynarmic_64.h"
|
||||
#ifdef HAS_NCE
|
||||
#include "core/arm/nce/arm_nce.h"
|
||||
#endif
|
||||
|
||||
namespace Kernel {
|
||||
|
||||
namespace {
|
||||
@@ -963,8 +957,10 @@ Result KProcess::Run(s32 priority, size_t stack_size) {
|
||||
R_TRY(m_handle_table.Add(std::addressof(thread_handle), main_thread));
|
||||
|
||||
// Set the thread arguments.
|
||||
main_thread->GetContext().r[0] = 0;
|
||||
main_thread->GetContext().r[1] = thread_handle;
|
||||
main_thread->GetContext32().cpu_registers[0] = 0;
|
||||
main_thread->GetContext64().cpu_registers[0] = 0;
|
||||
main_thread->GetContext32().cpu_registers[1] = thread_handle;
|
||||
main_thread->GetContext64().cpu_registers[1] = thread_handle;
|
||||
|
||||
// Update our state.
|
||||
this->ChangeState((state == State::Created) ? State::Running : State::RunningAttached);
|
||||
@@ -1203,9 +1199,6 @@ Result KProcess::LoadFromMetadata(const FileSys::ProgramMetadata& metadata, std:
|
||||
m_is_hbl = is_hbl;
|
||||
m_ideal_core_id = metadata.GetMainThreadCore();
|
||||
|
||||
// Set up emulation context.
|
||||
this->InitializeInterfaces();
|
||||
|
||||
// We succeeded.
|
||||
R_SUCCEED();
|
||||
}
|
||||
@@ -1234,31 +1227,6 @@ void KProcess::LoadModule(CodeSet code_set, KProcessAddress base_addr) {
|
||||
#endif
|
||||
}
|
||||
|
||||
void KProcess::InitializeInterfaces() {
|
||||
this->GetMemory().SetCurrentPageTable(*this);
|
||||
|
||||
#ifdef HAS_NCE
|
||||
if (this->Is64Bit() && Settings::IsNceEnabled()) {
|
||||
for (size_t i = 0; i < Core::Hardware::NUM_CPU_CORES; i++) {
|
||||
m_arm_interfaces[i] = std::make_unique<Core::ArmNce>(m_kernel.System(), true, i);
|
||||
}
|
||||
} else
|
||||
#endif
|
||||
if (this->Is64Bit()) {
|
||||
for (size_t i = 0; i < Core::Hardware::NUM_CPU_CORES; i++) {
|
||||
m_arm_interfaces[i] = std::make_unique<Core::ArmDynarmic64>(
|
||||
m_kernel.System(), m_kernel.IsMulticore(), this,
|
||||
static_cast<Core::DynarmicExclusiveMonitor&>(m_kernel.GetExclusiveMonitor()), i);
|
||||
}
|
||||
} else {
|
||||
for (size_t i = 0; i < Core::Hardware::NUM_CPU_CORES; i++) {
|
||||
m_arm_interfaces[i] = std::make_unique<Core::ArmDynarmic32>(
|
||||
m_kernel.System(), m_kernel.IsMulticore(), this,
|
||||
static_cast<Core::DynarmicExclusiveMonitor&>(m_kernel.GetExclusiveMonitor()), i);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
bool KProcess::InsertWatchpoint(KProcessAddress addr, u64 size, DebugWatchpointType type) {
|
||||
const auto watch{std::find_if(m_watchpoints.begin(), m_watchpoints.end(), [&](const auto& wp) {
|
||||
return wp.type == DebugWatchpointType::None;
|
||||
|
||||
@@ -5,7 +5,6 @@
|
||||
|
||||
#include <map>
|
||||
|
||||
#include "core/arm/arm_interface.h"
|
||||
#include "core/file_sys/program_metadata.h"
|
||||
#include "core/hle/kernel/code_set.h"
|
||||
#include "core/hle/kernel/k_address_arbiter.h"
|
||||
@@ -107,8 +106,6 @@ private:
|
||||
bool m_is_suspended{};
|
||||
bool m_is_immortal{};
|
||||
bool m_is_handle_table_initialized{};
|
||||
std::array<std::unique_ptr<Core::ArmInterface>, Core::Hardware::NUM_CPU_CORES>
|
||||
m_arm_interfaces{};
|
||||
std::array<KThread*, Core::Hardware::NUM_CPU_CORES> m_running_threads{};
|
||||
std::array<u64, Core::Hardware::NUM_CPU_CORES> m_running_thread_idle_counts{};
|
||||
std::array<u64, Core::Hardware::NUM_CPU_CORES> m_running_thread_switch_counts{};
|
||||
@@ -479,10 +476,6 @@ public:
|
||||
}
|
||||
#endif
|
||||
|
||||
Core::ArmInterface* GetArmInterface(size_t core_index) const {
|
||||
return m_arm_interfaces[core_index].get();
|
||||
}
|
||||
|
||||
public:
|
||||
// Attempts to insert a watchpoint into a free slot. Returns false if none are available.
|
||||
bool InsertWatchpoint(KProcessAddress addr, u64 size, DebugWatchpointType type);
|
||||
@@ -500,8 +493,6 @@ public:
|
||||
|
||||
void LoadModule(CodeSet code_set, KProcessAddress base_addr);
|
||||
|
||||
void InitializeInterfaces();
|
||||
|
||||
Core::Memory::Memory& GetMemory() const;
|
||||
|
||||
public:
|
||||
|
||||
@@ -7,6 +7,10 @@
|
||||
#include "core/hle/kernel/k_scoped_lock.h"
|
||||
#include "core/hle/kernel/svc_types.h"
|
||||
|
||||
namespace Core {
|
||||
class ARM_Interface;
|
||||
}
|
||||
|
||||
namespace Kernel {
|
||||
|
||||
class KProcessPageTable {
|
||||
|
||||
@@ -494,7 +494,12 @@ void KScheduler::ScheduleImplFiber() {
|
||||
}
|
||||
|
||||
void KScheduler::Unload(KThread* thread) {
|
||||
m_kernel.PhysicalCore(m_core_id).SaveContext(thread);
|
||||
auto& cpu_core = m_kernel.System().ArmInterface(m_core_id);
|
||||
cpu_core.SaveContext(thread->GetContext32());
|
||||
cpu_core.SaveContext(thread->GetContext64());
|
||||
// Save the TPIDR_EL0 system register in case it was modified.
|
||||
thread->SetTpidrEl0(cpu_core.GetTPIDR_EL0());
|
||||
cpu_core.ClearExclusiveState();
|
||||
|
||||
// Check if the thread is terminated by checking the DPC flags.
|
||||
if ((thread->GetStackParameters().dpc_flags & static_cast<u32>(DpcFlag::Terminated)) == 0) {
|
||||
@@ -504,7 +509,14 @@ void KScheduler::Unload(KThread* thread) {
|
||||
}
|
||||
|
||||
void KScheduler::Reload(KThread* thread) {
|
||||
m_kernel.PhysicalCore(m_core_id).LoadContext(thread);
|
||||
auto& cpu_core = m_kernel.System().ArmInterface(m_core_id);
|
||||
auto* process = thread->GetOwnerProcess();
|
||||
cpu_core.LoadContext(thread->GetContext32());
|
||||
cpu_core.LoadContext(thread->GetContext64());
|
||||
cpu_core.SetTlsAddress(GetInteger(thread->GetTlsAddress()));
|
||||
cpu_core.SetTPIDR_EL0(thread->GetTpidrEl0());
|
||||
cpu_core.LoadWatchpointArray(process ? &process->GetWatchpoints() : nullptr);
|
||||
cpu_core.ClearExclusiveState();
|
||||
}
|
||||
|
||||
void KScheduler::ClearPreviousThread(KernelCore& kernel, KThread* thread) {
|
||||
|
||||
@@ -27,14 +27,12 @@ bool KServerPort::IsLight() const {
|
||||
void KServerPort::CleanupSessions() {
|
||||
// Ensure our preconditions are met.
|
||||
if (this->IsLight()) {
|
||||
ASSERT(m_session_list.empty());
|
||||
} else {
|
||||
ASSERT(m_light_session_list.empty());
|
||||
UNIMPLEMENTED();
|
||||
}
|
||||
|
||||
// Cleanup the session list.
|
||||
while (true) {
|
||||
// Get the last session in the list.
|
||||
// Get the last session in the list
|
||||
KServerSession* session = nullptr;
|
||||
{
|
||||
KScopedSchedulerLock sl{m_kernel};
|
||||
@@ -51,26 +49,6 @@ void KServerPort::CleanupSessions() {
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
// Cleanup the light session list.
|
||||
while (true) {
|
||||
// Get the last session in the list.
|
||||
KLightServerSession* session = nullptr;
|
||||
{
|
||||
KScopedSchedulerLock sl{m_kernel};
|
||||
if (!m_light_session_list.empty()) {
|
||||
session = std::addressof(m_light_session_list.front());
|
||||
m_light_session_list.pop_front();
|
||||
}
|
||||
}
|
||||
|
||||
// Close the session.
|
||||
if (session != nullptr) {
|
||||
session->Close();
|
||||
} else {
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
void KServerPort::Destroy() {
|
||||
@@ -86,7 +64,8 @@ void KServerPort::Destroy() {
|
||||
|
||||
bool KServerPort::IsSignaled() const {
|
||||
if (this->IsLight()) {
|
||||
return !m_light_session_list.empty();
|
||||
UNIMPLEMENTED();
|
||||
return false;
|
||||
} else {
|
||||
return !m_session_list.empty();
|
||||
}
|
||||
@@ -104,18 +83,6 @@ void KServerPort::EnqueueSession(KServerSession* session) {
|
||||
}
|
||||
}
|
||||
|
||||
void KServerPort::EnqueueSession(KLightServerSession* session) {
|
||||
ASSERT(this->IsLight());
|
||||
|
||||
KScopedSchedulerLock sl{m_kernel};
|
||||
|
||||
// Add the session to our queue.
|
||||
m_light_session_list.push_back(*session);
|
||||
if (m_light_session_list.size() == 1) {
|
||||
this->NotifyAvailable();
|
||||
}
|
||||
}
|
||||
|
||||
KServerSession* KServerPort::AcceptSession() {
|
||||
ASSERT(!this->IsLight());
|
||||
|
||||
@@ -131,19 +98,4 @@ KServerSession* KServerPort::AcceptSession() {
|
||||
return session;
|
||||
}
|
||||
|
||||
KLightServerSession* KServerPort::AcceptLightSession() {
|
||||
ASSERT(this->IsLight());
|
||||
|
||||
KScopedSchedulerLock sl{m_kernel};
|
||||
|
||||
// Return the first session in the list.
|
||||
if (m_light_session_list.empty()) {
|
||||
return nullptr;
|
||||
}
|
||||
|
||||
KLightServerSession* session = std::addressof(m_light_session_list.front());
|
||||
m_light_session_list.pop_front();
|
||||
return session;
|
||||
}
|
||||
|
||||
} // namespace Kernel
|
||||
|
||||
@@ -9,7 +9,6 @@
|
||||
|
||||
#include "common/intrusive_list.h"
|
||||
|
||||
#include "core/hle/kernel/k_light_server_session.h"
|
||||
#include "core/hle/kernel/k_server_session.h"
|
||||
#include "core/hle/kernel/k_synchronization_object.h"
|
||||
|
||||
@@ -29,10 +28,8 @@ public:
|
||||
void Initialize(KPort* parent);
|
||||
|
||||
void EnqueueSession(KServerSession* session);
|
||||
void EnqueueSession(KLightServerSession* session);
|
||||
|
||||
KServerSession* AcceptSession();
|
||||
KLightServerSession* AcceptLightSession();
|
||||
|
||||
const KPort* GetParent() const {
|
||||
return m_parent;
|
||||
@@ -46,12 +43,10 @@ public:
|
||||
|
||||
private:
|
||||
using SessionList = Common::IntrusiveListBaseTraits<KServerSession>::ListType;
|
||||
using LightSessionList = Common::IntrusiveListBaseTraits<KLightServerSession>::ListType;
|
||||
|
||||
void CleanupSessions();
|
||||
|
||||
SessionList m_session_list{};
|
||||
LightSessionList m_light_session_list{};
|
||||
KPort* m_parent{};
|
||||
};
|
||||
|
||||
|
||||
@@ -453,11 +453,6 @@ Result KServerSession::ReceiveRequest(std::shared_ptr<Service::HLERequestContext
|
||||
size_t client_buffer_size = request->GetSize();
|
||||
// bool recv_list_broken = false;
|
||||
|
||||
if (!client_message) {
|
||||
client_message = GetInteger(client_thread->GetTlsAddress());
|
||||
client_buffer_size = MessageBufferSize;
|
||||
}
|
||||
|
||||
// Receive the message.
|
||||
Core::Memory::Memory& memory{client_thread->GetOwnerProcess()->GetMemory()};
|
||||
if (out_context != nullptr) {
|
||||
@@ -467,7 +462,8 @@ Result KServerSession::ReceiveRequest(std::shared_ptr<Service::HLERequestContext
|
||||
std::make_shared<Service::HLERequestContext>(m_kernel, memory, this, client_thread);
|
||||
(*out_context)->SetSessionRequestManager(manager);
|
||||
(*out_context)
|
||||
->PopulateFromIncomingCommandBuffer(*client_thread->GetOwnerProcess(), cmd_buf);
|
||||
->PopulateFromIncomingCommandBuffer(client_thread->GetOwnerProcess()->GetHandleTable(),
|
||||
cmd_buf);
|
||||
} else {
|
||||
KThread* server_thread = GetCurrentThreadPointer(m_kernel);
|
||||
KProcess& src_process = *client_thread->GetOwnerProcess();
|
||||
|
||||
@@ -46,10 +46,6 @@ public:
|
||||
return this->GetState() != State::Normal;
|
||||
}
|
||||
|
||||
Result OnRequest(KSessionRequest* request) {
|
||||
R_RETURN(m_server.OnRequest(request));
|
||||
}
|
||||
|
||||
KClientSession& GetClientSession() {
|
||||
return m_client;
|
||||
}
|
||||
|
||||
@@ -41,25 +41,24 @@ namespace {
|
||||
|
||||
constexpr inline s32 TerminatingThreadPriority = Kernel::Svc::SystemThreadPriorityHighest - 1;
|
||||
|
||||
static void ResetThreadContext32(Kernel::Svc::ThreadContext& ctx, u64 stack_top, u64 entry_point,
|
||||
u64 arg) {
|
||||
ctx = {};
|
||||
ctx.r[0] = arg;
|
||||
ctx.r[15] = entry_point;
|
||||
ctx.r[13] = stack_top;
|
||||
ctx.fpcr = 0;
|
||||
ctx.fpsr = 0;
|
||||
static void ResetThreadContext32(Kernel::KThread::ThreadContext32& context, u32 stack_top,
|
||||
u32 entry_point, u32 arg) {
|
||||
context = {};
|
||||
context.cpu_registers[0] = arg;
|
||||
context.cpu_registers[15] = entry_point;
|
||||
context.cpu_registers[13] = stack_top;
|
||||
context.fpscr = 0;
|
||||
}
|
||||
|
||||
static void ResetThreadContext64(Kernel::Svc::ThreadContext& ctx, u64 stack_top, u64 entry_point,
|
||||
u64 arg) {
|
||||
ctx = {};
|
||||
ctx.r[0] = arg;
|
||||
ctx.r[18] = Kernel::KSystemControl::GenerateRandomU64() | 1;
|
||||
ctx.pc = entry_point;
|
||||
ctx.sp = stack_top;
|
||||
ctx.fpcr = 0;
|
||||
ctx.fpsr = 0;
|
||||
static void ResetThreadContext64(Kernel::KThread::ThreadContext64& context, u64 stack_top,
|
||||
u64 entry_point, u64 arg) {
|
||||
context = {};
|
||||
context.cpu_registers[0] = arg;
|
||||
context.cpu_registers[18] = Kernel::KSystemControl::GenerateRandomU64() | 1;
|
||||
context.pc = entry_point;
|
||||
context.sp = stack_top;
|
||||
context.fpcr = 0;
|
||||
context.fpsr = 0;
|
||||
}
|
||||
} // namespace
|
||||
|
||||
@@ -224,11 +223,9 @@ Result KThread::Initialize(KThreadFunction func, uintptr_t arg, KProcessAddress
|
||||
}
|
||||
|
||||
// Initialize thread context.
|
||||
if (m_parent != nullptr && !m_parent->Is64Bit()) {
|
||||
ResetThreadContext32(m_thread_context, GetInteger(user_stack_top), GetInteger(func), arg);
|
||||
} else {
|
||||
ResetThreadContext64(m_thread_context, GetInteger(user_stack_top), GetInteger(func), arg);
|
||||
}
|
||||
ResetThreadContext64(m_thread_context_64, GetInteger(user_stack_top), GetInteger(func), arg);
|
||||
ResetThreadContext32(m_thread_context_32, static_cast<u32>(GetInteger(user_stack_top)),
|
||||
static_cast<u32>(GetInteger(func)), static_cast<u32>(arg));
|
||||
|
||||
// Setup the stack parameters.
|
||||
StackParameters& sp = this->GetStackParameters();
|
||||
@@ -826,7 +823,20 @@ void KThread::CloneFpuStatus() {
|
||||
ASSERT(this->GetOwnerProcess() != nullptr);
|
||||
ASSERT(this->GetOwnerProcess() == GetCurrentProcessPointer(m_kernel));
|
||||
|
||||
m_kernel.CurrentPhysicalCore().CloneFpuStatus(this);
|
||||
if (this->GetOwnerProcess()->Is64Bit()) {
|
||||
// Clone FPSR and FPCR.
|
||||
ThreadContext64 cur_ctx{};
|
||||
m_kernel.System().CurrentArmInterface().SaveContext(cur_ctx);
|
||||
|
||||
this->GetContext64().fpcr = cur_ctx.fpcr;
|
||||
this->GetContext64().fpsr = cur_ctx.fpsr;
|
||||
} else {
|
||||
// Clone FPSCR.
|
||||
ThreadContext32 cur_ctx{};
|
||||
m_kernel.System().CurrentArmInterface().SaveContext(cur_ctx);
|
||||
|
||||
this->GetContext32().fpscr = cur_ctx.fpscr;
|
||||
}
|
||||
}
|
||||
|
||||
Result KThread::SetActivity(Svc::ThreadActivity activity) {
|
||||
@@ -902,7 +912,7 @@ Result KThread::SetActivity(Svc::ThreadActivity activity) {
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
||||
Result KThread::GetThreadContext3(Svc::ThreadContext* out) {
|
||||
Result KThread::GetThreadContext3(Common::ScratchBuffer<u8>& out) {
|
||||
// Lock ourselves.
|
||||
KScopedLightLock lk{m_activity_pause_lock};
|
||||
|
||||
@@ -916,16 +926,18 @@ Result KThread::GetThreadContext3(Svc::ThreadContext* out) {
|
||||
|
||||
// If we're not terminating, get the thread's user context.
|
||||
if (!this->IsTerminationRequested()) {
|
||||
*out = m_thread_context;
|
||||
|
||||
// Mask away mode bits, interrupt bits, IL bit, and other reserved bits.
|
||||
constexpr u32 El0Aarch64PsrMask = 0xF0000000;
|
||||
constexpr u32 El0Aarch32PsrMask = 0xFE0FFE20;
|
||||
|
||||
if (m_parent->Is64Bit()) {
|
||||
out->pstate &= El0Aarch64PsrMask;
|
||||
// Mask away mode bits, interrupt bits, IL bit, and other reserved bits.
|
||||
auto context = GetContext64();
|
||||
context.pstate &= 0xFF0FFE20;
|
||||
out.resize_destructive(sizeof(context));
|
||||
std::memcpy(out.data(), std::addressof(context), sizeof(context));
|
||||
} else {
|
||||
out->pstate &= El0Aarch32PsrMask;
|
||||
// Mask away mode bits, interrupt bits, IL bit, and other reserved bits.
|
||||
auto context = GetContext32();
|
||||
context.cpsr &= 0xFF0FFE20;
|
||||
out.resize_destructive(sizeof(context));
|
||||
std::memcpy(out.data(), std::addressof(context), sizeof(context));
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -38,6 +38,7 @@ namespace Core {
|
||||
namespace Memory {
|
||||
class Memory;
|
||||
}
|
||||
class ARM_Interface;
|
||||
class System;
|
||||
} // namespace Core
|
||||
|
||||
@@ -136,6 +137,8 @@ public:
|
||||
~KThread() override;
|
||||
|
||||
public:
|
||||
using ThreadContext32 = Core::ARM_Interface::ThreadContext32;
|
||||
using ThreadContext64 = Core::ARM_Interface::ThreadContext64;
|
||||
using WaiterList = Common::IntrusiveListBaseTraits<KThread>::ListType;
|
||||
|
||||
/**
|
||||
@@ -243,22 +246,31 @@ public:
|
||||
* @returns The value of the TPIDR_EL0 register.
|
||||
*/
|
||||
u64 GetTpidrEl0() const {
|
||||
return m_thread_context.tpidr;
|
||||
return m_thread_context_64.tpidr;
|
||||
}
|
||||
|
||||
/// Sets the value of the TPIDR_EL0 Read/Write system register for this thread.
|
||||
void SetTpidrEl0(u64 value) {
|
||||
m_thread_context.tpidr = value;
|
||||
m_thread_context_64.tpidr = value;
|
||||
m_thread_context_32.tpidr = static_cast<u32>(value);
|
||||
}
|
||||
|
||||
void CloneFpuStatus();
|
||||
|
||||
Svc::ThreadContext& GetContext() {
|
||||
return m_thread_context;
|
||||
ThreadContext32& GetContext32() {
|
||||
return m_thread_context_32;
|
||||
}
|
||||
|
||||
const Svc::ThreadContext& GetContext() const {
|
||||
return m_thread_context;
|
||||
const ThreadContext32& GetContext32() const {
|
||||
return m_thread_context_32;
|
||||
}
|
||||
|
||||
ThreadContext64& GetContext64() {
|
||||
return m_thread_context_64;
|
||||
}
|
||||
|
||||
const ThreadContext64& GetContext64() const {
|
||||
return m_thread_context_64;
|
||||
}
|
||||
|
||||
std::shared_ptr<Common::Fiber>& GetHostContext();
|
||||
@@ -385,13 +397,6 @@ public:
|
||||
m_cancellable = false;
|
||||
}
|
||||
|
||||
u32* GetLightSessionData() const {
|
||||
return m_light_ipc_data;
|
||||
}
|
||||
void SetLightSessionData(u32* data) {
|
||||
m_light_ipc_data = data;
|
||||
}
|
||||
|
||||
bool IsTerminationRequested() const {
|
||||
return m_termination_requested || GetRawState() == ThreadState::Terminated;
|
||||
}
|
||||
@@ -572,7 +577,7 @@ public:
|
||||
|
||||
void RemoveWaiter(KThread* thread);
|
||||
|
||||
Result GetThreadContext3(Svc::ThreadContext* out);
|
||||
Result GetThreadContext3(Common::ScratchBuffer<u8>& out);
|
||||
|
||||
KThread* RemoveUserWaiterByKey(bool* out_has_waiters, KProcessAddress key) {
|
||||
return this->RemoveWaiterByKey(out_has_waiters, key, false);
|
||||
@@ -729,7 +734,8 @@ private:
|
||||
std::function<void()>&& init_func);
|
||||
|
||||
// For core KThread implementation
|
||||
Svc::ThreadContext m_thread_context{};
|
||||
ThreadContext32 m_thread_context_32{};
|
||||
ThreadContext64 m_thread_context_64{};
|
||||
Common::IntrusiveListNode m_process_list_node;
|
||||
Common::IntrusiveRedBlackTreeNode m_condvar_arbiter_tree_node{};
|
||||
s32 m_priority{};
|
||||
|
||||
@@ -99,6 +99,13 @@ struct KernelCore::Impl {
|
||||
RegisterHostThread(nullptr);
|
||||
}
|
||||
|
||||
void InitializeCores() {
|
||||
for (u32 core_id = 0; core_id < Core::Hardware::NUM_CPU_CORES; core_id++) {
|
||||
cores[core_id]->Initialize((*application_process).Is64Bit());
|
||||
system.ApplicationMemory().SetCurrentPageTable(*application_process, core_id);
|
||||
}
|
||||
}
|
||||
|
||||
void TerminateApplicationProcess() {
|
||||
application_process.load()->Terminate();
|
||||
}
|
||||
@@ -198,7 +205,7 @@ struct KernelCore::Impl {
|
||||
const s32 core{static_cast<s32>(i)};
|
||||
|
||||
schedulers[i] = std::make_unique<Kernel::KScheduler>(system.Kernel());
|
||||
cores[i] = std::make_unique<Kernel::PhysicalCore>(system.Kernel(), i);
|
||||
cores[i] = std::make_unique<Kernel::PhysicalCore>(i, system, *schedulers[i]);
|
||||
|
||||
auto* main_thread{Kernel::KThread::Create(system.Kernel())};
|
||||
main_thread->SetCurrentCore(core);
|
||||
@@ -873,6 +880,10 @@ void KernelCore::Initialize() {
|
||||
impl->Initialize(*this);
|
||||
}
|
||||
|
||||
void KernelCore::InitializeCores() {
|
||||
impl->InitializeCores();
|
||||
}
|
||||
|
||||
void KernelCore::Shutdown() {
|
||||
impl->Shutdown();
|
||||
}
|
||||
@@ -982,6 +993,21 @@ const KAutoObjectWithListContainer& KernelCore::ObjectListContainer() const {
|
||||
return *impl->global_object_list_container;
|
||||
}
|
||||
|
||||
void KernelCore::InvalidateAllInstructionCaches() {
|
||||
for (auto& physical_core : impl->cores) {
|
||||
physical_core->ArmInterface().ClearInstructionCache();
|
||||
}
|
||||
}
|
||||
|
||||
void KernelCore::InvalidateCpuInstructionCacheRange(KProcessAddress addr, std::size_t size) {
|
||||
for (auto& physical_core : impl->cores) {
|
||||
if (!physical_core->IsInitialized()) {
|
||||
continue;
|
||||
}
|
||||
physical_core->ArmInterface().InvalidateCacheRange(GetInteger(addr), size);
|
||||
}
|
||||
}
|
||||
|
||||
void KernelCore::PrepareReschedule(std::size_t id) {
|
||||
// TODO: Reimplement, this
|
||||
}
|
||||
@@ -1340,7 +1366,6 @@ struct KernelCore::SlabHeapContainer {
|
||||
KSlabHeap<KProcess> process;
|
||||
KSlabHeap<KResourceLimit> resource_limit;
|
||||
KSlabHeap<KSession> session;
|
||||
KSlabHeap<KLightSession> light_session;
|
||||
KSlabHeap<KSharedMemory> shared_memory;
|
||||
KSlabHeap<KSharedMemoryInfo> shared_memory_info;
|
||||
KSlabHeap<KThread> thread;
|
||||
@@ -1371,8 +1396,6 @@ KSlabHeap<T>& KernelCore::SlabHeap() {
|
||||
return slab_heap_container->resource_limit;
|
||||
} else if constexpr (std::is_same_v<T, KSession>) {
|
||||
return slab_heap_container->session;
|
||||
} else if constexpr (std::is_same_v<T, KLightSession>) {
|
||||
return slab_heap_container->light_session;
|
||||
} else if constexpr (std::is_same_v<T, KSharedMemory>) {
|
||||
return slab_heap_container->shared_memory;
|
||||
} else if constexpr (std::is_same_v<T, KSharedMemoryInfo>) {
|
||||
@@ -1410,7 +1433,6 @@ template KSlabHeap<KPort>& KernelCore::SlabHeap();
|
||||
template KSlabHeap<KProcess>& KernelCore::SlabHeap();
|
||||
template KSlabHeap<KResourceLimit>& KernelCore::SlabHeap();
|
||||
template KSlabHeap<KSession>& KernelCore::SlabHeap();
|
||||
template KSlabHeap<KLightSession>& KernelCore::SlabHeap();
|
||||
template KSlabHeap<KSharedMemory>& KernelCore::SlabHeap();
|
||||
template KSlabHeap<KSharedMemoryInfo>& KernelCore::SlabHeap();
|
||||
template KSlabHeap<KThread>& KernelCore::SlabHeap();
|
||||
|
||||
@@ -104,6 +104,9 @@ public:
|
||||
/// Resets the kernel to a clean slate for use.
|
||||
void Initialize();
|
||||
|
||||
/// Initializes the CPU cores.
|
||||
void InitializeCores();
|
||||
|
||||
/// Clears all resources in use by the kernel instance.
|
||||
void Shutdown();
|
||||
|
||||
@@ -178,6 +181,10 @@ public:
|
||||
|
||||
const KAutoObjectWithListContainer& ObjectListContainer() const;
|
||||
|
||||
void InvalidateAllInstructionCaches();
|
||||
|
||||
void InvalidateCpuInstructionCacheRange(KProcessAddress addr, std::size_t size);
|
||||
|
||||
/// Registers all kernel objects with the global emulation state, this is purely for tracking
|
||||
/// leaks after emulation has been shutdown.
|
||||
void RegisterKernelObject(KAutoObject* object);
|
||||
|
||||
@@ -1,206 +1,62 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2020 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include "common/scope_exit.h"
|
||||
#include "common/settings.h"
|
||||
#include "core/arm/dynarmic/arm_dynarmic_32.h"
|
||||
#include "core/arm/dynarmic/arm_dynarmic_64.h"
|
||||
#ifdef HAS_NCE
|
||||
#include "core/arm/nce/arm_nce.h"
|
||||
#endif
|
||||
#include "core/core.h"
|
||||
#include "core/debugger/debugger.h"
|
||||
#include "core/hle/kernel/k_process.h"
|
||||
#include "core/hle/kernel/k_thread.h"
|
||||
#include "core/hle/kernel/k_scheduler.h"
|
||||
#include "core/hle/kernel/kernel.h"
|
||||
#include "core/hle/kernel/physical_core.h"
|
||||
#include "core/hle/kernel/svc.h"
|
||||
|
||||
namespace Kernel {
|
||||
|
||||
PhysicalCore::PhysicalCore(KernelCore& kernel, std::size_t core_index)
|
||||
: m_kernel{kernel}, m_core_index{core_index} {
|
||||
m_is_single_core = !kernel.IsMulticore();
|
||||
PhysicalCore::PhysicalCore(std::size_t core_index, Core::System& system, KScheduler& scheduler)
|
||||
: m_core_index{core_index}, m_system{system}, m_scheduler{scheduler} {
|
||||
#if defined(ARCHITECTURE_x86_64) || defined(ARCHITECTURE_arm64)
|
||||
// TODO(bunnei): Initialization relies on a core being available. We may later replace this with
|
||||
// an NCE interface or a 32-bit instance of Dynarmic. This should be abstracted out to a CPU
|
||||
// manager.
|
||||
auto& kernel = system.Kernel();
|
||||
m_arm_interface = std::make_unique<Core::ARM_Dynarmic_64>(
|
||||
system, kernel.IsMulticore(),
|
||||
reinterpret_cast<Core::DynarmicExclusiveMonitor&>(kernel.GetExclusiveMonitor()),
|
||||
m_core_index);
|
||||
#else
|
||||
#error Platform not supported yet.
|
||||
#endif
|
||||
}
|
||||
|
||||
PhysicalCore::~PhysicalCore() = default;
|
||||
|
||||
void PhysicalCore::RunThread(Kernel::KThread* thread) {
|
||||
auto* process = thread->GetOwnerProcess();
|
||||
auto& system = m_kernel.System();
|
||||
auto* interface = process->GetArmInterface(m_core_index);
|
||||
|
||||
interface->Initialize();
|
||||
|
||||
const auto EnterContext = [&]() {
|
||||
system.EnterCPUProfile();
|
||||
|
||||
// Lock the core context.
|
||||
std::scoped_lock lk{m_guard};
|
||||
|
||||
// Check if we are already interrupted. If we are, we can just stop immediately.
|
||||
if (m_is_interrupted) {
|
||||
return false;
|
||||
}
|
||||
|
||||
// Mark that we are running.
|
||||
m_arm_interface = interface;
|
||||
m_current_thread = thread;
|
||||
|
||||
// Acquire the lock on the thread parameters.
|
||||
// This allows us to force synchronization with Interrupt.
|
||||
interface->LockThread(thread);
|
||||
|
||||
return true;
|
||||
};
|
||||
|
||||
const auto ExitContext = [&]() {
|
||||
// Unlock the thread.
|
||||
interface->UnlockThread(thread);
|
||||
|
||||
// Lock the core context.
|
||||
std::scoped_lock lk{m_guard};
|
||||
|
||||
// On exit, we no longer are running.
|
||||
m_arm_interface = nullptr;
|
||||
m_current_thread = nullptr;
|
||||
|
||||
system.ExitCPUProfile();
|
||||
};
|
||||
|
||||
while (true) {
|
||||
// If the thread is scheduled for termination, exit.
|
||||
if (thread->HasDpc() && thread->IsTerminationRequested()) {
|
||||
thread->Exit();
|
||||
}
|
||||
|
||||
// Notify the debugger and go to sleep if a step was performed
|
||||
// and this thread has been scheduled again.
|
||||
if (thread->GetStepState() == StepState::StepPerformed) {
|
||||
system.GetDebugger().NotifyThreadStopped(thread);
|
||||
thread->RequestSuspend(SuspendType::Debug);
|
||||
return;
|
||||
}
|
||||
|
||||
// Otherwise, run the thread.
|
||||
Core::HaltReason hr{};
|
||||
{
|
||||
// If we were interrupted, exit immediately.
|
||||
if (!EnterContext()) {
|
||||
return;
|
||||
}
|
||||
|
||||
if (thread->GetStepState() == StepState::StepPending) {
|
||||
hr = interface->StepThread(thread);
|
||||
|
||||
if (True(hr & Core::HaltReason::StepThread)) {
|
||||
thread->SetStepState(StepState::StepPerformed);
|
||||
}
|
||||
} else {
|
||||
hr = interface->RunThread(thread);
|
||||
}
|
||||
|
||||
ExitContext();
|
||||
}
|
||||
|
||||
// Determine why we stopped.
|
||||
const bool supervisor_call = True(hr & Core::HaltReason::SupervisorCall);
|
||||
const bool prefetch_abort = True(hr & Core::HaltReason::PrefetchAbort);
|
||||
const bool breakpoint = True(hr & Core::HaltReason::InstructionBreakpoint);
|
||||
const bool data_abort = True(hr & Core::HaltReason::DataAbort);
|
||||
const bool interrupt = True(hr & Core::HaltReason::BreakLoop);
|
||||
|
||||
// Since scheduling may occur here, we cannot use any cached
|
||||
// state after returning from calls we make.
|
||||
|
||||
// Notify the debugger and go to sleep if a breakpoint was hit,
|
||||
// or if the thread is unable to continue for any reason.
|
||||
if (breakpoint || prefetch_abort) {
|
||||
if (breakpoint) {
|
||||
interface->RewindBreakpointInstruction();
|
||||
}
|
||||
if (system.DebuggerEnabled()) {
|
||||
system.GetDebugger().NotifyThreadStopped(thread);
|
||||
} else {
|
||||
interface->LogBacktrace(process);
|
||||
}
|
||||
thread->RequestSuspend(SuspendType::Debug);
|
||||
return;
|
||||
}
|
||||
|
||||
// Notify the debugger and go to sleep on data abort.
|
||||
if (data_abort) {
|
||||
if (system.DebuggerEnabled()) {
|
||||
system.GetDebugger().NotifyThreadWatchpoint(thread, *interface->HaltedWatchpoint());
|
||||
}
|
||||
thread->RequestSuspend(SuspendType::Debug);
|
||||
return;
|
||||
}
|
||||
|
||||
// Handle system calls.
|
||||
if (supervisor_call) {
|
||||
// Perform call.
|
||||
Svc::Call(system, interface->GetSvcNumber());
|
||||
return;
|
||||
}
|
||||
|
||||
// Handle external interrupt sources.
|
||||
if (interrupt || m_is_single_core) {
|
||||
return;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
void PhysicalCore::LoadContext(const KThread* thread) {
|
||||
auto* const process = thread->GetOwnerProcess();
|
||||
if (!process) {
|
||||
// Kernel threads do not run on emulated CPU cores.
|
||||
void PhysicalCore::Initialize(bool is_64_bit) {
|
||||
#if defined(HAS_NCE)
|
||||
if (Settings::IsNceEnabled()) {
|
||||
m_arm_interface = std::make_unique<Core::ARM_NCE>(m_system, m_system.Kernel().IsMulticore(),
|
||||
m_core_index);
|
||||
return;
|
||||
}
|
||||
|
||||
auto* interface = process->GetArmInterface(m_core_index);
|
||||
if (interface) {
|
||||
interface->SetContext(thread->GetContext());
|
||||
interface->SetTpidrroEl0(GetInteger(thread->GetTlsAddress()));
|
||||
interface->SetWatchpointArray(&process->GetWatchpoints());
|
||||
#endif
|
||||
#if defined(ARCHITECTURE_x86_64) || defined(ARCHITECTURE_arm64)
|
||||
auto& kernel = m_system.Kernel();
|
||||
if (!is_64_bit) {
|
||||
// We already initialized a 64-bit core, replace with a 32-bit one.
|
||||
m_arm_interface = std::make_unique<Core::ARM_Dynarmic_32>(
|
||||
m_system, kernel.IsMulticore(),
|
||||
reinterpret_cast<Core::DynarmicExclusiveMonitor&>(kernel.GetExclusiveMonitor()),
|
||||
m_core_index);
|
||||
}
|
||||
#else
|
||||
#error Platform not supported yet.
|
||||
#endif
|
||||
}
|
||||
|
||||
void PhysicalCore::LoadSvcArguments(const KProcess& process, std::span<const uint64_t, 8> args) {
|
||||
process.GetArmInterface(m_core_index)->SetSvcArguments(args);
|
||||
}
|
||||
|
||||
void PhysicalCore::SaveContext(KThread* thread) const {
|
||||
auto* const process = thread->GetOwnerProcess();
|
||||
if (!process) {
|
||||
// Kernel threads do not run on emulated CPU cores.
|
||||
return;
|
||||
}
|
||||
|
||||
auto* interface = process->GetArmInterface(m_core_index);
|
||||
if (interface) {
|
||||
interface->GetContext(thread->GetContext());
|
||||
}
|
||||
}
|
||||
|
||||
void PhysicalCore::SaveSvcArguments(KProcess& process, std::span<uint64_t, 8> args) const {
|
||||
process.GetArmInterface(m_core_index)->GetSvcArguments(args);
|
||||
}
|
||||
|
||||
void PhysicalCore::CloneFpuStatus(KThread* dst) const {
|
||||
auto* process = dst->GetOwnerProcess();
|
||||
|
||||
Svc::ThreadContext ctx{};
|
||||
process->GetArmInterface(m_core_index)->GetContext(ctx);
|
||||
|
||||
dst->GetContext().fpcr = ctx.fpcr;
|
||||
dst->GetContext().fpsr = ctx.fpsr;
|
||||
}
|
||||
|
||||
void PhysicalCore::LogBacktrace() {
|
||||
auto* process = GetCurrentProcessPointer(m_kernel);
|
||||
if (!process) {
|
||||
return;
|
||||
}
|
||||
|
||||
auto* interface = process->GetArmInterface(m_core_index);
|
||||
if (interface) {
|
||||
interface->LogBacktrace(process);
|
||||
}
|
||||
void PhysicalCore::Run() {
|
||||
m_arm_interface->Run();
|
||||
m_arm_interface->ClearExclusiveState();
|
||||
}
|
||||
|
||||
void PhysicalCore::Idle() {
|
||||
@@ -213,31 +69,16 @@ bool PhysicalCore::IsInterrupted() const {
|
||||
}
|
||||
|
||||
void PhysicalCore::Interrupt() {
|
||||
// Lock core context.
|
||||
std::scoped_lock lk{m_guard};
|
||||
|
||||
// Load members.
|
||||
auto* arm_interface = m_arm_interface;
|
||||
auto* thread = m_current_thread;
|
||||
|
||||
// Add interrupt flag.
|
||||
std::unique_lock lk{m_guard};
|
||||
m_is_interrupted = true;
|
||||
|
||||
// Interrupt ourselves.
|
||||
m_on_interrupt.notify_one();
|
||||
|
||||
// If there is no thread running, we are done.
|
||||
if (arm_interface == nullptr) {
|
||||
return;
|
||||
}
|
||||
|
||||
// Interrupt the CPU.
|
||||
arm_interface->SignalInterrupt(thread);
|
||||
m_arm_interface->SignalInterrupt();
|
||||
m_on_interrupt.notify_all();
|
||||
}
|
||||
|
||||
void PhysicalCore::ClearInterrupt() {
|
||||
std::scoped_lock lk{m_guard};
|
||||
std::unique_lock lk{m_guard};
|
||||
m_is_interrupted = false;
|
||||
m_arm_interface->ClearInterrupt();
|
||||
}
|
||||
|
||||
} // namespace Kernel
|
||||
|
||||
@@ -11,7 +11,7 @@
|
||||
#include "core/arm/arm_interface.h"
|
||||
|
||||
namespace Kernel {
|
||||
class KernelCore;
|
||||
class KScheduler;
|
||||
} // namespace Kernel
|
||||
|
||||
namespace Core {
|
||||
@@ -23,55 +23,62 @@ namespace Kernel {
|
||||
|
||||
class PhysicalCore {
|
||||
public:
|
||||
PhysicalCore(KernelCore& kernel, std::size_t core_index);
|
||||
PhysicalCore(std::size_t core_index_, Core::System& system_, KScheduler& scheduler_);
|
||||
~PhysicalCore();
|
||||
|
||||
YUZU_NON_COPYABLE(PhysicalCore);
|
||||
YUZU_NON_MOVEABLE(PhysicalCore);
|
||||
|
||||
// Execute guest code running on the given thread.
|
||||
void RunThread(KThread* thread);
|
||||
/// Initialize the core for the specified parameters.
|
||||
void Initialize(bool is_64_bit);
|
||||
|
||||
// Copy context from thread to current core.
|
||||
void LoadContext(const KThread* thread);
|
||||
void LoadSvcArguments(const KProcess& process, std::span<const uint64_t, 8> args);
|
||||
/// Execute current jit state
|
||||
void Run();
|
||||
|
||||
// Copy context from current core to thread.
|
||||
void SaveContext(KThread* thread) const;
|
||||
void SaveSvcArguments(KProcess& process, std::span<uint64_t, 8> args) const;
|
||||
|
||||
// Copy floating point status registers to the target thread.
|
||||
void CloneFpuStatus(KThread* dst) const;
|
||||
|
||||
// Log backtrace of current processor state.
|
||||
void LogBacktrace();
|
||||
|
||||
// Wait for an interrupt.
|
||||
void Idle();
|
||||
|
||||
// Interrupt this core.
|
||||
/// Interrupt this physical core.
|
||||
void Interrupt();
|
||||
|
||||
// Clear this core's interrupt.
|
||||
/// Clear this core's interrupt
|
||||
void ClearInterrupt();
|
||||
|
||||
// Check if this core is interrupted.
|
||||
/// Check if this core is interrupted
|
||||
bool IsInterrupted() const;
|
||||
|
||||
bool IsInitialized() const {
|
||||
return m_arm_interface != nullptr;
|
||||
}
|
||||
|
||||
Core::ARM_Interface& ArmInterface() {
|
||||
return *m_arm_interface;
|
||||
}
|
||||
|
||||
const Core::ARM_Interface& ArmInterface() const {
|
||||
return *m_arm_interface;
|
||||
}
|
||||
|
||||
std::size_t CoreIndex() const {
|
||||
return m_core_index;
|
||||
}
|
||||
|
||||
Kernel::KScheduler& Scheduler() {
|
||||
return m_scheduler;
|
||||
}
|
||||
|
||||
const Kernel::KScheduler& Scheduler() const {
|
||||
return m_scheduler;
|
||||
}
|
||||
|
||||
private:
|
||||
KernelCore& m_kernel;
|
||||
const std::size_t m_core_index;
|
||||
Core::System& m_system;
|
||||
Kernel::KScheduler& m_scheduler;
|
||||
|
||||
std::mutex m_guard;
|
||||
std::condition_variable m_on_interrupt;
|
||||
Core::ArmInterface* m_arm_interface{};
|
||||
KThread* m_current_thread{};
|
||||
std::unique_ptr<Core::ARM_Interface> m_arm_interface;
|
||||
bool m_is_interrupted{};
|
||||
bool m_is_single_core{};
|
||||
};
|
||||
|
||||
} // namespace Kernel
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -9,8 +9,6 @@ namespace Core {
|
||||
class System;
|
||||
}
|
||||
|
||||
#include <span>
|
||||
|
||||
#include "common/common_types.h"
|
||||
#include "core/hle/kernel/svc_types.h"
|
||||
#include "core/hle/result.h"
|
||||
@@ -522,15 +520,15 @@ void CallSecureMonitor64From32(Core::System& system, ilp32::SecureMonitorArgumen
|
||||
void CallSecureMonitor64(Core::System& system, lp64::SecureMonitorArguments* args);
|
||||
|
||||
// Defined in svc_light_ipc.cpp.
|
||||
void SvcWrap_ReplyAndReceiveLight64From32(Core::System& system, std::span<uint64_t, 8> args);
|
||||
void SvcWrap_ReplyAndReceiveLight64(Core::System& system, std::span<uint64_t, 8> args);
|
||||
void SvcWrap_ReplyAndReceiveLight64From32(Core::System& system);
|
||||
void SvcWrap_ReplyAndReceiveLight64(Core::System& system);
|
||||
|
||||
void SvcWrap_SendSyncRequestLight64From32(Core::System& system, std::span<uint64_t, 8> args);
|
||||
void SvcWrap_SendSyncRequestLight64(Core::System& system, std::span<uint64_t, 8> args);
|
||||
void SvcWrap_SendSyncRequestLight64From32(Core::System& system);
|
||||
void SvcWrap_SendSyncRequestLight64(Core::System& system);
|
||||
|
||||
// Defined in svc_secure_monitor_call.cpp.
|
||||
void SvcWrap_CallSecureMonitor64From32(Core::System& system, std::span<uint64_t, 8> args);
|
||||
void SvcWrap_CallSecureMonitor64(Core::System& system, std::span<uint64_t, 8> args);
|
||||
void SvcWrap_CallSecureMonitor64From32(Core::System& system);
|
||||
void SvcWrap_CallSecureMonitor64(Core::System& system);
|
||||
|
||||
// Perform a supervisor call by index.
|
||||
void Call(Core::System& system, u32 imm);
|
||||
|
||||
@@ -103,7 +103,9 @@ void Break(Core::System& system, BreakReason reason, u64 info1, u64 info2) {
|
||||
|
||||
handle_debug_buffer(info1, info2);
|
||||
|
||||
system.CurrentPhysicalCore().LogBacktrace();
|
||||
auto* const current_thread = GetCurrentThreadPointer(system.Kernel());
|
||||
const auto thread_processor_id = current_thread->GetActiveCore();
|
||||
system.ArmInterface(static_cast<std::size_t>(thread_processor_id)).LogBacktrace();
|
||||
}
|
||||
|
||||
const bool is_hbl = GetCurrentProcess(system.Kernel()).IsHbl();
|
||||
|
||||
@@ -7,127 +7,59 @@
|
||||
#include "core/hle/kernel/k_client_session.h"
|
||||
#include "core/hle/kernel/k_hardware_timer.h"
|
||||
#include "core/hle/kernel/k_process.h"
|
||||
#include "core/hle/kernel/k_scoped_resource_reservation.h"
|
||||
#include "core/hle/kernel/k_server_session.h"
|
||||
#include "core/hle/kernel/k_session.h"
|
||||
#include "core/hle/kernel/svc.h"
|
||||
#include "core/hle/kernel/svc_results.h"
|
||||
|
||||
namespace Kernel::Svc {
|
||||
|
||||
namespace {
|
||||
|
||||
Result SendSyncRequestImpl(KernelCore& kernel, uintptr_t message, size_t buffer_size,
|
||||
Handle session_handle) {
|
||||
// Get the client session.
|
||||
/// Makes a blocking IPC call to a service.
|
||||
Result SendSyncRequest(Core::System& system, Handle handle) {
|
||||
// Get the client session from its handle.
|
||||
KScopedAutoObject session =
|
||||
GetCurrentProcess(kernel).GetHandleTable().GetObject<KClientSession>(session_handle);
|
||||
GetCurrentProcess(system.Kernel()).GetHandleTable().GetObject<KClientSession>(handle);
|
||||
R_UNLESS(session.IsNotNull(), ResultInvalidHandle);
|
||||
|
||||
// Get the parent, and persist a reference to it until we're done.
|
||||
KScopedAutoObject parent = session->GetParent();
|
||||
ASSERT(parent.IsNotNull());
|
||||
LOG_TRACE(Kernel_SVC, "called handle=0x{:08X}", handle);
|
||||
|
||||
// Send the request.
|
||||
R_RETURN(session->SendSyncRequest(message, buffer_size));
|
||||
R_RETURN(session->SendSyncRequest());
|
||||
}
|
||||
|
||||
Result ReplyAndReceiveImpl(KernelCore& kernel, int32_t* out_index, uintptr_t message,
|
||||
size_t buffer_size, KPhysicalAddress message_paddr,
|
||||
KSynchronizationObject** objs, int32_t num_objects, Handle reply_target,
|
||||
int64_t timeout_ns) {
|
||||
// Reply to the target, if one is specified.
|
||||
if (reply_target != InvalidHandle) {
|
||||
KScopedAutoObject session =
|
||||
GetCurrentProcess(kernel).GetHandleTable().GetObject<KServerSession>(reply_target);
|
||||
R_UNLESS(session.IsNotNull(), ResultInvalidHandle);
|
||||
|
||||
// If we fail to reply, we want to set the output index to -1.
|
||||
ON_RESULT_FAILURE {
|
||||
*out_index = -1;
|
||||
};
|
||||
|
||||
// Send the reply.
|
||||
R_TRY(session->SendReply());
|
||||
// R_TRY(session->SendReply(message, buffer_size, message_paddr));
|
||||
}
|
||||
|
||||
// Receive a message.
|
||||
{
|
||||
// Convert the timeout from nanoseconds to ticks.
|
||||
// NOTE: Nintendo does not use this conversion logic in WaitSynchronization...
|
||||
s64 timeout;
|
||||
if (timeout_ns > 0) {
|
||||
const s64 offset_tick(timeout_ns);
|
||||
if (offset_tick > 0) {
|
||||
timeout = kernel.HardwareTimer().GetTick() + offset_tick + 2;
|
||||
if (timeout <= 0) {
|
||||
timeout = std::numeric_limits<s64>::max();
|
||||
}
|
||||
} else {
|
||||
timeout = std::numeric_limits<s64>::max();
|
||||
}
|
||||
} else {
|
||||
timeout = timeout_ns;
|
||||
}
|
||||
|
||||
// Wait for a message.
|
||||
while (true) {
|
||||
// Wait for an object.
|
||||
s32 index;
|
||||
Result result = KSynchronizationObject::Wait(kernel, std::addressof(index), objs,
|
||||
num_objects, timeout);
|
||||
if (ResultTimedOut == result) {
|
||||
R_THROW(result);
|
||||
}
|
||||
|
||||
// Receive the request.
|
||||
if (R_SUCCEEDED(result)) {
|
||||
KServerSession* session = objs[index]->DynamicCast<KServerSession*>();
|
||||
if (session != nullptr) {
|
||||
// result = session->ReceiveRequest(message, buffer_size, message_paddr);
|
||||
result = session->ReceiveRequest();
|
||||
if (ResultNotFound == result) {
|
||||
continue;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
*out_index = index;
|
||||
R_RETURN(result);
|
||||
}
|
||||
}
|
||||
Result SendSyncRequestWithUserBuffer(Core::System& system, uint64_t message_buffer,
|
||||
uint64_t message_buffer_size, Handle session_handle) {
|
||||
UNIMPLEMENTED();
|
||||
R_THROW(ResultNotImplemented);
|
||||
}
|
||||
|
||||
Result ReplyAndReceiveImpl(KernelCore& kernel, int32_t* out_index, uintptr_t message,
|
||||
size_t buffer_size, KPhysicalAddress message_paddr,
|
||||
KProcessAddress user_handles, int32_t num_handles, Handle reply_target,
|
||||
int64_t timeout_ns) {
|
||||
Result SendAsyncRequestWithUserBuffer(Core::System& system, Handle* out_event_handle,
|
||||
uint64_t message_buffer, uint64_t message_buffer_size,
|
||||
Handle session_handle) {
|
||||
UNIMPLEMENTED();
|
||||
R_THROW(ResultNotImplemented);
|
||||
}
|
||||
|
||||
Result ReplyAndReceive(Core::System& system, s32* out_index, uint64_t handles_addr, s32 num_handles,
|
||||
Handle reply_target, s64 timeout_ns) {
|
||||
// Ensure number of handles is valid.
|
||||
R_UNLESS(0 <= num_handles && num_handles <= Svc::ArgumentHandleCountMax, ResultOutOfRange);
|
||||
R_UNLESS(0 <= num_handles && num_handles <= ArgumentHandleCountMax, ResultOutOfRange);
|
||||
|
||||
// Get the synchronization context.
|
||||
auto& process = GetCurrentProcess(kernel);
|
||||
auto& thread = GetCurrentThread(kernel);
|
||||
auto& handle_table = process.GetHandleTable();
|
||||
KSynchronizationObject** objs = thread.GetSynchronizationObjectBuffer().data();
|
||||
Handle* handles = thread.GetHandleBuffer().data();
|
||||
auto& kernel = system.Kernel();
|
||||
auto& handle_table = GetCurrentProcess(kernel).GetHandleTable();
|
||||
auto objs = GetCurrentThread(kernel).GetSynchronizationObjectBuffer();
|
||||
auto handles = GetCurrentThread(kernel).GetHandleBuffer();
|
||||
|
||||
// Copy user handles.
|
||||
if (num_handles > 0) {
|
||||
// Ensure that we can try to get the handles.
|
||||
R_UNLESS(process.GetPageTable().Contains(user_handles, num_handles * sizeof(Handle)),
|
||||
// Get the handles.
|
||||
R_UNLESS(GetCurrentMemory(kernel).ReadBlock(handles_addr, handles.data(),
|
||||
sizeof(Handle) * num_handles),
|
||||
ResultInvalidPointer);
|
||||
|
||||
// Get the handles
|
||||
R_UNLESS(
|
||||
GetCurrentMemory(kernel).ReadBlock(user_handles, handles, sizeof(Handle) * num_handles),
|
||||
ResultInvalidPointer);
|
||||
|
||||
// Convert the handles to objects.
|
||||
R_UNLESS(
|
||||
handle_table.GetMultipleObjects<KSynchronizationObject>(objs, handles, num_handles),
|
||||
ResultInvalidHandle);
|
||||
R_UNLESS(handle_table.GetMultipleObjects<KSynchronizationObject>(
|
||||
objs.data(), handles.data(), num_handles),
|
||||
ResultInvalidHandle);
|
||||
}
|
||||
|
||||
// Ensure handles are closed when we're done.
|
||||
@@ -137,135 +69,69 @@ Result ReplyAndReceiveImpl(KernelCore& kernel, int32_t* out_index, uintptr_t mes
|
||||
}
|
||||
});
|
||||
|
||||
R_RETURN(ReplyAndReceiveImpl(kernel, out_index, message, buffer_size, message_paddr, objs,
|
||||
num_handles, reply_target, timeout_ns));
|
||||
}
|
||||
// Reply to the target, if one is specified.
|
||||
if (reply_target != InvalidHandle) {
|
||||
KScopedAutoObject session = handle_table.GetObject<KServerSession>(reply_target);
|
||||
R_UNLESS(session.IsNotNull(), ResultInvalidHandle);
|
||||
|
||||
} // namespace
|
||||
|
||||
/// Makes a blocking IPC call to a service.
|
||||
Result SendSyncRequest(Core::System& system, Handle session_handle) {
|
||||
R_RETURN(SendSyncRequestImpl(system.Kernel(), 0, 0, session_handle));
|
||||
}
|
||||
|
||||
Result SendSyncRequestWithUserBuffer(Core::System& system, uint64_t message, uint64_t buffer_size,
|
||||
Handle session_handle) {
|
||||
auto& kernel = system.Kernel();
|
||||
|
||||
// Validate that the message buffer is page aligned and does not overflow.
|
||||
R_UNLESS(Common::IsAligned(message, PageSize), ResultInvalidAddress);
|
||||
R_UNLESS(buffer_size > 0, ResultInvalidSize);
|
||||
R_UNLESS(Common::IsAligned(buffer_size, PageSize), ResultInvalidSize);
|
||||
R_UNLESS(message < message + buffer_size, ResultInvalidCurrentMemory);
|
||||
|
||||
// Get the process page table.
|
||||
auto& page_table = GetCurrentProcess(kernel).GetPageTable();
|
||||
|
||||
// Lock the message buffer.
|
||||
R_TRY(page_table.LockForIpcUserBuffer(nullptr, message, buffer_size));
|
||||
|
||||
{
|
||||
// If we fail to send the message, unlock the message buffer.
|
||||
// If we fail to reply, we want to set the output index to -1.
|
||||
ON_RESULT_FAILURE {
|
||||
page_table.UnlockForIpcUserBuffer(message, buffer_size);
|
||||
*out_index = -1;
|
||||
};
|
||||
|
||||
// Send the request.
|
||||
ASSERT(message != 0);
|
||||
R_TRY(SendSyncRequestImpl(kernel, message, buffer_size, session_handle));
|
||||
// Send the reply.
|
||||
R_TRY(session->SendReply());
|
||||
}
|
||||
|
||||
// We successfully processed, so try to unlock the message buffer.
|
||||
R_RETURN(page_table.UnlockForIpcUserBuffer(message, buffer_size));
|
||||
}
|
||||
|
||||
Result SendAsyncRequestWithUserBuffer(Core::System& system, Handle* out_event_handle,
|
||||
uint64_t message, uint64_t buffer_size,
|
||||
Handle session_handle) {
|
||||
// Get the process and handle table.
|
||||
auto& process = GetCurrentProcess(system.Kernel());
|
||||
auto& handle_table = process.GetHandleTable();
|
||||
|
||||
// Reserve a new event from the process resource limit.
|
||||
KScopedResourceReservation event_reservation(std::addressof(process),
|
||||
Svc::LimitableResource::EventCountMax);
|
||||
R_UNLESS(event_reservation.Succeeded(), ResultLimitReached);
|
||||
|
||||
// Get the client session.
|
||||
KScopedAutoObject session = process.GetHandleTable().GetObject<KClientSession>(session_handle);
|
||||
R_UNLESS(session.IsNotNull(), ResultInvalidHandle);
|
||||
|
||||
// Get the parent, and persist a reference to it until we're done.
|
||||
KScopedAutoObject parent = session->GetParent();
|
||||
ASSERT(parent.IsNotNull());
|
||||
|
||||
// Create a new event.
|
||||
KEvent* event = KEvent::Create(system.Kernel());
|
||||
R_UNLESS(event != nullptr, ResultOutOfResource);
|
||||
|
||||
// Initialize the event.
|
||||
event->Initialize(std::addressof(process));
|
||||
|
||||
// Commit our reservation.
|
||||
event_reservation.Commit();
|
||||
|
||||
// At end of scope, kill the standing references to the sub events.
|
||||
SCOPE_EXIT({
|
||||
event->GetReadableEvent().Close();
|
||||
event->Close();
|
||||
});
|
||||
|
||||
// Register the event.
|
||||
KEvent::Register(system.Kernel(), event);
|
||||
|
||||
// Add the readable event to the handle table.
|
||||
R_TRY(handle_table.Add(out_event_handle, std::addressof(event->GetReadableEvent())));
|
||||
|
||||
// Ensure that if we fail to send the request, we close the readable handle.
|
||||
ON_RESULT_FAILURE {
|
||||
handle_table.Remove(*out_event_handle);
|
||||
};
|
||||
|
||||
// Send the async request.
|
||||
R_RETURN(session->SendAsyncRequest(event, message, buffer_size));
|
||||
}
|
||||
|
||||
Result ReplyAndReceive(Core::System& system, s32* out_index, uint64_t handles, s32 num_handles,
|
||||
Handle reply_target, s64 timeout_ns) {
|
||||
R_RETURN(ReplyAndReceiveImpl(system.Kernel(), out_index, 0, 0, 0, handles, num_handles,
|
||||
reply_target, timeout_ns));
|
||||
}
|
||||
|
||||
Result ReplyAndReceiveWithUserBuffer(Core::System& system, int32_t* out_index, uint64_t message,
|
||||
uint64_t buffer_size, uint64_t handles, int32_t num_handles,
|
||||
Handle reply_target, int64_t timeout_ns) {
|
||||
// Validate that the message buffer is page aligned and does not overflow.
|
||||
R_UNLESS(Common::IsAligned(message, PageSize), ResultInvalidAddress);
|
||||
R_UNLESS(buffer_size > 0, ResultInvalidSize);
|
||||
R_UNLESS(Common::IsAligned(buffer_size, PageSize), ResultInvalidSize);
|
||||
R_UNLESS(message < message + buffer_size, ResultInvalidCurrentMemory);
|
||||
|
||||
// Get the process page table.
|
||||
auto& page_table = GetCurrentProcess(system.Kernel()).GetPageTable();
|
||||
|
||||
// Lock the message buffer, getting its physical address.
|
||||
KPhysicalAddress message_paddr;
|
||||
R_TRY(page_table.LockForIpcUserBuffer(std::addressof(message_paddr), message, buffer_size));
|
||||
|
||||
{
|
||||
// If we fail to send the message, unlock the message buffer.
|
||||
ON_RESULT_FAILURE {
|
||||
page_table.UnlockForIpcUserBuffer(message, buffer_size);
|
||||
};
|
||||
|
||||
// Reply/Receive the request.
|
||||
ASSERT(message != 0);
|
||||
R_TRY(ReplyAndReceiveImpl(system.Kernel(), out_index, message, buffer_size, message_paddr,
|
||||
handles, num_handles, reply_target, timeout_ns));
|
||||
// Convert the timeout from nanoseconds to ticks.
|
||||
// NOTE: Nintendo does not use this conversion logic in WaitSynchronization...
|
||||
s64 timeout;
|
||||
if (timeout_ns > 0) {
|
||||
const s64 offset_tick(timeout_ns);
|
||||
if (offset_tick > 0) {
|
||||
timeout = kernel.HardwareTimer().GetTick() + offset_tick + 2;
|
||||
if (timeout <= 0) {
|
||||
timeout = std::numeric_limits<s64>::max();
|
||||
}
|
||||
} else {
|
||||
timeout = std::numeric_limits<s64>::max();
|
||||
}
|
||||
} else {
|
||||
timeout = timeout_ns;
|
||||
}
|
||||
|
||||
// We successfully processed, so try to unlock the message buffer.
|
||||
R_RETURN(page_table.UnlockForIpcUserBuffer(message, buffer_size));
|
||||
// Wait for a message.
|
||||
while (true) {
|
||||
// Wait for an object.
|
||||
s32 index;
|
||||
Result result = KSynchronizationObject::Wait(kernel, std::addressof(index), objs.data(),
|
||||
num_handles, timeout);
|
||||
if (result == ResultTimedOut) {
|
||||
R_RETURN(result);
|
||||
}
|
||||
|
||||
// Receive the request.
|
||||
if (R_SUCCEEDED(result)) {
|
||||
KServerSession* session = objs[index]->DynamicCast<KServerSession*>();
|
||||
if (session != nullptr) {
|
||||
result = session->ReceiveRequest();
|
||||
if (result == ResultNotFound) {
|
||||
continue;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
*out_index = index;
|
||||
R_RETURN(result);
|
||||
}
|
||||
}
|
||||
|
||||
Result ReplyAndReceiveWithUserBuffer(Core::System& system, int32_t* out_index,
|
||||
uint64_t message_buffer, uint64_t message_buffer_size,
|
||||
uint64_t handles, int32_t num_handles, Handle reply_target,
|
||||
int64_t timeout_ns) {
|
||||
UNIMPLEMENTED();
|
||||
R_THROW(ResultNotImplemented);
|
||||
}
|
||||
|
||||
Result SendSyncRequest64(Core::System& system, Handle session_handle) {
|
||||
|
||||
@@ -1,40 +1,21 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2023 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include "core/arm/arm_interface.h"
|
||||
#include "core/core.h"
|
||||
#include "core/hle/kernel/k_light_client_session.h"
|
||||
#include "core/hle/kernel/k_light_server_session.h"
|
||||
#include "core/hle/kernel/k_process.h"
|
||||
#include "core/hle/kernel/k_thread.h"
|
||||
#include "core/hle/kernel/svc.h"
|
||||
#include "core/hle/kernel/svc_results.h"
|
||||
|
||||
namespace Kernel::Svc {
|
||||
|
||||
Result SendSyncRequestLight(Core::System& system, Handle session_handle, u32* args) {
|
||||
// Get the light client session from its handle.
|
||||
KScopedAutoObject session = GetCurrentProcess(system.Kernel())
|
||||
.GetHandleTable()
|
||||
.GetObject<KLightClientSession>(session_handle);
|
||||
R_UNLESS(session.IsNotNull(), ResultInvalidHandle);
|
||||
|
||||
// Send the request.
|
||||
R_TRY(session->SendSyncRequest(args));
|
||||
|
||||
R_SUCCEED();
|
||||
UNIMPLEMENTED();
|
||||
R_THROW(ResultNotImplemented);
|
||||
}
|
||||
|
||||
Result ReplyAndReceiveLight(Core::System& system, Handle session_handle, u32* args) {
|
||||
// Get the light server session from its handle.
|
||||
KScopedAutoObject session = GetCurrentProcess(system.Kernel())
|
||||
.GetHandleTable()
|
||||
.GetObject<KLightServerSession>(session_handle);
|
||||
R_UNLESS(session.IsNotNull(), ResultInvalidHandle);
|
||||
|
||||
// Handle the request.
|
||||
R_TRY(session->ReplyAndReceive(args));
|
||||
|
||||
R_SUCCEED();
|
||||
UNIMPLEMENTED();
|
||||
R_THROW(ResultNotImplemented);
|
||||
}
|
||||
|
||||
Result SendSyncRequestLight64(Core::System& system, Handle session_handle, u32* args) {
|
||||
@@ -56,36 +37,37 @@ Result ReplyAndReceiveLight64From32(Core::System& system, Handle session_handle,
|
||||
// Custom ABI implementation for light IPC.
|
||||
|
||||
template <typename F>
|
||||
static void SvcWrap_LightIpc(Core::System& system, std::span<uint64_t, 8> args, F&& cb) {
|
||||
std::array<u32, 7> ipc_args{};
|
||||
static void SvcWrap_LightIpc(Core::System& system, F&& cb) {
|
||||
auto& core = system.CurrentArmInterface();
|
||||
std::array<u32, 7> arguments{};
|
||||
|
||||
Handle session_handle = static_cast<Handle>(args[0]);
|
||||
Handle session_handle = static_cast<Handle>(core.GetReg(0));
|
||||
for (int i = 0; i < 7; i++) {
|
||||
ipc_args[i] = static_cast<u32>(args[i + 1]);
|
||||
arguments[i] = static_cast<u32>(core.GetReg(i + 1));
|
||||
}
|
||||
|
||||
Result ret = cb(system, session_handle, ipc_args.data());
|
||||
Result ret = cb(system, session_handle, arguments.data());
|
||||
|
||||
args[0] = ret.raw;
|
||||
core.SetReg(0, ret.raw);
|
||||
for (int i = 0; i < 7; i++) {
|
||||
args[i + 1] = ipc_args[i];
|
||||
core.SetReg(i + 1, arguments[i]);
|
||||
}
|
||||
}
|
||||
|
||||
void SvcWrap_SendSyncRequestLight64(Core::System& system, std::span<uint64_t, 8> args) {
|
||||
SvcWrap_LightIpc(system, args, SendSyncRequestLight64);
|
||||
void SvcWrap_SendSyncRequestLight64(Core::System& system) {
|
||||
SvcWrap_LightIpc(system, SendSyncRequestLight64);
|
||||
}
|
||||
|
||||
void SvcWrap_ReplyAndReceiveLight64(Core::System& system, std::span<uint64_t, 8> args) {
|
||||
SvcWrap_LightIpc(system, args, ReplyAndReceiveLight64);
|
||||
void SvcWrap_ReplyAndReceiveLight64(Core::System& system) {
|
||||
SvcWrap_LightIpc(system, ReplyAndReceiveLight64);
|
||||
}
|
||||
|
||||
void SvcWrap_SendSyncRequestLight64From32(Core::System& system, std::span<uint64_t, 8> args) {
|
||||
SvcWrap_LightIpc(system, args, SendSyncRequestLight64From32);
|
||||
void SvcWrap_SendSyncRequestLight64From32(Core::System& system) {
|
||||
SvcWrap_LightIpc(system, SendSyncRequestLight64From32);
|
||||
}
|
||||
|
||||
void SvcWrap_ReplyAndReceiveLight64From32(Core::System& system, std::span<uint64_t, 8> args) {
|
||||
SvcWrap_LightIpc(system, args, ReplyAndReceiveLight64From32);
|
||||
void SvcWrap_ReplyAndReceiveLight64From32(Core::System& system) {
|
||||
SvcWrap_LightIpc(system, ReplyAndReceiveLight64From32);
|
||||
}
|
||||
|
||||
} // namespace Kernel::Svc
|
||||
|
||||
@@ -5,7 +5,6 @@
|
||||
#include "core/core.h"
|
||||
#include "core/hle/kernel/k_client_port.h"
|
||||
#include "core/hle/kernel/k_client_session.h"
|
||||
#include "core/hle/kernel/k_light_client_session.h"
|
||||
#include "core/hle/kernel/k_object_name.h"
|
||||
#include "core/hle/kernel/k_port.h"
|
||||
#include "core/hle/kernel/k_process.h"
|
||||
@@ -52,73 +51,13 @@ Result ConnectToNamedPort(Core::System& system, Handle* out, u64 user_name) {
|
||||
|
||||
Result CreatePort(Core::System& system, Handle* out_server, Handle* out_client,
|
||||
int32_t max_sessions, bool is_light, uint64_t name) {
|
||||
auto& kernel = system.Kernel();
|
||||
|
||||
// Ensure max sessions is valid.
|
||||
R_UNLESS(max_sessions > 0, ResultOutOfRange);
|
||||
|
||||
// Get the current handle table.
|
||||
auto& handle_table = GetCurrentProcess(kernel).GetHandleTable();
|
||||
|
||||
// Create a new port.
|
||||
KPort* port = KPort::Create(kernel);
|
||||
R_UNLESS(port != nullptr, ResultOutOfResource);
|
||||
|
||||
// Initialize the port.
|
||||
port->Initialize(max_sessions, is_light, name);
|
||||
|
||||
// Ensure that we clean up the port (and its only references are handle table) on function end.
|
||||
SCOPE_EXIT({
|
||||
port->GetServerPort().Close();
|
||||
port->GetClientPort().Close();
|
||||
});
|
||||
|
||||
// Register the port.
|
||||
KPort::Register(kernel, port);
|
||||
|
||||
// Add the client to the handle table.
|
||||
R_TRY(handle_table.Add(out_client, std::addressof(port->GetClientPort())));
|
||||
|
||||
// Ensure that we maintain a clean handle state on exit.
|
||||
ON_RESULT_FAILURE {
|
||||
handle_table.Remove(*out_client);
|
||||
};
|
||||
|
||||
// Add the server to the handle table.
|
||||
R_RETURN(handle_table.Add(out_server, std::addressof(port->GetServerPort())));
|
||||
UNIMPLEMENTED();
|
||||
R_THROW(ResultNotImplemented);
|
||||
}
|
||||
|
||||
Result ConnectToPort(Core::System& system, Handle* out, Handle port) {
|
||||
// Get the current handle table.
|
||||
auto& handle_table = GetCurrentProcess(system.Kernel()).GetHandleTable();
|
||||
|
||||
// Get the client port.
|
||||
KScopedAutoObject client_port = handle_table.GetObject<KClientPort>(port);
|
||||
R_UNLESS(client_port.IsNotNull(), ResultInvalidHandle);
|
||||
|
||||
// Reserve a handle for the port.
|
||||
// NOTE: Nintendo really does write directly to the output handle here.
|
||||
R_TRY(handle_table.Reserve(out));
|
||||
ON_RESULT_FAILURE {
|
||||
handle_table.Unreserve(*out);
|
||||
};
|
||||
|
||||
// Create the session.
|
||||
KAutoObject* session;
|
||||
if (client_port->IsLight()) {
|
||||
R_TRY(client_port->CreateLightSession(
|
||||
reinterpret_cast<KLightClientSession**>(std::addressof(session))));
|
||||
} else {
|
||||
R_TRY(client_port->CreateSession(
|
||||
reinterpret_cast<KClientSession**>(std::addressof(session))));
|
||||
}
|
||||
|
||||
// Register the session.
|
||||
handle_table.Register(*out, session);
|
||||
session->Close();
|
||||
|
||||
// We succeeded.
|
||||
R_SUCCEED();
|
||||
Result ConnectToPort(Core::System& system, Handle* out_handle, Handle port) {
|
||||
UNIMPLEMENTED();
|
||||
R_THROW(ResultNotImplemented);
|
||||
}
|
||||
|
||||
Result ManageNamedPort(Core::System& system, Handle* out_server_handle, uint64_t user_name,
|
||||
|
||||
@@ -22,29 +22,31 @@ void CallSecureMonitor64From32(Core::System& system, ilp32::SecureMonitorArgumen
|
||||
|
||||
// Custom ABI for CallSecureMonitor.
|
||||
|
||||
void SvcWrap_CallSecureMonitor64(Core::System& system, std::span<uint64_t, 8> args) {
|
||||
lp64::SecureMonitorArguments smc_args{};
|
||||
void SvcWrap_CallSecureMonitor64(Core::System& system) {
|
||||
auto& core = system.CurrentPhysicalCore().ArmInterface();
|
||||
lp64::SecureMonitorArguments args{};
|
||||
for (int i = 0; i < 8; i++) {
|
||||
smc_args.r[i] = args[i];
|
||||
args.r[i] = core.GetReg(i);
|
||||
}
|
||||
|
||||
CallSecureMonitor64(system, std::addressof(smc_args));
|
||||
CallSecureMonitor64(system, std::addressof(args));
|
||||
|
||||
for (int i = 0; i < 8; i++) {
|
||||
args[i] = smc_args.r[i];
|
||||
core.SetReg(i, args.r[i]);
|
||||
}
|
||||
}
|
||||
|
||||
void SvcWrap_CallSecureMonitor64From32(Core::System& system, std::span<uint64_t, 8> args) {
|
||||
ilp32::SecureMonitorArguments smc_args{};
|
||||
void SvcWrap_CallSecureMonitor64From32(Core::System& system) {
|
||||
auto& core = system.CurrentPhysicalCore().ArmInterface();
|
||||
ilp32::SecureMonitorArguments args{};
|
||||
for (int i = 0; i < 8; i++) {
|
||||
smc_args.r[i] = static_cast<u32>(args[i]);
|
||||
args.r[i] = static_cast<u32>(core.GetReg(i));
|
||||
}
|
||||
|
||||
CallSecureMonitor64From32(system, std::addressof(smc_args));
|
||||
CallSecureMonitor64From32(system, std::addressof(args));
|
||||
|
||||
for (int i = 0; i < 8; i++) {
|
||||
args[i] = smc_args.r[i];
|
||||
core.SetReg(i, args.r[i]);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -3,10 +3,8 @@
|
||||
|
||||
#include "common/scope_exit.h"
|
||||
#include "core/core.h"
|
||||
#include "core/hle/kernel/k_light_session.h"
|
||||
#include "core/hle/kernel/k_process.h"
|
||||
#include "core/hle/kernel/k_scoped_resource_reservation.h"
|
||||
#include "core/hle/kernel/k_server_port.h"
|
||||
#include "core/hle/kernel/k_session.h"
|
||||
#include "core/hle/kernel/svc.h"
|
||||
|
||||
@@ -22,7 +20,7 @@ Result CreateSession(Core::System& system, Handle* out_server, Handle* out_clien
|
||||
T* session;
|
||||
|
||||
// Reserve a new session from the process resource limit.
|
||||
// TODO: Dynamic resource limits
|
||||
// FIXME: LimitableResource_SessionCountMax
|
||||
KScopedResourceReservation session_reservation(std::addressof(process),
|
||||
LimitableResource::SessionCountMax);
|
||||
if (session_reservation.Succeeded()) {
|
||||
@@ -94,42 +92,16 @@ Result CreateSession(Core::System& system, Handle* out_server, Handle* out_clien
|
||||
Result CreateSession(Core::System& system, Handle* out_server, Handle* out_client, bool is_light,
|
||||
u64 name) {
|
||||
if (is_light) {
|
||||
R_RETURN(CreateSession<KLightSession>(system, out_server, out_client, name));
|
||||
// return CreateSession<KLightSession>(system, out_server, out_client, name);
|
||||
R_THROW(ResultNotImplemented);
|
||||
} else {
|
||||
R_RETURN(CreateSession<KSession>(system, out_server, out_client, name));
|
||||
}
|
||||
}
|
||||
|
||||
Result AcceptSession(Core::System& system, Handle* out, Handle port_handle) {
|
||||
// Get the current handle table.
|
||||
auto& handle_table = GetCurrentProcess(system.Kernel()).GetHandleTable();
|
||||
|
||||
// Get the server port.
|
||||
KScopedAutoObject port = handle_table.GetObject<KServerPort>(port_handle);
|
||||
R_UNLESS(port.IsNotNull(), ResultInvalidHandle);
|
||||
|
||||
// Reserve an entry for the new session.
|
||||
R_TRY(handle_table.Reserve(out));
|
||||
ON_RESULT_FAILURE {
|
||||
handle_table.Unreserve(*out);
|
||||
};
|
||||
|
||||
// Accept the session.
|
||||
KAutoObject* session;
|
||||
if (port->IsLight()) {
|
||||
session = port->AcceptLightSession();
|
||||
} else {
|
||||
session = port->AcceptSession();
|
||||
}
|
||||
|
||||
// Ensure we accepted successfully.
|
||||
R_UNLESS(session != nullptr, ResultNotFound);
|
||||
|
||||
// Register the session.
|
||||
handle_table.Register(*out, session);
|
||||
session->Close();
|
||||
|
||||
R_SUCCEED();
|
||||
Result AcceptSession(Core::System& system, Handle* out_handle, Handle port_handle) {
|
||||
UNIMPLEMENTED();
|
||||
R_THROW(ResultNotImplemented);
|
||||
}
|
||||
|
||||
Result CreateSession64(Core::System& system, Handle* out_server_session_handle,
|
||||
|
||||
@@ -90,6 +90,8 @@ Result StartThread(Core::System& system, Handle thread_handle) {
|
||||
|
||||
/// Called when a thread exits
|
||||
void ExitThread(Core::System& system) {
|
||||
LOG_DEBUG(Kernel_SVC, "called, pc=0x{:08X}", system.CurrentArmInterface().GetPC());
|
||||
|
||||
auto* const current_thread = GetCurrentThreadPointer(system.Kernel());
|
||||
system.GlobalSchedulerContext().RemoveThread(current_thread);
|
||||
current_thread->Exit();
|
||||
@@ -145,19 +147,47 @@ Result GetThreadContext3(Core::System& system, u64 out_context, Handle thread_ha
|
||||
R_UNLESS(thread.IsNotNull(), ResultInvalidHandle);
|
||||
|
||||
// Require the handle be to a non-current thread in the current process.
|
||||
R_UNLESS(thread->GetOwnerProcess() == GetCurrentProcessPointer(kernel), ResultInvalidHandle);
|
||||
R_UNLESS(thread.GetPointerUnsafe() != GetCurrentThreadPointer(kernel), ResultBusy);
|
||||
const auto* current_process = GetCurrentProcessPointer(kernel);
|
||||
R_UNLESS(current_process == thread->GetOwnerProcess(), ResultInvalidId);
|
||||
|
||||
// Get the thread context.
|
||||
Svc::ThreadContext context{};
|
||||
R_TRY(thread->GetThreadContext3(std::addressof(context)));
|
||||
// Verify that the thread isn't terminated.
|
||||
R_UNLESS(thread->GetState() != ThreadState::Terminated, ResultTerminationRequested);
|
||||
|
||||
// Copy the thread context to user space.
|
||||
R_UNLESS(
|
||||
GetCurrentMemory(kernel).WriteBlock(out_context, std::addressof(context), sizeof(context)),
|
||||
ResultInvalidPointer);
|
||||
/// Check that the thread is not the current one.
|
||||
/// NOTE: Nintendo does not check this, and thus the following loop will deadlock.
|
||||
R_UNLESS(thread.GetPointerUnsafe() != GetCurrentThreadPointer(kernel), ResultInvalidId);
|
||||
|
||||
R_SUCCEED();
|
||||
// Try to get the thread context until the thread isn't current on any core.
|
||||
while (true) {
|
||||
KScopedSchedulerLock sl{kernel};
|
||||
|
||||
// TODO(bunnei): Enforce that thread is suspended for debug here.
|
||||
|
||||
// If the thread's raw state isn't runnable, check if it's current on some core.
|
||||
if (thread->GetRawState() != ThreadState::Runnable) {
|
||||
bool current = false;
|
||||
for (auto i = 0; i < static_cast<s32>(Core::Hardware::NUM_CPU_CORES); ++i) {
|
||||
if (thread.GetPointerUnsafe() == kernel.Scheduler(i).GetSchedulerCurrentThread()) {
|
||||
current = true;
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
// If the thread is current, retry until it isn't.
|
||||
if (current) {
|
||||
continue;
|
||||
}
|
||||
}
|
||||
|
||||
// Get the thread context.
|
||||
static thread_local Common::ScratchBuffer<u8> context;
|
||||
R_TRY(thread->GetThreadContext3(context));
|
||||
|
||||
// Copy the thread context to user space.
|
||||
GetCurrentMemory(kernel).WriteBlock(out_context, context.data(), context.size());
|
||||
|
||||
R_SUCCEED();
|
||||
}
|
||||
}
|
||||
|
||||
/// Gets the priority for the specified thread
|
||||
|
||||
@@ -374,11 +374,11 @@ def get_registers(parse_result, bitness):
|
||||
|
||||
# Collects possibly multiple source registers into the named C++ value.
|
||||
def emit_gather(sources, name, type_name, reg_size):
|
||||
get_fn = f"GetArg{reg_size*8}"
|
||||
get_fn = f"GetReg{reg_size*8}"
|
||||
|
||||
if len(sources) == 1:
|
||||
s, = sources
|
||||
line = f"{name} = Convert<{type_name}>({get_fn}(args, {s}));"
|
||||
line = f"{name} = Convert<{type_name}>({get_fn}(system, {s}));"
|
||||
return [line]
|
||||
|
||||
var_type = f"std::array<uint{reg_size*8}_t, {len(sources)}>"
|
||||
@@ -387,7 +387,7 @@ def emit_gather(sources, name, type_name, reg_size):
|
||||
]
|
||||
for i in range(0, len(sources)):
|
||||
lines.append(
|
||||
f"{name}_gather[{i}] = {get_fn}(args, {sources[i]});")
|
||||
f"{name}_gather[{i}] = {get_fn}(system, {sources[i]});")
|
||||
|
||||
lines.append(f"{name} = Convert<{type_name}>({name}_gather);")
|
||||
return lines
|
||||
@@ -396,12 +396,12 @@ def emit_gather(sources, name, type_name, reg_size):
|
||||
# Produces one or more statements which assign the named C++ value
|
||||
# into possibly multiple registers.
|
||||
def emit_scatter(destinations, name, reg_size):
|
||||
set_fn = f"SetArg{reg_size*8}"
|
||||
set_fn = f"SetReg{reg_size*8}"
|
||||
reg_type = f"uint{reg_size*8}_t"
|
||||
|
||||
if len(destinations) == 1:
|
||||
d, = destinations
|
||||
line = f"{set_fn}(args, {d}, Convert<{reg_type}>({name}));"
|
||||
line = f"{set_fn}(system, {d}, Convert<{reg_type}>({name}));"
|
||||
return [line]
|
||||
|
||||
var_type = f"std::array<{reg_type}, {len(destinations)}>"
|
||||
@@ -411,7 +411,7 @@ def emit_scatter(destinations, name, reg_size):
|
||||
|
||||
for i in range(0, len(destinations)):
|
||||
lines.append(
|
||||
f"{set_fn}(args, {destinations[i]}, {name}_scatter[{i}]);")
|
||||
f"{set_fn}(system, {destinations[i]}, {name}_scatter[{i}]);")
|
||||
|
||||
return lines
|
||||
|
||||
@@ -433,7 +433,7 @@ def emit_lines(lines, indent=' '):
|
||||
def emit_wrapper(wrapped_fn, suffix, register_info, arguments, byte_size):
|
||||
return_write, output_writes, input_reads = register_info
|
||||
lines = [
|
||||
f"static void SvcWrap_{wrapped_fn}{suffix}(Core::System& system, std::span<uint64_t, 8> args) {{"
|
||||
f"static void SvcWrap_{wrapped_fn}{suffix}(Core::System& system) {{"
|
||||
]
|
||||
|
||||
# Get everything ready.
|
||||
@@ -498,8 +498,6 @@ namespace Core {
|
||||
class System;
|
||||
}
|
||||
|
||||
#include <span>
|
||||
|
||||
#include "common/common_types.h"
|
||||
#include "core/hle/kernel/svc_types.h"
|
||||
#include "core/hle/result.h"
|
||||
@@ -526,15 +524,15 @@ void CallSecureMonitor64From32(Core::System& system, ilp32::SecureMonitorArgumen
|
||||
void CallSecureMonitor64(Core::System& system, lp64::SecureMonitorArguments* args);
|
||||
|
||||
// Defined in svc_light_ipc.cpp.
|
||||
void SvcWrap_ReplyAndReceiveLight64From32(Core::System& system, std::span<uint64_t, 8> args);
|
||||
void SvcWrap_ReplyAndReceiveLight64(Core::System& system, std::span<uint64_t, 8> args);
|
||||
void SvcWrap_ReplyAndReceiveLight64From32(Core::System& system);
|
||||
void SvcWrap_ReplyAndReceiveLight64(Core::System& system);
|
||||
|
||||
void SvcWrap_SendSyncRequestLight64From32(Core::System& system, std::span<uint64_t, 8> args);
|
||||
void SvcWrap_SendSyncRequestLight64(Core::System& system, std::span<uint64_t, 8> args);
|
||||
void SvcWrap_SendSyncRequestLight64From32(Core::System& system);
|
||||
void SvcWrap_SendSyncRequestLight64(Core::System& system);
|
||||
|
||||
// Defined in svc_secure_monitor_call.cpp.
|
||||
void SvcWrap_CallSecureMonitor64From32(Core::System& system, std::span<uint64_t, 8> args);
|
||||
void SvcWrap_CallSecureMonitor64(Core::System& system, std::span<uint64_t, 8> args);
|
||||
void SvcWrap_CallSecureMonitor64From32(Core::System& system);
|
||||
void SvcWrap_CallSecureMonitor64(Core::System& system);
|
||||
|
||||
// Perform a supervisor call by index.
|
||||
void Call(Core::System& system, u32 imm);
|
||||
@@ -552,20 +550,20 @@ PROLOGUE_CPP = """
|
||||
|
||||
namespace Kernel::Svc {
|
||||
|
||||
static uint32_t GetArg32(std::span<uint64_t, 8> args, int n) {
|
||||
return static_cast<uint32_t>(args[n]);
|
||||
static uint32_t GetReg32(Core::System& system, int n) {
|
||||
return static_cast<uint32_t>(system.CurrentArmInterface().GetReg(n));
|
||||
}
|
||||
|
||||
static void SetArg32(std::span<uint64_t, 8> args, int n, uint32_t result) {
|
||||
args[n] = result;
|
||||
static void SetReg32(Core::System& system, int n, uint32_t result) {
|
||||
system.CurrentArmInterface().SetReg(n, static_cast<uint64_t>(result));
|
||||
}
|
||||
|
||||
static uint64_t GetArg64(std::span<uint64_t, 8> args, int n) {
|
||||
return args[n];
|
||||
static uint64_t GetReg64(Core::System& system, int n) {
|
||||
return system.CurrentArmInterface().GetReg(n);
|
||||
}
|
||||
|
||||
static void SetArg64(std::span<uint64_t, 8> args, int n, uint64_t result) {
|
||||
args[n] = result;
|
||||
static void SetReg64(Core::System& system, int n, uint64_t result) {
|
||||
system.CurrentArmInterface().SetReg(n, result);
|
||||
}
|
||||
|
||||
// Like bit_cast, but handles the case when the source and dest
|
||||
@@ -592,20 +590,15 @@ EPILOGUE_CPP = """
|
||||
|
||||
void Call(Core::System& system, u32 imm) {
|
||||
auto& kernel = system.Kernel();
|
||||
auto& process = GetCurrentProcess(kernel);
|
||||
|
||||
std::array<uint64_t, 8> args;
|
||||
kernel.CurrentPhysicalCore().SaveSvcArguments(process, args);
|
||||
kernel.EnterSVCProfile();
|
||||
|
||||
if (process.Is64Bit()) {
|
||||
Call64(system, imm, args);
|
||||
if (GetCurrentProcess(system.Kernel()).Is64Bit()) {
|
||||
Call64(system, imm);
|
||||
} else {
|
||||
Call32(system, imm, args);
|
||||
Call32(system, imm);
|
||||
}
|
||||
|
||||
kernel.ExitSVCProfile();
|
||||
kernel.CurrentPhysicalCore().LoadSvcArguments(process, args);
|
||||
}
|
||||
|
||||
} // namespace Kernel::Svc
|
||||
@@ -616,13 +609,13 @@ def emit_call(bitness, names, suffix):
|
||||
bit_size = REG_SIZES[bitness]*8
|
||||
indent = " "
|
||||
lines = [
|
||||
f"static void Call{bit_size}(Core::System& system, u32 imm, std::span<uint64_t, 8> args) {{",
|
||||
f"static void Call{bit_size}(Core::System& system, u32 imm) {{",
|
||||
f"{indent}switch (static_cast<SvcId>(imm)) {{"
|
||||
]
|
||||
|
||||
for _, name in names:
|
||||
lines.append(f"{indent}case SvcId::{name}:")
|
||||
lines.append(f"{indent*2}return SvcWrap_{name}{suffix}(system, args);")
|
||||
lines.append(f"{indent*2}return SvcWrap_{name}{suffix}(system);")
|
||||
|
||||
lines.append(f"{indent}default:")
|
||||
lines.append(
|
||||
|
||||
@@ -246,13 +246,7 @@ static void BuildEntryIndex(std::vector<FileSys::Entry>& entries, const std::vec
|
||||
entries.reserve(entries.size() + new_data.size());
|
||||
|
||||
for (const auto& new_entry : new_data) {
|
||||
auto name = new_entry->GetName();
|
||||
|
||||
if (type == FileSys::EntryType::File && name == FileSys::GetSaveDataSizeFileName()) {
|
||||
continue;
|
||||
}
|
||||
|
||||
entries.emplace_back(name, type,
|
||||
entries.emplace_back(new_entry->GetName(), type,
|
||||
type == FileSys::EntryType::Directory ? 0 : new_entry->GetSize());
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,199 +0,0 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2023 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-3.0-or-later
|
||||
|
||||
#include "core/core.h"
|
||||
#include "core/hle/kernel/k_shared_memory.h"
|
||||
#include "core/hle/service/hid/controllers/applet_resource.h"
|
||||
#include "core/hle/service/hid/errors.h"
|
||||
|
||||
namespace Service::HID {
|
||||
|
||||
AppletResource::AppletResource(Core::System& system_) : system{system_} {}
|
||||
|
||||
AppletResource::~AppletResource() = default;
|
||||
|
||||
Result AppletResource::CreateAppletResource(u64 aruid) {
|
||||
const u64 index = GetIndexFromAruid(aruid);
|
||||
|
||||
if (index >= AruidIndexMax) {
|
||||
return ResultAruidNotRegistered;
|
||||
}
|
||||
|
||||
if (data[index].flag.is_assigned) {
|
||||
return ResultAruidAlreadyRegistered;
|
||||
}
|
||||
|
||||
// TODO: Here shared memory is created for the process we don't quite emulate this part so
|
||||
// obtain this pointer from system
|
||||
auto& shared_memory = system.Kernel().GetHidSharedMem();
|
||||
|
||||
data[index].shared_memory_handle = &shared_memory;
|
||||
data[index].flag.is_assigned.Assign(true);
|
||||
// TODO: InitializeSixAxisControllerConfig(false);
|
||||
active_aruid = aruid;
|
||||
return ResultSuccess;
|
||||
}
|
||||
|
||||
Result AppletResource::RegisterAppletResourceUserId(u64 aruid, bool enable_input) {
|
||||
const u64 index = GetIndexFromAruid(aruid);
|
||||
|
||||
if (index < AruidIndexMax) {
|
||||
return ResultAruidAlreadyRegistered;
|
||||
}
|
||||
|
||||
std::size_t data_index = AruidIndexMax;
|
||||
for (std::size_t i = 0; i < AruidIndexMax; i++) {
|
||||
if (!data[i].flag.is_initialized) {
|
||||
data_index = i;
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
if (data_index == AruidIndexMax) {
|
||||
return ResultAruidNoAvailableEntries;
|
||||
}
|
||||
|
||||
AruidData& aruid_data = data[data_index];
|
||||
|
||||
aruid_data.aruid = aruid;
|
||||
aruid_data.flag.is_initialized.Assign(true);
|
||||
if (enable_input) {
|
||||
aruid_data.flag.enable_pad_input.Assign(true);
|
||||
aruid_data.flag.enable_six_axis_sensor.Assign(true);
|
||||
aruid_data.flag.bit_18.Assign(true);
|
||||
aruid_data.flag.enable_touchscreen.Assign(true);
|
||||
}
|
||||
|
||||
data_index = AruidIndexMax;
|
||||
for (std::size_t i = 0; i < AruidIndexMax; i++) {
|
||||
if (registration_list.flag[i] == RegistrationStatus::Initialized) {
|
||||
if (registration_list.aruid[i] != aruid) {
|
||||
continue;
|
||||
}
|
||||
data_index = i;
|
||||
break;
|
||||
}
|
||||
if (registration_list.flag[i] == RegistrationStatus::None) {
|
||||
data_index = i;
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
if (data_index == AruidIndexMax) {
|
||||
return ResultSuccess;
|
||||
}
|
||||
|
||||
registration_list.flag[data_index] = RegistrationStatus::Initialized;
|
||||
registration_list.aruid[data_index] = aruid;
|
||||
|
||||
return ResultSuccess;
|
||||
}
|
||||
|
||||
void AppletResource::UnregisterAppletResourceUserId(u64 aruid) {
|
||||
u64 index = GetIndexFromAruid(aruid);
|
||||
|
||||
if (index < AruidIndexMax) {
|
||||
if (data[index].flag.is_assigned) {
|
||||
data[index].shared_memory_handle = nullptr;
|
||||
data[index].flag.is_assigned.Assign(false);
|
||||
}
|
||||
}
|
||||
|
||||
index = GetIndexFromAruid(aruid);
|
||||
if (index < AruidIndexMax) {
|
||||
DestroySevenSixAxisTransferMemory();
|
||||
data[index].flag.raw = 0;
|
||||
data[index].aruid = 0;
|
||||
|
||||
index = GetIndexFromAruid(aruid);
|
||||
if (index < AruidIndexMax) {
|
||||
registration_list.flag[index] = RegistrationStatus::PendingDelete;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
u64 AppletResource::GetActiveAruid() {
|
||||
return active_aruid;
|
||||
}
|
||||
|
||||
Result AppletResource::GetSharedMemoryHandle(Kernel::KSharedMemory** out_handle, u64 aruid) {
|
||||
u64 index = GetIndexFromAruid(aruid);
|
||||
if (index >= AruidIndexMax) {
|
||||
return ResultAruidNotRegistered;
|
||||
}
|
||||
|
||||
*out_handle = data[index].shared_memory_handle;
|
||||
return ResultSuccess;
|
||||
}
|
||||
|
||||
u64 AppletResource::GetIndexFromAruid(u64 aruid) {
|
||||
for (std::size_t i = 0; i < AruidIndexMax; i++) {
|
||||
if (registration_list.flag[i] == RegistrationStatus::Initialized &&
|
||||
registration_list.aruid[i] == aruid) {
|
||||
return i;
|
||||
}
|
||||
}
|
||||
return AruidIndexMax;
|
||||
}
|
||||
|
||||
Result AppletResource::DestroySevenSixAxisTransferMemory() {
|
||||
// TODO
|
||||
return ResultSuccess;
|
||||
}
|
||||
|
||||
void AppletResource::EnableInput(u64 aruid, bool is_enabled) {
|
||||
const u64 index = GetIndexFromAruid(aruid);
|
||||
if (index >= AruidIndexMax) {
|
||||
return;
|
||||
}
|
||||
|
||||
data[index].flag.enable_pad_input.Assign(is_enabled);
|
||||
data[index].flag.enable_touchscreen.Assign(is_enabled);
|
||||
}
|
||||
|
||||
void AppletResource::EnableSixAxisSensor(u64 aruid, bool is_enabled) {
|
||||
const u64 index = GetIndexFromAruid(aruid);
|
||||
if (index >= AruidIndexMax) {
|
||||
return;
|
||||
}
|
||||
|
||||
data[index].flag.enable_six_axis_sensor.Assign(is_enabled);
|
||||
}
|
||||
|
||||
void AppletResource::EnablePadInput(u64 aruid, bool is_enabled) {
|
||||
const u64 index = GetIndexFromAruid(aruid);
|
||||
if (index >= AruidIndexMax) {
|
||||
return;
|
||||
}
|
||||
|
||||
data[index].flag.enable_pad_input.Assign(is_enabled);
|
||||
}
|
||||
|
||||
void AppletResource::EnableTouchScreen(u64 aruid, bool is_enabled) {
|
||||
const u64 index = GetIndexFromAruid(aruid);
|
||||
if (index >= AruidIndexMax) {
|
||||
return;
|
||||
}
|
||||
|
||||
data[index].flag.enable_touchscreen.Assign(is_enabled);
|
||||
}
|
||||
|
||||
void AppletResource::SetIsPalmaConnectable(u64 aruid, bool is_connectable) {
|
||||
const u64 index = GetIndexFromAruid(aruid);
|
||||
if (index >= AruidIndexMax) {
|
||||
return;
|
||||
}
|
||||
|
||||
data[index].flag.is_palma_connectable.Assign(is_connectable);
|
||||
}
|
||||
|
||||
void AppletResource::EnablePalmaBoostMode(u64 aruid, bool is_enabled) {
|
||||
const u64 index = GetIndexFromAruid(aruid);
|
||||
if (index >= AruidIndexMax) {
|
||||
return;
|
||||
}
|
||||
|
||||
data[index].flag.enable_palma_boost_mode.Assign(is_enabled);
|
||||
}
|
||||
|
||||
} // namespace Service::HID
|
||||
@@ -1,87 +0,0 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2023 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-3.0-or-later
|
||||
|
||||
#pragma once
|
||||
|
||||
#include <array>
|
||||
|
||||
#include "common/bit_field.h"
|
||||
#include "common/common_types.h"
|
||||
#include "core/hle/result.h"
|
||||
|
||||
namespace Core {
|
||||
class System;
|
||||
}
|
||||
|
||||
namespace Kernel {
|
||||
class KSharedMemory;
|
||||
}
|
||||
|
||||
namespace Service::HID {
|
||||
class AppletResource {
|
||||
public:
|
||||
explicit AppletResource(Core::System& system_);
|
||||
~AppletResource();
|
||||
|
||||
Result CreateAppletResource(u64 aruid);
|
||||
|
||||
Result RegisterAppletResourceUserId(u64 aruid, bool enable_input);
|
||||
void UnregisterAppletResourceUserId(u64 aruid);
|
||||
|
||||
u64 GetActiveAruid();
|
||||
Result GetSharedMemoryHandle(Kernel::KSharedMemory** out_handle, u64 aruid);
|
||||
|
||||
u64 GetIndexFromAruid(u64 aruid);
|
||||
|
||||
Result DestroySevenSixAxisTransferMemory();
|
||||
|
||||
void EnableInput(u64 aruid, bool is_enabled);
|
||||
void EnableSixAxisSensor(u64 aruid, bool is_enabled);
|
||||
void EnablePadInput(u64 aruid, bool is_enabled);
|
||||
void EnableTouchScreen(u64 aruid, bool is_enabled);
|
||||
void SetIsPalmaConnectable(u64 aruid, bool is_connectable);
|
||||
void EnablePalmaBoostMode(u64 aruid, bool is_enabled);
|
||||
|
||||
private:
|
||||
static constexpr std::size_t AruidIndexMax = 0x20;
|
||||
|
||||
enum RegistrationStatus : u32 {
|
||||
None,
|
||||
Initialized,
|
||||
PendingDelete,
|
||||
};
|
||||
|
||||
struct DataStatusFlag {
|
||||
union {
|
||||
u32 raw{};
|
||||
|
||||
BitField<0, 1, u32> is_initialized;
|
||||
BitField<1, 1, u32> is_assigned;
|
||||
BitField<16, 1, u32> enable_pad_input;
|
||||
BitField<17, 1, u32> enable_six_axis_sensor;
|
||||
BitField<18, 1, u32> bit_18;
|
||||
BitField<19, 1, u32> is_palma_connectable;
|
||||
BitField<20, 1, u32> enable_palma_boost_mode;
|
||||
BitField<21, 1, u32> enable_touchscreen;
|
||||
};
|
||||
};
|
||||
|
||||
struct AruidRegisterList {
|
||||
std::array<RegistrationStatus, AruidIndexMax> flag{};
|
||||
std::array<u64, AruidIndexMax> aruid{};
|
||||
};
|
||||
static_assert(sizeof(AruidRegisterList) == 0x180, "AruidRegisterList is an invalid size");
|
||||
|
||||
struct AruidData {
|
||||
DataStatusFlag flag{};
|
||||
u64 aruid{};
|
||||
Kernel::KSharedMemory* shared_memory_handle{nullptr};
|
||||
};
|
||||
|
||||
u64 active_aruid{};
|
||||
AruidRegisterList registration_list{};
|
||||
std::array<AruidData, AruidIndexMax> data{};
|
||||
|
||||
Core::System& system;
|
||||
};
|
||||
} // namespace Service::HID
|
||||
@@ -19,11 +19,6 @@ constexpr Result NpadIsSameType{ErrorModule::HID, 602};
|
||||
constexpr Result InvalidNpadId{ErrorModule::HID, 709};
|
||||
constexpr Result NpadNotConnected{ErrorModule::HID, 710};
|
||||
constexpr Result InvalidArraySize{ErrorModule::HID, 715};
|
||||
|
||||
constexpr Result ResultAruidNoAvailableEntries{ErrorModule::HID, 1044};
|
||||
constexpr Result ResultAruidAlreadyRegistered{ErrorModule::HID, 1046};
|
||||
constexpr Result ResultAruidNotRegistered{ErrorModule::HID, 1047};
|
||||
|
||||
constexpr Result InvalidPalmaHandle{ErrorModule::HID, 3302};
|
||||
|
||||
} // namespace Service::HID
|
||||
|
||||
@@ -1,8 +1,6 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2018 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include "core/hle/kernel/k_process.h"
|
||||
#include "core/hle/kernel/kernel.h"
|
||||
#include "core/hle/service/hid/hid.h"
|
||||
#include "core/hle/service/hid/hid_debug_server.h"
|
||||
#include "core/hle/service/hid/hid_firmware_settings.h"
|
||||
@@ -22,12 +20,6 @@ void LoopProcess(Core::System& system) {
|
||||
std::shared_ptr<HidFirmwareSettings> firmware_settings =
|
||||
std::make_shared<HidFirmwareSettings>();
|
||||
|
||||
// TODO: Remove this hack until this service is emulated properly.
|
||||
const auto process_list = system.Kernel().GetProcessList();
|
||||
if (!process_list.empty()) {
|
||||
resouce_manager->RegisterAppletResourceUserId(process_list[0]->GetId(), true);
|
||||
}
|
||||
|
||||
server_manager->RegisterNamedService(
|
||||
"hid", std::make_shared<IHidServer>(system, resouce_manager, firmware_settings));
|
||||
server_manager->RegisterNamedService(
|
||||
|
||||
@@ -224,13 +224,8 @@ void IHidServer::CreateAppletResource(HLERequestContext& ctx) {
|
||||
|
||||
LOG_DEBUG(Service_HID, "called, applet_resource_user_id={}", applet_resource_user_id);
|
||||
|
||||
Result result = GetResourceManager()->CreateAppletResource(applet_resource_user_id);
|
||||
if (result.IsSuccess()) {
|
||||
result = GetResourceManager()->GetNpad()->Activate(applet_resource_user_id);
|
||||
}
|
||||
|
||||
IPC::ResponseBuilder rb{ctx, 2, 0, 1};
|
||||
rb.Push(result);
|
||||
rb.Push(ResultSuccess);
|
||||
rb.PushIpcInterface<IAppletResource>(system, resource_manager);
|
||||
}
|
||||
|
||||
|
||||
@@ -3,7 +3,6 @@
|
||||
|
||||
#include "core/hid/hid_core.h"
|
||||
#include "core/hle/service/hid/controllers/npad.h"
|
||||
#include "core/hle/service/hid/controllers/palma.h"
|
||||
#include "core/hle/service/hid/controllers/touchscreen.h"
|
||||
#include "core/hle/service/hid/errors.h"
|
||||
#include "core/hle/service/hid/hid_system_server.h"
|
||||
@@ -64,13 +63,13 @@ IHidSystemServer::IHidSystemServer(Core::System& system_, std::shared_ptr<Resour
|
||||
{329, nullptr, "DetachAbstractedPadAll"},
|
||||
{330, nullptr, "CheckAbstractedPadConnection"},
|
||||
{500, nullptr, "SetAppletResourceUserId"},
|
||||
{501, &IHidSystemServer::RegisterAppletResourceUserId, "RegisterAppletResourceUserId"},
|
||||
{502, &IHidSystemServer::UnregisterAppletResourceUserId, "UnregisterAppletResourceUserId"},
|
||||
{503, &IHidSystemServer::EnableAppletToGetInput, "EnableAppletToGetInput"},
|
||||
{501, nullptr, "RegisterAppletResourceUserId"},
|
||||
{502, nullptr, "UnregisterAppletResourceUserId"},
|
||||
{503, nullptr, "EnableAppletToGetInput"},
|
||||
{504, nullptr, "SetAruidValidForVibration"},
|
||||
{505, &IHidSystemServer::EnableAppletToGetSixAxisSensor, "EnableAppletToGetSixAxisSensor"},
|
||||
{506, &IHidSystemServer::EnableAppletToGetPadInput, "EnableAppletToGetPadInput"},
|
||||
{507, &IHidSystemServer::EnableAppletToGetTouchScreen, "EnableAppletToGetTouchScreen"},
|
||||
{505, nullptr, "EnableAppletToGetSixAxisSensor"},
|
||||
{506, nullptr, "EnableAppletToGetPadInput"},
|
||||
{507, nullptr, "EnableAppletToGetTouchScreen"},
|
||||
{510, nullptr, "SetVibrationMasterVolume"},
|
||||
{511, nullptr, "GetVibrationMasterVolume"},
|
||||
{512, nullptr, "BeginPermitVibrationSession"},
|
||||
@@ -421,129 +420,6 @@ void IHidSystemServer::GetIrSensorState(HLERequestContext& ctx) {
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ResultSuccess);
|
||||
}
|
||||
void IHidSystemServer::RegisterAppletResourceUserId(HLERequestContext& ctx) {
|
||||
IPC::RequestParser rp{ctx};
|
||||
struct Parameters {
|
||||
bool enable_input;
|
||||
INSERT_PADDING_WORDS_NOINIT(1);
|
||||
u64 applet_resource_user_id;
|
||||
};
|
||||
static_assert(sizeof(Parameters) == 0x10, "Parameters has incorrect size.");
|
||||
|
||||
const auto parameters{rp.PopRaw<Parameters>()};
|
||||
|
||||
LOG_INFO(Service_HID, "called, enable_input={}, applet_resource_user_id={}",
|
||||
parameters.enable_input, parameters.applet_resource_user_id);
|
||||
|
||||
Result result = GetResourceManager()->RegisterAppletResourceUserId(
|
||||
parameters.applet_resource_user_id, parameters.enable_input);
|
||||
|
||||
if (result.IsSuccess()) {
|
||||
// result = GetResourceManager()->GetNpad()->RegisterAppletResourceUserId(
|
||||
// parameters.applet_resource_user_id);
|
||||
}
|
||||
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ResultSuccess);
|
||||
}
|
||||
|
||||
void IHidSystemServer::UnregisterAppletResourceUserId(HLERequestContext& ctx) {
|
||||
IPC::RequestParser rp{ctx};
|
||||
u64 applet_resource_user_id{rp.Pop<u64>()};
|
||||
|
||||
LOG_INFO(Service_HID, "called, applet_resource_user_id={}", applet_resource_user_id);
|
||||
|
||||
GetResourceManager()->UnregisterAppletResourceUserId(applet_resource_user_id);
|
||||
// GetResourceManager()->GetNpad()->UnregisterAppletResourceUserId(applet_resource_user_id);
|
||||
// GetResourceManager()->GetPalma()->UnregisterAppletResourceUserId(applet_resource_user_id);
|
||||
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ResultSuccess);
|
||||
}
|
||||
|
||||
void IHidSystemServer::EnableAppletToGetInput(HLERequestContext& ctx) {
|
||||
IPC::RequestParser rp{ctx};
|
||||
struct Parameters {
|
||||
bool is_enabled;
|
||||
INSERT_PADDING_WORDS_NOINIT(1);
|
||||
u64 applet_resource_user_id;
|
||||
};
|
||||
static_assert(sizeof(Parameters) == 0x10, "Parameters has incorrect size.");
|
||||
|
||||
const auto parameters{rp.PopRaw<Parameters>()};
|
||||
|
||||
LOG_INFO(Service_HID, "called, is_enabled={}, applet_resource_user_id={}",
|
||||
parameters.is_enabled, parameters.applet_resource_user_id);
|
||||
|
||||
GetResourceManager()->EnableInput(parameters.applet_resource_user_id, parameters.is_enabled);
|
||||
// GetResourceManager()->GetNpad()->EnableInput(parameters.applet_resource_user_id);
|
||||
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ResultSuccess);
|
||||
}
|
||||
|
||||
void IHidSystemServer::EnableAppletToGetSixAxisSensor(HLERequestContext& ctx) {
|
||||
IPC::RequestParser rp{ctx};
|
||||
struct Parameters {
|
||||
bool is_enabled;
|
||||
INSERT_PADDING_WORDS_NOINIT(1);
|
||||
u64 applet_resource_user_id;
|
||||
};
|
||||
static_assert(sizeof(Parameters) == 0x10, "Parameters has incorrect size.");
|
||||
|
||||
const auto parameters{rp.PopRaw<Parameters>()};
|
||||
|
||||
LOG_INFO(Service_HID, "called, is_enabled={}, applet_resource_user_id={}",
|
||||
parameters.is_enabled, parameters.applet_resource_user_id);
|
||||
|
||||
GetResourceManager()->EnableTouchScreen(parameters.applet_resource_user_id,
|
||||
parameters.is_enabled);
|
||||
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ResultSuccess);
|
||||
}
|
||||
|
||||
void IHidSystemServer::EnableAppletToGetPadInput(HLERequestContext& ctx) {
|
||||
IPC::RequestParser rp{ctx};
|
||||
struct Parameters {
|
||||
bool is_enabled;
|
||||
INSERT_PADDING_WORDS_NOINIT(1);
|
||||
u64 applet_resource_user_id;
|
||||
};
|
||||
static_assert(sizeof(Parameters) == 0x10, "Parameters has incorrect size.");
|
||||
|
||||
const auto parameters{rp.PopRaw<Parameters>()};
|
||||
|
||||
LOG_INFO(Service_HID, "called, is_enabled={}, applet_resource_user_id={}",
|
||||
parameters.is_enabled, parameters.applet_resource_user_id);
|
||||
|
||||
GetResourceManager()->EnablePadInput(parameters.applet_resource_user_id, parameters.is_enabled);
|
||||
// GetResourceManager()->GetNpad()->EnableInput(parameters.applet_resource_user_id);
|
||||
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ResultSuccess);
|
||||
}
|
||||
|
||||
void IHidSystemServer::EnableAppletToGetTouchScreen(HLERequestContext& ctx) {
|
||||
IPC::RequestParser rp{ctx};
|
||||
struct Parameters {
|
||||
bool is_enabled;
|
||||
INSERT_PADDING_WORDS_NOINIT(1);
|
||||
u64 applet_resource_user_id;
|
||||
};
|
||||
static_assert(sizeof(Parameters) == 0x10, "Parameters has incorrect size.");
|
||||
|
||||
const auto parameters{rp.PopRaw<Parameters>()};
|
||||
|
||||
LOG_INFO(Service_HID, "called, is_enabled={}, applet_resource_user_id={}",
|
||||
parameters.is_enabled, parameters.applet_resource_user_id);
|
||||
|
||||
GetResourceManager()->EnableTouchScreen(parameters.applet_resource_user_id,
|
||||
parameters.is_enabled);
|
||||
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ResultSuccess);
|
||||
}
|
||||
|
||||
void IHidSystemServer::AcquireConnectionTriggerTimeoutEvent(HLERequestContext& ctx) {
|
||||
LOG_INFO(Service_AM, "(STUBBED) called");
|
||||
|
||||
@@ -38,12 +38,6 @@ private:
|
||||
void HasLeftRightBattery(HLERequestContext& ctx);
|
||||
void GetUniquePadsFromNpad(HLERequestContext& ctx);
|
||||
void GetIrSensorState(HLERequestContext& ctx);
|
||||
void RegisterAppletResourceUserId(HLERequestContext& ctx);
|
||||
void UnregisterAppletResourceUserId(HLERequestContext& ctx);
|
||||
void EnableAppletToGetInput(HLERequestContext& ctx);
|
||||
void EnableAppletToGetSixAxisSensor(HLERequestContext& ctx);
|
||||
void EnableAppletToGetPadInput(HLERequestContext& ctx);
|
||||
void EnableAppletToGetTouchScreen(HLERequestContext& ctx);
|
||||
void AcquireConnectionTriggerTimeoutEvent(HLERequestContext& ctx);
|
||||
void AcquireDeviceRegisteredEventForControllerSupport(HLERequestContext& ctx);
|
||||
void GetRegisteredDevices(HLERequestContext& ctx);
|
||||
|
||||
@@ -9,7 +9,6 @@
|
||||
#include "core/hle/service/hid/resource_manager.h"
|
||||
#include "core/hle/service/ipc_helpers.h"
|
||||
|
||||
#include "core/hle/service/hid/controllers/applet_resource.h"
|
||||
#include "core/hle/service/hid/controllers/console_six_axis.h"
|
||||
#include "core/hle/service/hid/controllers/debug_pad.h"
|
||||
#include "core/hle/service/hid/controllers/gesture.h"
|
||||
@@ -34,9 +33,7 @@ constexpr auto mouse_keyboard_update_ns = std::chrono::nanoseconds{8 * 1000 * 10
|
||||
constexpr auto motion_update_ns = std::chrono::nanoseconds{5 * 1000 * 1000}; // (5ms, 200Hz)
|
||||
|
||||
ResourceManager::ResourceManager(Core::System& system_)
|
||||
: system{system_}, service_context{system_, "hid"} {
|
||||
applet_resource = std::make_shared<AppletResource>(system);
|
||||
}
|
||||
: system{system_}, service_context{system_, "hid"} {}
|
||||
|
||||
ResourceManager::~ResourceManager() = default;
|
||||
|
||||
@@ -80,11 +77,6 @@ void ResourceManager::Initialize() {
|
||||
system.HIDCore().ReloadInputDevices();
|
||||
is_initialized = true;
|
||||
}
|
||||
|
||||
std::shared_ptr<AppletResource> ResourceManager::GetAppletResource() const {
|
||||
return applet_resource;
|
||||
}
|
||||
|
||||
std::shared_ptr<CaptureButton> ResourceManager::GetCaptureButton() const {
|
||||
return capture_button;
|
||||
}
|
||||
@@ -145,46 +137,6 @@ std::shared_ptr<UniquePad> ResourceManager::GetUniquePad() const {
|
||||
return unique_pad;
|
||||
}
|
||||
|
||||
Result ResourceManager::CreateAppletResource(u64 aruid) {
|
||||
std::scoped_lock lock{shared_mutex};
|
||||
return applet_resource->CreateAppletResource(aruid);
|
||||
}
|
||||
|
||||
Result ResourceManager::RegisterAppletResourceUserId(u64 aruid, bool bool_value) {
|
||||
std::scoped_lock lock{shared_mutex};
|
||||
return applet_resource->RegisterAppletResourceUserId(aruid, bool_value);
|
||||
}
|
||||
|
||||
void ResourceManager::UnregisterAppletResourceUserId(u64 aruid) {
|
||||
std::scoped_lock lock{shared_mutex};
|
||||
applet_resource->UnregisterAppletResourceUserId(aruid);
|
||||
}
|
||||
|
||||
Result ResourceManager::GetSharedMemoryHandle(Kernel::KSharedMemory** out_handle, u64 aruid) {
|
||||
std::scoped_lock lock{shared_mutex};
|
||||
return applet_resource->GetSharedMemoryHandle(out_handle, aruid);
|
||||
}
|
||||
|
||||
void ResourceManager::EnableInput(u64 aruid, bool is_enabled) {
|
||||
std::scoped_lock lock{shared_mutex};
|
||||
applet_resource->EnableInput(aruid, is_enabled);
|
||||
}
|
||||
|
||||
void ResourceManager::EnableSixAxisSensor(u64 aruid, bool is_enabled) {
|
||||
std::scoped_lock lock{shared_mutex};
|
||||
applet_resource->EnableSixAxisSensor(aruid, is_enabled);
|
||||
}
|
||||
|
||||
void ResourceManager::EnablePadInput(u64 aruid, bool is_enabled) {
|
||||
std::scoped_lock lock{shared_mutex};
|
||||
applet_resource->EnablePadInput(aruid, is_enabled);
|
||||
}
|
||||
|
||||
void ResourceManager::EnableTouchScreen(u64 aruid, bool is_enabled) {
|
||||
std::scoped_lock lock{shared_mutex};
|
||||
applet_resource->EnableTouchScreen(aruid, is_enabled);
|
||||
}
|
||||
|
||||
void ResourceManager::UpdateControllers(std::uintptr_t user_data,
|
||||
std::chrono::nanoseconds ns_late) {
|
||||
auto& core_timing = system.CoreTiming();
|
||||
@@ -220,12 +172,14 @@ void ResourceManager::UpdateMotion(std::uintptr_t user_data, std::chrono::nanose
|
||||
}
|
||||
|
||||
IAppletResource::IAppletResource(Core::System& system_, std::shared_ptr<ResourceManager> resource)
|
||||
: ServiceFramework{system_, "IAppletResource"}, resource_manager{resource} {
|
||||
: ServiceFramework{system_, "IAppletResource"} {
|
||||
static const FunctionInfo functions[] = {
|
||||
{0, &IAppletResource::GetSharedMemoryHandle, "GetSharedMemoryHandle"},
|
||||
};
|
||||
RegisterHandlers(functions);
|
||||
|
||||
resource->Initialize();
|
||||
|
||||
// Register update callbacks
|
||||
npad_update_event = Core::Timing::CreateEvent(
|
||||
"HID::UpdatePadCallback",
|
||||
@@ -279,13 +233,9 @@ IAppletResource::~IAppletResource() {
|
||||
void IAppletResource::GetSharedMemoryHandle(HLERequestContext& ctx) {
|
||||
LOG_DEBUG(Service_HID, "called");
|
||||
|
||||
Kernel::KSharedMemory* handle;
|
||||
const u64 applet_resource_user_id = resource_manager->GetAppletResource()->GetActiveAruid();
|
||||
const auto result = resource_manager->GetSharedMemoryHandle(&handle, applet_resource_user_id);
|
||||
|
||||
IPC::ResponseBuilder rb{ctx, 2, 1};
|
||||
rb.Push(result);
|
||||
rb.PushCopyObjects(handle);
|
||||
rb.Push(ResultSuccess);
|
||||
rb.PushCopyObjects(&system.Kernel().GetHidSharedMem());
|
||||
}
|
||||
|
||||
} // namespace Service::HID
|
||||
|
||||
@@ -6,20 +6,11 @@
|
||||
#include "core/hle/service/kernel_helpers.h"
|
||||
#include "core/hle/service/service.h"
|
||||
|
||||
namespace Core {
|
||||
class System;
|
||||
}
|
||||
|
||||
namespace Core::Timing {
|
||||
struct EventType;
|
||||
}
|
||||
|
||||
namespace Kernel {
|
||||
class KSharedMemory;
|
||||
}
|
||||
|
||||
namespace Service::HID {
|
||||
class AppletResource;
|
||||
class Controller_Stubbed;
|
||||
class ConsoleSixAxis;
|
||||
class DebugPad;
|
||||
@@ -47,7 +38,6 @@ public:
|
||||
|
||||
void Initialize();
|
||||
|
||||
std::shared_ptr<AppletResource> GetAppletResource() const;
|
||||
std::shared_ptr<CaptureButton> GetCaptureButton() const;
|
||||
std::shared_ptr<ConsoleSixAxis> GetConsoleSixAxis() const;
|
||||
std::shared_ptr<DebugMouse> GetDebugMouse() const;
|
||||
@@ -64,18 +54,6 @@ public:
|
||||
std::shared_ptr<TouchScreen> GetTouchScreen() const;
|
||||
std::shared_ptr<UniquePad> GetUniquePad() const;
|
||||
|
||||
Result CreateAppletResource(u64 aruid);
|
||||
|
||||
Result RegisterAppletResourceUserId(u64 aruid, bool bool_value);
|
||||
void UnregisterAppletResourceUserId(u64 aruid);
|
||||
|
||||
Result GetSharedMemoryHandle(Kernel::KSharedMemory** out_handle, u64 aruid);
|
||||
|
||||
void EnableInput(u64 aruid, bool is_enabled);
|
||||
void EnableSixAxisSensor(u64 aruid, bool is_enabled);
|
||||
void EnablePadInput(u64 aruid, bool is_enabled);
|
||||
void EnableTouchScreen(u64 aruid, bool is_enabled);
|
||||
|
||||
void UpdateControllers(std::uintptr_t user_data, std::chrono::nanoseconds ns_late);
|
||||
void UpdateNpad(std::uintptr_t user_data, std::chrono::nanoseconds ns_late);
|
||||
void UpdateMouseKeyboard(std::uintptr_t user_data, std::chrono::nanoseconds ns_late);
|
||||
@@ -84,9 +62,6 @@ public:
|
||||
private:
|
||||
bool is_initialized{false};
|
||||
|
||||
mutable std::mutex shared_mutex;
|
||||
std::shared_ptr<AppletResource> applet_resource = nullptr;
|
||||
|
||||
std::shared_ptr<CaptureButton> capture_button = nullptr;
|
||||
std::shared_ptr<ConsoleSixAxis> console_six_axis = nullptr;
|
||||
std::shared_ptr<DebugMouse> debug_mouse = nullptr;
|
||||
@@ -131,8 +106,6 @@ private:
|
||||
std::shared_ptr<Core::Timing::EventType> default_update_event;
|
||||
std::shared_ptr<Core::Timing::EventType> mouse_keyboard_update_event;
|
||||
std::shared_ptr<Core::Timing::EventType> motion_update_event;
|
||||
|
||||
std::shared_ptr<ResourceManager> resource_manager;
|
||||
};
|
||||
|
||||
} // namespace Service::HID
|
||||
|
||||
@@ -146,10 +146,8 @@ HLERequestContext::HLERequestContext(Kernel::KernelCore& kernel_, Core::Memory::
|
||||
|
||||
HLERequestContext::~HLERequestContext() = default;
|
||||
|
||||
void HLERequestContext::ParseCommandBuffer(Kernel::KProcess& process, u32_le* src_cmdbuf,
|
||||
bool incoming) {
|
||||
client_handle_table = &process.GetHandleTable();
|
||||
|
||||
void HLERequestContext::ParseCommandBuffer(const Kernel::KHandleTable& handle_table,
|
||||
u32_le* src_cmdbuf, bool incoming) {
|
||||
IPC::RequestParser rp(src_cmdbuf);
|
||||
command_header = rp.PopRaw<IPC::CommandHeader>();
|
||||
|
||||
@@ -162,8 +160,7 @@ void HLERequestContext::ParseCommandBuffer(Kernel::KProcess& process, u32_le* sr
|
||||
if (command_header->enable_handle_descriptor) {
|
||||
handle_descriptor_header = rp.PopRaw<IPC::HandleDescriptorHeader>();
|
||||
if (handle_descriptor_header->send_current_pid) {
|
||||
pid = process.GetProcessId();
|
||||
rp.Skip(2, false);
|
||||
pid = rp.Pop<u64>();
|
||||
}
|
||||
if (incoming) {
|
||||
// Populate the object lists with the data in the IPC request.
|
||||
@@ -270,9 +267,9 @@ void HLERequestContext::ParseCommandBuffer(Kernel::KProcess& process, u32_le* sr
|
||||
rp.Skip(1, false); // The command is actually an u64, but we don't use the high part.
|
||||
}
|
||||
|
||||
Result HLERequestContext::PopulateFromIncomingCommandBuffer(Kernel::KProcess& process,
|
||||
u32_le* src_cmdbuf) {
|
||||
ParseCommandBuffer(process, src_cmdbuf, true);
|
||||
Result HLERequestContext::PopulateFromIncomingCommandBuffer(
|
||||
const Kernel::KHandleTable& handle_table, u32_le* src_cmdbuf) {
|
||||
ParseCommandBuffer(handle_table, src_cmdbuf, true);
|
||||
|
||||
if (command_header->IsCloseCommand()) {
|
||||
// Close does not populate the rest of the IPC header
|
||||
|
||||
@@ -38,7 +38,6 @@ namespace Kernel {
|
||||
class KAutoObject;
|
||||
class KernelCore;
|
||||
class KHandleTable;
|
||||
class KProcess;
|
||||
class KServerSession;
|
||||
class KThread;
|
||||
} // namespace Kernel
|
||||
@@ -76,7 +75,6 @@ protected:
|
||||
|
||||
using SessionRequestHandlerWeakPtr = std::weak_ptr<SessionRequestHandler>;
|
||||
using SessionRequestHandlerPtr = std::shared_ptr<SessionRequestHandler>;
|
||||
using SessionRequestHandlerFactory = std::function<SessionRequestHandlerPtr()>;
|
||||
|
||||
/**
|
||||
* Manages the underlying HLE requests for a session, and whether (or not) the session should be
|
||||
@@ -196,7 +194,8 @@ public:
|
||||
}
|
||||
|
||||
/// Populates this context with data from the requesting process/thread.
|
||||
Result PopulateFromIncomingCommandBuffer(Kernel::KProcess& process, u32_le* src_cmdbuf);
|
||||
Result PopulateFromIncomingCommandBuffer(const Kernel::KHandleTable& handle_table,
|
||||
u32_le* src_cmdbuf);
|
||||
|
||||
/// Writes data from this context back to the requesting process/thread.
|
||||
Result WriteToOutgoingCommandBuffer(Kernel::KThread& requesting_thread);
|
||||
@@ -359,10 +358,6 @@ public:
|
||||
return *thread;
|
||||
}
|
||||
|
||||
Kernel::KHandleTable& GetClientHandleTable() {
|
||||
return *client_handle_table;
|
||||
}
|
||||
|
||||
[[nodiscard]] std::shared_ptr<SessionRequestManager> GetManager() const {
|
||||
return manager.lock();
|
||||
}
|
||||
@@ -378,12 +373,12 @@ public:
|
||||
private:
|
||||
friend class IPC::ResponseBuilder;
|
||||
|
||||
void ParseCommandBuffer(Kernel::KProcess& process, u32_le* src_cmdbuf, bool incoming);
|
||||
void ParseCommandBuffer(const Kernel::KHandleTable& handle_table, u32_le* src_cmdbuf,
|
||||
bool incoming);
|
||||
|
||||
std::array<u32, IPC::COMMAND_BUFFER_LENGTH> cmd_buf;
|
||||
Kernel::KServerSession* server_session{};
|
||||
Kernel::KHandleTable* client_handle_table{};
|
||||
Kernel::KThread* thread{};
|
||||
Kernel::KThread* thread;
|
||||
|
||||
std::vector<Handle> incoming_move_handles;
|
||||
std::vector<Handle> incoming_copy_handles;
|
||||
|
||||
@@ -1,7 +1,6 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2022 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include "core/arm/debug.h"
|
||||
#include "core/arm/symbols.h"
|
||||
#include "core/core.h"
|
||||
#include "core/hle/kernel/k_code_memory.h"
|
||||
@@ -99,9 +98,8 @@ public:
|
||||
if (return_value == 0) {
|
||||
// The callback has written to the output executable code range,
|
||||
// requiring an instruction cache invalidation
|
||||
Core::InvalidateInstructionCacheRange(process.GetPointerUnsafe(),
|
||||
configuration.user_rx_memory.offset,
|
||||
configuration.user_rx_memory.size);
|
||||
system.InvalidateCpuInstructionCacheRange(configuration.user_rx_memory.offset,
|
||||
configuration.user_rx_memory.size);
|
||||
|
||||
// Write back to the IPC output buffer, if provided
|
||||
if (ctx.CanWriteBuffer()) {
|
||||
|
||||
@@ -1,12 +1,117 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2018 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include <memory>
|
||||
#include <fmt/format.h>
|
||||
#include <mbedtls/sha256.h>
|
||||
|
||||
#include "common/alignment.h"
|
||||
#include "common/hex_util.h"
|
||||
#include "common/scope_exit.h"
|
||||
#include "core/core.h"
|
||||
#include "core/hle/kernel/k_page_table.h"
|
||||
#include "core/hle/kernel/svc_results.h"
|
||||
#include "core/hle/kernel/svc_types.h"
|
||||
#include "core/hle/service/ipc_helpers.h"
|
||||
#include "core/hle/service/ldr/ldr.h"
|
||||
#include "core/hle/service/server_manager.h"
|
||||
#include "core/hle/service/service.h"
|
||||
#include "core/loader/nro.h"
|
||||
#include "core/memory.h"
|
||||
|
||||
namespace Service::LDR {
|
||||
|
||||
constexpr Result ERROR_INSUFFICIENT_ADDRESS_SPACE{ErrorModule::RO, 2};
|
||||
|
||||
[[maybe_unused]] constexpr Result ERROR_INVALID_MEMORY_STATE{ErrorModule::Loader, 51};
|
||||
constexpr Result ERROR_INVALID_NRO{ErrorModule::Loader, 52};
|
||||
constexpr Result ERROR_INVALID_NRR{ErrorModule::Loader, 53};
|
||||
constexpr Result ERROR_MISSING_NRR_HASH{ErrorModule::Loader, 54};
|
||||
constexpr Result ERROR_MAXIMUM_NRO{ErrorModule::Loader, 55};
|
||||
constexpr Result ERROR_MAXIMUM_NRR{ErrorModule::Loader, 56};
|
||||
constexpr Result ERROR_ALREADY_LOADED{ErrorModule::Loader, 57};
|
||||
constexpr Result ERROR_INVALID_ALIGNMENT{ErrorModule::Loader, 81};
|
||||
constexpr Result ERROR_INVALID_SIZE{ErrorModule::Loader, 82};
|
||||
constexpr Result ERROR_INVALID_NRO_ADDRESS{ErrorModule::Loader, 84};
|
||||
[[maybe_unused]] constexpr Result ERROR_INVALID_NRR_ADDRESS{ErrorModule::Loader, 85};
|
||||
constexpr Result ERROR_NOT_INITIALIZED{ErrorModule::Loader, 87};
|
||||
|
||||
constexpr std::size_t MAXIMUM_LOADED_RO{0x40};
|
||||
constexpr std::size_t MAXIMUM_MAP_RETRIES{0x200};
|
||||
|
||||
constexpr std::size_t TEXT_INDEX{0};
|
||||
constexpr std::size_t RO_INDEX{1};
|
||||
constexpr std::size_t DATA_INDEX{2};
|
||||
|
||||
struct NRRCertification {
|
||||
u64_le application_id_mask;
|
||||
u64_le application_id_pattern;
|
||||
INSERT_PADDING_BYTES(0x10);
|
||||
std::array<u8, 0x100> public_key; // Also known as modulus
|
||||
std::array<u8, 0x100> signature;
|
||||
};
|
||||
static_assert(sizeof(NRRCertification) == 0x220, "NRRCertification has invalid size.");
|
||||
|
||||
struct NRRHeader {
|
||||
u32_le magic;
|
||||
u32_le certification_signature_key_generation; // 9.0.0+
|
||||
INSERT_PADDING_WORDS(2);
|
||||
NRRCertification certification;
|
||||
std::array<u8, 0x100> signature;
|
||||
u64_le application_id;
|
||||
u32_le size;
|
||||
u8 nrr_kind; // 7.0.0+
|
||||
INSERT_PADDING_BYTES(3);
|
||||
u32_le hash_offset;
|
||||
u32_le hash_count;
|
||||
INSERT_PADDING_WORDS(2);
|
||||
};
|
||||
static_assert(sizeof(NRRHeader) == 0x350, "NRRHeader has invalid size.");
|
||||
|
||||
struct SegmentHeader {
|
||||
u32_le memory_offset;
|
||||
u32_le memory_size;
|
||||
};
|
||||
static_assert(sizeof(SegmentHeader) == 0x8, "SegmentHeader has invalid size.");
|
||||
|
||||
struct NROHeader {
|
||||
// Switchbrew calls this "Start" (0x10)
|
||||
INSERT_PADDING_WORDS(1);
|
||||
u32_le mod_offset;
|
||||
INSERT_PADDING_WORDS(2);
|
||||
|
||||
// Switchbrew calls this "Header" (0x70)
|
||||
u32_le magic;
|
||||
u32_le version;
|
||||
u32_le nro_size;
|
||||
u32_le flags;
|
||||
// .text, .ro, .data
|
||||
std::array<SegmentHeader, 3> segment_headers;
|
||||
u32_le bss_size;
|
||||
INSERT_PADDING_WORDS(1);
|
||||
std::array<u8, 0x20> build_id;
|
||||
u32_le dso_handle_offset;
|
||||
INSERT_PADDING_WORDS(1);
|
||||
// .apiInfo, .dynstr, .dynsym
|
||||
std::array<SegmentHeader, 3> segment_headers_2;
|
||||
};
|
||||
static_assert(sizeof(NROHeader) == 0x80, "NROHeader has invalid size.");
|
||||
|
||||
using SHA256Hash = std::array<u8, 0x20>;
|
||||
|
||||
struct NROInfo {
|
||||
SHA256Hash hash{};
|
||||
VAddr nro_address{};
|
||||
std::size_t nro_size{};
|
||||
VAddr bss_address{};
|
||||
std::size_t bss_size{};
|
||||
std::size_t text_size{};
|
||||
std::size_t ro_size{};
|
||||
std::size_t data_size{};
|
||||
VAddr src_addr{};
|
||||
};
|
||||
static_assert(sizeof(NROInfo) == 0x60, "NROInfo has invalid size.");
|
||||
|
||||
class DebugMonitor final : public ServiceFramework<DebugMonitor> {
|
||||
public:
|
||||
explicit DebugMonitor(Core::System& system_) : ServiceFramework{system_, "ldr:dmnt"} {
|
||||
@@ -53,12 +158,541 @@ public:
|
||||
}
|
||||
};
|
||||
|
||||
class RelocatableObject final : public ServiceFramework<RelocatableObject> {
|
||||
public:
|
||||
explicit RelocatableObject(Core::System& system_) : ServiceFramework{system_, "ldr:ro"} {
|
||||
// clang-format off
|
||||
static const FunctionInfo functions[] = {
|
||||
{0, &RelocatableObject::LoadModule, "LoadModule"},
|
||||
{1, &RelocatableObject::UnloadModule, "UnloadModule"},
|
||||
{2, &RelocatableObject::RegisterModuleInfo, "RegisterModuleInfo"},
|
||||
{3, &RelocatableObject::UnregisterModuleInfo, "UnregisterModuleInfo"},
|
||||
{4, &RelocatableObject::Initialize, "Initialize"},
|
||||
{10, nullptr, "RegisterModuleInfo2"},
|
||||
};
|
||||
// clang-format on
|
||||
|
||||
RegisterHandlers(functions);
|
||||
}
|
||||
|
||||
void RegisterModuleInfo(HLERequestContext& ctx) {
|
||||
struct Parameters {
|
||||
u64_le process_id;
|
||||
u64_le nrr_address;
|
||||
u64_le nrr_size;
|
||||
};
|
||||
|
||||
IPC::RequestParser rp{ctx};
|
||||
const auto [process_id, nrr_address, nrr_size] = rp.PopRaw<Parameters>();
|
||||
|
||||
LOG_DEBUG(Service_LDR,
|
||||
"called with process_id={:016X}, nrr_address={:016X}, nrr_size={:016X}",
|
||||
process_id, nrr_address, nrr_size);
|
||||
|
||||
if (!initialized) {
|
||||
LOG_ERROR(Service_LDR, "LDR:RO not initialized before use!");
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ERROR_NOT_INITIALIZED);
|
||||
return;
|
||||
}
|
||||
|
||||
if (nrr.size() >= MAXIMUM_LOADED_RO) {
|
||||
LOG_ERROR(Service_LDR, "Loading new NRR would exceed the maximum number of loaded NRRs "
|
||||
"(0x40)! Failing...");
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ERROR_MAXIMUM_NRR);
|
||||
return;
|
||||
}
|
||||
|
||||
// NRR Address does not fall on 0x1000 byte boundary
|
||||
if (!Common::Is4KBAligned(nrr_address)) {
|
||||
LOG_ERROR(Service_LDR, "NRR Address has invalid alignment (actual {:016X})!",
|
||||
nrr_address);
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ERROR_INVALID_ALIGNMENT);
|
||||
return;
|
||||
}
|
||||
|
||||
// NRR Size is zero or causes overflow
|
||||
if (nrr_address + nrr_size <= nrr_address || nrr_size == 0 ||
|
||||
!Common::Is4KBAligned(nrr_size)) {
|
||||
LOG_ERROR(Service_LDR, "NRR Size is invalid! (nrr_address={:016X}, nrr_size={:016X})",
|
||||
nrr_address, nrr_size);
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ERROR_INVALID_SIZE);
|
||||
return;
|
||||
}
|
||||
|
||||
// Read NRR data from memory
|
||||
std::vector<u8> nrr_data(nrr_size);
|
||||
system.ApplicationMemory().ReadBlock(nrr_address, nrr_data.data(), nrr_size);
|
||||
NRRHeader header;
|
||||
std::memcpy(&header, nrr_data.data(), sizeof(NRRHeader));
|
||||
|
||||
if (header.magic != Common::MakeMagic('N', 'R', 'R', '0')) {
|
||||
LOG_ERROR(Service_LDR, "NRR did not have magic 'NRR0' (actual {:08X})!", header.magic);
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ERROR_INVALID_NRR);
|
||||
return;
|
||||
}
|
||||
|
||||
if (header.size != nrr_size) {
|
||||
LOG_ERROR(Service_LDR,
|
||||
"NRR header reported size did not match LoadNrr parameter size! "
|
||||
"(header_size={:016X}, loadnrr_size={:016X})",
|
||||
header.size, nrr_size);
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ERROR_INVALID_SIZE);
|
||||
return;
|
||||
}
|
||||
|
||||
if (system.GetApplicationProcessProgramID() != header.application_id) {
|
||||
LOG_ERROR(Service_LDR,
|
||||
"Attempting to load NRR with title ID other than current process. (actual "
|
||||
"{:016X})!",
|
||||
header.application_id);
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ERROR_INVALID_NRR);
|
||||
return;
|
||||
}
|
||||
|
||||
std::vector<SHA256Hash> hashes;
|
||||
|
||||
// Copy all hashes in the NRR (specified by hash count/hash offset) into vector.
|
||||
for (std::size_t i = header.hash_offset;
|
||||
i < (header.hash_offset + (header.hash_count * sizeof(SHA256Hash))); i += 8) {
|
||||
SHA256Hash hash;
|
||||
std::memcpy(hash.data(), nrr_data.data() + i, sizeof(SHA256Hash));
|
||||
hashes.emplace_back(hash);
|
||||
}
|
||||
|
||||
nrr.insert_or_assign(nrr_address, std::move(hashes));
|
||||
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ResultSuccess);
|
||||
}
|
||||
|
||||
void UnregisterModuleInfo(HLERequestContext& ctx) {
|
||||
IPC::RequestParser rp{ctx};
|
||||
const auto pid = rp.Pop<u64>();
|
||||
const auto nrr_address = rp.Pop<VAddr>();
|
||||
|
||||
LOG_DEBUG(Service_LDR, "called with pid={}, nrr_address={:016X}", pid, nrr_address);
|
||||
|
||||
nrr.erase(nrr_address);
|
||||
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
|
||||
rb.Push(ResultSuccess);
|
||||
}
|
||||
|
||||
bool ValidateRegionForMap(Kernel::KProcessPageTable& page_table, VAddr start,
|
||||
std::size_t size) const {
|
||||
const std::size_t padding_size{page_table.GetNumGuardPages() * Kernel::PageSize};
|
||||
|
||||
Kernel::KMemoryInfo start_info;
|
||||
Kernel::Svc::PageInfo page_info;
|
||||
R_ASSERT(
|
||||
page_table.QueryInfo(std::addressof(start_info), std::addressof(page_info), start - 1));
|
||||
|
||||
if (start_info.GetState() != Kernel::KMemoryState::Free) {
|
||||
return {};
|
||||
}
|
||||
|
||||
if (start_info.GetAddress() > (start - padding_size)) {
|
||||
return {};
|
||||
}
|
||||
|
||||
Kernel::KMemoryInfo end_info;
|
||||
R_ASSERT(page_table.QueryInfo(std::addressof(end_info), std::addressof(page_info),
|
||||
start + size));
|
||||
|
||||
if (end_info.GetState() != Kernel::KMemoryState::Free) {
|
||||
return {};
|
||||
}
|
||||
|
||||
return (start + size + padding_size) <= (end_info.GetAddress() + end_info.GetSize());
|
||||
}
|
||||
|
||||
Result GetAvailableMapRegion(Kernel::KProcessPageTable& page_table, u64 size, VAddr& out_addr) {
|
||||
size = Common::AlignUp(size, Kernel::PageSize);
|
||||
size += page_table.GetNumGuardPages() * Kernel::PageSize * 4;
|
||||
|
||||
const auto is_region_available = [&](VAddr addr) {
|
||||
const auto end_addr = addr + size;
|
||||
while (addr < end_addr) {
|
||||
if (system.ApplicationMemory().IsValidVirtualAddress(addr)) {
|
||||
return false;
|
||||
}
|
||||
|
||||
if (!page_table.Contains(out_addr, size)) {
|
||||
return false;
|
||||
}
|
||||
|
||||
if (page_table.IsInHeapRegion(out_addr, size)) {
|
||||
return false;
|
||||
}
|
||||
|
||||
if (page_table.IsInAliasRegion(out_addr, size)) {
|
||||
return false;
|
||||
}
|
||||
|
||||
addr += Kernel::PageSize;
|
||||
}
|
||||
return true;
|
||||
};
|
||||
|
||||
bool succeeded = false;
|
||||
const auto map_region_end =
|
||||
GetInteger(page_table.GetAliasCodeRegionStart()) + page_table.GetAliasCodeRegionSize();
|
||||
while (current_map_addr < map_region_end) {
|
||||
if (is_region_available(current_map_addr)) {
|
||||
succeeded = true;
|
||||
break;
|
||||
}
|
||||
current_map_addr += 0x100000;
|
||||
}
|
||||
|
||||
if (!succeeded) {
|
||||
ASSERT_MSG(false, "Out of address space!");
|
||||
return Kernel::ResultOutOfMemory;
|
||||
}
|
||||
|
||||
out_addr = current_map_addr;
|
||||
current_map_addr += size;
|
||||
|
||||
return ResultSuccess;
|
||||
}
|
||||
|
||||
Result MapProcessCodeMemory(VAddr* out_map_location, Kernel::KProcess* process, VAddr base_addr,
|
||||
u64 size) {
|
||||
auto& page_table{process->GetPageTable()};
|
||||
VAddr addr{};
|
||||
|
||||
for (std::size_t retry = 0; retry < MAXIMUM_MAP_RETRIES; retry++) {
|
||||
R_TRY(GetAvailableMapRegion(page_table, size, addr));
|
||||
|
||||
const Result result{page_table.MapCodeMemory(addr, base_addr, size)};
|
||||
if (result == Kernel::ResultInvalidCurrentMemory) {
|
||||
continue;
|
||||
}
|
||||
|
||||
R_TRY(result);
|
||||
|
||||
if (ValidateRegionForMap(page_table, addr, size)) {
|
||||
*out_map_location = addr;
|
||||
return ResultSuccess;
|
||||
}
|
||||
}
|
||||
|
||||
return ERROR_INSUFFICIENT_ADDRESS_SPACE;
|
||||
}
|
||||
|
||||
Result MapNro(VAddr* out_map_location, Kernel::KProcess* process, VAddr nro_addr,
|
||||
std::size_t nro_size, VAddr bss_addr, std::size_t bss_size, std::size_t size) {
|
||||
for (std::size_t retry = 0; retry < MAXIMUM_MAP_RETRIES; retry++) {
|
||||
auto& page_table{process->GetPageTable()};
|
||||
VAddr addr{};
|
||||
|
||||
R_TRY(MapProcessCodeMemory(&addr, process, nro_addr, nro_size));
|
||||
|
||||
if (bss_size) {
|
||||
auto block_guard = detail::ScopeExit([&] {
|
||||
page_table.UnmapCodeMemory(addr + nro_size, bss_addr, bss_size);
|
||||
page_table.UnmapCodeMemory(addr, nro_addr, nro_size);
|
||||
});
|
||||
|
||||
const Result result{page_table.MapCodeMemory(addr + nro_size, bss_addr, bss_size)};
|
||||
|
||||
if (result == Kernel::ResultInvalidCurrentMemory) {
|
||||
continue;
|
||||
}
|
||||
|
||||
if (result.IsError()) {
|
||||
return result;
|
||||
}
|
||||
|
||||
block_guard.Cancel();
|
||||
}
|
||||
|
||||
if (ValidateRegionForMap(page_table, addr, size)) {
|
||||
*out_map_location = addr;
|
||||
return ResultSuccess;
|
||||
}
|
||||
}
|
||||
|
||||
return ERROR_INSUFFICIENT_ADDRESS_SPACE;
|
||||
}
|
||||
|
||||
Result LoadNro(Kernel::KProcess* process, const NROHeader& nro_header, VAddr nro_addr,
|
||||
VAddr start) const {
|
||||
const VAddr text_start{start + nro_header.segment_headers[TEXT_INDEX].memory_offset};
|
||||
const VAddr ro_start{start + nro_header.segment_headers[RO_INDEX].memory_offset};
|
||||
const VAddr data_start{start + nro_header.segment_headers[DATA_INDEX].memory_offset};
|
||||
const VAddr bss_start{data_start + nro_header.segment_headers[DATA_INDEX].memory_size};
|
||||
const VAddr bss_end_addr{
|
||||
Common::AlignUp(bss_start + nro_header.bss_size, Kernel::PageSize)};
|
||||
|
||||
const auto CopyCode = [this](VAddr src_addr, VAddr dst_addr, u64 size) {
|
||||
system.ApplicationMemory().CopyBlock(dst_addr, src_addr, size);
|
||||
};
|
||||
CopyCode(nro_addr + nro_header.segment_headers[TEXT_INDEX].memory_offset, text_start,
|
||||
nro_header.segment_headers[TEXT_INDEX].memory_size);
|
||||
CopyCode(nro_addr + nro_header.segment_headers[RO_INDEX].memory_offset, ro_start,
|
||||
nro_header.segment_headers[RO_INDEX].memory_size);
|
||||
CopyCode(nro_addr + nro_header.segment_headers[DATA_INDEX].memory_offset, data_start,
|
||||
nro_header.segment_headers[DATA_INDEX].memory_size);
|
||||
|
||||
R_TRY(process->GetPageTable().SetProcessMemoryPermission(
|
||||
text_start, ro_start - text_start, Kernel::Svc::MemoryPermission::ReadExecute));
|
||||
R_TRY(process->GetPageTable().SetProcessMemoryPermission(
|
||||
ro_start, data_start - ro_start, Kernel::Svc::MemoryPermission::Read));
|
||||
|
||||
return process->GetPageTable().SetProcessMemoryPermission(
|
||||
data_start, bss_end_addr - data_start, Kernel::Svc::MemoryPermission::ReadWrite);
|
||||
}
|
||||
|
||||
void LoadModule(HLERequestContext& ctx) {
|
||||
struct Parameters {
|
||||
u64_le process_id;
|
||||
u64_le image_address;
|
||||
u64_le image_size;
|
||||
u64_le bss_address;
|
||||
u64_le bss_size;
|
||||
};
|
||||
|
||||
IPC::RequestParser rp{ctx};
|
||||
const auto [process_id, nro_address, nro_size, bss_address, bss_size] =
|
||||
rp.PopRaw<Parameters>();
|
||||
|
||||
LOG_DEBUG(Service_LDR,
|
||||
"called with pid={:016X}, nro_addr={:016X}, nro_size={:016X}, bss_addr={:016X}, "
|
||||
"bss_size={:016X}",
|
||||
process_id, nro_address, nro_size, bss_address, bss_size);
|
||||
|
||||
if (!initialized) {
|
||||
LOG_ERROR(Service_LDR, "LDR:RO not initialized before use!");
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ERROR_NOT_INITIALIZED);
|
||||
return;
|
||||
}
|
||||
|
||||
if (nro.size() >= MAXIMUM_LOADED_RO) {
|
||||
LOG_ERROR(Service_LDR, "Loading new NRO would exceed the maximum number of loaded NROs "
|
||||
"(0x40)! Failing...");
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ERROR_MAXIMUM_NRO);
|
||||
return;
|
||||
}
|
||||
|
||||
// NRO Address does not fall on 0x1000 byte boundary
|
||||
if (!Common::Is4KBAligned(nro_address)) {
|
||||
LOG_ERROR(Service_LDR, "NRO Address has invalid alignment (actual {:016X})!",
|
||||
nro_address);
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ERROR_INVALID_ALIGNMENT);
|
||||
return;
|
||||
}
|
||||
|
||||
// NRO Size or BSS Size is zero or causes overflow
|
||||
const auto nro_size_valid =
|
||||
nro_size != 0 && nro_address + nro_size > nro_address && Common::Is4KBAligned(nro_size);
|
||||
const auto bss_size_valid = nro_size + bss_size >= nro_size &&
|
||||
(bss_size == 0 || bss_address + bss_size > bss_address);
|
||||
|
||||
if (!nro_size_valid || !bss_size_valid) {
|
||||
LOG_ERROR(Service_LDR,
|
||||
"NRO Size or BSS Size is invalid! (nro_address={:016X}, nro_size={:016X}, "
|
||||
"bss_address={:016X}, bss_size={:016X})",
|
||||
nro_address, nro_size, bss_address, bss_size);
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ERROR_INVALID_SIZE);
|
||||
return;
|
||||
}
|
||||
|
||||
// Read NRO data from memory
|
||||
std::vector<u8> nro_data(nro_size);
|
||||
system.ApplicationMemory().ReadBlock(nro_address, nro_data.data(), nro_size);
|
||||
|
||||
SHA256Hash hash{};
|
||||
mbedtls_sha256_ret(nro_data.data(), nro_data.size(), hash.data(), 0);
|
||||
|
||||
// NRO Hash is already loaded
|
||||
if (std::any_of(nro.begin(), nro.end(), [&hash](const std::pair<VAddr, NROInfo>& info) {
|
||||
return info.second.hash == hash;
|
||||
})) {
|
||||
LOG_ERROR(Service_LDR, "NRO is already loaded!");
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ERROR_ALREADY_LOADED);
|
||||
return;
|
||||
}
|
||||
|
||||
// NRO Hash is not in any loaded NRR
|
||||
if (!IsValidNROHash(hash)) {
|
||||
LOG_ERROR(Service_LDR,
|
||||
"NRO hash is not present in any currently loaded NRRs (hash={})!",
|
||||
Common::HexToString(hash));
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ERROR_MISSING_NRR_HASH);
|
||||
return;
|
||||
}
|
||||
|
||||
// Load and validate the NRO header
|
||||
NROHeader header{};
|
||||
std::memcpy(&header, nro_data.data(), sizeof(NROHeader));
|
||||
if (!IsValidNRO(header, nro_size, bss_size)) {
|
||||
LOG_ERROR(Service_LDR, "NRO was invalid!");
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ERROR_INVALID_NRO);
|
||||
return;
|
||||
}
|
||||
|
||||
// Map memory for the NRO
|
||||
VAddr map_location{};
|
||||
const auto map_result{MapNro(&map_location, system.ApplicationProcess(), nro_address,
|
||||
nro_size, bss_address, bss_size, nro_size + bss_size)};
|
||||
if (map_result != ResultSuccess) {
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(map_result);
|
||||
}
|
||||
|
||||
// Load the NRO into the mapped memory
|
||||
if (const auto result{
|
||||
LoadNro(system.ApplicationProcess(), header, nro_address, map_location)};
|
||||
result.IsError()) {
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(result);
|
||||
}
|
||||
|
||||
// Track the loaded NRO
|
||||
nro.insert_or_assign(map_location,
|
||||
NROInfo{hash, map_location, nro_size, bss_address, bss_size,
|
||||
header.segment_headers[TEXT_INDEX].memory_size,
|
||||
header.segment_headers[RO_INDEX].memory_size,
|
||||
header.segment_headers[DATA_INDEX].memory_size, nro_address});
|
||||
|
||||
IPC::ResponseBuilder rb{ctx, 4};
|
||||
rb.Push(ResultSuccess);
|
||||
rb.Push(map_location);
|
||||
}
|
||||
|
||||
Result UnmapNro(const NROInfo& info) {
|
||||
// Each region must be unmapped separately to validate memory state
|
||||
auto& page_table{system.ApplicationProcess()->GetPageTable()};
|
||||
|
||||
if (info.bss_size != 0) {
|
||||
R_TRY(page_table.UnmapCodeMemory(info.nro_address + info.text_size + info.ro_size +
|
||||
info.data_size,
|
||||
info.bss_address, info.bss_size));
|
||||
}
|
||||
|
||||
R_TRY(page_table.UnmapCodeMemory(info.nro_address + info.text_size + info.ro_size,
|
||||
info.src_addr + info.text_size + info.ro_size,
|
||||
info.data_size));
|
||||
R_TRY(page_table.UnmapCodeMemory(info.nro_address + info.text_size,
|
||||
info.src_addr + info.text_size, info.ro_size));
|
||||
R_TRY(page_table.UnmapCodeMemory(info.nro_address, info.src_addr, info.text_size));
|
||||
return ResultSuccess;
|
||||
}
|
||||
|
||||
void UnloadModule(HLERequestContext& ctx) {
|
||||
if (!initialized) {
|
||||
LOG_ERROR(Service_LDR, "LDR:RO not initialized before use!");
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ERROR_NOT_INITIALIZED);
|
||||
return;
|
||||
}
|
||||
|
||||
struct Parameters {
|
||||
u64_le process_id;
|
||||
u64_le nro_address;
|
||||
};
|
||||
|
||||
IPC::RequestParser rp{ctx};
|
||||
const auto [process_id, nro_address] = rp.PopRaw<Parameters>();
|
||||
LOG_DEBUG(Service_LDR, "called with process_id={:016X}, nro_address=0x{:016X}", process_id,
|
||||
nro_address);
|
||||
|
||||
if (!Common::Is4KBAligned(nro_address)) {
|
||||
LOG_ERROR(Service_LDR, "NRO address has invalid alignment (nro_address=0x{:016X})",
|
||||
nro_address);
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ERROR_INVALID_ALIGNMENT);
|
||||
return;
|
||||
}
|
||||
|
||||
const auto iter = nro.find(nro_address);
|
||||
if (iter == nro.end()) {
|
||||
LOG_ERROR(Service_LDR,
|
||||
"The NRO attempting to be unmapped was not mapped or has an invalid address "
|
||||
"(nro_address=0x{:016X})!",
|
||||
nro_address);
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ERROR_INVALID_NRO_ADDRESS);
|
||||
return;
|
||||
}
|
||||
|
||||
const auto result{UnmapNro(iter->second)};
|
||||
|
||||
nro.erase(iter);
|
||||
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
|
||||
rb.Push(result);
|
||||
}
|
||||
|
||||
void Initialize(HLERequestContext& ctx) {
|
||||
LOG_WARNING(Service_LDR, "(STUBBED) called");
|
||||
|
||||
initialized = true;
|
||||
current_map_addr =
|
||||
GetInteger(system.ApplicationProcess()->GetPageTable().GetAliasCodeRegionStart());
|
||||
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(ResultSuccess);
|
||||
}
|
||||
|
||||
private:
|
||||
bool initialized{};
|
||||
|
||||
std::map<VAddr, NROInfo> nro;
|
||||
std::map<VAddr, std::vector<SHA256Hash>> nrr;
|
||||
VAddr current_map_addr{};
|
||||
|
||||
bool IsValidNROHash(const SHA256Hash& hash) const {
|
||||
return std::any_of(nrr.begin(), nrr.end(), [&hash](const auto& p) {
|
||||
return std::find(p.second.begin(), p.second.end(), hash) != p.second.end();
|
||||
});
|
||||
}
|
||||
|
||||
static bool IsValidNRO(const NROHeader& header, u64 nro_size, u64 bss_size) {
|
||||
return header.magic == Common::MakeMagic('N', 'R', 'O', '0') &&
|
||||
header.nro_size == nro_size && header.bss_size == bss_size &&
|
||||
|
||||
header.segment_headers[RO_INDEX].memory_offset ==
|
||||
header.segment_headers[TEXT_INDEX].memory_offset +
|
||||
header.segment_headers[TEXT_INDEX].memory_size &&
|
||||
|
||||
header.segment_headers[DATA_INDEX].memory_offset ==
|
||||
header.segment_headers[RO_INDEX].memory_offset +
|
||||
header.segment_headers[RO_INDEX].memory_size &&
|
||||
|
||||
nro_size == header.segment_headers[DATA_INDEX].memory_offset +
|
||||
header.segment_headers[DATA_INDEX].memory_size &&
|
||||
|
||||
Common::Is4KBAligned(header.segment_headers[TEXT_INDEX].memory_size) &&
|
||||
Common::Is4KBAligned(header.segment_headers[RO_INDEX].memory_size) &&
|
||||
Common::Is4KBAligned(header.segment_headers[DATA_INDEX].memory_size);
|
||||
}
|
||||
};
|
||||
|
||||
void LoopProcess(Core::System& system) {
|
||||
auto server_manager = std::make_unique<ServerManager>(system);
|
||||
|
||||
server_manager->RegisterNamedService("ldr:dmnt", std::make_shared<DebugMonitor>(system));
|
||||
server_manager->RegisterNamedService("ldr:pm", std::make_shared<ProcessManager>(system));
|
||||
server_manager->RegisterNamedService("ldr:shel", std::make_shared<Shell>(system));
|
||||
server_manager->RegisterNamedService("ldr:ro", std::make_shared<RelocatableObject>(system));
|
||||
|
||||
ServerManager::RunServer(std::move(server_manager));
|
||||
}
|
||||
|
||||
@@ -171,7 +171,6 @@ void MakeGraphicBuffer(android::BufferQueueProducer& producer, u32 slot, u32 han
|
||||
buffer->height = SharedBufferHeight;
|
||||
buffer->stride = SharedBufferBlockLinearStride;
|
||||
buffer->format = SharedBufferBlockLinearFormat;
|
||||
buffer->external_format = SharedBufferBlockLinearFormat;
|
||||
buffer->buffer_id = handle;
|
||||
buffer->offset = slot * SharedBufferSlotSize;
|
||||
ASSERT(producer.SetPreallocatedBuffer(slot, buffer) == android::Status::NoError);
|
||||
|
||||
@@ -1,709 +0,0 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2023 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include <mbedtls/sha256.h>
|
||||
|
||||
#include "common/scope_exit.h"
|
||||
#include "core/hle/kernel/k_process.h"
|
||||
|
||||
#include "core/hle/service/ipc_helpers.h"
|
||||
#include "core/hle/service/ro/ro.h"
|
||||
#include "core/hle/service/ro/ro_nro_utils.h"
|
||||
#include "core/hle/service/ro/ro_results.h"
|
||||
#include "core/hle/service/ro/ro_types.h"
|
||||
#include "core/hle/service/server_manager.h"
|
||||
#include "core/hle/service/service.h"
|
||||
|
||||
namespace Service::RO {
|
||||
|
||||
namespace {
|
||||
|
||||
// Convenience definitions.
|
||||
constexpr size_t MaxSessions = 0x3;
|
||||
constexpr size_t MaxNrrInfos = 0x40;
|
||||
constexpr size_t MaxNroInfos = 0x40;
|
||||
|
||||
constexpr u64 InvalidProcessId = 0xffffffffffffffffULL;
|
||||
constexpr u64 InvalidContextId = 0xffffffffffffffffULL;
|
||||
|
||||
// Types.
|
||||
using Sha256Hash = std::array<u8, 32>;
|
||||
|
||||
struct NroInfo {
|
||||
u64 base_address;
|
||||
u64 nro_heap_address;
|
||||
u64 nro_heap_size;
|
||||
u64 bss_heap_address;
|
||||
u64 bss_heap_size;
|
||||
u64 code_size;
|
||||
u64 rw_size;
|
||||
ModuleId module_id;
|
||||
};
|
||||
|
||||
struct NrrInfo {
|
||||
u64 nrr_heap_address;
|
||||
u64 nrr_heap_size;
|
||||
|
||||
// Verification.
|
||||
std::vector<Sha256Hash> hashes;
|
||||
};
|
||||
|
||||
struct ProcessContext {
|
||||
constexpr ProcessContext() = default;
|
||||
|
||||
void Initialize(Kernel::KProcess* process, u64 process_id) {
|
||||
ASSERT(!m_in_use);
|
||||
|
||||
m_nro_in_use = {};
|
||||
m_nrr_in_use = {};
|
||||
m_nro_infos = {};
|
||||
m_nrr_infos = {};
|
||||
|
||||
m_process = process;
|
||||
m_process_id = process_id;
|
||||
m_in_use = true;
|
||||
|
||||
if (m_process) {
|
||||
m_process->Open();
|
||||
}
|
||||
}
|
||||
|
||||
void Finalize() {
|
||||
ASSERT(m_in_use);
|
||||
|
||||
if (m_process) {
|
||||
m_process->Close();
|
||||
}
|
||||
|
||||
m_nro_in_use = {};
|
||||
m_nrr_in_use = {};
|
||||
m_nro_infos = {};
|
||||
m_nrr_infos = {};
|
||||
|
||||
m_process = nullptr;
|
||||
m_process_id = InvalidProcessId;
|
||||
m_in_use = false;
|
||||
}
|
||||
|
||||
Kernel::KProcess* GetProcess() const {
|
||||
return m_process;
|
||||
}
|
||||
|
||||
u64 GetProcessId() const {
|
||||
return m_process_id;
|
||||
}
|
||||
|
||||
bool IsFree() const {
|
||||
return !m_in_use;
|
||||
}
|
||||
|
||||
u64 GetProgramId(Kernel::KProcess* other_process) const {
|
||||
// Automatically select a handle, allowing for override.
|
||||
if (other_process) {
|
||||
return other_process->GetProgramId();
|
||||
} else if (m_process) {
|
||||
return m_process->GetProgramId();
|
||||
} else {
|
||||
return 0;
|
||||
}
|
||||
}
|
||||
|
||||
Result GetNrrInfoByAddress(NrrInfo** out, u64 nrr_heap_address) {
|
||||
for (size_t i = 0; i < MaxNrrInfos; i++) {
|
||||
if (m_nrr_in_use[i] && m_nrr_infos[i].nrr_heap_address == nrr_heap_address) {
|
||||
if (out != nullptr) {
|
||||
*out = std::addressof(m_nrr_infos[i]);
|
||||
}
|
||||
R_SUCCEED();
|
||||
}
|
||||
}
|
||||
R_THROW(RO::ResultNotRegistered);
|
||||
}
|
||||
|
||||
Result GetFreeNrrInfo(NrrInfo** out) {
|
||||
for (size_t i = 0; i < MaxNrrInfos; i++) {
|
||||
if (!m_nrr_in_use[i]) {
|
||||
if (out != nullptr) {
|
||||
*out = std::addressof(m_nrr_infos[i]);
|
||||
}
|
||||
R_SUCCEED();
|
||||
}
|
||||
}
|
||||
R_THROW(RO::ResultTooManyNrr);
|
||||
}
|
||||
|
||||
Result GetNroInfoByAddress(NroInfo** out, u64 nro_address) {
|
||||
for (size_t i = 0; i < MaxNroInfos; i++) {
|
||||
if (m_nro_in_use[i] && m_nro_infos[i].base_address == nro_address) {
|
||||
if (out != nullptr) {
|
||||
*out = std::addressof(m_nro_infos[i]);
|
||||
}
|
||||
R_SUCCEED();
|
||||
}
|
||||
}
|
||||
R_THROW(RO::ResultNotLoaded);
|
||||
}
|
||||
|
||||
Result GetNroInfoByModuleId(NroInfo** out, const ModuleId* module_id) {
|
||||
for (size_t i = 0; i < MaxNroInfos; i++) {
|
||||
if (m_nro_in_use[i] && std::memcmp(std::addressof(m_nro_infos[i].module_id), module_id,
|
||||
sizeof(*module_id)) == 0) {
|
||||
if (out != nullptr) {
|
||||
*out = std::addressof(m_nro_infos[i]);
|
||||
}
|
||||
R_SUCCEED();
|
||||
}
|
||||
}
|
||||
R_THROW(RO::ResultNotLoaded);
|
||||
}
|
||||
|
||||
Result GetFreeNroInfo(NroInfo** out) {
|
||||
for (size_t i = 0; i < MaxNroInfos; i++) {
|
||||
if (!m_nro_in_use[i]) {
|
||||
if (out != nullptr) {
|
||||
*out = std::addressof(m_nro_infos[i]);
|
||||
}
|
||||
R_SUCCEED();
|
||||
}
|
||||
}
|
||||
R_THROW(RO::ResultTooManyNro);
|
||||
}
|
||||
|
||||
Result ValidateHasNroHash(u64 base_address, const NroHeader* nro_header) const {
|
||||
// Calculate hash.
|
||||
Sha256Hash hash;
|
||||
{
|
||||
const u64 size = nro_header->GetSize();
|
||||
|
||||
std::vector<u8> nro_data(size);
|
||||
m_process->GetMemory().ReadBlock(base_address, nro_data.data(), size);
|
||||
|
||||
mbedtls_sha256_ret(nro_data.data(), size, hash.data(), 0);
|
||||
}
|
||||
|
||||
for (size_t i = 0; i < MaxNrrInfos; i++) {
|
||||
// Ensure we only check NRRs that are used.
|
||||
if (!m_nrr_in_use[i]) {
|
||||
continue;
|
||||
}
|
||||
|
||||
// Locate the hash within the hash list.
|
||||
const auto hash_it = std::ranges::find(m_nrr_infos[i].hashes, hash);
|
||||
if (hash_it == m_nrr_infos[i].hashes.end()) {
|
||||
continue;
|
||||
}
|
||||
|
||||
// The hash is valid!
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
||||
R_THROW(RO::ResultNotAuthorized);
|
||||
}
|
||||
|
||||
Result ValidateNro(ModuleId* out_module_id, u64* out_rx_size, u64* out_ro_size,
|
||||
u64* out_rw_size, u64 base_address, u64 expected_nro_size,
|
||||
u64 expected_bss_size) {
|
||||
// Ensure we have a process to work on.
|
||||
R_UNLESS(m_process != nullptr, RO::ResultInvalidProcess);
|
||||
|
||||
// Read the NRO header.
|
||||
NroHeader header{};
|
||||
m_process->GetMemory().ReadBlock(base_address, std::addressof(header), sizeof(header));
|
||||
|
||||
// Validate header.
|
||||
R_UNLESS(header.IsMagicValid(), RO::ResultInvalidNro);
|
||||
|
||||
// Read sizes from header.
|
||||
const u64 nro_size = header.GetSize();
|
||||
const u64 text_ofs = header.GetTextOffset();
|
||||
const u64 text_size = header.GetTextSize();
|
||||
const u64 ro_ofs = header.GetRoOffset();
|
||||
const u64 ro_size = header.GetRoSize();
|
||||
const u64 rw_ofs = header.GetRwOffset();
|
||||
const u64 rw_size = header.GetRwSize();
|
||||
const u64 bss_size = header.GetBssSize();
|
||||
|
||||
// Validate sizes meet expected.
|
||||
R_UNLESS(nro_size == expected_nro_size, RO::ResultInvalidNro);
|
||||
R_UNLESS(bss_size == expected_bss_size, RO::ResultInvalidNro);
|
||||
|
||||
// Validate all sizes are aligned.
|
||||
R_UNLESS(Common::IsAligned(text_size, Core::Memory::YUZU_PAGESIZE), RO::ResultInvalidNro);
|
||||
R_UNLESS(Common::IsAligned(ro_size, Core::Memory::YUZU_PAGESIZE), RO::ResultInvalidNro);
|
||||
R_UNLESS(Common::IsAligned(rw_size, Core::Memory::YUZU_PAGESIZE), RO::ResultInvalidNro);
|
||||
R_UNLESS(Common::IsAligned(bss_size, Core::Memory::YUZU_PAGESIZE), RO::ResultInvalidNro);
|
||||
|
||||
// Validate sections are in order.
|
||||
R_UNLESS(text_ofs <= ro_ofs, RO::ResultInvalidNro);
|
||||
R_UNLESS(ro_ofs <= rw_ofs, RO::ResultInvalidNro);
|
||||
|
||||
// Validate sections are sequential and contiguous.
|
||||
R_UNLESS(text_ofs == 0, RO::ResultInvalidNro);
|
||||
R_UNLESS(text_ofs + text_size == ro_ofs, RO::ResultInvalidNro);
|
||||
R_UNLESS(ro_ofs + ro_size == rw_ofs, RO::ResultInvalidNro);
|
||||
R_UNLESS(rw_ofs + rw_size == nro_size, RO::ResultInvalidNro);
|
||||
|
||||
// Verify NRO hash.
|
||||
R_TRY(this->ValidateHasNroHash(base_address, std::addressof(header)));
|
||||
|
||||
// Check if NRO has already been loaded.
|
||||
const ModuleId* module_id = header.GetModuleId();
|
||||
R_UNLESS(R_FAILED(this->GetNroInfoByModuleId(nullptr, module_id)), RO::ResultAlreadyLoaded);
|
||||
|
||||
// Apply patches to NRO.
|
||||
// LocateAndApplyIpsPatchesToModule(module_id, static_cast<u8*>(mapped_memory), nro_size);
|
||||
|
||||
// Copy to output.
|
||||
*out_module_id = *module_id;
|
||||
*out_rx_size = text_size;
|
||||
*out_ro_size = ro_size;
|
||||
*out_rw_size = rw_size;
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
||||
void SetNrrInfoInUse(const NrrInfo* info, bool in_use) {
|
||||
ASSERT(std::addressof(m_nrr_infos[0]) <= info &&
|
||||
info <= std::addressof(m_nrr_infos[MaxNrrInfos - 1]));
|
||||
const size_t index = info - std::addressof(m_nrr_infos[0]);
|
||||
m_nrr_in_use[index] = in_use;
|
||||
}
|
||||
|
||||
void SetNroInfoInUse(const NroInfo* info, bool in_use) {
|
||||
ASSERT(std::addressof(m_nro_infos[0]) <= info &&
|
||||
info <= std::addressof(m_nro_infos[MaxNroInfos - 1]));
|
||||
const size_t index = info - std::addressof(m_nro_infos[0]);
|
||||
m_nro_in_use[index] = in_use;
|
||||
}
|
||||
|
||||
private:
|
||||
std::array<bool, MaxNroInfos> m_nro_in_use{};
|
||||
std::array<bool, MaxNrrInfos> m_nrr_in_use{};
|
||||
std::array<NroInfo, MaxNroInfos> m_nro_infos{};
|
||||
std::array<NrrInfo, MaxNrrInfos> m_nrr_infos{};
|
||||
Kernel::KProcess* m_process{};
|
||||
u64 m_process_id{InvalidProcessId};
|
||||
bool m_in_use{};
|
||||
};
|
||||
|
||||
Result ValidateAddressAndNonZeroSize(u64 address, u64 size) {
|
||||
R_UNLESS(Common::IsAligned(address, Core::Memory::YUZU_PAGESIZE), RO::ResultInvalidAddress);
|
||||
R_UNLESS(size != 0, RO::ResultInvalidSize);
|
||||
R_UNLESS(Common::IsAligned(size, Core::Memory::YUZU_PAGESIZE), RO::ResultInvalidSize);
|
||||
R_UNLESS(address < address + size, RO::ResultInvalidSize);
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
||||
Result ValidateAddressAndSize(u64 address, u64 size) {
|
||||
R_UNLESS(Common::IsAligned(address, Core::Memory::YUZU_PAGESIZE), RO::ResultInvalidAddress);
|
||||
R_UNLESS(Common::IsAligned(size, Core::Memory::YUZU_PAGESIZE), RO::ResultInvalidSize);
|
||||
R_UNLESS(size == 0 || address < address + size, RO::ResultInvalidSize);
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
||||
class RoContext {
|
||||
public:
|
||||
explicit RoContext() = default;
|
||||
|
||||
Result RegisterProcess(size_t* out_context_id, Kernel::KProcess* process, u64 process_id) {
|
||||
// Validate process id.
|
||||
R_UNLESS(process->GetProcessId() == process_id, RO::ResultInvalidProcess);
|
||||
|
||||
// Check if a process context already exists.
|
||||
R_UNLESS(this->GetContextByProcessId(process_id) == nullptr, RO::ResultInvalidSession);
|
||||
|
||||
// Allocate a context to manage the process handle.
|
||||
*out_context_id = this->AllocateContext(process, process_id);
|
||||
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
||||
Result ValidateProcess(size_t context_id, u64 process_id) {
|
||||
const ProcessContext* ctx = this->GetContextById(context_id);
|
||||
R_UNLESS(ctx != nullptr, RO::ResultInvalidProcess);
|
||||
R_UNLESS(ctx->GetProcessId() == process_id, RO::ResultInvalidProcess);
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
||||
void UnregisterProcess(size_t context_id) {
|
||||
this->FreeContext(context_id);
|
||||
}
|
||||
|
||||
Result RegisterModuleInfo(size_t context_id, u64 nrr_address, u64 nrr_size, NrrKind nrr_kind,
|
||||
bool enforce_nrr_kind) {
|
||||
// Get context.
|
||||
ProcessContext* context = this->GetContextById(context_id);
|
||||
ASSERT(context != nullptr);
|
||||
|
||||
// Validate address/size.
|
||||
R_TRY(ValidateAddressAndNonZeroSize(nrr_address, nrr_size));
|
||||
|
||||
// Check we have space for a new NRR.
|
||||
NrrInfo* nrr_info = nullptr;
|
||||
R_TRY(context->GetFreeNrrInfo(std::addressof(nrr_info)));
|
||||
|
||||
// Ensure we have a valid process to read from.
|
||||
Kernel::KProcess* process = context->GetProcess();
|
||||
R_UNLESS(process != nullptr, RO::ResultInvalidProcess);
|
||||
|
||||
// Read NRR.
|
||||
NrrHeader header{};
|
||||
process->GetMemory().ReadBlock(nrr_address, std::addressof(header), sizeof(header));
|
||||
|
||||
// Set NRR info.
|
||||
context->SetNrrInfoInUse(nrr_info, true);
|
||||
nrr_info->nrr_heap_address = nrr_address;
|
||||
nrr_info->nrr_heap_size = nrr_size;
|
||||
|
||||
// Read NRR hash list.
|
||||
nrr_info->hashes.resize(header.GetNumHashes());
|
||||
process->GetMemory().ReadBlock(nrr_address + header.GetHashesOffset(),
|
||||
nrr_info->hashes.data(),
|
||||
sizeof(Sha256Hash) * header.GetNumHashes());
|
||||
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
||||
Result UnregisterModuleInfo(size_t context_id, u64 nrr_address) {
|
||||
// Get context.
|
||||
ProcessContext* context = this->GetContextById(context_id);
|
||||
ASSERT(context != nullptr);
|
||||
|
||||
// Validate address.
|
||||
R_UNLESS(Common::IsAligned(nrr_address, Core::Memory::YUZU_PAGESIZE),
|
||||
RO::ResultInvalidAddress);
|
||||
|
||||
// Check the NRR is loaded.
|
||||
NrrInfo* nrr_info = nullptr;
|
||||
R_TRY(context->GetNrrInfoByAddress(std::addressof(nrr_info), nrr_address));
|
||||
|
||||
// Nintendo does this unconditionally, whether or not the actual unmap succeeds.
|
||||
context->SetNrrInfoInUse(nrr_info, false);
|
||||
*nrr_info = {};
|
||||
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
||||
Result MapManualLoadModuleMemory(u64* out_address, size_t context_id, u64 nro_address,
|
||||
u64 nro_size, u64 bss_address, u64 bss_size) {
|
||||
// Get context.
|
||||
ProcessContext* context = this->GetContextById(context_id);
|
||||
ASSERT(context != nullptr);
|
||||
|
||||
// Validate address/size.
|
||||
R_TRY(ValidateAddressAndNonZeroSize(nro_address, nro_size));
|
||||
R_TRY(ValidateAddressAndSize(bss_address, bss_size));
|
||||
|
||||
const u64 total_size = nro_size + bss_size;
|
||||
R_UNLESS(total_size >= nro_size, RO::ResultInvalidSize);
|
||||
R_UNLESS(total_size >= bss_size, RO::ResultInvalidSize);
|
||||
|
||||
// Check we have space for a new NRO.
|
||||
NroInfo* nro_info = nullptr;
|
||||
R_TRY(context->GetFreeNroInfo(std::addressof(nro_info)));
|
||||
nro_info->nro_heap_address = nro_address;
|
||||
nro_info->nro_heap_size = nro_size;
|
||||
nro_info->bss_heap_address = bss_address;
|
||||
nro_info->bss_heap_size = bss_size;
|
||||
|
||||
// Map the NRO.
|
||||
R_TRY(MapNro(std::addressof(nro_info->base_address), context->GetProcess(), nro_address,
|
||||
nro_size, bss_address, bss_size, generate_random));
|
||||
ON_RESULT_FAILURE {
|
||||
UnmapNro(context->GetProcess(), nro_info->base_address, nro_address, nro_size,
|
||||
bss_address, bss_size);
|
||||
};
|
||||
|
||||
// Validate the NRO (parsing region extents).
|
||||
u64 rx_size = 0, ro_size = 0, rw_size = 0;
|
||||
R_TRY(context->ValidateNro(std::addressof(nro_info->module_id), std::addressof(rx_size),
|
||||
std::addressof(ro_size), std::addressof(rw_size),
|
||||
nro_info->base_address, nro_size, bss_size));
|
||||
|
||||
// Set NRO perms.
|
||||
R_TRY(SetNroPerms(context->GetProcess(), nro_info->base_address, rx_size, ro_size,
|
||||
rw_size + bss_size));
|
||||
|
||||
context->SetNroInfoInUse(nro_info, true);
|
||||
nro_info->code_size = rx_size + ro_size;
|
||||
nro_info->rw_size = rw_size;
|
||||
*out_address = nro_info->base_address;
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
||||
Result UnmapManualLoadModuleMemory(size_t context_id, u64 nro_address) {
|
||||
// Get context.
|
||||
ProcessContext* context = this->GetContextById(context_id);
|
||||
ASSERT(context != nullptr);
|
||||
|
||||
// Validate address.
|
||||
R_UNLESS(Common::IsAligned(nro_address, Core::Memory::YUZU_PAGESIZE),
|
||||
RO::ResultInvalidAddress);
|
||||
|
||||
// Check the NRO is loaded.
|
||||
NroInfo* nro_info = nullptr;
|
||||
R_TRY(context->GetNroInfoByAddress(std::addressof(nro_info), nro_address));
|
||||
|
||||
// Unmap.
|
||||
const NroInfo nro_backup = *nro_info;
|
||||
{
|
||||
// Nintendo does this unconditionally, whether or not the actual unmap succeeds.
|
||||
context->SetNroInfoInUse(nro_info, false);
|
||||
std::memset(nro_info, 0, sizeof(*nro_info));
|
||||
}
|
||||
R_RETURN(UnmapNro(context->GetProcess(), nro_backup.base_address,
|
||||
nro_backup.nro_heap_address, nro_backup.code_size + nro_backup.rw_size,
|
||||
nro_backup.bss_heap_address, nro_backup.bss_heap_size));
|
||||
}
|
||||
|
||||
private:
|
||||
std::array<ProcessContext, MaxSessions> process_contexts;
|
||||
std::mt19937_64 generate_random;
|
||||
|
||||
// Context Helpers.
|
||||
ProcessContext* GetContextById(size_t context_id) {
|
||||
if (context_id == InvalidContextId) {
|
||||
return nullptr;
|
||||
}
|
||||
|
||||
ASSERT(context_id < process_contexts.size());
|
||||
return std::addressof(process_contexts[context_id]);
|
||||
}
|
||||
|
||||
ProcessContext* GetContextByProcessId(u64 process_id) {
|
||||
for (size_t i = 0; i < MaxSessions; i++) {
|
||||
if (process_contexts[i].GetProcessId() == process_id) {
|
||||
return std::addressof(process_contexts[i]);
|
||||
}
|
||||
}
|
||||
return nullptr;
|
||||
}
|
||||
|
||||
size_t AllocateContext(Kernel::KProcess* process, u64 process_id) {
|
||||
// Find a free process context.
|
||||
for (size_t i = 0; i < MaxSessions; i++) {
|
||||
ProcessContext* context = std::addressof(process_contexts[i]);
|
||||
|
||||
if (context->IsFree()) {
|
||||
context->Initialize(process, process_id);
|
||||
return i;
|
||||
}
|
||||
}
|
||||
|
||||
// Failure to find a free context is actually an abort condition.
|
||||
UNREACHABLE();
|
||||
}
|
||||
|
||||
void FreeContext(size_t context_id) {
|
||||
if (ProcessContext* context = GetContextById(context_id); context != nullptr) {
|
||||
context->Finalize();
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
class RoInterface {
|
||||
public:
|
||||
explicit RoInterface(std::shared_ptr<RoContext> ro, NrrKind nrr_kind)
|
||||
: m_ro(ro), m_context_id(InvalidContextId), m_nrr_kind(nrr_kind) {}
|
||||
~RoInterface() {
|
||||
m_ro->UnregisterProcess(m_context_id);
|
||||
}
|
||||
|
||||
Result MapManualLoadModuleMemory(u64* out_load_address, u64 client_pid, u64 nro_address,
|
||||
u64 nro_size, u64 bss_address, u64 bss_size) {
|
||||
R_TRY(m_ro->ValidateProcess(m_context_id, client_pid));
|
||||
R_RETURN(m_ro->MapManualLoadModuleMemory(out_load_address, m_context_id, nro_address,
|
||||
nro_size, bss_address, bss_size));
|
||||
}
|
||||
|
||||
Result UnmapManualLoadModuleMemory(u64 client_pid, u64 nro_address) {
|
||||
R_TRY(m_ro->ValidateProcess(m_context_id, client_pid));
|
||||
R_RETURN(m_ro->UnmapManualLoadModuleMemory(m_context_id, nro_address));
|
||||
}
|
||||
|
||||
Result RegisterModuleInfo(u64 client_pid, u64 nrr_address, u64 nrr_size) {
|
||||
R_TRY(m_ro->ValidateProcess(m_context_id, client_pid));
|
||||
R_RETURN(
|
||||
m_ro->RegisterModuleInfo(m_context_id, nrr_address, nrr_size, NrrKind::User, true));
|
||||
}
|
||||
|
||||
Result UnregisterModuleInfo(u64 client_pid, u64 nrr_address) {
|
||||
R_TRY(m_ro->ValidateProcess(m_context_id, client_pid));
|
||||
R_RETURN(m_ro->UnregisterModuleInfo(m_context_id, nrr_address));
|
||||
}
|
||||
|
||||
Result RegisterProcessHandle(u64 client_pid, Kernel::KProcess* process) {
|
||||
// Register the process.
|
||||
R_RETURN(m_ro->RegisterProcess(std::addressof(m_context_id), process, client_pid));
|
||||
}
|
||||
|
||||
Result RegisterProcessModuleInfo(u64 client_pid, u64 nrr_address, u64 nrr_size,
|
||||
Kernel::KProcess* process) {
|
||||
// Validate the process.
|
||||
R_TRY(m_ro->ValidateProcess(m_context_id, client_pid));
|
||||
|
||||
// Register the module.
|
||||
R_RETURN(m_ro->RegisterModuleInfo(m_context_id, nrr_address, nrr_size, m_nrr_kind,
|
||||
m_nrr_kind == NrrKind::JitPlugin));
|
||||
}
|
||||
|
||||
private:
|
||||
std::shared_ptr<RoContext> m_ro{};
|
||||
size_t m_context_id{};
|
||||
NrrKind m_nrr_kind{};
|
||||
};
|
||||
|
||||
class IRoInterface : public ServiceFramework<IRoInterface> {
|
||||
public:
|
||||
explicit IRoInterface(Core::System& system_, const char* name_, std::shared_ptr<RoContext> ro,
|
||||
NrrKind nrr_kind)
|
||||
: ServiceFramework{system_, name_}, interface {
|
||||
ro, nrr_kind
|
||||
} {
|
||||
// clang-format off
|
||||
static const FunctionInfo functions[] = {
|
||||
{0, &IRoInterface::MapManualLoadModuleMemory, "MapManualLoadModuleMemory"},
|
||||
{1, &IRoInterface::UnmapManualLoadModuleMemory, "UnmapManualLoadModuleMemory"},
|
||||
{2, &IRoInterface::RegisterModuleInfo, "RegisterModuleInfo"},
|
||||
{3, &IRoInterface::UnregisterModuleInfo, "UnregisterModuleInfo"},
|
||||
{4, &IRoInterface::RegisterProcessHandle, "RegisterProcessHandle"},
|
||||
{10, &IRoInterface::RegisterProcessModuleInfo, "RegisterProcessModuleInfo"},
|
||||
};
|
||||
// clang-format on
|
||||
|
||||
RegisterHandlers(functions);
|
||||
}
|
||||
|
||||
private:
|
||||
void MapManualLoadModuleMemory(HLERequestContext& ctx) {
|
||||
LOG_DEBUG(Service_LDR, "(called)");
|
||||
|
||||
struct InputParameters {
|
||||
u64 client_pid;
|
||||
u64 nro_address;
|
||||
u64 nro_size;
|
||||
u64 bss_address;
|
||||
u64 bss_size;
|
||||
};
|
||||
|
||||
IPC::RequestParser rp{ctx};
|
||||
auto params = rp.PopRaw<InputParameters>();
|
||||
|
||||
u64 load_address = 0;
|
||||
auto result = interface.MapManualLoadModuleMemory(&load_address, ctx.GetPID(),
|
||||
params.nro_address, params.nro_size,
|
||||
params.bss_address, params.bss_size);
|
||||
|
||||
IPC::ResponseBuilder rb{ctx, 4};
|
||||
rb.Push(result);
|
||||
rb.Push(load_address);
|
||||
}
|
||||
|
||||
void UnmapManualLoadModuleMemory(HLERequestContext& ctx) {
|
||||
LOG_DEBUG(Service_LDR, "(called)");
|
||||
|
||||
struct InputParameters {
|
||||
u64 client_pid;
|
||||
u64 nro_address;
|
||||
};
|
||||
|
||||
IPC::RequestParser rp{ctx};
|
||||
auto params = rp.PopRaw<InputParameters>();
|
||||
auto result = interface.UnmapManualLoadModuleMemory(ctx.GetPID(), params.nro_address);
|
||||
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(result);
|
||||
}
|
||||
|
||||
void RegisterModuleInfo(HLERequestContext& ctx) {
|
||||
LOG_DEBUG(Service_LDR, "(called)");
|
||||
|
||||
struct InputParameters {
|
||||
u64 client_pid;
|
||||
u64 nrr_address;
|
||||
u64 nrr_size;
|
||||
};
|
||||
|
||||
IPC::RequestParser rp{ctx};
|
||||
auto params = rp.PopRaw<InputParameters>();
|
||||
auto result =
|
||||
interface.RegisterModuleInfo(ctx.GetPID(), params.nrr_address, params.nrr_size);
|
||||
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(result);
|
||||
}
|
||||
|
||||
void UnregisterModuleInfo(HLERequestContext& ctx) {
|
||||
LOG_DEBUG(Service_LDR, "(called)");
|
||||
|
||||
struct InputParameters {
|
||||
u64 client_pid;
|
||||
u64 nrr_address;
|
||||
};
|
||||
|
||||
IPC::RequestParser rp{ctx};
|
||||
auto params = rp.PopRaw<InputParameters>();
|
||||
auto result = interface.UnregisterModuleInfo(ctx.GetPID(), params.nrr_address);
|
||||
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(result);
|
||||
}
|
||||
|
||||
void RegisterProcessHandle(HLERequestContext& ctx) {
|
||||
LOG_DEBUG(Service_LDR, "(called)");
|
||||
|
||||
auto process_h = ctx.GetClientHandleTable().GetObject(ctx.GetCopyHandle(0));
|
||||
auto client_pid = ctx.GetPID();
|
||||
auto result = interface.RegisterProcessHandle(client_pid,
|
||||
process_h->DynamicCast<Kernel::KProcess*>());
|
||||
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(result);
|
||||
}
|
||||
|
||||
void RegisterProcessModuleInfo(HLERequestContext& ctx) {
|
||||
LOG_DEBUG(Service_LDR, "(called)");
|
||||
|
||||
struct InputParameters {
|
||||
u64 client_pid;
|
||||
u64 nrr_address;
|
||||
u64 nrr_size;
|
||||
};
|
||||
|
||||
IPC::RequestParser rp{ctx};
|
||||
auto params = rp.PopRaw<InputParameters>();
|
||||
auto process_h = ctx.GetClientHandleTable().GetObject(ctx.GetCopyHandle(0));
|
||||
|
||||
auto client_pid = ctx.GetPID();
|
||||
auto result =
|
||||
interface.RegisterProcessModuleInfo(client_pid, params.nrr_address, params.nrr_size,
|
||||
process_h->DynamicCast<Kernel::KProcess*>());
|
||||
|
||||
IPC::ResponseBuilder rb{ctx, 2};
|
||||
rb.Push(result);
|
||||
}
|
||||
|
||||
RoInterface interface;
|
||||
};
|
||||
|
||||
} // namespace
|
||||
|
||||
void LoopProcess(Core::System& system) {
|
||||
auto server_manager = std::make_unique<ServerManager>(system);
|
||||
|
||||
auto ro = std::make_shared<RoContext>();
|
||||
|
||||
const auto RoInterfaceFactoryForUser = [&, ro] {
|
||||
return std::make_shared<IRoInterface>(system, "ldr:ro", ro, NrrKind::User);
|
||||
};
|
||||
|
||||
const auto RoInterfaceFactoryForJitPlugin = [&, ro] {
|
||||
return std::make_shared<IRoInterface>(system, "ro:1", ro, NrrKind::JitPlugin);
|
||||
};
|
||||
|
||||
server_manager->RegisterNamedService("ldr:ro", std::move(RoInterfaceFactoryForUser));
|
||||
server_manager->RegisterNamedService("ro:1", std::move(RoInterfaceFactoryForJitPlugin));
|
||||
|
||||
ServerManager::RunServer(std::move(server_manager));
|
||||
}
|
||||
|
||||
} // namespace Service::RO
|
||||
@@ -1,14 +0,0 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2023 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#pragma once
|
||||
|
||||
namespace Core {
|
||||
class System;
|
||||
}
|
||||
|
||||
namespace Service::RO {
|
||||
|
||||
void LoopProcess(Core::System& system);
|
||||
|
||||
} // namespace Service::RO
|
||||
@@ -1,185 +0,0 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2023 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include "core/hle/kernel/k_process.h"
|
||||
#include "core/hle/service/ro/ro_nro_utils.h"
|
||||
#include "core/hle/service/ro/ro_results.h"
|
||||
|
||||
namespace Service::RO {
|
||||
|
||||
namespace {
|
||||
|
||||
struct ProcessMemoryRegion {
|
||||
u64 address;
|
||||
u64 size;
|
||||
};
|
||||
|
||||
size_t GetTotalProcessMemoryRegionSize(const ProcessMemoryRegion* regions, size_t num_regions) {
|
||||
size_t total = 0;
|
||||
|
||||
for (size_t i = 0; i < num_regions; ++i) {
|
||||
total += regions[i].size;
|
||||
}
|
||||
|
||||
return total;
|
||||
}
|
||||
|
||||
size_t SetupNroProcessMemoryRegions(ProcessMemoryRegion* regions, u64 nro_heap_address,
|
||||
u64 nro_heap_size, u64 bss_heap_address, u64 bss_heap_size) {
|
||||
// Reset region count.
|
||||
size_t num_regions = 0;
|
||||
|
||||
// We always want a region for the nro.
|
||||
regions[num_regions++] = {nro_heap_address, nro_heap_size};
|
||||
|
||||
// If we have bss, create a region for bss.
|
||||
if (bss_heap_size > 0) {
|
||||
regions[num_regions++] = {bss_heap_address, bss_heap_size};
|
||||
}
|
||||
|
||||
return num_regions;
|
||||
}
|
||||
|
||||
Result SetProcessMemoryPermission(Kernel::KProcess* process, u64 address, u64 size,
|
||||
Kernel::Svc::MemoryPermission permission) {
|
||||
auto& page_table = process->GetPageTable();
|
||||
|
||||
// Set permission.
|
||||
R_RETURN(page_table.SetProcessMemoryPermission(address, size, permission));
|
||||
}
|
||||
|
||||
Result UnmapProcessCodeMemory(Kernel::KProcess* process, u64 process_code_address,
|
||||
const ProcessMemoryRegion* regions, size_t num_regions) {
|
||||
// Get the total process memory region size.
|
||||
const size_t total_size = GetTotalProcessMemoryRegionSize(regions, num_regions);
|
||||
|
||||
auto& page_table = process->GetPageTable();
|
||||
|
||||
// Unmap each region in order.
|
||||
size_t cur_offset = total_size;
|
||||
for (size_t i = 0; i < num_regions; ++i) {
|
||||
// We want to unmap in reverse order.
|
||||
const auto& cur_region = regions[num_regions - 1 - i];
|
||||
|
||||
// Subtract to update the current offset.
|
||||
cur_offset -= cur_region.size;
|
||||
|
||||
// Unmap.
|
||||
R_TRY(page_table.UnmapCodeMemory(process_code_address + cur_offset, cur_region.address,
|
||||
cur_region.size));
|
||||
}
|
||||
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
||||
Result EnsureGuardPages(Kernel::KProcessPageTable& page_table, u64 map_address, u64 map_size) {
|
||||
Kernel::KMemoryInfo memory_info;
|
||||
Kernel::Svc::PageInfo page_info;
|
||||
|
||||
// Ensure page before mapping is unmapped.
|
||||
R_TRY(page_table.QueryInfo(std::addressof(memory_info), std::addressof(page_info),
|
||||
map_address - 1));
|
||||
R_UNLESS(memory_info.GetSvcState() == Kernel::Svc::MemoryState::Free,
|
||||
Kernel::ResultInvalidState);
|
||||
|
||||
// Ensure page after mapping is unmapped.
|
||||
R_TRY(page_table.QueryInfo(std::addressof(memory_info), std::addressof(page_info),
|
||||
map_address + map_size));
|
||||
R_UNLESS(memory_info.GetSvcState() == Kernel::Svc::MemoryState::Free,
|
||||
Kernel::ResultInvalidState);
|
||||
|
||||
// Successfully verified guard pages.
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
||||
Result MapProcessCodeMemory(u64* out, Kernel::KProcess* process, const ProcessMemoryRegion* regions,
|
||||
size_t num_regions, std::mt19937_64& generate_random) {
|
||||
auto& page_table = process->GetPageTable();
|
||||
const u64 alias_code_start =
|
||||
GetInteger(page_table.GetAliasCodeRegionStart()) / Kernel::PageSize;
|
||||
const u64 alias_code_size = page_table.GetAliasCodeRegionSize() / Kernel::PageSize;
|
||||
|
||||
for (size_t trial = 0; trial < 64; trial++) {
|
||||
// Generate a new trial address.
|
||||
const u64 mapped_address =
|
||||
(alias_code_start + (generate_random() % alias_code_size)) * Kernel::PageSize;
|
||||
|
||||
const auto MapRegions = [&] {
|
||||
// Map the regions in order.
|
||||
u64 mapped_size = 0;
|
||||
for (size_t i = 0; i < num_regions; ++i) {
|
||||
// If we fail, unmap up to where we've mapped.
|
||||
ON_RESULT_FAILURE {
|
||||
R_ASSERT(UnmapProcessCodeMemory(process, mapped_address, regions, i));
|
||||
};
|
||||
|
||||
// Map the current region.
|
||||
R_TRY(page_table.MapCodeMemory(mapped_address + mapped_size, regions[i].address,
|
||||
regions[i].size));
|
||||
|
||||
mapped_size += regions[i].size;
|
||||
}
|
||||
|
||||
// If we fail, unmap all mapped regions.
|
||||
ON_RESULT_FAILURE {
|
||||
R_ASSERT(UnmapProcessCodeMemory(process, mapped_address, regions, num_regions));
|
||||
};
|
||||
|
||||
// Ensure guard pages.
|
||||
R_RETURN(EnsureGuardPages(page_table, mapped_address, mapped_size));
|
||||
};
|
||||
|
||||
if (R_SUCCEEDED(MapRegions())) {
|
||||
// Set the output address.
|
||||
*out = mapped_address;
|
||||
R_SUCCEED();
|
||||
}
|
||||
}
|
||||
|
||||
// We failed to map anything.
|
||||
R_THROW(RO::ResultOutOfAddressSpace);
|
||||
}
|
||||
|
||||
} // namespace
|
||||
|
||||
Result MapNro(u64* out_base_address, Kernel::KProcess* process, u64 nro_heap_address,
|
||||
u64 nro_heap_size, u64 bss_heap_address, u64 bss_heap_size,
|
||||
std::mt19937_64& generate_random) {
|
||||
// Set up the process memory regions.
|
||||
std::array<ProcessMemoryRegion, 2> regions{};
|
||||
const size_t num_regions = SetupNroProcessMemoryRegions(
|
||||
regions.data(), nro_heap_address, nro_heap_size, bss_heap_address, bss_heap_size);
|
||||
|
||||
// Re-map the nro/bss as code memory in the destination process.
|
||||
R_RETURN(MapProcessCodeMemory(out_base_address, process, regions.data(), num_regions,
|
||||
generate_random));
|
||||
}
|
||||
|
||||
Result SetNroPerms(Kernel::KProcess* process, u64 base_address, u64 rx_size, u64 ro_size,
|
||||
u64 rw_size) {
|
||||
const u64 rx_offset = 0;
|
||||
const u64 ro_offset = rx_offset + rx_size;
|
||||
const u64 rw_offset = ro_offset + ro_size;
|
||||
|
||||
R_TRY(SetProcessMemoryPermission(process, base_address + rx_offset, rx_size,
|
||||
Kernel::Svc::MemoryPermission::ReadExecute));
|
||||
R_TRY(SetProcessMemoryPermission(process, base_address + ro_offset, ro_size,
|
||||
Kernel::Svc::MemoryPermission::Read));
|
||||
R_TRY(SetProcessMemoryPermission(process, base_address + rw_offset, rw_size,
|
||||
Kernel::Svc::MemoryPermission::ReadWrite));
|
||||
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
||||
Result UnmapNro(Kernel::KProcess* process, u64 base_address, u64 nro_heap_address,
|
||||
u64 nro_heap_size, u64 bss_heap_address, u64 bss_heap_size) {
|
||||
// Set up the process memory regions.
|
||||
std::array<ProcessMemoryRegion, 2> regions{};
|
||||
const size_t num_regions = SetupNroProcessMemoryRegions(
|
||||
regions.data(), nro_heap_address, nro_heap_size, bss_heap_address, bss_heap_size);
|
||||
|
||||
// Unmap the nro/bss.
|
||||
R_RETURN(UnmapProcessCodeMemory(process, base_address, regions.data(), num_regions));
|
||||
}
|
||||
|
||||
} // namespace Service::RO
|
||||
@@ -1,26 +0,0 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2023 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#pragma once
|
||||
|
||||
#include <random>
|
||||
|
||||
#include "common/common_types.h"
|
||||
|
||||
namespace Kernel {
|
||||
class KProcess;
|
||||
}
|
||||
|
||||
union Result;
|
||||
|
||||
namespace Service::RO {
|
||||
|
||||
Result MapNro(u64* out_base_address, Kernel::KProcess* process, u64 nro_heap_address,
|
||||
u64 nro_heap_size, u64 bss_heap_address, u64 bss_heap_size,
|
||||
std::mt19937_64& generate_random);
|
||||
Result SetNroPerms(Kernel::KProcess* process, u64 base_address, u64 rx_size, u64 ro_size,
|
||||
u64 rw_size);
|
||||
Result UnmapNro(Kernel::KProcess* process, u64 base_address, u64 nro_heap_address,
|
||||
u64 nro_heap_size, u64 bss_heap_address, u64 bss_heap_size);
|
||||
|
||||
} // namespace Service::RO
|
||||
@@ -1,24 +0,0 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2023 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include "core/hle/result.h"
|
||||
|
||||
namespace Service::RO {
|
||||
|
||||
constexpr Result ResultOutOfAddressSpace{ErrorModule::RO, 2};
|
||||
constexpr Result ResultAlreadyLoaded{ErrorModule::RO, 3};
|
||||
constexpr Result ResultInvalidNro{ErrorModule::RO, 4};
|
||||
constexpr Result ResultInvalidNrr{ErrorModule::RO, 6};
|
||||
constexpr Result ResultTooManyNro{ErrorModule::RO, 7};
|
||||
constexpr Result ResultTooManyNrr{ErrorModule::RO, 8};
|
||||
constexpr Result ResultNotAuthorized{ErrorModule::RO, 9};
|
||||
constexpr Result ResultInvalidNrrKind{ErrorModule::RO, 10};
|
||||
constexpr Result ResultInternalError{ErrorModule::RO, 1023};
|
||||
constexpr Result ResultInvalidAddress{ErrorModule::RO, 1025};
|
||||
constexpr Result ResultInvalidSize{ErrorModule::RO, 1026};
|
||||
constexpr Result ResultNotLoaded{ErrorModule::RO, 1028};
|
||||
constexpr Result ResultNotRegistered{ErrorModule::RO, 1029};
|
||||
constexpr Result ResultInvalidSession{ErrorModule::RO, 1030};
|
||||
constexpr Result ResultInvalidProcess{ErrorModule::RO, 1031};
|
||||
|
||||
} // namespace Service::RO
|
||||
@@ -1,181 +0,0 @@
|
||||
// SPDX-FileCopyrightText: Copyright 2023 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include "common/assert.h"
|
||||
#include "common/common_funcs.h"
|
||||
#include "common/common_types.h"
|
||||
|
||||
namespace Service::RO {
|
||||
|
||||
enum class NrrKind : u8 {
|
||||
User = 0,
|
||||
JitPlugin = 1,
|
||||
Count,
|
||||
};
|
||||
|
||||
static constexpr size_t ModuleIdSize = 0x20;
|
||||
struct ModuleId {
|
||||
std::array<u8, ModuleIdSize> data;
|
||||
};
|
||||
static_assert(sizeof(ModuleId) == ModuleIdSize);
|
||||
|
||||
struct NrrCertification {
|
||||
static constexpr size_t RsaKeySize = 0x100;
|
||||
static constexpr size_t SignedSize = 0x120;
|
||||
|
||||
u64 program_id_mask;
|
||||
u64 program_id_pattern;
|
||||
std::array<u8, 0x10> reserved_10;
|
||||
std::array<u8, RsaKeySize> modulus;
|
||||
std::array<u8, RsaKeySize> signature;
|
||||
};
|
||||
static_assert(sizeof(NrrCertification) ==
|
||||
NrrCertification::RsaKeySize + NrrCertification::SignedSize);
|
||||
|
||||
class NrrHeader {
|
||||
public:
|
||||
static constexpr u32 Magic = Common::MakeMagic('N', 'R', 'R', '0');
|
||||
|
||||
public:
|
||||
bool IsMagicValid() const {
|
||||
return m_magic == Magic;
|
||||
}
|
||||
|
||||
bool IsProgramIdValid() const {
|
||||
return (m_program_id & m_certification.program_id_mask) ==
|
||||
m_certification.program_id_pattern;
|
||||
}
|
||||
|
||||
NrrKind GetNrrKind() const {
|
||||
const NrrKind kind = static_cast<NrrKind>(m_nrr_kind);
|
||||
ASSERT(kind < NrrKind::Count);
|
||||
return kind;
|
||||
}
|
||||
|
||||
u64 GetProgramId() const {
|
||||
return m_program_id;
|
||||
}
|
||||
|
||||
u32 GetSize() const {
|
||||
return m_size;
|
||||
}
|
||||
|
||||
u32 GetNumHashes() const {
|
||||
return m_num_hashes;
|
||||
}
|
||||
|
||||
size_t GetHashesOffset() const {
|
||||
return m_hashes_offset;
|
||||
}
|
||||
|
||||
u32 GetKeyGeneration() const {
|
||||
return m_key_generation;
|
||||
}
|
||||
|
||||
const u8* GetCertificationSignature() const {
|
||||
return m_certification.signature.data();
|
||||
}
|
||||
|
||||
const u8* GetCertificationSignedArea() const {
|
||||
return reinterpret_cast<const u8*>(std::addressof(m_certification));
|
||||
}
|
||||
|
||||
const u8* GetCertificationModulus() const {
|
||||
return m_certification.modulus.data();
|
||||
}
|
||||
|
||||
const u8* GetSignature() const {
|
||||
return m_signature.data();
|
||||
}
|
||||
|
||||
size_t GetSignedAreaSize() const {
|
||||
return m_size - GetSignedAreaOffset();
|
||||
}
|
||||
|
||||
static constexpr size_t GetSignedAreaOffset() {
|
||||
return offsetof(NrrHeader, m_program_id);
|
||||
}
|
||||
|
||||
private:
|
||||
u32 m_magic;
|
||||
u32 m_key_generation;
|
||||
INSERT_PADDING_BYTES_NOINIT(8);
|
||||
NrrCertification m_certification;
|
||||
std::array<u8, 0x100> m_signature;
|
||||
u64 m_program_id;
|
||||
u32 m_size;
|
||||
u8 m_nrr_kind; // 7.0.0+
|
||||
INSERT_PADDING_BYTES_NOINIT(3);
|
||||
u32 m_hashes_offset;
|
||||
u32 m_num_hashes;
|
||||
INSERT_PADDING_BYTES_NOINIT(8);
|
||||
};
|
||||
static_assert(sizeof(NrrHeader) == 0x350, "NrrHeader has wrong size");
|
||||
|
||||
class NroHeader {
|
||||
public:
|
||||
static constexpr u32 Magic = Common::MakeMagic('N', 'R', 'O', '0');
|
||||
|
||||
public:
|
||||
bool IsMagicValid() const {
|
||||
return m_magic == Magic;
|
||||
}
|
||||
|
||||
u32 GetSize() const {
|
||||
return m_size;
|
||||
}
|
||||
|
||||
u32 GetTextOffset() const {
|
||||
return m_text_offset;
|
||||
}
|
||||
|
||||
u32 GetTextSize() const {
|
||||
return m_text_size;
|
||||
}
|
||||
|
||||
u32 GetRoOffset() const {
|
||||
return m_ro_offset;
|
||||
}
|
||||
|
||||
u32 GetRoSize() const {
|
||||
return m_ro_size;
|
||||
}
|
||||
|
||||
u32 GetRwOffset() const {
|
||||
return m_rw_offset;
|
||||
}
|
||||
|
||||
u32 GetRwSize() const {
|
||||
return m_rw_size;
|
||||
}
|
||||
|
||||
u32 GetBssSize() const {
|
||||
return m_bss_size;
|
||||
}
|
||||
|
||||
const ModuleId* GetModuleId() const {
|
||||
return std::addressof(m_module_id);
|
||||
}
|
||||
|
||||
private:
|
||||
u32 m_entrypoint_insn;
|
||||
u32 m_mod_offset;
|
||||
INSERT_PADDING_BYTES_NOINIT(0x8);
|
||||
u32 m_magic;
|
||||
INSERT_PADDING_BYTES_NOINIT(0x4);
|
||||
u32 m_size;
|
||||
INSERT_PADDING_BYTES_NOINIT(0x4);
|
||||
u32 m_text_offset;
|
||||
u32 m_text_size;
|
||||
u32 m_ro_offset;
|
||||
u32 m_ro_size;
|
||||
u32 m_rw_offset;
|
||||
u32 m_rw_size;
|
||||
u32 m_bss_size;
|
||||
INSERT_PADDING_BYTES_NOINIT(0x4);
|
||||
ModuleId m_module_id;
|
||||
INSERT_PADDING_BYTES_NOINIT(0x20);
|
||||
};
|
||||
static_assert(sizeof(NroHeader) == 0x80, "NroHeader has wrong size");
|
||||
|
||||
} // namespace Service::RO
|
||||
@@ -93,13 +93,13 @@ Result ServerManager::RegisterSession(Kernel::KServerSession* session,
|
||||
}
|
||||
|
||||
Result ServerManager::RegisterNamedService(const std::string& service_name,
|
||||
SessionRequestHandlerFactory&& handler_factory,
|
||||
std::shared_ptr<SessionRequestHandler>&& handler,
|
||||
u32 max_sessions) {
|
||||
ASSERT(m_sessions.size() + m_ports.size() < MaximumWaitObjects);
|
||||
|
||||
// Add the new server to sm:.
|
||||
ASSERT(R_SUCCEEDED(
|
||||
m_system.ServiceManager().RegisterService(service_name, max_sessions, handler_factory)));
|
||||
m_system.ServiceManager().RegisterService(service_name, max_sessions, handler)));
|
||||
|
||||
// Get the registered port.
|
||||
Kernel::KPort* port{};
|
||||
@@ -112,7 +112,7 @@ Result ServerManager::RegisterNamedService(const std::string& service_name,
|
||||
// Begin tracking the server port.
|
||||
{
|
||||
std::scoped_lock ll{m_list_mutex};
|
||||
m_ports.emplace(std::addressof(port->GetServerPort()), std::move(handler_factory));
|
||||
m_ports.emplace(std::addressof(port->GetServerPort()), std::move(handler));
|
||||
}
|
||||
|
||||
// Signal the wakeup event.
|
||||
@@ -121,18 +121,8 @@ Result ServerManager::RegisterNamedService(const std::string& service_name,
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
||||
Result ServerManager::RegisterNamedService(const std::string& service_name,
|
||||
std::shared_ptr<SessionRequestHandler>&& handler,
|
||||
u32 max_sessions) {
|
||||
// Make the factory.
|
||||
const auto HandlerFactory = [handler]() { return handler; };
|
||||
|
||||
// Register the service with the new factory.
|
||||
R_RETURN(this->RegisterNamedService(service_name, std::move(HandlerFactory), max_sessions));
|
||||
}
|
||||
|
||||
Result ServerManager::ManageNamedPort(const std::string& service_name,
|
||||
SessionRequestHandlerFactory&& handler_factory,
|
||||
std::shared_ptr<SessionRequestHandler>&& handler,
|
||||
u32 max_sessions) {
|
||||
ASSERT(m_sessions.size() + m_ports.size() < MaximumWaitObjects);
|
||||
|
||||
@@ -159,7 +149,7 @@ Result ServerManager::ManageNamedPort(const std::string& service_name,
|
||||
// Begin tracking the server port.
|
||||
{
|
||||
std::scoped_lock ll{m_list_mutex};
|
||||
m_ports.emplace(std::addressof(port->GetServerPort()), std::move(handler_factory));
|
||||
m_ports.emplace(std::addressof(port->GetServerPort()), std::move(handler));
|
||||
}
|
||||
|
||||
// We succeeded.
|
||||
@@ -279,13 +269,13 @@ Result ServerManager::WaitAndProcessImpl() {
|
||||
case HandleType::Port: {
|
||||
// Port signaled.
|
||||
auto* port = wait_obj->DynamicCast<Kernel::KServerPort*>();
|
||||
SessionRequestHandlerFactory handler_factory;
|
||||
std::shared_ptr<SessionRequestHandler> handler;
|
||||
|
||||
// Remove from tracking.
|
||||
{
|
||||
std::scoped_lock ll{m_list_mutex};
|
||||
ASSERT(m_ports.contains(port));
|
||||
m_ports.at(port).swap(handler_factory);
|
||||
m_ports.at(port).swap(handler);
|
||||
m_ports.erase(port);
|
||||
}
|
||||
|
||||
@@ -293,7 +283,7 @@ Result ServerManager::WaitAndProcessImpl() {
|
||||
sl.unlock();
|
||||
|
||||
// Finish.
|
||||
R_RETURN(this->OnPortEvent(port, std::move(handler_factory)));
|
||||
R_RETURN(this->OnPortEvent(port, std::move(handler)));
|
||||
}
|
||||
case HandleType::Session: {
|
||||
// Session signaled.
|
||||
@@ -343,19 +333,19 @@ Result ServerManager::WaitAndProcessImpl() {
|
||||
}
|
||||
|
||||
Result ServerManager::OnPortEvent(Kernel::KServerPort* port,
|
||||
SessionRequestHandlerFactory&& handler_factory) {
|
||||
std::shared_ptr<SessionRequestHandler>&& handler) {
|
||||
// Accept a new server session.
|
||||
Kernel::KServerSession* session = port->AcceptSession();
|
||||
ASSERT(session != nullptr);
|
||||
|
||||
// Create the session manager and install the handler.
|
||||
auto manager = std::make_shared<SessionRequestManager>(m_system.Kernel(), *this);
|
||||
manager->SetSessionHandler(handler_factory());
|
||||
manager->SetSessionHandler(std::shared_ptr(handler));
|
||||
|
||||
// Track the server session.
|
||||
{
|
||||
std::scoped_lock ll{m_list_mutex};
|
||||
m_ports.emplace(port, std::move(handler_factory));
|
||||
m_ports.emplace(port, std::move(handler));
|
||||
m_sessions.emplace(session, std::move(manager));
|
||||
}
|
||||
|
||||
|
||||
@@ -13,7 +13,6 @@
|
||||
#include "common/polyfill_thread.h"
|
||||
#include "common/thread.h"
|
||||
#include "core/hle/result.h"
|
||||
#include "core/hle/service/hle_ipc.h"
|
||||
#include "core/hle/service/mutex.h"
|
||||
|
||||
namespace Core {
|
||||
@@ -29,6 +28,10 @@ class KSynchronizationObject;
|
||||
|
||||
namespace Service {
|
||||
|
||||
class HLERequestContext;
|
||||
class SessionRequestHandler;
|
||||
class SessionRequestManager;
|
||||
|
||||
class ServerManager {
|
||||
public:
|
||||
explicit ServerManager(Core::System& system);
|
||||
@@ -36,14 +39,11 @@ public:
|
||||
|
||||
Result RegisterSession(Kernel::KServerSession* session,
|
||||
std::shared_ptr<SessionRequestManager> manager);
|
||||
Result RegisterNamedService(const std::string& service_name,
|
||||
SessionRequestHandlerFactory&& handler_factory,
|
||||
u32 max_sessions = 64);
|
||||
Result RegisterNamedService(const std::string& service_name,
|
||||
std::shared_ptr<SessionRequestHandler>&& handler,
|
||||
u32 max_sessions = 64);
|
||||
Result ManageNamedPort(const std::string& service_name,
|
||||
SessionRequestHandlerFactory&& handler_factory, u32 max_sessions = 64);
|
||||
std::shared_ptr<SessionRequestHandler>&& handler, u32 max_sessions = 64);
|
||||
Result ManageDeferral(Kernel::KEvent** out_event);
|
||||
|
||||
Result LoopProcess();
|
||||
@@ -56,7 +56,7 @@ private:
|
||||
|
||||
Result LoopProcessImpl();
|
||||
Result WaitAndProcessImpl();
|
||||
Result OnPortEvent(Kernel::KServerPort* port, SessionRequestHandlerFactory&& handler_factory);
|
||||
Result OnPortEvent(Kernel::KServerPort* port, std::shared_ptr<SessionRequestHandler>&& handler);
|
||||
Result OnSessionEvent(Kernel::KServerSession* session,
|
||||
std::shared_ptr<SessionRequestManager>&& manager);
|
||||
Result OnDeferralEvent(std::list<RequestState>&& deferrals);
|
||||
@@ -68,7 +68,7 @@ private:
|
||||
std::mutex m_list_mutex;
|
||||
|
||||
// Guest state tracking
|
||||
std::map<Kernel::KServerPort*, SessionRequestHandlerFactory> m_ports{};
|
||||
std::map<Kernel::KServerPort*, std::shared_ptr<SessionRequestHandler>> m_ports{};
|
||||
std::map<Kernel::KServerSession*, std::shared_ptr<SessionRequestManager>> m_sessions{};
|
||||
Kernel::KEvent* m_event{};
|
||||
Kernel::KEvent* m_deferral_event{};
|
||||
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user